DE2651506C2 - Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen - Google Patents
Verfahren zur Herstellung von in Wasser dispergierbaren PolyurethanenInfo
- Publication number
- DE2651506C2 DE2651506C2 DE2651506A DE2651506A DE2651506C2 DE 2651506 C2 DE2651506 C2 DE 2651506C2 DE 2651506 A DE2651506 A DE 2651506A DE 2651506 A DE2651506 A DE 2651506A DE 2651506 C2 DE2651506 C2 DE 2651506C2
- Authority
- DE
- Germany
- Prior art keywords
- groups
- parts
- polyurethane
- water
- isocyanate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920002635 polyurethane Polymers 0.000 title claims description 73
- 239000004814 polyurethane Substances 0.000 title claims description 73
- 238000000034 method Methods 0.000 title claims description 51
- 238000002360 preparation method Methods 0.000 title claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 125000005442 diisocyanate group Chemical group 0.000 claims description 15
- 239000012948 isocyanate Substances 0.000 claims description 12
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 12
- 150000002513 isocyanates Chemical class 0.000 claims description 12
- 239000004970 Chain extender Substances 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 6
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 239000006185 dispersion Substances 0.000 description 84
- 239000007787 solid Substances 0.000 description 56
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 28
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 27
- 229920000570 polyether Polymers 0.000 description 25
- 239000002245 particle Substances 0.000 description 23
- 239000004721 Polyphenylene oxide Substances 0.000 description 21
- 150000002009 diols Chemical class 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 19
- 229920003009 polyurethane dispersion Polymers 0.000 description 18
- 125000003010 ionic group Chemical group 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 16
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 16
- 229920000728 polyester Polymers 0.000 description 16
- 239000002904 solvent Substances 0.000 description 15
- 239000003792 electrolyte Substances 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 14
- 238000002474 experimental method Methods 0.000 description 13
- 230000000052 comparative effect Effects 0.000 description 12
- -1 sodium chloride Chemical class 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 10
- 125000002091 cationic group Chemical group 0.000 description 9
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 7
- 125000002947 alkylene group Chemical group 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 239000013049 sediment Substances 0.000 description 7
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 5
- 238000010348 incorporation Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 238000006386 neutralization reaction Methods 0.000 description 5
- 239000000049 pigment Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 238000005956 quaternization reaction Methods 0.000 description 5
- DTXBWQWOKXFEPI-UHFFFAOYSA-N 1,4-diaminobutane-2-sulfonic acid;sodium Chemical compound [Na].NCCC(CN)S(O)(=O)=O DTXBWQWOKXFEPI-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000001361 adipic acid Substances 0.000 description 4
- 235000011037 adipic acid Nutrition 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000015271 coagulation Effects 0.000 description 4
- 238000005345 coagulation Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical group C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 3
- 238000000149 argon plasma sintering Methods 0.000 description 3
- 239000010425 asbestos Substances 0.000 description 3
- 230000001588 bifunctional effect Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000011888 foil Substances 0.000 description 3
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- 229920000554 ionomer Polymers 0.000 description 3
- 239000010985 leather Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 3
- 229920003226 polyurethane urea Polymers 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910052895 riebeckite Inorganic materials 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000003475 lamination Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 229920006295 polythiol Polymers 0.000 description 2
- 229920003225 polyurethane elastomer Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium group Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 2
- 238000010257 thawing Methods 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- ZWVMLYRJXORSEP-LURJTMIESA-N (2s)-hexane-1,2,6-triol Chemical compound OCCCC[C@H](O)CO ZWVMLYRJXORSEP-LURJTMIESA-N 0.000 description 1
- GFNDFCFPJQPVQL-UHFFFAOYSA-N 1,12-diisocyanatododecane Chemical compound O=C=NCCCCCCCCCCCCN=C=O GFNDFCFPJQPVQL-UHFFFAOYSA-N 0.000 description 1
- BJQAPWAEPRRBOZ-UHFFFAOYSA-N 1,4-diaminobutane-2-sulfonic acid Chemical compound NCCC(CN)S(O)(=O)=O BJQAPWAEPRRBOZ-UHFFFAOYSA-N 0.000 description 1
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical compound O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- OJTDQKJGUDLVLO-UHFFFAOYSA-N 1-isocyanato-6,6-dimethylheptane Chemical compound CC(C)(C)CCCCCN=C=O OJTDQKJGUDLVLO-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101100107522 Mus musculus Slc1a5 gene Proteins 0.000 description 1
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 1
- OJGMJJSTLJEDHF-UHFFFAOYSA-N NCCOS(=O)(=O)CCN.[Na] Chemical compound NCCOS(=O)(=O)CCN.[Na] OJGMJJSTLJEDHF-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 241000033695 Sige Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical class OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000011111 cardboard Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229920001870 copolymer plastic Polymers 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000012971 dimethylpiperazine Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 210000000003 hoof Anatomy 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229940117969 neopentyl glycol Drugs 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- VIKNJXKGJWUCNN-XGXHKTLJSA-N norethisterone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 VIKNJXKGJWUCNN-XGXHKTLJSA-N 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical class OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 239000006223 plastic coating Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- JCMLRUNDSXARRW-UHFFFAOYSA-N trioxouranium Chemical compound O=[U](=O)=O JCMLRUNDSXARRW-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000007762 w/o emulsion Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/721—Two or more polyisocyanates not provided for in one single group C08G18/73 - C08G18/80
- C08G18/722—Combination of two or more aliphatic and/or cycloaliphatic polyisocyanates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
- C08G18/0819—Manufacture of polymers containing ionic or ionogenic groups containing anionic or anionogenic groups
- C08G18/0828—Manufacture of polymers containing ionic or ionogenic groups containing anionic or anionogenic groups containing sulfonate groups or groups forming them
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/10—Prepolymer processes involving reaction of isocyanates or isothiocyanates with compounds having active hydrogen in a first reaction step
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/2805—Compounds having only one group containing active hydrogen
- C08G18/2815—Monohydroxy compounds
- C08G18/283—Compounds containing ether groups, e.g. oxyalkylated monohydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Polyurethanes Or Polyureas (AREA)
- Paints Or Removers (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2651506A DE2651506C2 (de) | 1976-11-11 | 1976-11-11 | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen |
| CA000290372A CA1119745A (en) | 1976-11-11 | 1977-11-07 | Process for the preparation of polyurethanes which are dispersible in water |
| US05/849,690 US4237264A (en) | 1976-11-11 | 1977-11-08 | Process for the preparation of polyurethanes which are dispersible in water |
| AT799677A AT358825B (de) | 1976-11-11 | 1977-11-09 | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
| IT51747/77A IT1091777B (it) | 1976-11-11 | 1977-11-09 | Procedimento per produrre poliuretani disperdibili in acqua |
| FR7734010A FR2370761A1 (fr) | 1976-11-11 | 1977-11-10 | Polyurethannes dispersables dans l'eau et leur procede de preparation |
| BE182534A BE860712A (fr) | 1976-11-11 | 1977-11-10 | Polyurethannes dispersables dans l'eau et leur procede de preparation |
| ES464014A ES464014A1 (es) | 1976-11-11 | 1977-11-10 | Procedimiento para la obtencion de poliuretanos dispersablesen agua. |
| AU30547/77A AU507570B2 (en) | 1976-11-11 | 1977-11-10 | Dispersible polyurethanes |
| GB47024/77A GB1573346A (en) | 1976-11-11 | 1977-11-11 | Polyurethanes which are dispersible in water and a process for their preparation |
| JP13482477A JPS5360990A (en) | 1976-11-11 | 1977-11-11 | Preparation of water dispersable polyurethane |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2651506A DE2651506C2 (de) | 1976-11-11 | 1976-11-11 | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2651506A1 DE2651506A1 (de) | 1978-05-24 |
| DE2651506C2 true DE2651506C2 (de) | 1986-04-30 |
Family
ID=5992938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2651506A Expired DE2651506C2 (de) | 1976-11-11 | 1976-11-11 | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4237264A (enExample) |
| JP (1) | JPS5360990A (enExample) |
| AT (1) | AT358825B (enExample) |
| AU (1) | AU507570B2 (enExample) |
| BE (1) | BE860712A (enExample) |
| CA (1) | CA1119745A (enExample) |
| DE (1) | DE2651506C2 (enExample) |
| ES (1) | ES464014A1 (enExample) |
| FR (1) | FR2370761A1 (enExample) |
| GB (1) | GB1573346A (enExample) |
| IT (1) | IT1091777B (enExample) |
Families Citing this family (106)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2659617A1 (de) * | 1976-12-30 | 1978-07-06 | Bayer Ag | Elektrolyte enthaltende ionomer- dispersionen |
| JPS56145964A (en) * | 1980-04-14 | 1981-11-13 | Dainippon Ink & Chem Inc | Aqueous adhesive |
| DE3027198A1 (de) * | 1980-07-18 | 1982-02-11 | Bayer Ag, 5090 Leverkusen | Feste, in wasser dispergierbare, isocyanatgruppen aufweisende kunststoffvorlaeufer, ein verfahren zur herstellung von waessrigen kunststoffdispersionen unter verwendung dieser kunststoffvorlaeufer, sowie die verwendung der kunststoffvorlaeufer als vernetzungsmittel fuer waessrige kunststoffdispersionen |
| DE3036846A1 (de) * | 1980-09-30 | 1982-05-27 | Agfa-Gevaert Ag, 5090 Leverkusen | Verfahren zur herstellung von dispersionen hydrophober substanzen in wasser |
| DE3048085A1 (de) * | 1980-12-19 | 1982-07-22 | Bayer Ag, 5090 Leverkusen | Dispersionen von sulfonatgruppen aufweisenden polymeren, ein verfahren zu ihrer herstellung, sowie ihre verwendung als beschichtungsmittel |
| US4408008A (en) * | 1981-07-24 | 1983-10-04 | Mobay Chemical Corporation | Stable, colloidal, aqueous dispersions of cross-linked urea-urethane polymers and their method of production |
| JPS5819378A (ja) * | 1981-07-29 | 1983-02-04 | Dainippon Ink & Chem Inc | 水性接着剤 |
| JPS5841374U (ja) * | 1981-09-10 | 1983-03-18 | 花王株式会社 | 包装容器 |
| DE3216567A1 (de) | 1982-05-04 | 1983-11-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von waessrigen dispersionen von, chemisch fixierte carboxylat- und/oder sulfonatgruppen aufweisenden, polyurethanen |
| US4622378A (en) * | 1982-12-23 | 1986-11-11 | The Procter & Gamble Company | Zwitterionic polymers having clay soil removal/anti-redeposition properties useful in detergent compositions |
| DE3320217A1 (de) * | 1983-06-03 | 1984-12-06 | Bayer Ag, 5090 Leverkusen | Anorganisch-organische verbundwerkstoffe und verfahren zu ihrer herstellung |
| US4501852A (en) * | 1983-06-20 | 1985-02-26 | Mobay Chemical Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| JPS60120751A (ja) * | 1983-12-02 | 1985-06-28 | Toyo Tire & Rubber Co Ltd | 水性樹脂分散体 |
| DE3344693A1 (de) * | 1983-12-10 | 1985-06-20 | Bayer Ag, 5090 Leverkusen | Waessrige loesungen oder dispersionen von polyisocyanat-polyadditionsprodukten, ein verfahren zu ihrer herstellung, sowie ihre verwendung als bzw. zur herstellung von klebemittel |
| DE3465599D1 (en) * | 1984-01-27 | 1987-10-01 | Byk Chemie Gmbh | Addition compounds suited as dispersing agents, process for their preparation, their use and solid materials coated with them |
| DE3417265A1 (de) * | 1984-05-10 | 1985-11-14 | Bayer Ag, 5090 Leverkusen | Polyurethan-dispersionen und ihre verwendung als finish-mittel |
| US4582873A (en) * | 1984-05-21 | 1986-04-15 | Ppg Industries, Inc. | Process for producing aqueous dispersions, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| US4567228A (en) * | 1984-05-21 | 1986-01-28 | Ppg Industries, Inc. | Aqueous dispersion, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| US4542065A (en) * | 1984-05-21 | 1985-09-17 | Ppg Industries, Inc. | Chemically treated glass fibers and strands and dispersed products thereof |
| US4742095A (en) * | 1985-07-25 | 1988-05-03 | Mobay Corporation | Continuous process for the production of aqueous polyurethane-urea dispersions |
| US4701480A (en) * | 1985-09-23 | 1987-10-20 | Mobay Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| DE3625605A1 (de) * | 1986-07-29 | 1988-02-11 | Hoechst Ag | Waessrige pigmentzubereitungen und ihre verwendung |
| DE3630045A1 (de) * | 1986-09-04 | 1988-03-17 | Bayer Ag | Klebstoff und die verwendung des klebstoffs zur herstellung von verklebungen |
| CA1304869C (en) * | 1986-10-21 | 1992-07-07 | Peter H. Markusch | Continuous process for the production of aqueous polyurethane-urea dispersions |
| DE3640752A1 (de) * | 1986-11-28 | 1988-06-09 | Akzo Gmbh | Anionische polyurethane |
| DE3641494A1 (de) * | 1986-12-04 | 1988-06-09 | Bayer Ag | In wasser loesliche oder dispergierbare poylurethane, ein verfahren zu ihrer herstellung und ihre verwendung zur beschichtung beliebiger substrate |
| JPS63144450U (enExample) * | 1987-03-13 | 1988-09-22 | ||
| US4826894A (en) * | 1987-05-19 | 1989-05-02 | Mobay Corporation | Aqueous polyurethane-ureas dispersions and their use for the production of coatings having improved humidity resistance |
| IT1222093B (it) † | 1987-07-22 | 1990-08-31 | Conceria Conti S P A | Procedimento per la rifinizione di pellame,cuoio e simili substrati fibrosi |
| DE3735587A1 (de) * | 1987-10-21 | 1989-05-11 | Bayer Ag | Verfahren zur herstellung von waessrigen polyurethan-polyharnstoffdispersionen |
| US4956438A (en) * | 1989-02-08 | 1990-09-11 | The Dow Chemical Company | Bulk polyurethane ionomers |
| DE3922493A1 (de) * | 1989-07-08 | 1991-01-17 | Bayer Ag | Verfahren zur herstellung von waessrigen dispersionen von polyurethanen und ihre verwendung als beschichtungsmittel fuer beliebige substrate |
| US5137967A (en) * | 1990-07-06 | 1992-08-11 | Reichhold Chemicals, Inc. | Hydrazine extended aqueous polyurethane |
| DE4112327A1 (de) * | 1991-04-16 | 1992-10-22 | Bayer Ag | Waessrige oligourethanformierung fuer pigmente |
| DE4125454A1 (de) * | 1991-08-01 | 1993-02-04 | Bayer Ag | Beschichtungsmittel und ihre verwendung zur erzeugung wasserdampfdurchlaessiger beschichtungen |
| US5747582A (en) * | 1992-10-29 | 1998-05-05 | Bayer Aktiengesellschaft | Aqueous coating compositions and their use for the preparation of coatings that are permeable to water vapor |
| US5610232A (en) * | 1993-09-24 | 1997-03-11 | H.B. Fuller Licensing & Financing, Inc. | Aqueous non-gelling, anionic polyurethane dispersions and process for their manufacture |
| US5608000A (en) * | 1993-09-24 | 1997-03-04 | H. B. Fuller Licensing & Financing, Inc. | Aqueous polyurethane dispersion adhesive compositions with improved heat resistance |
| US5703158A (en) * | 1993-09-24 | 1997-12-30 | H.B. Fuller Licensing & Financing, Inc. | Aqueous anionic poly (urethane/urea) dispersions |
| US5518764A (en) * | 1994-03-22 | 1996-05-21 | Bayer Aktiengesellschaft | Process for coating textiles |
| US5872182A (en) * | 1994-09-09 | 1999-02-16 | H. B. Fuller Licensing & Financing, Inc. | Water-based polyurethanes for footwear |
| DE19517185A1 (de) * | 1995-05-11 | 1996-11-14 | Bayer Ag | Biologisch abbaubare und kompostierbare Formkörper einschließlich Flächengebilden |
| US5569706A (en) * | 1995-06-02 | 1996-10-29 | Bayer Corporation | Aqueous polyurea dispersions with improved hardness and solvent resistance |
| DE19529575A1 (de) * | 1995-08-11 | 1997-02-13 | Remmers Bauchemie Gmbh | Holzprodukt mit verbesserter Witterungsbeständigkeit und Dimensionsstabilität |
| US5593810A (en) * | 1996-05-14 | 1997-01-14 | Polaroid Corporation | Diffusion transfer film unit |
| US5733967A (en) * | 1996-08-20 | 1998-03-31 | Bayer Corporation | Aqueous polyurethane dispersions and their use for preparing coatings with excellent hydrolytic and thermal stability |
| US5652301A (en) * | 1996-08-20 | 1997-07-29 | Bayer Corporation | Aqueous polyurea dispersions and their use for preparing coatings with excellent hydrolytic and thermal stability |
| US5714561A (en) * | 1996-09-23 | 1998-02-03 | Uniroyal Chemical Company, Inc. | Water-dispersable polyurethanes |
| DE19645663A1 (de) * | 1996-11-06 | 1998-05-07 | Bayer Ag | Biologisch abbaubare und kompostierbare Formkörper |
| JP2001513129A (ja) | 1997-02-26 | 2001-08-28 | バイエル・アクチエンゲゼルシヤフト | 生物学的に分解可能な皮革 |
| US5747630A (en) * | 1997-03-13 | 1998-05-05 | Morton International, Inc. | Polyurethane binder for a magnetic recording medium |
| US20020197443A1 (en) * | 1997-03-17 | 2002-12-26 | Schrock Alan K. | Process for preparing carpets having polyurethane backings obtained from polyurethane latex formulations |
| US5912093A (en) * | 1997-05-15 | 1999-06-15 | National Science Council | Polyurethane-based polymeric electrolyte and process for producing same |
| US5919860A (en) * | 1997-12-17 | 1999-07-06 | Bayer Corporation | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| US5932652A (en) * | 1997-12-17 | 1999-08-03 | Bayer Corporation | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| DE19804123A1 (de) * | 1998-02-03 | 1999-08-05 | Agfa Gevaert Ag | Inkjet-Tinte |
| DE19812880A1 (de) | 1998-03-24 | 1999-09-30 | Bayer Ag | Formteil und flexible Folie mit geschützter Leiterbahn und Verfahren zu ihrer Herstellung |
| US6325887B1 (en) | 1998-04-30 | 2001-12-04 | Morton International, Inc. | Heat-activatable polyurethane/urea adhesive in aqueous dispersion |
| US6743844B1 (en) | 1998-08-17 | 2004-06-01 | Dow Global Technologies Inc. | Spill resistant carpet backing |
| JP4463992B2 (ja) | 1998-12-18 | 2010-05-19 | ダウ グローバル テクノロジーズ インコーポレイティド | 防湿性の改良されたポリマーの製造に有用な水性ポリウレタン分散液 |
| WO2000039178A1 (en) | 1998-12-29 | 2000-07-06 | The Dow Chemical Company | Polyurethane foams prepared from mechanically frothed polyurethane dispersions |
| US6077901A (en) * | 1999-05-06 | 2000-06-20 | Bayer Corporation | Aqueous compositions containing mixtures of silane-functional resins |
| US6147155A (en) * | 1999-06-08 | 2000-11-14 | Bayer Corporation | Aqueous polyurethane dispersions containing non-cyclic diisocyanates and a process for their preparation |
| US6518348B1 (en) | 1999-12-14 | 2003-02-11 | Dow Global Technologies Inc. | Carpet backing compounds thickened by hydrophobically-modified ethylene-oxide-based urethane block copolymers |
| KR100746464B1 (ko) | 1999-12-23 | 2007-08-03 | 아크조 노벨 엔.브이. | 부가 중합체 및 폴리우레탄을 포함하는 수성 코팅 조성물 |
| US6455631B1 (en) | 2000-12-01 | 2002-09-24 | Bayer Corporation | Aqueous polyurethane dispersions containing modified hydrazide groups and their use in one-component thermoset compositions |
| DE10122444A1 (de) * | 2001-05-09 | 2002-11-14 | Bayer Ag | Polyurethan-Polyharnstoff Dispersionen als Beschichtungsmittel |
| DE10138765A1 (de) | 2001-08-07 | 2003-02-20 | Bayer Ag | Wässrige Dispersionen hydrophiler Polyurethanharze |
| DE10216896A1 (de) | 2002-04-17 | 2003-11-13 | Goldschmidt Ag Th | Wässrige Polysiloxan-Polyurethan-Dispersion, ihre Herstellung und Verwendung in Beschichtungsmitteln |
| KR101111990B1 (ko) * | 2002-10-31 | 2012-02-17 | 다우 글로벌 테크놀로지스 엘엘씨 | 폴리우레탄 분산액 및 이로부터 제조된 제품 |
| DE10251797A1 (de) | 2002-11-07 | 2004-05-19 | Bayer Ag | Polyurethanharz mit hohem Carbonatgruppengehalt |
| US7066801B2 (en) * | 2003-02-21 | 2006-06-27 | Dow Global Technologies, Inc. | Method of manufacturing a fixed abrasive material |
| US6910951B2 (en) | 2003-02-24 | 2005-06-28 | Dow Global Technologies, Inc. | Materials and methods for chemical-mechanical planarization |
| DE10324306A1 (de) * | 2003-05-30 | 2004-12-16 | Bayer Materialscience Ag | Wässrige PUR-Dispersionen zur Herstellung von Beschichtungen mit Softfeel-Effekt |
| AU2004251165A1 (en) * | 2003-06-13 | 2005-01-06 | Dow Global Technologies Inc | High performance polyurethane carpet backings containing modified vegetable oil polyols |
| US20070265388A1 (en) * | 2003-10-28 | 2007-11-15 | Dow Global Technologies Inc. | Polyurethane dispersion and articles prepared therefrom |
| US7238745B2 (en) * | 2003-12-15 | 2007-07-03 | Bayer Materialscience Llc | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| DE102004002525A1 (de) * | 2004-01-16 | 2005-08-04 | Bayer Materialscience Ag | Beschichtungsmittelzusammensetzung |
| DE102004013259A1 (de) * | 2004-03-18 | 2005-09-29 | Bayer Materialscience Ag | Wässrige PUR-Dispersionen mit verbesserter Haftung |
| DE102004023768A1 (de) * | 2004-05-11 | 2005-12-01 | Bayer Materialscience Ag | Wässrige Polyurethan-Dispersionen und ihre Verwendung als Klebstoff |
| US20050287349A1 (en) * | 2004-06-23 | 2005-12-29 | Yu Poli C | Method for coating coils |
| DE102004045533A1 (de) * | 2004-09-20 | 2006-03-23 | Bayer Materialscience Ag | Hydrolysestabile Beschichtungsmittelzusammensetzung |
| DE102004049591A1 (de) * | 2004-10-12 | 2006-04-13 | Bayer Materialscience Ag | Wässrige Schaumbeschichtung mit Softfeel-Effekt |
| DE102005029626A1 (de) * | 2005-06-23 | 2007-01-04 | Bayer Materialscience Ag | Polymermischung auf Basis von Polycarbonatpolyolen |
| CN101283014B (zh) * | 2005-09-02 | 2014-06-25 | 陶氏环球技术有限责任公司 | 用于硬表面涂层的不含溶剂的聚氨酯分散体 |
| KR101341076B1 (ko) * | 2005-12-15 | 2013-12-11 | 아크조노벨코팅스인터내셔널비.브이. | 다층 코팅 시스템 |
| US20090264586A1 (en) * | 2006-05-12 | 2009-10-22 | Nuplex Resins B.V. | Aqueous dispersion of an auto-oxidatively drying polyurethane |
| BRPI0711003A2 (pt) * | 2006-05-18 | 2011-08-23 | Dow Global Technologies Inc | dispersão de poliuretano aquoso, uso de uma dispersão de poliuretano aquosa e polìmero de poliuretano |
| CN101516957B (zh) * | 2006-09-20 | 2011-12-28 | 三井化学株式会社 | 水性聚氨酯树脂 |
| DE102006048926A1 (de) * | 2006-10-17 | 2008-04-24 | Bayer Materialscience Ag | Wässriges Beschichtungsmittel auf Basis eines Bindemittelgemisches als Basislack |
| DE102007020523A1 (de) | 2007-05-02 | 2008-11-06 | Helling, Günter, Dr. | Metallsalz-Nanogel enthaltende Polymere |
| EP2170971B1 (de) * | 2007-07-19 | 2011-02-02 | Basf Se | Wasserdispergierbare polyisocyanate |
| CL2008003125A1 (es) * | 2007-11-07 | 2009-11-27 | Bayer Materialscience Ag | Dispersion poliuretano-poliuretano urea acuosa de uno o mas polioles, di o poliisocianato y mezcla de monoaminos d1 y diamino primarios y/o secundarios d2 donde al menos d1 y/o d2 tiene sulfonato y/o carboxilato, funcionalidad amino 1,65 a 1,95, relacion nco 1,04 a 1,9; procedimiento de preparacion; composiciones; uso; y compuesto. |
| DE102007054002A1 (de) | 2007-11-13 | 2009-05-14 | Bayer Materialscience Ag | Nicht-ionisch hydrophilierte Bindemittel-Dispersionen |
| CN101959914B (zh) * | 2007-12-26 | 2014-02-12 | 陶氏环球技术有限责任公司 | 聚氨酯分散体和从该分散体制得的涂层 |
| US20110045219A1 (en) * | 2009-08-18 | 2011-02-24 | Bayer Materialscience Llc | Coating compositions for glass substrates |
| EP2319876A1 (de) * | 2009-10-16 | 2011-05-11 | Bayer MaterialScience AG | Aromatsiche Polyurethanharnstoffdispersionen |
| TWI485187B (zh) | 2010-08-17 | 2015-05-21 | Stahl Internat Bv | 安定之水蠟分散液 |
| EP2441791A1 (en) | 2010-10-14 | 2012-04-18 | Clariant International Ltd. | Stable aqueous wax dispersions |
| TWI555800B (zh) * | 2011-04-04 | 2016-11-01 | 拜耳材料科學股份有限公司 | 聚胺基甲酸酯脲分散體 |
| WO2016124251A1 (en) | 2015-02-06 | 2016-08-11 | Taminco | Aqueous polyurethane dispersions |
| WO2017221455A1 (ja) * | 2016-06-20 | 2017-12-28 | Dic株式会社 | 凝固物の製造方法 |
| JP6183577B1 (ja) * | 2016-06-20 | 2017-08-23 | Dic株式会社 | 凝固物の製造方法 |
| CN116410437A (zh) * | 2021-12-29 | 2023-07-11 | 财团法人工业技术研究院 | 水性聚氨酯分散液以及纺织物 |
| EP4559672A1 (en) | 2023-11-27 | 2025-05-28 | Henkel AG & Co. KGaA | Method of separating bonded articles |
| EP4559671A1 (en) | 2023-11-27 | 2025-05-28 | Henkel AG & Co. KGaA | Method of separating bonded articles |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1495745C3 (de) * | 1963-09-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung wäßriger, emulgatorfreier Polyurethan-Latices |
| US3796678A (en) * | 1970-08-17 | 1974-03-12 | Minnesota Mining & Mfg | Highly branched,capped polyurethanes for pressure sensitive adhesives |
| US3988278A (en) * | 1970-08-17 | 1976-10-26 | Minnesota Mining And Manufacturing Company | Stable polymer latex and process for making same |
| AU472873B2 (en) * | 1971-07-29 | 1976-06-10 | Ppg Industries Inc | Zwitterion-containing compositions |
| US4048001A (en) * | 1973-01-10 | 1977-09-13 | American Cyanamid Company | Polyurethane textile adhesive |
| DE2314513C3 (de) * | 1973-03-23 | 1980-08-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen |
| DE2314512C3 (de) * | 1973-03-23 | 1980-10-09 | Bayer Ag, 5090 Leverkusen | Thermoplastische, nichtionische, in Wasser despergierbare im wesentlichen lineare Polyurethanelastomere |
| DE2320719C2 (de) * | 1973-04-25 | 1983-04-14 | Bayer Ag, 5090 Leverkusen | Thermoplastische, emulgatorfreie, nicht ionische, in Wasser despergierbare, im wesentlichen lineare Polyurethanamid-Elastomere, Verfahren zu ihrer Herstellung und Verwendung |
| JPS5240358B2 (enExample) * | 1973-11-27 | 1977-10-12 | ||
| US3993615A (en) * | 1973-12-10 | 1976-11-23 | W. R. Grace & Co. | Process and composition for breaking emulsions |
| FR2308646A1 (fr) * | 1975-04-23 | 1976-11-19 | Rhone Poulenc Ind | Polyurethanne hydrophile et son application |
| US4046729A (en) * | 1975-06-02 | 1977-09-06 | Ppg Industries, Inc. | Water-reduced urethane coating compositions |
| US4028313A (en) * | 1975-06-25 | 1977-06-07 | Bayer Aktiengesellschaft | Process for the production of water-dispersible polyhydroxyl compounds |
| DE2551094A1 (de) * | 1975-11-14 | 1977-05-26 | Bayer Ag | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
-
1976
- 1976-11-11 DE DE2651506A patent/DE2651506C2/de not_active Expired
-
1977
- 1977-11-07 CA CA000290372A patent/CA1119745A/en not_active Expired
- 1977-11-08 US US05/849,690 patent/US4237264A/en not_active Expired - Lifetime
- 1977-11-09 IT IT51747/77A patent/IT1091777B/it active
- 1977-11-09 AT AT799677A patent/AT358825B/de not_active IP Right Cessation
- 1977-11-10 ES ES464014A patent/ES464014A1/es not_active Expired
- 1977-11-10 AU AU30547/77A patent/AU507570B2/en not_active Expired
- 1977-11-10 FR FR7734010A patent/FR2370761A1/fr active Granted
- 1977-11-10 BE BE182534A patent/BE860712A/xx not_active IP Right Cessation
- 1977-11-11 GB GB47024/77A patent/GB1573346A/en not_active Expired
- 1977-11-11 JP JP13482477A patent/JPS5360990A/ja active Granted
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| AU507570B2 (en) | 1980-02-21 |
| ES464014A1 (es) | 1978-07-16 |
| US4237264A (en) | 1980-12-02 |
| FR2370761A1 (fr) | 1978-06-09 |
| AT358825B (de) | 1980-10-10 |
| IT1091777B (it) | 1985-07-06 |
| ATA799677A (de) | 1980-02-15 |
| DE2651506A1 (de) | 1978-05-24 |
| FR2370761B1 (enExample) | 1984-06-29 |
| AU3054777A (en) | 1979-05-17 |
| BE860712A (fr) | 1978-05-10 |
| JPS579735B2 (enExample) | 1982-02-23 |
| JPS5360990A (en) | 1978-05-31 |
| CA1119745A (en) | 1982-03-09 |
| GB1573346A (en) | 1980-08-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2651506C2 (de) | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen | |
| DE2551094C2 (enExample) | ||
| DE2651505C2 (enExample) | ||
| DE2555534C3 (de) | In Wasser dispergierbare Polyurethane | |
| EP0269972B1 (de) | Verfahren zur Herstellung von in Wasser löslichen oder dispergierbaren Polyurethanen und ihre Verwendung zur Beschichtung beliebiger Substrate | |
| EP0004927B1 (de) | In Wasser dispergierbare oder lösliche Polyurethane sowie ein Verfahren zu ihrer Herstellung | |
| DE2314512C3 (de) | Thermoplastische, nichtionische, in Wasser despergierbare im wesentlichen lineare Polyurethanelastomere | |
| EP0044460B1 (de) | Feste, in Wasser dispergierbare, Isocyanatgruppen aufweisende Kunststoffvorläufer und Verfahren zur Herstellung von wässrigen Kunststoffdispersionen unter Verwendung dieser Kunststoffvorläufer | |
| DE2446440C3 (de) | Verfahren zur Herstellung von wäßrigen Dispersionen von Sulfonatgruppen aufweisenden Polyurethanen | |
| EP1387859B1 (de) | Polyurethan-polyharnstoff dispersionen als beschichtungsmittel | |
| DE2530809C2 (de) | Verfahren zur Herstellung von gefärbten, gegebenenfalls verschäumten Polyurethankunststoffen | |
| DE2843790A1 (de) | Verfahren zur herstellung von waessrigen dispersionen oder loesungen von polyurethan-polyharnstoffen, die nach diesem verfahren erhaeltlichen dispersionen oder loesungen, sowie ihre verwendung | |
| EP0595149B2 (de) | Verwendung wässriger Beschichtungsmittel zur Erzeugung wasserdampfdurchlässiger Beschichtungen | |
| EP0278278A1 (de) | Beschichtungs- und Zurichtmittel für Leder | |
| EP0000029A1 (de) | Verfahren zur Herstellung von wässrigen Polyurethan-Dispersionen und -Lösungen und deren Verwendung zur Beschichtung von flexiblen Substraten | |
| EP0003785B1 (de) | Überzugsmittel und Verfahren zur Beschichtung von PVC | |
| DE3735587A1 (de) | Verfahren zur herstellung von waessrigen polyurethan-polyharnstoffdispersionen | |
| WO2005068526A1 (de) | Thermovergilbungsstabile polyurethan-polyharnstoff dispersionen | |
| DE2708442C2 (de) | Verfahren zur Herstellung von modifizierten wäßrigen Kunststoff-Dispersionen | |
| EP2118161B1 (de) | Polyurethan-dispersionen auf basis von 2,2'-mdi | |
| DE2734576A1 (de) | Verfahren zur herstellung von waessrigen dispersionen oder loesungen von isocyanat-polyadditionsprodukten | |
| EP0000347A1 (de) | Elektrolytstabile wässrige Lösungen von Polyurethanionomeren und Verfahren zur Herstellung dieser Ionomeren | |
| WO2010119002A1 (de) | Sphärische partikel und ihre verwendung | |
| WO2000059975A1 (de) | Polyurethan-dispersionen mit alkoxysilan-endgruppen für glasfaserschlichten | |
| EP0147668A1 (de) | Hitzevernetzbare PUR-Beschichtungsmassen, Verfahren zu ihrer Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings | ||
| 8339 | Ceased/non-payment of the annual fee |