DE2647853A1 - Verfahren zur herstellung von 3,4- dihydro-2-(1h)-chinazolinonen und 3,4-dihydro- 2(1h)-chinazolinthionen - Google Patents
Verfahren zur herstellung von 3,4- dihydro-2-(1h)-chinazolinonen und 3,4-dihydro- 2(1h)-chinazolinthionenInfo
- Publication number
- DE2647853A1 DE2647853A1 DE19762647853 DE2647853A DE2647853A1 DE 2647853 A1 DE2647853 A1 DE 2647853A1 DE 19762647853 DE19762647853 DE 19762647853 DE 2647853 A DE2647853 A DE 2647853A DE 2647853 A1 DE2647853 A1 DE 2647853A1
- Authority
- DE
- Germany
- Prior art keywords
- dihydro
- general formula
- reaction
- quinazolinone
- cyclopropylmethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 15
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- -1 methylenedioxy group Chemical group 0.000 claims description 8
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 claims description 7
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical class NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- CTOUNZIAEBIWAW-UHFFFAOYSA-N 3,4-dihydro-1h-quinazolin-2-one Chemical class C1=CC=C2NC(=O)NCC2=C1 CTOUNZIAEBIWAW-UHFFFAOYSA-N 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000005059 halophenyl group Chemical group 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- MHBPJMUAIOKJNL-UHFFFAOYSA-N 1h-quinazoline-2-thione Chemical class C1=CC=CC2=NC(S)=NC=C21 MHBPJMUAIOKJNL-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- VGNAMTKXQSLQJZ-UHFFFAOYSA-N 3,4-dihydro-1h-quinazoline-2-thione Chemical class C1=CC=C2NC(=S)NCC2=C1 VGNAMTKXQSLQJZ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000001760 anti-analgesic effect Effects 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- ZDHKFMGKDDLMGN-UHFFFAOYSA-N 1-(cyclopropylmethyl)-1-(4-methoxyphenyl)thiourea Chemical compound C1=CC(OC)=CC=C1N(C(N)=S)CC1CC1 ZDHKFMGKDDLMGN-UHFFFAOYSA-N 0.000 description 1
- RUVYXZNLBIJUHG-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-methylsulfanyl-4-phenyl-3,4-dihydroquinazolin-2-one Chemical compound O=C1NC(C=2C=CC=CC=2)C2=CC(SC)=CC=C2N1CC1CC1 RUVYXZNLBIJUHG-UHFFFAOYSA-N 0.000 description 1
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NTROOTGUIZEBHH-UHFFFAOYSA-N O=C1NC2=C3OCOC3=CC=C2CN1 Chemical compound O=C1NC2=C3OCOC3=CC=C2CN1 NTROOTGUIZEBHH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- CDHUJLBZOFEXMY-UHFFFAOYSA-N phenylurea urea Chemical compound NC(=O)N.C1(=CC=CC=C1)NC(=O)N CDHUJLBZOFEXMY-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/78—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 2
- C07D239/80—Oxygen atoms
- C07D239/82—Oxygen atoms with an aryl radical attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/78—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50128578A JPS5251379A (en) | 1975-10-24 | 1975-10-24 | Preparation 3,4-dihydro-2(1h)-quinazoline derivates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2647853A1 true DE2647853A1 (de) | 1977-05-05 |
Family
ID=14988206
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762647853 Withdrawn DE2647853A1 (de) | 1975-10-24 | 1976-10-22 | Verfahren zur herstellung von 3,4- dihydro-2-(1h)-chinazolinonen und 3,4-dihydro- 2(1h)-chinazolinthionen |
Country Status (13)
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3102567A4 (en) * | 2014-02-04 | 2017-06-28 | University of Tennessee Research Foundation | Inhibitors of paxillin function and related compositions and methods |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5271483A (en) * | 1975-12-11 | 1977-06-14 | Sumitomo Chem Co Ltd | Synthesis of 2(1h)-quinazolinone derivatives |
| US4622398A (en) * | 1985-06-24 | 1986-11-11 | Eli Lilly And Company | Dialkylaminotetrahydroquinazoline |
| JPH0611219Y2 (ja) * | 1988-12-22 | 1994-03-23 | トヨタ自動車株式会社 | 車両の自動変速機用シフトレバー装置 |
| AU2436792A (en) * | 1991-08-16 | 1993-03-16 | Merck & Co., Inc. | Quinazoline derivatives as inhibitors of hiv reverse transcriptase |
| IL102764A0 (en) * | 1991-08-16 | 1993-01-31 | Merck & Co Inc | Quinazoline derivatives,and pharmaceutical compositions containing them |
| AU6423298A (en) * | 1997-03-26 | 1998-10-20 | Sumitomo Pharmaceuticals Company, Limited | 4-arylmethylene-1,4-dihydro-2h-azine derivatives |
| AR038658A1 (es) * | 2001-06-15 | 2005-01-26 | Novartis Ag | Derivados de 4-aril-2(1h) quinazolinona y 4-aril-quinazolina 2-sustituidas, un proceso para su preparacion, composiciones farmaceuticas y el uso de dichos derivados para la preparacion de un medicamento |
| EP1394242A3 (en) * | 2002-08-07 | 2004-04-21 | Rohm And Haas Company | Cyclic thioureas and their use as additives for lubricating oils |
| GB0230015D0 (en) * | 2002-12-23 | 2003-01-29 | Novartis Ag | Organic compounds |
| CA2513708C (en) * | 2003-01-23 | 2011-01-04 | Shire Holdings Ag | Formulation and methods for the treatment of thrombocythemia |
| US20060030574A1 (en) * | 2004-08-04 | 2006-02-09 | Shire Holdings Ag | Quinazoline derivatives useful for the treatment of peripheral arterial disease and as phosphodiesterase inhibitors |
| US7700608B2 (en) * | 2004-08-04 | 2010-04-20 | Shire Holdings Ag | Quinazoline derivatives and their use in the treatment of thrombocythemia |
| US7910597B2 (en) * | 2006-11-28 | 2011-03-22 | Shire Llc | Substituted quinazolines |
| US8304420B2 (en) | 2006-11-28 | 2012-11-06 | Shire Llc | Substituted quinazolines for reducing platelet count |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3829420A (en) * | 1970-07-13 | 1974-08-13 | Sumitomo Chemical Co | 3,4-dihydro-2(1h)-quinazolinones and preparation thereof |
| US3686178A (en) * | 1970-09-16 | 1972-08-22 | Sandoz Ag | Preparation of 4-aryl-2(1h)-quinazolinones and thiones |
| US3764600A (en) * | 1970-10-06 | 1973-10-09 | Sandoz Ag | 1-substituted-quinazoline-2(1h)-thiones |
| US3748331A (en) * | 1971-05-06 | 1973-07-24 | Sandoz Ag | 1,4-disubstituted-methylenedioxy -2-(1h)-quinazolinones and quinazolinthiones |
-
1975
- 1975-10-24 JP JP50128578A patent/JPS5251379A/ja active Granted
-
1976
- 1976-10-11 NL NL7611210.A patent/NL166934B/xx not_active IP Right Cessation
- 1976-10-12 GB GB42337/76A patent/GB1510068A/en not_active Expired
- 1976-10-12 US US05/731,574 patent/US4202974A/en not_active Expired - Lifetime
- 1976-10-15 AT AT770976A patent/AT353796B/de not_active IP Right Cessation
- 1976-10-19 FR FR7631342A patent/FR2328700A1/fr active Granted
- 1976-10-21 SE SE7611693A patent/SE422577B/xx unknown
- 1976-10-21 CH CH1331876A patent/CH601259A5/xx not_active IP Right Cessation
- 1976-10-22 CA CA263,980A patent/CA1049521A/en not_active Expired
- 1976-10-22 DE DE19762647853 patent/DE2647853A1/de not_active Withdrawn
- 1976-10-22 HU HU76SU932A patent/HU173529B/hu unknown
- 1976-10-22 DK DK480976AA patent/DK137534B/da not_active IP Right Cessation
- 1976-10-22 MX MX765006U patent/MX3743E/es unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3102567A4 (en) * | 2014-02-04 | 2017-06-28 | University of Tennessee Research Foundation | Inhibitors of paxillin function and related compositions and methods |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5251379A (en) | 1977-04-25 |
| JPS5416513B2 (US07122603-20061017-C00187.png) | 1979-06-22 |
| AT353796B (de) | 1979-12-10 |
| SE7611693L (sv) | 1977-04-25 |
| DK480976A (US07122603-20061017-C00187.png) | 1977-04-25 |
| GB1510068A (en) | 1978-05-10 |
| FR2328700B1 (US07122603-20061017-C00187.png) | 1979-03-02 |
| NL7611210A (nl) | 1977-04-26 |
| DK137534C (US07122603-20061017-C00187.png) | 1978-08-14 |
| US4202974A (en) | 1980-05-13 |
| CH601259A5 (US07122603-20061017-C00187.png) | 1978-06-30 |
| AU1854576A (en) | 1978-02-16 |
| NL166934B (nl) | 1981-05-15 |
| CA1049521A (en) | 1979-02-27 |
| MX3743E (es) | 1981-06-10 |
| SE422577B (sv) | 1982-03-15 |
| ATA770976A (de) | 1979-05-15 |
| FR2328700A1 (fr) | 1977-05-20 |
| DK137534B (da) | 1978-03-20 |
| HU173529B (hu) | 1979-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19532052C2 (de) | Verfahren zur Herstellung von Chinazolinderivaten | |
| DE2647853A1 (de) | Verfahren zur herstellung von 3,4- dihydro-2-(1h)-chinazolinonen und 3,4-dihydro- 2(1h)-chinazolinthionen | |
| DE69327890T2 (de) | Verfahren zur Herstellung von 2-(un)substituierten 4-Alkylimidazolen | |
| DE2165056C3 (de) | Verfahren zur Herstellung von CMnazollnonen | |
| DE2707102C2 (de) | Verfahren zur regiospezifischen Herstellung von o-Aminophenylketonen | |
| DE2141616C3 (de) | Oxazole- und Oxazine eckige Klammer auf 3,2-c eckige Klammer zu chinazolinone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2702530A1 (de) | Verfahren zur herstellung von 3,4-dihydro-2(1h)-chinazolinon-derivaten | |
| DE69703115T2 (de) | Zwischenprodukte um 2-imidazolin-5onederivate herzustellen. | |
| DE2259222A1 (de) | Neue, 1,1-dioxothiazolidin-4-one und verfahren zu deren herstellung | |
| DE2534962B2 (de) | cis-3,4-Ureylenthiophan-l,1-dioxid und Verfahren zu seiner Herstellung | |
| EP0653423B1 (de) | Verfahren zur Herstellung von substituierten Chinazolin-2,4-dionen | |
| CH638525A5 (de) | 3-(tetrazol-5-yl)-1-azaxanthone und verfahren zu ihrer herstellung. | |
| FI82239C (fi) | Framstaellning av aminderivat. | |
| DE2654795C2 (de) | Verfahren zur Herstellung von aromatisch substituierten Sulfamoylbenzoesäure-Derivaten | |
| EP0582288A1 (de) | Verfahren zur Herstellung von 2-Halogen-4,6-dialkoxypyrimidinen | |
| DE2820575C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE19610786A1 (de) | Verfahren zur Herstellung von substituierten aromatischen Thiocarbonsäureamiden | |
| EP1685097B1 (de) | Verfahren zur herstellung von 4-pentafluorsulfanyl-benzoylguanidinen | |
| DE2406972A1 (de) | Verfahren zur herstellung von 5-sulfa- moylanthranilsaeuren | |
| DE2848670A1 (de) | 6- eckige klammer auf 2-hydroxy-4- kleiner als 1,2,3-triazolyl-(2) groesser als -phenyl eckige klammer zu -2,4- dioxo-1,3,5-trimethyl-hexahydro-s- triazine sowie deren herstellung und verwendung als zwischenprodukte fuer die herstellung optischer aufheller | |
| DE2814355B2 (de) | Verfahren zur Herstellung von 4-Methyl-5- [(2aminoäthyl)-thiomethyl] -imidazol-dihydrochlorid | |
| EP0005174B1 (de) | 2-Methyl-5-(2-hydroxystyryl)-1.3.4-thiadiazol und seine Herstellung | |
| DE2238362A1 (de) | Verfahren zur herstellung von neuen pyridazon-(4)-verbindungen | |
| DE2414498B2 (de) | Verfahren zur Herstellung von N- [(l-Äthyl-2pyrrolidinyl)-methyl] -2- alkoxy-5sulfamoylbenzamidderivaten | |
| AT256863B (de) | Verfahren zur Herstellung neuer basischer Derivate des Dihydro-1, 3-benzoxazin-2, 4-dions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |