DE2741753C3 - - Google Patents
Info
- Publication number
- DE2741753C3 DE2741753C3 DE2741753C3 DE 2741753 C3 DE2741753 C3 DE 2741753C3 DE 2741753 C3 DE2741753 C3 DE 2741753C3
- Authority
- DE
- Germany
- Prior art keywords
- paper
- weight
- copolymers
- salts
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920001577 copolymer Polymers 0.000 claims description 39
- 239000011780 sodium chloride Substances 0.000 claims description 18
- 239000007864 aqueous solution Substances 0.000 claims description 16
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 13
- NLHHRLWOUZZQLW-UHFFFAOYSA-N acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 11
- CERQOIWHTDAKMF-UHFFFAOYSA-N methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 11
- HRPVXLWXLXDGHG-UHFFFAOYSA-N acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 10
- 159000000007 calcium salts Chemical class 0.000 claims description 10
- ATMLPEJAVWINOF-UHFFFAOYSA-N acrylic acid acrylic acid Chemical compound OC(=O)C=C.OC(=O)C=C ATMLPEJAVWINOF-UHFFFAOYSA-N 0.000 claims description 9
- FQPSGWSUVKBHSU-UHFFFAOYSA-N Methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 6
- 159000000003 magnesium salts Chemical class 0.000 claims description 5
- GYCMBHHDWRMZGG-UHFFFAOYSA-N 2-cyanopropene-1 Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 101700000038 mpas Proteins 0.000 claims description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 3
- 125000005396 acrylic acid ester group Chemical group 0.000 claims description 2
- JHPBZFOKBAGZBL-UHFFFAOYSA-N (3-hydroxy-2,2,4-trimethylpentyl) 2-methylprop-2-enoate Chemical compound CC(C)C(O)C(C)(C)COC(=O)C(C)=C JHPBZFOKBAGZBL-UHFFFAOYSA-N 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 19
- 230000000052 comparative effect Effects 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 210000001138 Tears Anatomy 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 9
- 150000003863 ammonium salts Chemical class 0.000 description 8
- 229920002472 Starch Polymers 0.000 description 7
- -1 alkaline earth metal salts Chemical class 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000001447 alkali salts Chemical class 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- PZZYQPZGQPZBDN-UHFFFAOYSA-N Aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 229920000881 Modified starch Polymers 0.000 description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L Potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000005591 charge neutralization Effects 0.000 description 2
- 230000000875 corresponding Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 235000019426 modified starch Nutrition 0.000 description 2
- 230000001264 neutralization Effects 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 230000000379 polymerizing Effects 0.000 description 2
- 235000019394 potassium persulphate Nutrition 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N Itaconic acid Chemical compound OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L Magnesium hydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N Polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L Sulphite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 101700050013 TRIL Proteins 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004432 carbon atoms Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011068 load Methods 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000010893 paper waste Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000007870 radical polymerization initiator Substances 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1546369C3 (de) | Verfahren zur Herstellung von Papier, Pappe und dgl. mit verbesserter Naßfestigkeit. Ausscheidung aus: 1177824 | |
| EP1819877B1 (de) | Verfahren zur herstellung von papier, pappe und karton mit hoher trockenfestigkeit | |
| EP2443284B1 (de) | Verfahren zur erhöhung der trockenfestigkeit von papier, pappe und karton | |
| EP1999314B1 (de) | Verfahren zur herstellung von papier, pappe und karton mit hoher trockenfestigkeit | |
| EP0013969B1 (de) | Verfahren zur Herstellung von Papier mit hoher Trockenfestigkeit und niedriger Nassfestigkeit | |
| EP0193111B1 (de) | Verfahren zur Herstellung von Papier mit hoher Trockenfestigkeit | |
| DE3706525A1 (de) | Verfahren zur herstellung von papier, pappe und karton mit hoher trockenfestigkeit | |
| DE2357165B2 (de) | Oberflächenleim- und -streichmasse für Papier | |
| EP2258735B1 (de) | Kationische Stärke-Pfropfcopolymere | |
| DE69717643T2 (de) | Modifizierte kolophoniumemulsion | |
| DE2425265C2 (de) | Mittel zur Oberflächenleimung von Papier | |
| DE1546468A1 (de) | Verfahren zur Herstellung polymermodifizierter Cellulosefasern | |
| DE69725779T2 (de) | Leimung von Papier mit Latexdispersionen aus Copolymeren aus hydrophoben Monomeren und niedermolecularen Styrol/Maleinanhydride-Polymeren | |
| DE2741753B1 (de) | Verfahren zur Herstellung von Papier mit hoher Trockenfestigkeit und niedriger Nassfestigkeit | |
| DE2741753C3 (ro) | ||
| DE2821830A1 (de) | Verfahren zur oberflaechenleimung von papier | |
| EP0146000B1 (de) | Verfahren zur Herstellung von Papier, Karton und Pappe mit hoher Trocken-, Nass- und Laugenfestigkeit | |
| DE1240731B (de) | Verfahren zur Herstellung von Papier oder papieraehnlichen Flaechengebilden | |
| DE1617204C (de) | Harzleimmassen und Verfahren zu deren Herstellung | |
| CH496079A (de) | Harzleimmasse, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0542125B1 (de) | Verfahren zum Abscheiden eines in Wasser gelösten Bindemittels | |
| DE1696168C3 (de) | Verfahren zum Leimen von Papier | |
| DE3530477C2 (ro) | ||
| WO2006136556A2 (de) | Verfahren zur herstellung von papier, pappe und karton | |
| DE2040692C3 (de) | Verfahren zur Papierleimung |