DE2716603A1 - Verfahren zur herstellung von trifluormethylthioessigsaeure oder alpha-trifluormethylthiopropionsaeure und 1-trifluormethylthio-2,2,2-trialkoxyaethan- zwischenprodukte - Google Patents
Verfahren zur herstellung von trifluormethylthioessigsaeure oder alpha-trifluormethylthiopropionsaeure und 1-trifluormethylthio-2,2,2-trialkoxyaethan- zwischenprodukteInfo
- Publication number
- DE2716603A1 DE2716603A1 DE19772716603 DE2716603A DE2716603A1 DE 2716603 A1 DE2716603 A1 DE 2716603A1 DE 19772716603 DE19772716603 DE 19772716603 DE 2716603 A DE2716603 A DE 2716603A DE 2716603 A1 DE2716603 A1 DE 2716603A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- trifluoromethylthio
- carried out
- methyl
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 15
- ZAGWQJWRWKULDE-UHFFFAOYSA-N 3,3,3-trifluoropropanethioic s-acid Chemical compound OC(=S)CC(F)(F)F ZAGWQJWRWKULDE-UHFFFAOYSA-N 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000000543 intermediate Substances 0.000 title description 5
- NYURGIPZRULSSW-UHFFFAOYSA-N 3,3,3-trifluoro-2-methylpropanethioic s-acid Chemical compound SC(=O)C(C)C(F)(F)F NYURGIPZRULSSW-UHFFFAOYSA-N 0.000 title description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 13
- 238000010992 reflux Methods 0.000 claims description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 239000011707 mineral Substances 0.000 claims description 5
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 4
- -1 α-trifluoroethylthiopropionic acid Chemical compound 0.000 claims description 4
- 229910001516 alkali metal iodide Inorganic materials 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 2
- 239000013067 intermediate product Substances 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- ABUFEAKDTQPJQZ-UHFFFAOYSA-N 2,2-diethylbutane-1,1,1-triol Chemical compound CCC(CC)(CC)C(O)(O)O ABUFEAKDTQPJQZ-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 101100495769 Caenorhabditis elegans che-1 gene Proteins 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- RQYLOOVORNJDQX-UHFFFAOYSA-N trifluoromethyl thiohypochlorite Chemical compound FC(F)(F)SCl RQYLOOVORNJDQX-UHFFFAOYSA-N 0.000 description 6
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- MTDQWSZMIYBIIR-UHFFFAOYSA-N 1,1,1-trimethoxy-2-(trifluoromethylsulfanyl)ethane Chemical compound COC(OC)(OC)CSC(F)(F)F MTDQWSZMIYBIIR-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- JDNTWHVOXJZDSN-UHFFFAOYSA-N iodoacetic acid Chemical compound OC(=O)CI JDNTWHVOXJZDSN-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical compound CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- MFLLMKMFWIUACU-UHFFFAOYSA-N trifluoromethanethiol Chemical compound FC(F)(F)S MFLLMKMFWIUACU-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/677,190 US4028408A (en) | 1976-04-15 | 1976-04-15 | Novel preparation of trifluoromethylthioacetic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2716603A1 true DE2716603A1 (de) | 1977-10-27 |
Family
ID=24717685
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772716603 Withdrawn DE2716603A1 (de) | 1976-04-15 | 1977-04-14 | Verfahren zur herstellung von trifluormethylthioessigsaeure oder alpha-trifluormethylthiopropionsaeure und 1-trifluormethylthio-2,2,2-trialkoxyaethan- zwischenprodukte |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4028408A (enExample) |
| JP (1) | JPS52128322A (enExample) |
| DE (1) | DE2716603A1 (enExample) |
| FR (1) | FR2348196A1 (enExample) |
| GB (1) | GB1553124A (enExample) |
| IE (1) | IE44680B1 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104610107B (zh) * | 2015-02-13 | 2016-06-15 | 江苏凌云药业有限公司 | 一种4-三氟甲硫基硝基苯的制备方法 |
-
1976
- 1976-04-15 US US05/677,190 patent/US4028408A/en not_active Expired - Lifetime
-
1977
- 1977-04-07 FR FR7710620A patent/FR2348196A1/fr active Granted
- 1977-04-14 JP JP4342677A patent/JPS52128322A/ja active Pending
- 1977-04-14 GB GB15456/77A patent/GB1553124A/en not_active Expired
- 1977-04-14 DE DE19772716603 patent/DE2716603A1/de not_active Withdrawn
- 1977-04-14 IE IE779/77A patent/IE44680B1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE44680L (en) | 1977-10-15 |
| GB1553124A (en) | 1979-09-19 |
| US4028408A (en) | 1977-06-07 |
| IE44680B1 (en) | 1982-02-24 |
| JPS52128322A (en) | 1977-10-27 |
| FR2348196A1 (fr) | 1977-11-10 |
| FR2348196B1 (enExample) | 1980-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69623532T2 (de) | Verfahren zur Herstellung von 4-Trifluormethylnicotinsäure | |
| EP0556683A1 (de) | Verfahren zur Herstellung von 2-Chlor-5-methyl-pyridin | |
| DE2819264C2 (de) | Verfahren zur Herstellung von Cyanopinacolon | |
| EP0178260A2 (de) | Verfahren zur Herstellung von fluorierten Pyridin-Derivaten | |
| EP0439745B1 (de) | Verfahren zur Herstellung von 2-Chlor-5-methyl-pyridin | |
| DE2716603A1 (de) | Verfahren zur herstellung von trifluormethylthioessigsaeure oder alpha-trifluormethylthiopropionsaeure und 1-trifluormethylthio-2,2,2-trialkoxyaethan- zwischenprodukte | |
| CH645623A5 (en) | 2-Methyl-3-acetoxy-4,5-bis(halomethyl)pyridines, process for their preparation and process for the preparation of pyridoxin | |
| DE2533396C2 (de) | 3-Methyl-3-aryl-brenztraubensäureester und Verfahren zu ihrer Herstellung | |
| EP0302227B1 (de) | 5-Halogen-6-amino-nikotin-säurehalogenide, ihre Herstellung und ihre Verwendung | |
| EP1232151B1 (de) | Verfahren zur herstellung von benzofuranonoximen | |
| EP0034248B1 (de) | Neue mehrfach ungesättigte BNC-Halogenide und Verfahren zu ihrer Herstellung | |
| EP0056938B1 (de) | Verfahren zur Herstellung von 3,6-disubstituierten 4-Amino-1,2,4-triazin-5-onen | |
| EP0143888B1 (de) | Verfahren zur Herstellung von 17-Alpha-acyloxy-6-chlor-1-alpha, 2-alpha-methylen-4,6-pregnadien-3,20-dionen | |
| DE2808006A1 (de) | Verfahren zur herstellung von prostacyclin und seinen analogen | |
| EP0021115A1 (de) | Verfahren zur Herstellung von 3,3-Dimethyl-cyclopropan-1,1,2-tricarbonsäurederivaten sowie Alpha-Halogen-nitrile als neue Zwischenprodukte hierfür und Verfahren zu deren Herstellung | |
| DE69512268T2 (de) | Herstellung von halogenierten alkoholen | |
| CH633245A5 (de) | Verfahren zur herstellung von 2,3-dichlor-1-(c1-7)-alkoxybenzolen. | |
| DE871449C (de) | Verfahren zur Herstellung des Pentaerythrit-dichlorhydrin-monoschwefligsaeureesters | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| EP0378073B1 (de) | Verfahren zur Herstellung von 1,3-Cyclopentandion | |
| DE1924844A1 (de) | Verfahren zur Herstellung von Trimethyl-2-cyclohexen-1-onen | |
| DE69204802T2 (de) | Verfahren zur Herstellung von 2-Fluoro-4-(Trifluoromethyl)Acetanilid. | |
| DE2621833A1 (de) | Herstellung organischer saeuren | |
| DE2329251C2 (de) | Verfahren zur Herstellung von disubstituiertem Malonsäuredinitril | |
| CH667655A5 (de) | Verfahren zur herstellung von 4-alkoxy-2(5h)-thiophenonen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |