DE2619832A1 - Verfahren zum herstellen von fluorsilikonpolymeren - Google Patents
Verfahren zum herstellen von fluorsilikonpolymerenInfo
- Publication number
- DE2619832A1 DE2619832A1 DE19762619832 DE2619832A DE2619832A1 DE 2619832 A1 DE2619832 A1 DE 2619832A1 DE 19762619832 DE19762619832 DE 19762619832 DE 2619832 A DE2619832 A DE 2619832A DE 2619832 A1 DE2619832 A1 DE 2619832A1
- Authority
- DE
- Germany
- Prior art keywords
- composition
- catalyst
- silanol
- diorganopolysiloxane
- end groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 28
- 229920000642 polymer Polymers 0.000 title description 7
- 238000004519 manufacturing process Methods 0.000 title description 5
- -1 polysiloxane Polymers 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 30
- 239000003054 catalyst Substances 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 claims description 13
- 125000005372 silanol group Chemical group 0.000 claims description 13
- 239000013638 trimer Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 9
- 239000004927 clay Substances 0.000 claims description 9
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 239000002798 polar solvent Substances 0.000 claims description 8
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical group CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 claims description 6
- 239000012975 dibutyltin dilaurate Substances 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 230000008707 rearrangement Effects 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 229920001296 polysiloxane Polymers 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical group [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229920002554 vinyl polymer Chemical group 0.000 claims description 3
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 claims description 2
- 239000013256 coordination polymer Substances 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 description 17
- 229920001971 elastomer Polymers 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 239000005060 rubber Substances 0.000 description 14
- 150000002009 diols Chemical class 0.000 description 13
- 125000004122 cyclic group Chemical group 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- ZQTYRTSKQFQYPQ-UHFFFAOYSA-N trisiloxane Chemical compound [SiH3]O[SiH2]O[SiH3] ZQTYRTSKQFQYPQ-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000008961 swelling Effects 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 4
- 229920001519 homopolymer Polymers 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 150000001923 cyclic compounds Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- 229920002379 silicone rubber Polymers 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JGHTXIKECBJCFI-UHFFFAOYSA-N trifluoro(propyl)silane Chemical group CCC[Si](F)(F)F JGHTXIKECBJCFI-UHFFFAOYSA-N 0.000 description 2
- QMTFKWDCWOTPGJ-KVVVOXFISA-N (z)-octadec-9-enoic acid;tin Chemical compound [Sn].CCCCCCCC\C=C/CCCCCCCC(O)=O QMTFKWDCWOTPGJ-KVVVOXFISA-N 0.000 description 1
- KOMNUTZXSVSERR-UHFFFAOYSA-N 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione Chemical compound C=CCN1C(=O)N(CC=C)C(=O)N(CC=C)C1=O KOMNUTZXSVSERR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- URZHQOCYXDNFGN-UHFFFAOYSA-N 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,2,4,6-trioxatrisilinane Chemical compound FC(F)(F)CC[Si]1(C)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1 URZHQOCYXDNFGN-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- QTRQFVAKGZFBRT-UHFFFAOYSA-N 2-(3,3,3-trifluoropropyl)-1,3,5,2,4,6-trioxatrisilinane Chemical compound FC(F)(F)CC[SiH]1O[SiH2]O[SiH2]O1 QTRQFVAKGZFBRT-UHFFFAOYSA-N 0.000 description 1
- RWLALWYNXFYRGW-UHFFFAOYSA-N 2-Ethyl-1,3-hexanediol Chemical compound CCCC(O)C(CC)CO RWLALWYNXFYRGW-UHFFFAOYSA-N 0.000 description 1
- IHEDBVUTTQXGSJ-UHFFFAOYSA-M 2-[bis(2-oxidoethyl)amino]ethanolate;titanium(4+);hydroxide Chemical compound [OH-].[Ti+4].[O-]CCN(CC[O-])CC[O-] IHEDBVUTTQXGSJ-UHFFFAOYSA-M 0.000 description 1
- KTXWGMUMDPYXNN-UHFFFAOYSA-N 2-ethylhexan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-] KTXWGMUMDPYXNN-UHFFFAOYSA-N 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 229910008051 Si-OH Inorganic materials 0.000 description 1
- 229910006358 Si—OH Inorganic materials 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical class NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- HSSJULAPNNGXFW-UHFFFAOYSA-N [Co].[Zn] Chemical compound [Co].[Zn] HSSJULAPNNGXFW-UHFFFAOYSA-N 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- FWYSSOIRLVHQNC-UHFFFAOYSA-M benzyl(trimethyl)azanium;acetate Chemical compound CC([O-])=O.C[N+](C)(C)CC1=CC=CC=C1 FWYSSOIRLVHQNC-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- LUZSPGQEISANPO-UHFFFAOYSA-N butyltin Chemical compound CCCC[Sn] LUZSPGQEISANPO-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical class O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical class CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 229960005082 etohexadiol Drugs 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- HTDJPCNNEPUOOQ-UHFFFAOYSA-N hexamethylcyclotrisiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 HTDJPCNNEPUOOQ-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- YVBBRRALBYAZBM-UHFFFAOYSA-N perfluorooctane Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F YVBBRRALBYAZBM-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- WSFQLUVWDKCYSW-UHFFFAOYSA-M sodium;2-hydroxy-3-morpholin-4-ylpropane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC(O)CN1CCOCC1 WSFQLUVWDKCYSW-UHFFFAOYSA-M 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003608 titanium Chemical class 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- LSZKGNJKKQYFLR-UHFFFAOYSA-J tri(butanoyloxy)stannyl butanoate Chemical compound [Sn+4].CCCC([O-])=O.CCCC([O-])=O.CCCC([O-])=O.CCCC([O-])=O LSZKGNJKKQYFLR-UHFFFAOYSA-J 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/22—Polysiloxanes containing silicon bound to organic groups containing atoms other than carbon, hydrogen and oxygen
- C08G77/24—Polysiloxanes containing silicon bound to organic groups containing atoms other than carbon, hydrogen and oxygen halogen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/576,702 US3997496A (en) | 1975-05-12 | 1975-05-12 | Process for the preparation of fluorosilicone polymers and copolymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2619832A1 true DE2619832A1 (de) | 1976-11-25 |
Family
ID=24305610
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762619832 Withdrawn DE2619832A1 (de) | 1975-05-12 | 1976-05-05 | Verfahren zum herstellen von fluorsilikonpolymeren |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3997496A (enExample) |
| JP (1) | JPS5910374B2 (enExample) |
| DE (1) | DE2619832A1 (enExample) |
| FR (1) | FR2311052A1 (enExample) |
| GB (1) | GB1543213A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3030882A1 (de) * | 1979-08-17 | 1981-03-26 | Asahi Glass Co. Ltd., Tokio/Tokyo | Neue fluor enthaltende elastomere |
| EP0113127A3 (en) * | 1982-12-29 | 1987-08-05 | Wacker-Chemie Gmbh | Process for preparing diorganopolysiloxane containing fluoroalkyl groups |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4089833A (en) * | 1977-05-02 | 1978-05-16 | General Electric Company | Process aids for fluorosilicone polymers |
| US4317899A (en) * | 1978-11-13 | 1982-03-02 | General Electric Company | Process for producing fluorosilicone polymers |
| US4348531A (en) * | 1979-08-30 | 1982-09-07 | General Electric Company | Fluorosilicone polydimethylsiloxane equilibration chainstopper and process for manufacture |
| US4397985A (en) * | 1980-04-04 | 1983-08-09 | Allied Corporation | Polyester yarn finish composition |
| US4486567A (en) * | 1983-03-14 | 1984-12-04 | Dow Corning Corporation | Method of polymerizing hydroxyl endblocked polydiorganosiloxane using quaternary ammonium carboxylate-carboxylic acid catalyst |
| US4525528A (en) * | 1983-10-11 | 1985-06-25 | General Electric Company | Peroxide-curable fluorosilicone copolymer compositions |
| US5054390A (en) * | 1985-04-05 | 1991-10-08 | British Ceramic Research Association Ltd. | Off-set printing by silk screening an intermediate surface and transferring the image to an article by an off-set pad |
| US4942065A (en) * | 1988-07-05 | 1990-07-17 | General Electric Company | Method for curing silicone coatings on plastic substrates, and curable compositions related thereto |
| US4863520A (en) * | 1988-07-05 | 1989-09-05 | General Electric Company | Method for curing silicone coatings on plastic substrates, and curable compositions related thereto |
| US4882368A (en) * | 1988-09-26 | 1989-11-21 | Dow Corning Corporation | Low compression set fluorosilicone rubber |
| US5087683A (en) * | 1989-02-07 | 1992-02-11 | Shin-Etsu Chemical Co. Ltd. | Process for producing α, ω-hydroxyfluoroalkylpolysiloxanes |
| US5081172A (en) * | 1989-12-13 | 1992-01-14 | Dow Corning Corporation | Method to reduce compression set in silanol-containing silicone elastomer bases |
| US5502144A (en) * | 1994-07-15 | 1996-03-26 | University Of Cincinnati | Composition and method for preparing silicone elastomers |
| JP2004523606A (ja) * | 2000-12-14 | 2004-08-05 | ゼネラル・エレクトリック・カンパニイ | フルオロシリコーン消泡剤組成物の製造方法 |
| DE102004039409A1 (de) * | 2004-08-13 | 2006-02-23 | Holmenkol Sport-Technologies Gmbh & Co. Kg | Gleitmittel für Sportgeräte |
| JP7579330B2 (ja) | 2019-09-09 | 2024-11-07 | ダウ シリコーンズ コーポレーション | アルコキシ官能性有機ケイ素化合物を調製する方法 |
| CN119137190A (zh) | 2022-05-09 | 2024-12-13 | 美国陶氏有机硅公司 | 硅氧烷聚合物的聚合 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3160601A (en) * | 1959-07-13 | 1964-12-08 | Dow Corning | Amine salts of phosphoric acid and amine salts of carboxylic acid as silanol condensation catalysts |
| US3094497A (en) * | 1960-07-28 | 1963-06-18 | Dow Corning | Condensation catalysts |
| US3110689A (en) * | 1960-12-28 | 1963-11-12 | Union Carbide Corp | Organosiloxane compositions curable to elastomers at room temperature |
| FR1385740A (fr) * | 1963-02-01 | 1965-01-15 | Dow Corning | Composition stabilisée, à base de graisse |
| FR1478227A (fr) * | 1966-05-03 | 1967-04-21 | Gen Electric | Perfectionnements aux procédés pour la préparation de polymères organiques du silicium par intercondensation |
| US3853932A (en) * | 1973-12-28 | 1974-12-10 | Gen Electric | Process for producing silanol end-stopped polymers of low molecular weight |
-
1975
- 1975-05-12 US US05/576,702 patent/US3997496A/en not_active Expired - Lifetime
-
1976
- 1976-05-05 DE DE19762619832 patent/DE2619832A1/de not_active Withdrawn
- 1976-05-11 JP JP51052906A patent/JPS5910374B2/ja not_active Expired
- 1976-05-12 FR FR7614221A patent/FR2311052A1/fr active Granted
- 1976-05-12 GB GB19490/76A patent/GB1543213A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3030882A1 (de) * | 1979-08-17 | 1981-03-26 | Asahi Glass Co. Ltd., Tokio/Tokyo | Neue fluor enthaltende elastomere |
| EP0113127A3 (en) * | 1982-12-29 | 1987-08-05 | Wacker-Chemie Gmbh | Process for preparing diorganopolysiloxane containing fluoroalkyl groups |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS51138798A (en) | 1976-11-30 |
| FR2311052A1 (fr) | 1976-12-10 |
| US3997496A (en) | 1976-12-14 |
| FR2311052B1 (enExample) | 1981-07-31 |
| JPS5910374B2 (ja) | 1984-03-08 |
| GB1543213A (en) | 1979-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69117040T2 (de) | Verbesserte, bei Zimmertemperatur härtbare Siliconzusammensetzungen und Verfahren zu ihrer Herstellung | |
| DE3887442T2 (de) | Verfahren zur Herstellung von Polysiloxanen mit endständigen Hydroxylgruppen. | |
| DE2648242A1 (de) | Fluorkohlenstoffsiloxanmasse | |
| DE2460085C2 (de) | Verfahren zur Herstellung von Silanolendgruppen aufweisenden Diorganopolysiloxanen geringen Molekulargewichtes | |
| DE1694969C3 (de) | Härten von Polysiloxanmassen bei Raumtemperatur | |
| DE2058289C3 (de) | Verfahren zur Unterstützung der Reaktion zwischen Si-gebundenen Hydroxylgruppen und Si-gebundenen Alkoxygruppen unter Bildung von mindestens einer neuen Siloxanbindung | |
| DE2411363A1 (de) | Verfahren zum herstellen von organopolysiloxan-polycarbonat-blockcopolymeren | |
| DE2644551A1 (de) | Loesungsmittelbestaendige kalthaertende silikonkautschuk-massen | |
| DE69013710T2 (de) | Verfahren zur Herstellung von Organosiliciumverbindungen. | |
| US3997496A (en) | Process for the preparation of fluorosilicone polymers and copolymers | |
| DE2059111A1 (de) | Bei Raumtemperatur vulkanisierbare Siloxanblockcopolymere | |
| DE69031848T2 (de) | Fluorsiliconmassen mit verbessertem elastischen Verhalten | |
| DE1495859A1 (de) | Organopolysiloxane und Verfahren zur Herstellung derselben | |
| DE4424115A1 (de) | Verfahren zum Herstellen von linearen Triorganosiloxyendgruppen aufweisenden Silicon-Flüssigkeiten mit geringem Silianolgehalt | |
| EP0305737A2 (de) | Verfahren zum Kondensieren und/oder Äquilibrieren von Organo-(poly)siloxanen | |
| DE1495956C3 (de) | Verfahren zur Herstellung von Organopolysiloxancopolymeren | |
| DE2818705A1 (de) | Verfahrenshilfsmittel enthaltende fluorsilicon-zusammensetzungen sowie verfahren zu deren herstellung | |
| DE3213053A1 (de) | Fluorsilicon-kautschukmasse, verfahren zu ihrer haertung und polymer | |
| DE2618418C3 (de) | Siloxancopolymer | |
| EP1036820B1 (de) | Lagerstabile, unter Abspaltung von Alkoholen zu Elastomeren vernetzbare Organopolysiloxanmassen | |
| DE3428840A1 (de) | Verfahren zur herstellung von alkoxyendgruppen aufweisendem polydiorganosiloxan | |
| DE2945786A1 (de) | Verfahren zum herstellen von fluorsilikon-polymeren | |
| DE3624206C1 (de) | Unter Ausschluss von Wasser lagerfaehige,bei Zutritt von Wasser bei Raumtemperatur zu Elastomeren vernetzende Massen | |
| DE69022526T2 (de) | Silacyclobutanfunktionelle Polymere und ihre Herstellung. | |
| DE2021304A1 (de) | Carboran-Siloxan-Polymere |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |