DE2723220C2 - Polarisiertes elektromagnetisches Miniaturrelais - Google Patents
Polarisiertes elektromagnetisches MiniaturrelaisInfo
- Publication number
- DE2723220C2 DE2723220C2 DE2723220A DE2723220A DE2723220C2 DE 2723220 C2 DE2723220 C2 DE 2723220C2 DE 2723220 A DE2723220 A DE 2723220A DE 2723220 A DE2723220 A DE 2723220A DE 2723220 C2 DE2723220 C2 DE 2723220C2
- Authority
- DE
- Germany
- Prior art keywords
- permanent magnet
- relay
- pole
- magnet arrangement
- coil
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000004907 flux Effects 0.000 claims description 26
- 230000008878 coupling Effects 0.000 claims description 17
- 238000010168 coupling process Methods 0.000 claims description 17
- 238000005859 coupling reaction Methods 0.000 claims description 17
- 230000007704 transition Effects 0.000 claims description 13
- 230000005291 magnetic effect Effects 0.000 claims description 7
- 230000005294 ferromagnetic effect Effects 0.000 claims description 6
- 239000011810 insulating material Substances 0.000 claims description 5
- 238000013461 design Methods 0.000 claims description 4
- 230000013011 mating Effects 0.000 claims description 4
- 230000010287 polarization Effects 0.000 claims description 4
- 238000004804 winding Methods 0.000 claims description 3
- 238000010276 construction Methods 0.000 claims description 2
- 230000004044 response Effects 0.000 claims description 2
- 229910000859 α-Fe Inorganic materials 0.000 claims 1
- 238000004891 communication Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000000284 resting effect Effects 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000003302 ferromagnetic material Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H51/00—Electromagnetic relays
- H01H51/22—Polarised relays
- H01H51/2236—Polarised relays comprising pivotable armature, pivoting at extremity or bending point of armature
- H01H51/2245—Armature inside coil
- H01H51/2254—Contact forms part of armature
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Electromagnets (AREA)
- Non-Reversible Transmitting Devices (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2723220A DE2723220C2 (de) | 1977-05-23 | 1977-05-23 | Polarisiertes elektromagnetisches Miniaturrelais |
| CH1576677A CH625080A5 (enExample) | 1977-05-23 | 1977-12-21 | |
| AT0306078A AT373104B (de) | 1977-05-23 | 1978-04-27 | Polarisiertes elektromagnetisches miniaturrelais |
| SE7805424A SE421571B (sv) | 1977-05-23 | 1978-05-11 | Polariserat elektromagnetiskt miniatyrrele |
| US05/905,229 US4215329A (en) | 1977-05-23 | 1978-05-12 | Polarized electromagnetic miniature relay |
| YU01138/78A YU113878A (en) | 1977-05-23 | 1978-05-12 | Polarized electromagnetic miniature relay |
| GB20075/78A GB1593930A (en) | 1977-05-23 | 1978-05-17 | Polarised relay |
| ES469970A ES469970A1 (es) | 1977-05-23 | 1978-05-18 | Rele miniatura electromagnetico polarizado. |
| IT23580/78A IT1095831B (it) | 1977-05-23 | 1978-05-19 | Rele'miniature elettromagnetico polarizzato |
| BE187964A BE867382A (fr) | 1977-05-23 | 1978-05-23 | Relais electromagnetique miniature, polarise |
| JP6154478A JPS53145046A (en) | 1977-05-23 | 1978-05-23 | Miniature polar electromagnetic relay |
| FR7815336A FR2392486A1 (fr) | 1977-05-23 | 1978-05-23 | Relais electromagnetique, miniature, polarise |
| NL7805576A NL7805576A (nl) | 1977-05-23 | 1978-05-23 | Gepolariseerd elektromagnetisch miniatuurrelais. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2723220A DE2723220C2 (de) | 1977-05-23 | 1977-05-23 | Polarisiertes elektromagnetisches Miniaturrelais |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2723220B1 DE2723220B1 (de) | 1978-11-23 |
| DE2723220C2 true DE2723220C2 (de) | 1979-08-02 |
Family
ID=6009660
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2723220A Expired DE2723220C2 (de) | 1977-05-23 | 1977-05-23 | Polarisiertes elektromagnetisches Miniaturrelais |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4215329A (enExample) |
| JP (1) | JPS53145046A (enExample) |
| AT (1) | AT373104B (enExample) |
| BE (1) | BE867382A (enExample) |
| CH (1) | CH625080A5 (enExample) |
| DE (1) | DE2723220C2 (enExample) |
| ES (1) | ES469970A1 (enExample) |
| FR (1) | FR2392486A1 (enExample) |
| GB (1) | GB1593930A (enExample) |
| IT (1) | IT1095831B (enExample) |
| NL (1) | NL7805576A (enExample) |
| SE (1) | SE421571B (enExample) |
| YU (1) | YU113878A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3132244A1 (de) * | 1981-08-14 | 1983-03-03 | Siemens AG, 1000 Berlin und 8000 München | Polarisiertes elektromagnetisches relais |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2901077C2 (de) * | 1979-01-12 | 1983-03-03 | Siemens AG, 1000 Berlin und 8000 München | Verfahren zur Abdichtung eines elektromagnetischen Relais |
| DE2954352C2 (de) * | 1979-03-30 | 1984-12-13 | Hans 8024 Deisenhofen Sauer | Gepoltes Zungenkontaktrelais |
| DE3100817A1 (de) * | 1981-01-13 | 1982-08-12 | Siemens AG, 1000 Berlin und 8000 München | Polarisiertes elektromagnetisches relais |
| DE3102011A1 (de) * | 1981-01-22 | 1982-08-26 | Siemens AG, 1000 Berlin und 8000 München | Elektromagnetische relais |
| DE3132239C2 (de) * | 1981-08-14 | 1986-12-04 | Siemens AG, 1000 Berlin und 8000 München | Elektromagnetisches Relais |
| DE3378805D1 (en) * | 1982-07-06 | 1989-02-02 | Nec Corp | Transfer-type electromagnetic relay |
| DE3338208A1 (de) * | 1983-10-20 | 1985-05-02 | Siemens AG, 1000 Berlin und 8000 München | Elektromagnetisches relais und verfahren zu dessen herstellung |
| DE3472732D1 (en) * | 1983-10-20 | 1988-08-18 | Siemens Ag | Electromagnetic relay and method for its manufacture |
| DE3438275C1 (de) * | 1984-10-18 | 1989-11-23 | SDS-Relais AG, 8024 Deisenhofen | Gepoltes elektromagnetisches Relais |
| US4688010A (en) * | 1984-12-22 | 1987-08-18 | Matsushita Electric Works, Ltd. | Electromagnetic relay |
| US4672344A (en) * | 1985-04-19 | 1987-06-09 | Siemens Aktiengesellschaft | Polarized electromagnetic relay |
| US4912438A (en) * | 1987-10-22 | 1990-03-27 | Nec Corporation | Electromagnetic relay |
| US6320145B1 (en) * | 1998-03-31 | 2001-11-20 | California Institute Of Technology | Fabricating and using a micromachined magnetostatic relay or switch |
| CZ303755B6 (cs) * | 2008-11-18 | 2013-04-24 | Sedlácek@Martin | Zádlazbová deska, zvláste pro zádlazbu kolejového rostu |
| JP5560058B2 (ja) * | 2010-01-26 | 2014-07-23 | 富士通コンポーネント株式会社 | 電磁継電器 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4828119U (enExample) * | 1971-08-04 | 1973-04-05 | ||
| FR2222746A1 (en) * | 1973-03-20 | 1974-10-18 | Campot Etienne | Extra flat relay for four pole magnetic cct - can be mono-, bi-, or tristable |
| DE2345471A1 (de) * | 1973-09-08 | 1975-04-10 | Erni & Co Elektro Ind | Elektromagnetisches relais |
| NL7408907A (nl) * | 1974-07-02 | 1976-01-06 | Philips Nv | Bistabiele schakelaar met strookcontacten. |
| GB1516541A (en) * | 1974-12-13 | 1978-07-05 | Sauer H | Electromagnetic relays |
| DE2461884C3 (de) * | 1974-12-30 | 1982-04-15 | Sds-Elektro Gmbh, 8024 Deisenhofen | Elektromagnetisches Schaltgerät |
| FR2314576A1 (fr) * | 1975-06-11 | 1977-01-07 | Matsushita Electric Works Ltd | Relais a lame |
-
1977
- 1977-05-23 DE DE2723220A patent/DE2723220C2/de not_active Expired
- 1977-12-21 CH CH1576677A patent/CH625080A5/de not_active IP Right Cessation
-
1978
- 1978-04-27 AT AT0306078A patent/AT373104B/de not_active IP Right Cessation
- 1978-05-11 SE SE7805424A patent/SE421571B/sv unknown
- 1978-05-12 YU YU01138/78A patent/YU113878A/xx unknown
- 1978-05-12 US US05/905,229 patent/US4215329A/en not_active Expired - Lifetime
- 1978-05-17 GB GB20075/78A patent/GB1593930A/en not_active Expired
- 1978-05-18 ES ES469970A patent/ES469970A1/es not_active Expired
- 1978-05-19 IT IT23580/78A patent/IT1095831B/it active
- 1978-05-23 JP JP6154478A patent/JPS53145046A/ja active Granted
- 1978-05-23 BE BE187964A patent/BE867382A/xx not_active IP Right Cessation
- 1978-05-23 NL NL7805576A patent/NL7805576A/xx not_active Application Discontinuation
- 1978-05-23 FR FR7815336A patent/FR2392486A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3132244A1 (de) * | 1981-08-14 | 1983-03-03 | Siemens AG, 1000 Berlin und 8000 München | Polarisiertes elektromagnetisches relais |
Also Published As
| Publication number | Publication date |
|---|---|
| AT373104B (de) | 1983-12-27 |
| JPS6227494B2 (enExample) | 1987-06-15 |
| US4215329A (en) | 1980-07-29 |
| BE867382A (fr) | 1978-11-23 |
| CH625080A5 (enExample) | 1981-08-31 |
| SE421571B (sv) | 1982-01-04 |
| ES469970A1 (es) | 1979-03-16 |
| YU113878A (en) | 1982-06-30 |
| DE2723220B1 (de) | 1978-11-23 |
| NL7805576A (nl) | 1978-11-27 |
| IT7823580A0 (it) | 1978-05-19 |
| FR2392486B1 (enExample) | 1982-03-19 |
| SE7805424L (sv) | 1978-11-24 |
| ATA306078A (de) | 1983-04-15 |
| IT1095831B (it) | 1985-08-17 |
| FR2392486A1 (fr) | 1978-12-22 |
| GB1593930A (en) | 1981-07-22 |
| JPS53145046A (en) | 1978-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2723220C2 (de) | Polarisiertes elektromagnetisches Miniaturrelais | |
| DE3526852A1 (de) | Magnetschaltkreisvorrichtung | |
| DE3885508T2 (de) | Elektromagnetisches Relais. | |
| DE3320000C2 (de) | Elektromagnetisches Relais | |
| EP0147681B1 (de) | Polarisiertes elektromagnetisches Relais | |
| EP0017129B1 (de) | Gepoltes Zungenkontaktrelais | |
| DE3132239C2 (de) | Elektromagnetisches Relais | |
| DE69023882T2 (de) | Miniaturleistungsrelais für gedruckte Schaltungen. | |
| EP0072976B1 (de) | Polarisiertes elektromagnetisches Relais | |
| DE2146407C3 (de) | Flachrelais in Miniaturbauweise | |
| DE3002899C2 (de) | Tonabnehmersystem mit beweglicher Spule | |
| EP0077017B1 (de) | Polarisiertes elektromagnetisches Relais | |
| DE2654111C2 (enExample) | ||
| EP0091687B1 (de) | Elektromagnetisches Relais | |
| DE69111310T2 (de) | Polarisiertes elektromagnetisches Relais schmaler Bauform. | |
| DE3124412C1 (de) | Polarisiertes elektromagnetisches Kleinrelais | |
| DE1934624C3 (de) | Elektromagnetisches Relais | |
| DE3508795C2 (enExample) | ||
| DE7716318U1 (de) | Polarisiertes elektromagnetisches Miniaturrelais | |
| CH522285A (de) | Stromstoss-Schalter | |
| DE2714478C2 (de) | Dichtes polarisiertes elektromagnetisches Relais | |
| DE2703584C2 (de) | Elektromagnetisches Relais | |
| DE3224070C2 (de) | Polarisiertes Relais | |
| DE2807311C3 (de) | Bistabiles, polarisiertes Relais | |
| DE3802688A1 (de) | Polarisiertes relais |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EI | Miscellaneous see part 3 | ||
| EIB | Restricted by decision of the de-patent office |
Free format text: VOM 27.02.80 |
|
| 8310 | Action for declaration of annulment | ||
| 8313 | Request for invalidation rejected/withdrawn | ||
| 8339 | Ceased/non-payment of the annual fee |