DE2739433C2 - - Google Patents
Info
- Publication number
- DE2739433C2 DE2739433C2 DE2739433A DE2739433A DE2739433C2 DE 2739433 C2 DE2739433 C2 DE 2739433C2 DE 2739433 A DE2739433 A DE 2739433A DE 2739433 A DE2739433 A DE 2739433A DE 2739433 C2 DE2739433 C2 DE 2739433C2
- Authority
- DE
- Germany
- Prior art keywords
- cocatalyst
- electron
- substituent
- thianthrene
- lewis acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000001424 substituent group Chemical group 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 35
- -1 thianthrene compound Chemical class 0.000 claims description 24
- LQCSUVWASPTLDK-UHFFFAOYSA-N 1,2-dichloro-3,4-dimethylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(C)=C(C)C(Cl)=C2Cl LQCSUVWASPTLDK-UHFFFAOYSA-N 0.000 claims description 21
- 238000005660 chlorination reaction Methods 0.000 claims description 21
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 16
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 16
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 15
- 150000005029 thianthrenes Chemical class 0.000 claims description 14
- 239000011968 lewis acid catalyst Substances 0.000 claims description 13
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 10
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 9
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 8
- 150000002898 organic sulfur compounds Chemical class 0.000 claims description 7
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 5
- HYSKKCRVDRHHAZ-UHFFFAOYSA-N 1,2-dibromo-3,4-dimethylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(C)=C(C)C(Br)=C2Br HYSKKCRVDRHHAZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- YCDKPINFFNNYJZ-UHFFFAOYSA-N 1,2-difluoro-3,4-dimethylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(C)=C(C)C(F)=C2F YCDKPINFFNNYJZ-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 87
- 239000003054 catalyst Substances 0.000 description 39
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 29
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000007795 chemical reaction product Substances 0.000 description 11
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 6
- 229940073608 benzyl chloride Drugs 0.000 description 6
- 230000008901 benefit Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- DGHKQBYAUUIYTD-UHFFFAOYSA-N 1-chloro-2,3-dimethylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(C)=C2Cl DGHKQBYAUUIYTD-UHFFFAOYSA-N 0.000 description 2
- XCBMOPWJRUGJNW-UHFFFAOYSA-N 2,3,7,8-tetramethylthianthrene Chemical compound S1C2=CC(C)=C(C)C=C2SC2=C1C=C(C)C(C)=C2 XCBMOPWJRUGJNW-UHFFFAOYSA-N 0.000 description 2
- JAHXASZKJPAIFU-UHFFFAOYSA-N 2,7-dichloro-3,8-dimethylthianthrene Chemical compound S1C2=CC(Cl)=C(C)C=C2SC2=C1C=C(C)C(Cl)=C2 JAHXASZKJPAIFU-UHFFFAOYSA-N 0.000 description 2
- BKPNWIJECRDPGU-UHFFFAOYSA-N 2,8-dichloro-3,7-dimethylthianthrene Chemical compound S1C2=CC(C)=C(Cl)C=C2SC2=C1C=C(C)C(Cl)=C2 BKPNWIJECRDPGU-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- DAMJCWMGELCIMI-UHFFFAOYSA-N benzyl n-(2-oxopyrrolidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CCNC1=O DAMJCWMGELCIMI-UHFFFAOYSA-N 0.000 description 2
- 150000005524 benzylchlorides Chemical class 0.000 description 2
- 125000001743 benzylic group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- HQBWKEQPMQMEBD-UHFFFAOYSA-N 1,2,3-trichloro-4-methylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(Cl)=C(Cl)C(Cl)=C2C HQBWKEQPMQMEBD-UHFFFAOYSA-N 0.000 description 1
- YYFDLAQOKLPUPH-UHFFFAOYSA-N 1,2,3-trifluoro-4-methylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(F)=C(F)C(F)=C2C YYFDLAQOKLPUPH-UHFFFAOYSA-N 0.000 description 1
- ZQPJAHNXXUEZDU-UHFFFAOYSA-N 1,2,3-trimethyl-4-(trifluoromethyl)thianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(C)=C(C)C(C)=C2C(F)(F)F ZQPJAHNXXUEZDU-UHFFFAOYSA-N 0.000 description 1
- LAQZKGFRFHJMNK-UHFFFAOYSA-N 1,2-dibromo-3-methylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(Br)=C2Br LAQZKGFRFHJMNK-UHFFFAOYSA-N 0.000 description 1
- FLSOXHZCQDGXRV-UHFFFAOYSA-N 1,2-dichloro-3-methylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(Cl)=C2Cl FLSOXHZCQDGXRV-UHFFFAOYSA-N 0.000 description 1
- JZADUXITBULLEG-UHFFFAOYSA-N 1,2-difluoro-3-methylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(F)=C2F JZADUXITBULLEG-UHFFFAOYSA-N 0.000 description 1
- SRTVGDTVYHPCKI-UHFFFAOYSA-N 1,2-dimethyl-3,4-bis(trifluoromethyl)thianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C(C(F)(F)F)=C(C(F)(F)F)C(C)=C2C SRTVGDTVYHPCKI-UHFFFAOYSA-N 0.000 description 1
- AHBGXHAWSHTPOM-UHFFFAOYSA-N 1,3,2$l^{4},4$l^{4}-dioxadistibetane 2,4-dioxide Chemical compound O=[Sb]O[Sb](=O)=O AHBGXHAWSHTPOM-UHFFFAOYSA-N 0.000 description 1
- ODNBVEIAQAZNNM-UHFFFAOYSA-N 1-(6-chloroimidazo[1,2-b]pyridazin-3-yl)ethanone Chemical compound C1=CC(Cl)=NN2C(C(=O)C)=CN=C21 ODNBVEIAQAZNNM-UHFFFAOYSA-N 0.000 description 1
- CJCMYQCSXNTTNM-UHFFFAOYSA-N 1-bromo-2,3,4-trimethylthianthrene Chemical compound C1=CC=C2SC3=C(C)C(C)=C(C)C(Br)=C3SC2=C1 CJCMYQCSXNTTNM-UHFFFAOYSA-N 0.000 description 1
- AJZVNPXEYSCFAT-UHFFFAOYSA-N 1-bromo-2,3-dimethylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(C)=C2Br AJZVNPXEYSCFAT-UHFFFAOYSA-N 0.000 description 1
- JSJZYCHTUFOKHU-UHFFFAOYSA-N 1-bromo-2-methylthianthrene Chemical compound C1=CC=C2SC3=C(Br)C(C)=CC=C3SC2=C1 JSJZYCHTUFOKHU-UHFFFAOYSA-N 0.000 description 1
- WPGXTNPTVGOSCD-UHFFFAOYSA-N 1-chloro-2,3,4-trimethylthianthrene Chemical compound C1=CC=C2SC3=C(C)C(C)=C(C)C(Cl)=C3SC2=C1 WPGXTNPTVGOSCD-UHFFFAOYSA-N 0.000 description 1
- VQPZYMCPALLGFT-UHFFFAOYSA-N 1-chloro-2-methylthianthrene Chemical compound C1=CC=C2SC3=C(Cl)C(C)=CC=C3SC2=C1 VQPZYMCPALLGFT-UHFFFAOYSA-N 0.000 description 1
- OSOUNOBYRMOXQQ-UHFFFAOYSA-N 1-chloro-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1 OSOUNOBYRMOXQQ-UHFFFAOYSA-N 0.000 description 1
- NTANEBWQKLWOQD-UHFFFAOYSA-N 1-chlorothianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=CC=C2Cl NTANEBWQKLWOQD-UHFFFAOYSA-N 0.000 description 1
- FPXNMMODYDWNEZ-UHFFFAOYSA-N 1-fluoro-2,3-dimethylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(C)=C2F FPXNMMODYDWNEZ-UHFFFAOYSA-N 0.000 description 1
- MMZYCBHLNZVROM-UHFFFAOYSA-N 1-fluoro-2-methylbenzene Chemical compound CC1=CC=CC=C1F MMZYCBHLNZVROM-UHFFFAOYSA-N 0.000 description 1
- VNQVFHLMEWOEOW-UHFFFAOYSA-N 1-fluoro-2-methylthianthrene Chemical compound C1=CC=C2SC3=C(F)C(C)=CC=C3SC2=C1 VNQVFHLMEWOEOW-UHFFFAOYSA-N 0.000 description 1
- BGUJBZMNUQABEE-UHFFFAOYSA-N 1-methyl-2,3,4-tris(trifluoromethyl)thianthrene Chemical compound C1=CC=C2SC3=C(C(F)(F)F)C(C(F)(F)F)=C(C(F)(F)F)C(C)=C3SC2=C1 BGUJBZMNUQABEE-UHFFFAOYSA-N 0.000 description 1
- LEIKPMFRIYWHKW-UHFFFAOYSA-N 1-methylthianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=CC=C2C LEIKPMFRIYWHKW-UHFFFAOYSA-N 0.000 description 1
- JCJOKFLPNGCLSA-UHFFFAOYSA-N 2,3,7,8-tetrachlorothianthrene Chemical compound S1C2=CC(Cl)=C(Cl)C=C2SC2=C1C=C(Cl)C(Cl)=C2 JCJOKFLPNGCLSA-UHFFFAOYSA-N 0.000 description 1
- WZIJFXLGJYCBAO-UHFFFAOYSA-N 2,3-dichloro-7,8-dimethylthianthrene Chemical compound S1C2=CC(Cl)=C(Cl)C=C2SC2=C1C=C(C)C(C)=C2 WZIJFXLGJYCBAO-UHFFFAOYSA-N 0.000 description 1
- ABHNWMUIUMTXQE-UHFFFAOYSA-N 2,3-dimethyl-1-(trifluoromethyl)thianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(C)=C2C(F)(F)F ABHNWMUIUMTXQE-UHFFFAOYSA-N 0.000 description 1
- MXGGWAJEZSIYGP-UHFFFAOYSA-N 2,7-dibromo-3,8-dimethylthianthrene Chemical compound S1C2=CC(Br)=C(C)C=C2SC2=C1C=C(C)C(Br)=C2 MXGGWAJEZSIYGP-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- YUSKLZQDFPWYTK-UHFFFAOYSA-N 2-methyl-1-(trifluoromethyl)thianthrene Chemical compound C1=CC=C2SC3=C(C(F)(F)F)C(C)=CC=C3SC2=C1 YUSKLZQDFPWYTK-UHFFFAOYSA-N 0.000 description 1
- ZJCZFAAXZODMQT-UHFFFAOYSA-N 2-methylpentadecane-2-thiol Chemical compound CCCCCCCCCCCCCC(C)(C)S ZJCZFAAXZODMQT-UHFFFAOYSA-N 0.000 description 1
- XQLHFCFZQVPXIH-UHFFFAOYSA-N 3-methyl-1,2-bis(trifluoromethyl)thianthrene Chemical compound S1C2=CC=CC=C2SC2=C1C=C(C)C(C(F)(F)F)=C2C(F)(F)F XQLHFCFZQVPXIH-UHFFFAOYSA-N 0.000 description 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 description 1
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Inorganic materials F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- RLEITFSOMWBFSJ-UHFFFAOYSA-N CC1=C2C(=C(C(=C1Br)Br)Br)SC3=CC=CC=C3S2 Chemical compound CC1=C2C(=C(C(=C1Br)Br)Br)SC3=CC=CC=C3S2 RLEITFSOMWBFSJ-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- MBMLMWLHJBBADN-UHFFFAOYSA-N Ferrous sulfide Chemical compound [Fe]=S MBMLMWLHJBBADN-UHFFFAOYSA-N 0.000 description 1
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- KCZFLPPCFOHPNI-UHFFFAOYSA-N alumane;iron Chemical compound [AlH3].[Fe] KCZFLPPCFOHPNI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000411 antimony tetroxide Inorganic materials 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- NFMAZVUSKIJEIH-UHFFFAOYSA-N bis(sulfanylidene)iron Chemical compound S=[Fe]=S NFMAZVUSKIJEIH-UHFFFAOYSA-N 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 229910000339 iron disulfide Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- LIKBJVNGSGBSGK-UHFFFAOYSA-N iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Fe+3].[Fe+3] LIKBJVNGSGBSGK-UHFFFAOYSA-N 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 229910052981 lead sulfide Inorganic materials 0.000 description 1
- 229940056932 lead sulfide Drugs 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- AHXDSVSZEZHDLV-UHFFFAOYSA-N mesulfen Chemical compound CC1=CC=C2SC3=CC(C)=CC=C3SC2=C1 AHXDSVSZEZHDLV-UHFFFAOYSA-N 0.000 description 1
- PDKHNCYLMVRIFV-UHFFFAOYSA-H molybdenum;hexachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mo] PDKHNCYLMVRIFV-UHFFFAOYSA-H 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- LIYKJALVRPGQTR-UHFFFAOYSA-M oxostibanylium;chloride Chemical compound [Cl-].[Sb+]=O LIYKJALVRPGQTR-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- NYVGTLXTOJKHJN-UHFFFAOYSA-N thianthrene 5-oxide Chemical group C1=CC=C2S(=O)C3=CC=CC=C3SC2=C1 NYVGTLXTOJKHJN-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/12—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the ring of aromatic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/729,439 US4069264A (en) | 1976-10-04 | 1976-10-04 | Process for directed chlorination of alkylbenzenes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2739433A1 DE2739433A1 (de) | 1978-04-06 |
| DE2739433C2 true DE2739433C2 (cg-RX-API-DMAC7.html) | 1987-07-23 |
Family
ID=24931029
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772739433 Granted DE2739433A1 (de) | 1976-10-04 | 1977-09-01 | Verfahren fuer die direkte chlorierung von alkylbenzolen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4069264A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS6030299B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE859325A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7705427A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1103702A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2739433A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2366244A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1576363A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1143678B (cg-RX-API-DMAC7.html) |
| NL (1) | NL188632C (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3023437A1 (de) * | 1979-06-28 | 1981-01-22 | Ihara Chemical Ind Co | Verfahren zur herstellung von p-chloralkylbenzol |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4190609A (en) * | 1976-10-04 | 1980-02-26 | Hooker Chemicals & Plastics Corp. | Process for the directed chlorination of xylenes |
| US4069263A (en) * | 1977-01-03 | 1978-01-17 | Hooker Chemicals & Plastics Corporation | Process for directed chlorination of alkylbenzenes |
| US4495036A (en) * | 1983-07-11 | 1985-01-22 | The Dow Chemical Company | Electrochemical chlorination process |
| DE3432095A1 (de) * | 1984-08-31 | 1986-03-06 | Hoechst Ag, 6230 Frankfurt | Verfahren zur kernchlorierung von toluol |
| DE3916664A1 (de) * | 1989-05-23 | 1991-01-03 | Bayer Ag | Verfahren zur herstellung von 2-chlor-4-nitro-alkylbenzol |
| US5621153A (en) * | 1995-04-21 | 1997-04-15 | Occidental Chemical Corporation | Process for the preparation of chloro-alkylbenzenes and novel cocatalysts therefor |
| US6222079B1 (en) | 1999-10-28 | 2001-04-24 | Occidental Chemical Corporation | Method of increasing certain isomeric ratios in chlorinating substituted benzenes |
| US7012166B2 (en) * | 2003-03-18 | 2006-03-14 | General Electric Company | Catalyst composition and method for chlorinating aromatic compounds |
| CN104844587B (zh) * | 2015-04-29 | 2018-06-01 | 深圳市华星光电技术有限公司 | 含有吩恶噻结构的共轭化合物及其制备方法与有机电致发光二极管器件 |
| CN110372526A (zh) * | 2019-07-30 | 2019-10-25 | 江苏超跃化学有限公司 | 一种3-甲基-2-氨基苯甲酸的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1741305A (en) * | 1926-02-04 | 1929-12-31 | Selden Co | Purification of aromatic hydrocarbons |
| US1946040A (en) * | 1931-10-01 | 1934-02-06 | Dow Chemical Co | Catalyst for the nuclear chlorination of benzene compounds and method of using same |
| US3226447A (en) * | 1960-12-22 | 1965-12-28 | Union Carbide Australia | Directed nuclear substitution-chlorination of aromatic hydrocarbons and halogenated aromatic hydrocarbons |
| US3920757A (en) * | 1971-08-25 | 1975-11-18 | Dow Chemical Co | Chlorination with sulfuryl chloride |
| US4031142A (en) * | 1975-08-01 | 1977-06-21 | Hooker Chemicals & Plastics Corporation | Process for the directed chlorination of alkylbenzenes |
| US4031147A (en) * | 1975-08-01 | 1977-06-21 | Hooker Chemicals & Plastics Corporation | Process for directed chlorination of alkylbenzenes |
-
1976
- 1976-10-04 US US05/729,439 patent/US4069264A/en not_active Expired - Lifetime
-
1977
- 1977-08-09 JP JP52095521A patent/JPS6030299B2/ja not_active Expired
- 1977-08-16 BR BR7705427A patent/BR7705427A/pt unknown
- 1977-09-01 DE DE19772739433 patent/DE2739433A1/de active Granted
- 1977-09-06 IT IT7727278A patent/IT1143678B/it active
- 1977-09-07 GB GB37416/77A patent/GB1576363A/en not_active Expired
- 1977-09-13 NL NLAANVRAGE7710011,A patent/NL188632C/xx not_active IP Right Cessation
- 1977-09-28 CA CA287,709A patent/CA1103702A/en not_active Expired
- 1977-09-30 FR FR7729520A patent/FR2366244A1/fr active Granted
- 1977-10-03 BE BE181412A patent/BE859325A/xx not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3023437A1 (de) * | 1979-06-28 | 1981-01-22 | Ihara Chemical Ind Co | Verfahren zur herstellung von p-chloralkylbenzol |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1103702A (en) | 1981-06-23 |
| IT1143678B (it) | 1986-10-22 |
| GB1576363A (en) | 1980-10-08 |
| NL188632B (nl) | 1992-03-16 |
| FR2366244A1 (fr) | 1978-04-28 |
| NL7710011A (nl) | 1978-04-06 |
| NL188632C (nl) | 1992-08-17 |
| DE2739433A1 (de) | 1978-04-06 |
| BR7705427A (pt) | 1978-06-06 |
| FR2366244B1 (cg-RX-API-DMAC7.html) | 1983-12-16 |
| BE859325A (fr) | 1978-04-03 |
| JPS5344529A (en) | 1978-04-21 |
| US4069264A (en) | 1978-01-17 |
| JPS6030299B2 (ja) | 1985-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2634338C2 (de) | Verfahren zur Herstellung von im Kern monochlorierten Alkylbenzolen mit einem erhöhten Gehalt an p-Chlor-alkylbenzol | |
| DE2739433C2 (cg-RX-API-DMAC7.html) | ||
| DE2516567A1 (de) | Verfahren zum chlorieren von aromatischen verbindungen | |
| EP0340581B1 (de) | Verfahren zur Kernchlorierung von aromatischen Kohlenwasserstoffen | |
| DE2649112C3 (de) | Verfahren zur Herstellung von p-Chlorxylenolen durch Chlorierung von Xylenolen | |
| DE2634340A1 (de) | Verfahren zur direkten chlorierung von alkylbenzolen | |
| US4190609A (en) | Process for the directed chlorination of xylenes | |
| DE2800175C3 (de) | Verfahren zur Herstellung von Mischungen aus p-Chlortoluol und o-Chlortoluol | |
| CH648817A5 (de) | Verfahren zur herstellung von p-chloralkylbenzol. | |
| DE2523104C3 (de) | Verfahren zur Herstellung von 2,5-Dichlortoluol | |
| EP0442115B1 (de) | Verfahren zur Kernchlorierung von aromatischen Kohlenwasserstoffen | |
| DE1518164A1 (de) | Verfahren zur Oxychlorierung von Aromaten | |
| EP0001252B1 (de) | Verfahren zur Herstellung von m-Halogenbenzoylhalogeniden | |
| EP0505874A1 (de) | Verfahren zur Herstellung von p-Dichlorbenzol | |
| EP0283833B1 (de) | Verfahren zur Entfernung von m-Chlortoluol aus Chlortoluolgemischen | |
| DE3874496T2 (de) | Verfahren zur herstellung von 4,4'-dibrombiphenyl. | |
| DE1123663B (de) | Verfahren zur Herstellung von hochchlorierten Arylsulfiden | |
| DE2936288C2 (de) | Verfahren zur Herstellung von 2,2'-bis-[4-(1,1,3,3-Tetramethylbutyl)-phenol]-sulfid | |
| CH630592A5 (de) | Verfahren zur herstellung von 2-halogen-4-bromphenolen. | |
| DE2447932A1 (de) | Verfahren zur halogenierung von aromatischen kohlenwasserstoffen | |
| EP0046555B1 (de) | Verfahren zur Herstellung von 2,5-Dichlortoluol | |
| CH630593A5 (de) | Verfahren zur herstellung von 4-brom-2-chlorphenol. | |
| DE2258747A1 (de) | Verfahren zur herstellung von dichlortoluol | |
| DE1618517C3 (de) | Verfahren zur Herstellung von 1,2,43-Tetrachlorbenzol | |
| DE2203791A1 (de) | beta-Chlorvinylsulfone und Verfahren zu deren Herstellung aus Sulfonylchloriden und Acetylenen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: OCCIDENTAL CHEMICAL CORP. (EINE GESELLSCHAFT N.D.G |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |