DE2748561A1 - Elektrolumineszierende leuchtstoffplatte - Google Patents
Elektrolumineszierende leuchtstoffplatteInfo
- Publication number
- DE2748561A1 DE2748561A1 DE19772748561 DE2748561A DE2748561A1 DE 2748561 A1 DE2748561 A1 DE 2748561A1 DE 19772748561 DE19772748561 DE 19772748561 DE 2748561 A DE2748561 A DE 2748561A DE 2748561 A1 DE2748561 A1 DE 2748561A1
- Authority
- DE
- Germany
- Prior art keywords
- layer
- phosphor
- plate according
- activator
- zinc
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 31
- 239000012190 activator Substances 0.000 claims description 14
- 239000000758 substrate Substances 0.000 claims description 9
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052802 copper Inorganic materials 0.000 claims description 6
- 239000010949 copper Substances 0.000 claims description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 4
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical group [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical group [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- 229910001370 Se alloy Inorganic materials 0.000 claims description 2
- 229910052771 Terbium Inorganic materials 0.000 claims description 2
- 229910052770 Uranium Inorganic materials 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- SNWNLRQYQRTOBP-UHFFFAOYSA-N [O--].[S--].[Zn++].[Zn++] Chemical compound [O--].[S--].[Zn++].[Zn++] SNWNLRQYQRTOBP-UHFFFAOYSA-N 0.000 claims description 2
- NQLXCOMGUJQTRM-UHFFFAOYSA-N [S-2].[S-2].S.[Zn+2].[Zn+2].[SeH2] Chemical compound [S-2].[S-2].S.[Zn+2].[Zn+2].[SeH2] NQLXCOMGUJQTRM-UHFFFAOYSA-N 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- SBIBMFFZSBJNJF-UHFFFAOYSA-N selenium;zinc Chemical compound [Se]=[Zn] SBIBMFFZSBJNJF-UHFFFAOYSA-N 0.000 claims description 2
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 claims description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000011787 zinc oxide Substances 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- 239000004744 fabric Substances 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000011230 binding agent Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 229910052984 zinc sulfide Inorganic materials 0.000 description 4
- 239000005083 Zinc sulfide Substances 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 3
- 229910001887 tin oxide Inorganic materials 0.000 description 3
- 101100286286 Dictyostelium discoideum ipi gene Proteins 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 238000001259 photo etching Methods 0.000 description 1
- -1 polyethylene methacrylate Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B33/00—Electroluminescent light sources
- H05B33/12—Light sources with substantially two-dimensional radiating surfaces
- H05B33/14—Light sources with substantially two-dimensional radiating surfaces characterised by the chemical or physical composition or the arrangement of the electroluminescent material, or by the simultaneous addition of the electroluminescent material in or onto the light source
- H05B33/145—Arrangements of the electroluminescent material
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B33/00—Electroluminescent light sources
- H05B33/12—Light sources with substantially two-dimensional radiating surfaces
Landscapes
- Luminescent Compositions (AREA)
- Electroluminescent Light Sources (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB45213/76A GB1571620A (en) | 1976-10-29 | 1976-10-29 | Electroluminescent phosphor panels |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2748561A1 true DE2748561A1 (de) | 1978-05-11 |
Family
ID=10436324
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772748561 Withdrawn DE2748561A1 (de) | 1976-10-29 | 1977-10-28 | Elektrolumineszierende leuchtstoffplatte |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4137481A (OSRAM) |
| JP (1) | JPS5380993A (OSRAM) |
| CA (1) | CA1085032A (OSRAM) |
| DE (1) | DE2748561A1 (OSRAM) |
| FR (1) | FR2369640A1 (OSRAM) |
| GB (1) | GB1571620A (OSRAM) |
| NL (1) | NL7711760A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2952585A1 (de) * | 1978-12-29 | 1980-07-10 | Gte Sylvania Inc | Elektrolumineszenz-darstellungsvorrichtung |
| EP0163351A1 (en) * | 1984-05-31 | 1985-12-04 | Koninklijke Philips Electronics N.V. | Thin film electroluminescent device |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5842960B2 (ja) * | 1980-06-13 | 1983-09-22 | 双葉電子工業株式会社 | エレクトロルミネセンス装置 |
| US4279726A (en) * | 1980-06-23 | 1981-07-21 | Gte Laboratories Incorporated | Process for making electroluminescent films and devices |
| US4458177A (en) * | 1980-12-22 | 1984-07-03 | General Electric Company | Flexible electroluminescent lamp device and phosphor admixture therefor |
| FI62448C (fi) * | 1981-04-22 | 1982-12-10 | Lohja Ab Oy | Elektroluminensstruktur |
| JPS57187893A (en) * | 1981-05-12 | 1982-11-18 | Sumitomo Electric Industries | Thin film light emitting element |
| EP0090535B1 (en) * | 1982-03-25 | 1986-07-02 | The Secretary of State for Defence in Her Britannic Majesty's Government of the United Kingdom of Great Britain and | Electroluminescent panels and method of manufacture |
| US4634934A (en) * | 1982-05-19 | 1987-01-06 | Matsushita Electric Industrial Co. Ltd. | Electroluminescent display device |
| US4599538A (en) * | 1982-09-30 | 1986-07-08 | Gte Prod Corp | Electroluminescent display device |
| US4672264A (en) * | 1985-01-08 | 1987-06-09 | Phosphor Products Company Limited | High contrast electroluminescent display panels |
| US4859904A (en) * | 1985-06-04 | 1989-08-22 | Phosphor Products Company Limited | High contrast electroluminescent displays |
| GB8522143D0 (en) * | 1985-09-06 | 1985-10-09 | Phosphor Prod Co Ltd | Electroluminescent devices |
| GB8727326D0 (en) * | 1987-11-21 | 1987-12-23 | Emi Plc Thorn | Display device |
| JPH0268968A (ja) * | 1988-09-02 | 1990-03-08 | Sharp Corp | 化合物半導体発光素子 |
| FI84960C (fi) * | 1990-07-18 | 1992-02-10 | Planar Int Oy | Lysaemnesskikt foer elektroluminescensdisplay. |
| US5206749A (en) * | 1990-12-31 | 1993-04-27 | Kopin Corporation | Liquid crystal display having essentially single crystal transistors pixels and driving circuits |
| US5475514A (en) | 1990-12-31 | 1995-12-12 | Kopin Corporation | Transferred single crystal arrayed devices including a light shield for projection displays |
| US5444557A (en) * | 1990-12-31 | 1995-08-22 | Kopin Corporation | Single crystal silicon arrayed devices for projection displays |
| US5661371A (en) * | 1990-12-31 | 1997-08-26 | Kopin Corporation | Color filter system for light emitting display panels |
| US5751261A (en) * | 1990-12-31 | 1998-05-12 | Kopin Corporation | Control system for display panels |
| US5258690A (en) * | 1991-05-23 | 1993-11-02 | Westinghouse Electric Corp. | TFEL edge emitter module with hermetically-sealed and refractive index-matched solid covering over light-emitting face |
| US6048616A (en) * | 1993-04-21 | 2000-04-11 | Philips Electronics N.A. Corp. | Encapsulated quantum sized doped semiconductor particles and method of manufacturing same |
| KR0146491B1 (ko) * | 1994-09-16 | 1998-10-01 | 양승택 | 적층구조로 구성된 유기고분자 전계발광소자 |
| US7301276B2 (en) * | 2000-03-27 | 2007-11-27 | Semiconductor Energy Laboratory Co., Ltd. | Light emitting apparatus and method of manufacturing the same |
| US6849935B2 (en) | 2002-05-10 | 2005-02-01 | Sarnoff Corporation | Low-cost circuit board materials and processes for area array electrical interconnections over a large area between a device and the circuit board |
| USRE41914E1 (en) | 2002-05-10 | 2010-11-09 | Ponnusamy Palanisamy | Thermal management in electronic displays |
| US6936964B2 (en) * | 2002-09-30 | 2005-08-30 | Eastman Kodak Company | OLED lamp |
| EP4133026B1 (en) | 2020-04-08 | 2025-07-02 | Lumineq Oy | Display element and method for manufacturing a display element |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2824992A (en) * | 1955-01-17 | 1958-02-25 | Sylvania Electric Prod | Electroluminescent lamp |
| US4015166A (en) * | 1972-09-06 | 1977-03-29 | Matsushita Electric Industrial Co., Ltd. | X-Y matrix type electroluminescent display panel |
| US3854070A (en) * | 1972-12-27 | 1974-12-10 | N Vlasenko | Electroluminescent device with variable emission |
-
1976
- 1976-10-29 GB GB45213/76A patent/GB1571620A/en not_active Expired
-
1977
- 1977-10-18 US US05/843,188 patent/US4137481A/en not_active Expired - Lifetime
- 1977-10-26 NL NL7711760A patent/NL7711760A/xx not_active Application Discontinuation
- 1977-10-27 FR FR7732434A patent/FR2369640A1/fr active Granted
- 1977-10-28 CA CA289,817A patent/CA1085032A/en not_active Expired
- 1977-10-28 DE DE19772748561 patent/DE2748561A1/de not_active Withdrawn
- 1977-10-29 JP JP13018077A patent/JPS5380993A/ja active Pending
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2952585A1 (de) * | 1978-12-29 | 1980-07-10 | Gte Sylvania Inc | Elektrolumineszenz-darstellungsvorrichtung |
| EP0163351A1 (en) * | 1984-05-31 | 1985-12-04 | Koninklijke Philips Electronics N.V. | Thin film electroluminescent device |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1085032A (en) | 1980-09-02 |
| US4137481A (en) | 1979-01-30 |
| FR2369640A1 (fr) | 1978-05-26 |
| GB1571620A (en) | 1980-07-16 |
| NL7711760A (nl) | 1978-05-03 |
| JPS5380993A (en) | 1978-07-17 |
| FR2369640B1 (OSRAM) | 1984-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2748561A1 (de) | Elektrolumineszierende leuchtstoffplatte | |
| DE3877902T2 (de) | Elektronenquelle mit mikrospitzen-emissionskathoden und diese quelle benutzende bildwiedergabe-anordnung, die auf durch feldemission angeregter kathodolumineszenz beruht. | |
| DE69419045T2 (de) | Elektrochrome Glasscheibe und seine Anwendung in Fahrzeugen und Bauwesen | |
| DE2554162A1 (de) | Abbildungsverfahren | |
| DE1589429B2 (de) | Elektrisch steuerbare optische Vorrichtung | |
| DE2656140A1 (de) | Elektrolumineszentes speicher- und anzeigeelement | |
| DE4024602A1 (de) | Elektrolumineszenzvorrichtung | |
| DE1179300B (de) | Elektrolumineszenter Leuchtkondensator zur Darstellung von Zeichen und Verfahren zu seiner Herstellung | |
| DE69502005T2 (de) | Eine Suspension brauchbar für die Abscheidung lumineszierender Stoffe mittels Elektrophorese, insbesondere für die Herstellung flacher Bildschirme | |
| DE2510792A1 (de) | Leuchtanzeigeeinrichtung | |
| DD158305A5 (de) | Elektrolumineszenzanordnung | |
| DE2629855A1 (de) | Vorrichtung fuer die elektrochromische wiedergabe von bildern und signalen | |
| DE2825390A1 (de) | Verfahren und schaltungsanordnung zum ansteuern einer elektrochromen anzeigezelle | |
| DE2431770B2 (de) | Elektrofotografisches aufzeichnungsmaterial | |
| US4849673A (en) | Electroluminescent devices without particle conductive coating | |
| DE1935730C3 (de) | Verfahren zur Herstellung einer Festkorperspeicherplatte | |
| DE69015731T2 (de) | Gasentladungstafel. | |
| DE1809749B2 (de) | Signalspeichervorrichtung | |
| DE1589818A1 (de) | Anzeigeroehre mit lumineszierender Flaeche | |
| DE2403893A1 (de) | Elektronenemitter, verfahren zu seiner herstellung und unter seiner verwendung gebaute elektronische oder optoelektronische einrichtungen | |
| DE3100467C2 (de) | Leuchtstoff mit hoher Leuchtdichte | |
| WO1998054767A1 (de) | Leitfähiges schichtsystem und dessen verwendung in elektrolumineszierenden anordnungen | |
| DE2160792C3 (de) | Gasentladungsanzeige- und Speicherfeld | |
| DE1033712B (de) | Speicher fuer binaere Informationen | |
| DE1042648B (de) | Vorrichtung zur Speicherung von Information |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8139 | Disposal/non-payment of the annual fee |