DE2556071A1 - Sulfinylhalogenide und verfahren zu ihrer herstellung aus penicillin-sulfoxiden - Google Patents
Sulfinylhalogenide und verfahren zu ihrer herstellung aus penicillin-sulfoxidenInfo
- Publication number
- DE2556071A1 DE2556071A1 DE19752556071 DE2556071A DE2556071A1 DE 2556071 A1 DE2556071 A1 DE 2556071A1 DE 19752556071 DE19752556071 DE 19752556071 DE 2556071 A DE2556071 A DE 2556071A DE 2556071 A1 DE2556071 A1 DE 2556071A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- general formula
- methyl
- carbon atoms
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 49
- 230000008569 process Effects 0.000 title claims description 18
- FCZNNHHXCFARDY-WQRUCBPWSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)CC1=CC=CC=C1 FCZNNHHXCFARDY-WQRUCBPWSA-N 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 11
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical class S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 title 1
- -1 4-nitrobenzyloxy group Chemical group 0.000 claims description 147
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 45
- 125000004432 carbon atom Chemical group C* 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 35
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical class ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 29
- 239000003795 chemical substances by application Substances 0.000 claims description 28
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 27
- 239000002904 solvent Substances 0.000 claims description 27
- 230000002140 halogenating effect Effects 0.000 claims description 25
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 16
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000006244 carboxylic acid protecting group Chemical group 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 9
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 8
- 125000004797 2,2,2-trichloroethoxy group Chemical group ClC(CO*)(Cl)Cl 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 6
- 125000001246 bromo group Chemical group Br* 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- WIMGCNFCFYONPX-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1COC(=O)C(C(=C)C)N(C1=O)C(S(Cl)=O)C1NC(=O)COC1=CC=CC=C1 WIMGCNFCFYONPX-UHFFFAOYSA-N 0.000 claims description 4
- WDRFYIPWHMGQPN-UHFFFAOYSA-N 2-chloroisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Cl)C(=O)C2=C1 WDRFYIPWHMGQPN-UHFFFAOYSA-N 0.000 claims description 4
- 125000003368 amide group Chemical group 0.000 claims description 4
- 125000004970 halomethyl group Chemical group 0.000 claims description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000000018 nitroso group Chemical group N(=O)* 0.000 claims description 3
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- HTDVVRGHONTQMQ-UHFFFAOYSA-N 2,2,2-trichloroethyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate Chemical compound O=C1N(C(C(=C)C)C(=O)OCC(Cl)(Cl)Cl)C(S(Cl)=O)C1NC(=O)CC1=CC=CC=C1 HTDVVRGHONTQMQ-UHFFFAOYSA-N 0.000 claims description 2
- OGVLQETULPBRTN-UHFFFAOYSA-N benzhydryl 2-[2-chlorosulfinyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)OC(=O)C(C(=C)C)N(C1=O)C(S(Cl)=O)C1NC(=O)COC1=CC=CC=C1 OGVLQETULPBRTN-UHFFFAOYSA-N 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000005042 acyloxymethyl group Chemical group 0.000 claims 2
- 125000001589 carboacyl group Chemical group 0.000 claims 2
- CLUKTSIUGTWYPH-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-(2-chlorosulfinyl-3-formamido-4-oxoazetidin-1-yl)-3-methylbut-3-enoate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1COC(=O)C(C(=C)C)N1C(S(Cl)=O)C(NC=O)C1=O CLUKTSIUGTWYPH-UHFFFAOYSA-N 0.000 claims 1
- BFSXROKQPGUERI-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-(3-acetamido-2-chlorosulfinyl-4-oxoazetidin-1-yl)-3-methylbut-3-enoate Chemical compound O=C1C(NC(=O)C)C(S(Cl)=O)N1C(C(C)=C)C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 BFSXROKQPGUERI-UHFFFAOYSA-N 0.000 claims 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 41
- 238000010992 reflux Methods 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 239000007858 starting material Substances 0.000 description 12
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 10
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 10
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 10
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 229930182555 Penicillin Natural products 0.000 description 9
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 229940049954 penicillin Drugs 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 150000003462 sulfoxides Chemical class 0.000 description 7
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- KDXFMMHNGFNJFA-UHFFFAOYSA-N 4-oxoazetidine-2-sulfinyl chloride Chemical class ClS(=O)C1CC(=O)N1 KDXFMMHNGFNJFA-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- WNMFNGGUHIIQJE-BEZSAJEZSA-N (4-nitrophenyl)methyl (5r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(C(S2=O)(C)C)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)COC1=CC=CC=C1 WNMFNGGUHIIQJE-BEZSAJEZSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000000746 allylic group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 125000002632 imidazolidinyl group Chemical group 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- OGEBVIRSYGXOGZ-GELUPKEKSA-N O=S1C(C)(C)C(C(O)=O)N2C(=O)C[C@H]21 Chemical compound O=S1C(C)(C)C(C(O)=O)N2C(=O)C[C@H]21 OGEBVIRSYGXOGZ-GELUPKEKSA-N 0.000 description 2
- 229930195708 Penicillin V Natural products 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 2
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 150000007973 cyanuric acids Chemical class 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- ICDQOGMPYSAZFB-UHFFFAOYSA-N ethyl n-chlorocarbamate Chemical class CCOC(=O)NCl ICDQOGMPYSAZFB-UHFFFAOYSA-N 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000001469 hydantoins Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- YXKPEPQKJIALCJ-UHFFFAOYSA-N methyl 2-[2-chlorosulfinyl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-methylbut-3-enoate Chemical compound O=C1N(C(C(=O)OC)C(C)=C)C(S(Cl)=O)C1N1C(=O)C2=CC=CC=C2C1=O YXKPEPQKJIALCJ-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- DTMXHYUPALBXFG-UHFFFAOYSA-N n-chloro-n,4-dimethylbenzenesulfonamide Chemical compound CN(Cl)S(=O)(=O)C1=CC=C(C)C=C1 DTMXHYUPALBXFG-UHFFFAOYSA-N 0.000 description 2
- 229940056360 penicillin g Drugs 0.000 description 2
- 229940056367 penicillin v Drugs 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 150000003673 urethanes Chemical class 0.000 description 2
- 125000002348 vinylic group Chemical group 0.000 description 2
- LNVKHOIUIPPOFH-ISTVAULSSA-N (2s,5r,6r)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)N1[C@H]1[C@H]2SC(C)(C)[C@H](C(O)=O)N2C1=O LNVKHOIUIPPOFH-ISTVAULSSA-N 0.000 description 1
- DXIXQMDZEZETJS-UHFFFAOYSA-N (4-methylphenyl) n-chlorocarbamate Chemical compound CC1=CC=C(OC(=O)NCl)C=C1 DXIXQMDZEZETJS-UHFFFAOYSA-N 0.000 description 1
- FCNCMIYIVTYORS-GZNCHQMQSA-N (4-nitrophenyl)methyl (5r)-3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1([C@H]2SC(C(N2C1=O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)(C)C)NC(=O)COC1=CC=CC=C1 FCNCMIYIVTYORS-GZNCHQMQSA-N 0.000 description 1
- LADXFZKPGFVWEF-PXTXNPLLSA-N (4-nitrophenyl)methyl (5r)-6-acetamido-3,3-dimethyl-4,7-dioxo-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound N1([C@H](S(C2(C)C)=O)C(C1=O)NC(=O)C)C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 LADXFZKPGFVWEF-PXTXNPLLSA-N 0.000 description 1
- UCBAURXLMISMMB-AXRAFADPSA-N (5R)-2-benzhydryl-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound CC1(C(N2[C@H](S1=O)C(C2=O)NC(=O)COC3=CC=CC=C3)(C(C4=CC=CC=C4)C5=CC=CC=C5)C(=O)O)C UCBAURXLMISMMB-AXRAFADPSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- LYBJXVMKLFINFS-UHFFFAOYSA-N 1,3-dichloro-1,3-diphenylurea Chemical compound C=1C=CC=CC=1N(Cl)C(=O)N(Cl)C1=CC=CC=C1 LYBJXVMKLFINFS-UHFFFAOYSA-N 0.000 description 1
- HGUWAJIBWQYNAV-UHFFFAOYSA-N 1,3-dichloro-1-(4-methylphenyl)urea Chemical compound CC1=CC=C(N(Cl)C(=O)NCl)C=C1 HGUWAJIBWQYNAV-UHFFFAOYSA-N 0.000 description 1
- PGAJRUFQINAARK-UHFFFAOYSA-N 1,3-dichloro-1-cyclohexyl-3-ethylurea Chemical compound CCN(Cl)C(=O)N(Cl)C1CCCCC1 PGAJRUFQINAARK-UHFFFAOYSA-N 0.000 description 1
- OOUCRJBCRWRTKG-UHFFFAOYSA-N 1,3-dichloro-1-phenyl-3-propylurea Chemical compound CCCN(Cl)C(=O)N(Cl)C1=CC=CC=C1 OOUCRJBCRWRTKG-UHFFFAOYSA-N 0.000 description 1
- TUQCXXYUMOIHKA-UHFFFAOYSA-N 1,3-dichloro-1-phenylurea Chemical compound ClNC(=O)N(Cl)C1=CC=CC=C1 TUQCXXYUMOIHKA-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- XKGBJFSOWOKVKH-UHFFFAOYSA-N 1,3-dichloro-5-methylimidazolidine-2,4-dione Chemical compound CC1N(Cl)C(=O)N(Cl)C1=O XKGBJFSOWOKVKH-UHFFFAOYSA-N 0.000 description 1
- YKZAEXPHYBFRHB-UHFFFAOYSA-N 1,3-dichloroimidazolidine-2,4-dione Chemical compound ClN1CC(=O)N(Cl)C1=O YKZAEXPHYBFRHB-UHFFFAOYSA-N 0.000 description 1
- ADFIFDHDLIZVFW-UHFFFAOYSA-N 1-chloropiperidine-2,6-dione Chemical compound ClN1C(=O)CCCC1=O ADFIFDHDLIZVFW-UHFFFAOYSA-N 0.000 description 1
- LJCZNYWLQZZIOS-UHFFFAOYSA-N 2,2,2-trichlorethoxycarbonyl chloride Chemical compound ClC(=O)OCC(Cl)(Cl)Cl LJCZNYWLQZZIOS-UHFFFAOYSA-N 0.000 description 1
- PVFYLJVDDZPUMC-UHFFFAOYSA-N 2,2,2-trichloroethyl 2-(3-acetamido-2-chlorosulfinyl-4-oxoazetidin-1-yl)-3-methylbut-3-enoate Chemical compound CC(=O)NC1C(S(Cl)=O)N(C(C(C)=C)C(=O)OCC(Cl)(Cl)Cl)C1=O PVFYLJVDDZPUMC-UHFFFAOYSA-N 0.000 description 1
- ZZGYTZZZKCQAHC-UHFFFAOYSA-N 2,2,2-trichloroethyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate Chemical compound O=C1N(C(C(=C)C)C(=O)OCC(Cl)(Cl)Cl)C(S(Cl)=O)C1NC(=O)COC1=CC=CC=C1 ZZGYTZZZKCQAHC-UHFFFAOYSA-N 0.000 description 1
- RNAMYOYQYRYFQY-UHFFFAOYSA-N 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-n-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine Chemical compound N1=C(N2CCC(F)(F)CC2)N=C2C=C(OCCCN3CCCC3)C(OC)=CC2=C1NC1CCN(C(C)C)CC1 RNAMYOYQYRYFQY-UHFFFAOYSA-N 0.000 description 1
- AYKSPIBLOMDDGD-UHFFFAOYSA-N 2-(chlorocarbamoyl)benzenesulfonic acid Chemical compound ClN=C(O)C1=CC=CC=C1S(O)(=O)=O AYKSPIBLOMDDGD-UHFFFAOYSA-N 0.000 description 1
- KVDFWDFBMLQCOP-UHFFFAOYSA-N 2-[3-(butanoylamino)-2-chlorosulfinyl-4-oxoazetidin-1-yl]-3-methyl-2-[(4-nitrophenyl)methyl]but-3-enoic acid Chemical compound CCCC(=O)NC1C(N(C1=O)C(CC2=CC=C(C=C2)[N+](=O)[O-])(C(=C)C)C(=O)O)S(=O)Cl KVDFWDFBMLQCOP-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- AXZGBGYOUHWQFC-UHFFFAOYSA-N 3-(chloroamino)-3-oxopropane-1-sulfonic acid Chemical compound ClN=C(O)CCS(O)(=O)=O AXZGBGYOUHWQFC-UHFFFAOYSA-N 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- NZFIRLLOEUJXNX-UHFFFAOYSA-N 4-(chloroamino)-4-oxobutane-1-sulfonic acid Chemical compound ClN=C(O)CCCS(O)(=O)=O NZFIRLLOEUJXNX-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- UBAICQBHFRACCR-UVEYZTKTSA-N CC(C)(C(CC(C=C1)=CC=C1[N+]([O-])=O)(C(O)=O)N([C@H]1[C@@H]2NC=O)C2=O)S1=O Chemical compound CC(C)(C(CC(C=C1)=CC=C1[N+]([O-])=O)(C(O)=O)N([C@H]1[C@@H]2NC=O)C2=O)S1=O UBAICQBHFRACCR-UVEYZTKTSA-N 0.000 description 1
- QGKIUHRYRLYUMH-BMWVUBTQSA-N CC1(C(N2[C@H](S1=O)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)(CC(Cl)(Cl)Cl)C(=O)O)C Chemical compound CC1(C(N2[C@H](S1=O)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)(CC(Cl)(Cl)Cl)C(=O)O)C QGKIUHRYRLYUMH-BMWVUBTQSA-N 0.000 description 1
- 239000005997 Calcium carbide Substances 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical class ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WHTNHYRHHHFFBV-UHFFFAOYSA-N ClNS(=O)=O Chemical class ClNS(=O)=O WHTNHYRHHHFFBV-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- NXTVQNIVUKXOIL-UHFFFAOYSA-N N-chlorotoluene-p-sulfonamide Chemical compound CC1=CC=C(S(=O)(=O)NCl)C=C1 NXTVQNIVUKXOIL-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- LQRWQRNSWOFFML-UHFFFAOYSA-N chloro-[(3-chlorophenyl)methyl]carbamic acid Chemical compound C1=CC(=CC(=C1)Cl)CN(C(=O)O)Cl LQRWQRNSWOFFML-UHFFFAOYSA-N 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- NLVXFGVZNJMFDC-UHFFFAOYSA-N cyclohexyl n,n-dichlorocarbamate Chemical compound ClN(Cl)C(=O)OC1CCCCC1 NLVXFGVZNJMFDC-UHFFFAOYSA-N 0.000 description 1
- DSJSTZRIFMQDHV-UHFFFAOYSA-N cyclohexyl n-chloro-n-(4-nitrophenyl)carbamate Chemical compound C1=CC([N+](=O)[O-])=CC=C1N(Cl)C(=O)OC1CCCCC1 DSJSTZRIFMQDHV-UHFFFAOYSA-N 0.000 description 1
- UJUFCZFKGZMCDF-UHFFFAOYSA-N cyclohexyl n-chloro-n-cyclohexylcarbamate Chemical compound C1CCCCC1OC(=O)N(Cl)C1CCCCC1 UJUFCZFKGZMCDF-UHFFFAOYSA-N 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- VRHAQNTWKSVEEC-UHFFFAOYSA-N ethyl 1,3-dioxoisoindole-2-carboxylate Chemical compound C1=CC=C2C(=O)N(C(=O)OCC)C(=O)C2=C1 VRHAQNTWKSVEEC-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- PCGGNOFZZFFFLU-UHFFFAOYSA-N ethyl n,n-dichlorocarbamate Chemical compound CCOC(=O)N(Cl)Cl PCGGNOFZZFFFLU-UHFFFAOYSA-N 0.000 description 1
- CDPVPXHQPQQRFB-UHFFFAOYSA-N ethyl n-chloro-n-cyclohexylcarbamate Chemical compound CCOC(=O)N(Cl)C1CCCCC1 CDPVPXHQPQQRFB-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000003564 m-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(C#N)=C1[H])C([H])([H])* 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- HIGXYHXNZVNOCV-OPCHAXAVSA-N methyl (5r)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-4,7-dioxo-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C1=O)[C@@H]2N1C(C(=O)OC)C(C)(C)S2=O HIGXYHXNZVNOCV-OPCHAXAVSA-N 0.000 description 1
- HXSLDKNUBFXDRG-UHFFFAOYSA-N methyl n,n-dichlorocarbamate Chemical compound COC(=O)N(Cl)Cl HXSLDKNUBFXDRG-UHFFFAOYSA-N 0.000 description 1
- WRWXAONSPQSLTH-UHFFFAOYSA-N methyl n-chlorocarbamate Chemical compound COC(=O)NCl WRWXAONSPQSLTH-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- KZYWTQNZACMDPS-UHFFFAOYSA-N n,4-dichlorobenzamide Chemical compound ClNC(=O)C1=CC=C(Cl)C=C1 KZYWTQNZACMDPS-UHFFFAOYSA-N 0.000 description 1
- GWLOGZRVYXAHRE-UHFFFAOYSA-N n,4-dimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(C)C=C1 GWLOGZRVYXAHRE-UHFFFAOYSA-N 0.000 description 1
- PJBJJXCZRAHMCK-UHFFFAOYSA-N n,n-dichlorobenzenesulfonamide Chemical compound ClN(Cl)S(=O)(=O)C1=CC=CC=C1 PJBJJXCZRAHMCK-UHFFFAOYSA-N 0.000 description 1
- WIJTTWJQVXJEFE-UHFFFAOYSA-N n-(3-bromophenyl)-n-chlorobutanamide Chemical compound CCCC(=O)N(Cl)C1=CC=CC(Br)=C1 WIJTTWJQVXJEFE-UHFFFAOYSA-N 0.000 description 1
- DHHIKEVWSRQXQP-UHFFFAOYSA-N n-chloro-4-methylbenzamide Chemical compound CC1=CC=C(C(=O)NCl)C=C1 DHHIKEVWSRQXQP-UHFFFAOYSA-N 0.000 description 1
- KZOXUQBSBWDWQQ-UHFFFAOYSA-N n-chloro-n-(4-methylphenyl)propane-2-sulfonamide Chemical compound CC(C)S(=O)(=O)N(Cl)C1=CC=C(C)C=C1 KZOXUQBSBWDWQQ-UHFFFAOYSA-N 0.000 description 1
- PMXQDTBJZLOVSV-UHFFFAOYSA-N n-chloro-n-cyclohexylacetamide Chemical compound CC(=O)N(Cl)C1CCCCC1 PMXQDTBJZLOVSV-UHFFFAOYSA-N 0.000 description 1
- RWVOAAWFMJRINI-UHFFFAOYSA-N n-chloro-n-cyclohexylbenzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N(Cl)C1CCCCC1 RWVOAAWFMJRINI-UHFFFAOYSA-N 0.000 description 1
- YTYAPSXIGOPIOH-UHFFFAOYSA-N n-chloro-n-cyclohexylcyclohexanesulfonamide Chemical compound C1CCCCC1S(=O)(=O)N(Cl)C1CCCCC1 YTYAPSXIGOPIOH-UHFFFAOYSA-N 0.000 description 1
- YEXVRBUZIOSARW-UHFFFAOYSA-N n-chloro-n-cyclohexylethanesulfonamide Chemical compound CCS(=O)(=O)N(Cl)C1CCCCC1 YEXVRBUZIOSARW-UHFFFAOYSA-N 0.000 description 1
- FGJCTKGHKMARPX-UHFFFAOYSA-N n-chloro-n-ethyl-3-nitrobenzenesulfonamide Chemical compound CCN(Cl)S(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 FGJCTKGHKMARPX-UHFFFAOYSA-N 0.000 description 1
- XPTJWKPOBFHDHX-UHFFFAOYSA-N n-chloro-n-ethylbenzamide Chemical compound CCN(Cl)C(=O)C1=CC=CC=C1 XPTJWKPOBFHDHX-UHFFFAOYSA-N 0.000 description 1
- DQJKBIDVOSQVEV-UHFFFAOYSA-N n-chloro-n-methylacetamide Chemical compound CN(Cl)C(C)=O DQJKBIDVOSQVEV-UHFFFAOYSA-N 0.000 description 1
- WQJHFILPJKSLJW-UHFFFAOYSA-N n-chloro-n-phenylbenzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N(Cl)C1=CC=CC=C1 WQJHFILPJKSLJW-UHFFFAOYSA-N 0.000 description 1
- RKLUHJIBJTXOQU-UHFFFAOYSA-N n-chloro-n-phenylpropanamide Chemical compound CCC(=O)N(Cl)C1=CC=CC=C1 RKLUHJIBJTXOQU-UHFFFAOYSA-N 0.000 description 1
- UFICRBPXWFJZFC-UHFFFAOYSA-N n-chloro-n-propylbenzenesulfonamide Chemical compound CCCN(Cl)S(=O)(=O)C1=CC=CC=C1 UFICRBPXWFJZFC-UHFFFAOYSA-N 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- CHVZPRDGLWBEMJ-UHFFFAOYSA-N n-chlorobenzenesulfonamide Chemical compound ClNS(=O)(=O)C1=CC=CC=C1 CHVZPRDGLWBEMJ-UHFFFAOYSA-N 0.000 description 1
- QQZCYGRKEOWFAG-UHFFFAOYSA-N n-chlorocyclohexanecarboxamide Chemical compound ClNC(=O)C1CCCCC1 QQZCYGRKEOWFAG-UHFFFAOYSA-N 0.000 description 1
- KFKMOYYBYVVHQQ-UHFFFAOYSA-N n-chloromethanesulfonamide Chemical compound CS(=O)(=O)NCl KFKMOYYBYVVHQQ-UHFFFAOYSA-N 0.000 description 1
- UPSNOKIUEULXHF-UHFFFAOYSA-N n-chloropropanamide Chemical compound CCC(=O)NCl UPSNOKIUEULXHF-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical group [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- QRUSAMIBASLVND-UHFFFAOYSA-N phenyl n,n-dichlorocarbamate Chemical compound ClN(Cl)C(=O)OC1=CC=CC=C1 QRUSAMIBASLVND-UHFFFAOYSA-N 0.000 description 1
- WXVSGQIVJIHVKH-UHFFFAOYSA-N phenyl n-chloro-n-phenylcarbamate Chemical compound C=1C=CC=CC=1N(Cl)C(=O)OC1=CC=CC=C1 WXVSGQIVJIHVKH-UHFFFAOYSA-N 0.000 description 1
- LAIWRIKKCCMYIX-UHFFFAOYSA-N phenyl n-chloro-n-propylcarbamate Chemical compound CCCN(Cl)C(=O)OC1=CC=CC=C1 LAIWRIKKCCMYIX-UHFFFAOYSA-N 0.000 description 1
- FJVNNOMOBHNDRT-UHFFFAOYSA-N phenyl n-chlorocarbamate Chemical compound ClNC(=O)OC1=CC=CC=C1 FJVNNOMOBHNDRT-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- CYAFWKWGHFXITJ-UHFFFAOYSA-N propan-2-yl n-chloro-n-(4-methylphenyl)carbamate Chemical compound CC(C)OC(=O)N(Cl)C1=CC=C(C)C=C1 CYAFWKWGHFXITJ-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- CLZWAWBPWVRRGI-UHFFFAOYSA-N tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-bromophenoxy]ethoxy]-4-methyl-n-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate Chemical compound CC1=CC=C(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)C(OCCOC=2C(=CC=C(Br)C=2)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)=C1 CLZWAWBPWVRRGI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US53627374A | 1974-12-24 | 1974-12-24 | |
| US63273275A | 1975-11-19 | 1975-11-19 | |
| US05/673,017 US4081440A (en) | 1974-12-24 | 1976-04-02 | Sulfinyl halides and their preparation from penicillin sulfoxides |
| US05/852,251 US4165315A (en) | 1974-12-24 | 1977-11-17 | Sulfinyl halides and their preparation from penicillin sulfoxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2556071A1 true DE2556071A1 (de) | 1976-07-08 |
Family
ID=27504660
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752556071 Granted DE2556071A1 (de) | 1974-12-24 | 1975-12-12 | Sulfinylhalogenide und verfahren zu ihrer herstellung aus penicillin-sulfoxiden |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4081440A (enExample) |
| JP (2) | JPS5851951B2 (enExample) |
| AT (1) | AT341671B (enExample) |
| BE (1) | BE837040A (enExample) |
| CA (1) | CA1069126A (enExample) |
| CH (1) | CH617677A5 (enExample) |
| DE (1) | DE2556071A1 (enExample) |
| FR (1) | FR2295949A1 (enExample) |
| GB (1) | GB1527749A (enExample) |
| NL (1) | NL183031C (enExample) |
| SE (1) | SE427658B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726394A1 (de) * | 1976-06-16 | 1977-12-29 | Lilly Co Eli | Verfahren zur herstellung von 2-chlorsulfinylazetidin-4-onen |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4159272A (en) * | 1977-09-01 | 1979-06-26 | Eli Lilly And Company | Process for 2-chlorosulfinylazetidin-4-ones |
| US4190724A (en) * | 1978-11-13 | 1980-02-26 | Eli Lilly And Company | Process for 3-exomethylenecepham sulfoxides |
| US4289695A (en) * | 1978-11-13 | 1981-09-15 | Eli Lilly And Company | Process for preparing 2-chlorosulfinylazetidinones |
| MA18604A1 (fr) * | 1978-11-13 | 1980-07-01 | Lilly Co Eli | Procede de preparation de 2-chlorosulfinylazetidinones |
| US4230620A (en) * | 1979-03-26 | 1980-10-28 | Eli Lilly And Company | Process for preparing penicillin sulfoxides |
| US4368156A (en) * | 1981-03-09 | 1983-01-11 | Eli Lilly And Company | Preparation of 4-haloazetidin-2-ones from 4-sulfinoazetidin-2-ones |
| DE3366497D1 (en) * | 1982-01-22 | 1986-11-06 | Beecham Group Plc | Antibacterial agents, their preparation and use |
| FI103048B1 (fi) * | 1989-03-22 | 1999-04-15 | Dsm Nv | Menetelmä 3-eksometyleenikefaamisulfoksidijohdannaisten valmistamiseksi |
| US5126446A (en) * | 1991-01-04 | 1992-06-30 | Eli Lilly And Company | Process for 3-exomethylenecepham sulfoxide esters |
| US5350845A (en) * | 1992-04-08 | 1994-09-27 | Eli Lilly And Company | Process for preparing 7-substituted-amino-3-hydroxy-3-cephem-4-protected carboxy-sulfoxide esters |
| US5347000A (en) * | 1992-11-05 | 1994-09-13 | Ranbaxy Laboratories Ltd. | Process for the preparation of 2-chlorosulfinylazetidinone |
| US5604222A (en) * | 1993-12-27 | 1997-02-18 | Lupin Laboratories, Ltd. | Method for the preparation of 2-chloro sulfinyl azetidinones |
| US5578721A (en) * | 1994-07-11 | 1996-11-26 | Lupin Laboratories Limited | Process for preparation of 3-exomethylene cepham sulfoxide esters |
| IN184516B (enExample) * | 1996-01-19 | 2000-09-02 | Lupin Laoratories Ltd | |
| KR100370291B1 (ko) * | 1996-08-23 | 2003-08-21 | 주식회사 코오롱 | 2-브로모설피닐 아제티디논 유도체의 제조방법 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3843682A (en) * | 1972-05-15 | 1974-10-22 | Lilly Co Eli | 2-chlorosulfinyl-3-imido-azetedin-4-ones |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852282A (en) * | 1969-04-01 | 1974-12-03 | Squibb & Sons Inc | Certain 2-substituted cephalosporins |
| YU35448B (en) * | 1970-02-18 | 1981-02-28 | Koninkl Gist Spiritus | Process for obtaining 7-substituted amino-deacetoxy cephalosporanic acids |
| US3864338A (en) * | 1970-08-11 | 1975-02-04 | Squibb & Sons Inc | Process for the preparation of {66 {hu 2{b -cephalosporin aldehydes |
| DE2265798C2 (de) * | 1971-06-24 | 1985-09-26 | Fujisawa Pharmaceutical Co., Ltd., Osaka | Verfahren zur Herstellung von Oxoazetidin-Derivaten |
-
1975
- 1975-11-27 CA CA240,643A patent/CA1069126A/en not_active Expired
- 1975-12-12 DE DE19752556071 patent/DE2556071A1/de active Granted
- 1975-12-17 CH CH1636175A patent/CH617677A5/de not_active IP Right Cessation
- 1975-12-18 GB GB51963/75A patent/GB1527749A/en not_active Expired
- 1975-12-22 SE SE7514549A patent/SE427658B/xx not_active IP Right Cessation
- 1975-12-22 JP JP50153913A patent/JPS5851951B2/ja not_active Expired
- 1975-12-23 BE BE1007102A patent/BE837040A/xx not_active IP Right Cessation
- 1975-12-23 AT AT980375A patent/AT341671B/de not_active IP Right Cessation
- 1975-12-24 NL NLAANVRAGE7515070,A patent/NL183031C/xx not_active IP Right Cessation
- 1975-12-24 FR FR7539713A patent/FR2295949A1/fr active Granted
-
1976
- 1976-01-01 JP JP51001459A patent/JPS5848552B2/ja not_active Expired
- 1976-04-02 US US05/673,017 patent/US4081440A/en not_active Expired - Lifetime
-
1977
- 1977-11-17 US US05/852,251 patent/US4165315A/en not_active Expired - Lifetime
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3843682A (en) * | 1972-05-15 | 1974-10-22 | Lilly Co Eli | 2-chlorosulfinyl-3-imido-azetedin-4-ones |
Non-Patent Citations (2)
| Title |
|---|
| Angew. Chemie, 85, 40, 1973 * |
| J. Am. Chem. Soc., 1609, 1974 * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726394A1 (de) * | 1976-06-16 | 1977-12-29 | Lilly Co Eli | Verfahren zur herstellung von 2-chlorsulfinylazetidin-4-onen |
Also Published As
| Publication number | Publication date |
|---|---|
| NL183031B (nl) | 1988-02-01 |
| NL183031C (nl) | 1988-07-01 |
| FR2295949A1 (fr) | 1976-07-23 |
| US4165315A (en) | 1979-08-21 |
| JPS5848552B2 (ja) | 1983-10-28 |
| JPS5262271A (en) | 1977-05-23 |
| SE427658B (sv) | 1983-04-25 |
| AT341671B (de) | 1978-02-27 |
| GB1527749A (en) | 1978-10-11 |
| JPS51125274A (en) | 1976-11-01 |
| CH617677A5 (enExample) | 1980-06-13 |
| BE837040A (fr) | 1976-06-23 |
| ATA980375A (de) | 1977-06-15 |
| CA1069126A (en) | 1980-01-01 |
| AU8708375A (en) | 1977-06-02 |
| SE7514549L (sv) | 1976-06-25 |
| NL7515070A (nl) | 1976-06-28 |
| US4081440A (en) | 1978-03-28 |
| JPS5851951B2 (ja) | 1983-11-19 |
| FR2295949B1 (enExample) | 1978-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0042026B1 (de) | 3,4-Disubstituierte Azetidin-2-onverbindungen und Verfahren zu ihrer Herstellung | |
| DE2606278C2 (enExample) | ||
| DE2556071A1 (de) | Sulfinylhalogenide und verfahren zu ihrer herstellung aus penicillin-sulfoxiden | |
| DD154542A5 (de) | Verfahren zur herstellung von 6 beta-hydroxyalkylpenicillansaeuren | |
| DE2529941A1 (de) | Azetidinonderivate und verfahren zu ihrer herstellung | |
| CH632271A5 (de) | Verfahren zur herstellung von cephalosporinen. | |
| DE2735454A1 (de) | Verfahren zur herstellung von 3-chlorcephemverbindungen | |
| DE1940080A1 (de) | Reduktion von delta?-Cephalosporinsulfoxiden | |
| CH623331A5 (en) | Process for the preparation of 7beta-amino- and 7beta-acylamino-6alphaH-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-ca rboxylic acid derivatives | |
| DE3008257C2 (de) | Verfahren zur Herstellung von Penicillansäure-1,1-dioxid und dessen Estern | |
| DE2534926C2 (de) | Verfahren zur Herstellung von Estern der 7-Oxo- und 7β-Hydroxy-cephalosporansäure und deren 3-substituierten Derivaten | |
| DE2643486A1 (de) | Verfahren zur herstellung von 3-hydroxy-3-cephemestersulfoxiden | |
| DE2726394A1 (de) | Verfahren zur herstellung von 2-chlorsulfinylazetidin-4-onen | |
| DE2651771A1 (de) | 7-amino-3-methyl-1-oxadethia-3- cephem-4-carbonsaeure-derivate, verfahren zu ihrer herstellung, arzneimittel und zwischenprodukte | |
| DE2254644A1 (de) | Substituierte ceph-3-eme und ceph-3-em-sulfoxide und verfahren zu ihrer herstellung | |
| DE2556045C2 (enExample) | ||
| DE3231596A1 (de) | Penem-3-carbonsaeurederivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| DE2138319A1 (de) | Chemische Verbindungen | |
| DE3534857A1 (de) | Cephalosporinsulfoxide, verfahren zu deren herstellung und deren verwendung bei der herstellung von cephalosporinen | |
| DE2838073A1 (de) | Verfahren zur herstellung von substituierten 3-methyl-2-azetidinyl-3- butensaeureestern | |
| AT337357B (de) | Verfahren zur herstellung von neuen penamderivaten | |
| DE2727977C3 (de) | 7α -Methoxycephalosporinderivate und sie enthaltende Arzneimittel | |
| DE2358178C2 (de) | Verfahren zur Herstellung von 2,3-Methylen-6-amino-penicillansäure Derivaten | |
| AT331983B (de) | Verfahren zur herstellung eines neuen derivates der 7-trichlor-acetamido -3- desacetoxy-cephalosporansaure | |
| DE2707815A1 (de) | Neue azetidinone und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SPOTT, G., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |