DE2543673A1 - Verfahren zur herstellung von 1,4- butandiol aus 2-buten-1,4-dicarbonsaeure - Google Patents
Verfahren zur herstellung von 1,4- butandiol aus 2-buten-1,4-dicarbonsaeureInfo
- Publication number
- DE2543673A1 DE2543673A1 DE19752543673 DE2543673A DE2543673A1 DE 2543673 A1 DE2543673 A1 DE 2543673A1 DE 19752543673 DE19752543673 DE 19752543673 DE 2543673 A DE2543673 A DE 2543673A DE 2543673 A1 DE2543673 A1 DE 2543673A1
- Authority
- DE
- Germany
- Prior art keywords
- stage
- acid
- hydrogenolysis
- butanediol
- butene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 title claims description 58
- 238000000034 method Methods 0.000 title claims description 51
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 42
- 238000005886 esterification reaction Methods 0.000 claims description 35
- 230000032050 esterification Effects 0.000 claims description 34
- 239000003054 catalyst Substances 0.000 claims description 27
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 23
- 150000002148 esters Chemical class 0.000 claims description 23
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 claims description 15
- YHGNXQAFNHCBTK-OWOJBTEDSA-N trans-3-hexenedioic acid Chemical compound OC(=O)C\C=C\CC(O)=O YHGNXQAFNHCBTK-OWOJBTEDSA-N 0.000 claims description 12
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 9
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- 239000010949 copper Substances 0.000 claims description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000001530 fumaric acid Substances 0.000 claims description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 4
- 239000011976 maleic acid Substances 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 2
- IDRUFHLMTBZQBT-UHFFFAOYSA-N 2-prop-1-enylpropanedioic acid Chemical compound CC=CC(C(O)=O)C(O)=O IDRUFHLMTBZQBT-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- NGMTUCFCIUGWAG-UHFFFAOYSA-L [Cu+2].[O-]Cl=O.[O-]Cl=O Chemical compound [Cu+2].[O-]Cl=O.[O-]Cl=O NGMTUCFCIUGWAG-UHFFFAOYSA-L 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 238000004064 recycling Methods 0.000 claims 1
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- -1 alkyl hydroxybutyrate Chemical compound 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000004821 distillation Methods 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- JBSLOWBPDRZSMB-FPLPWBNLSA-N dibutyl (z)-but-2-enedioate Chemical compound CCCCOC(=O)\C=C/C(=O)OCCCC JBSLOWBPDRZSMB-FPLPWBNLSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 4
- 125000005907 alkyl ester group Chemical group 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000004508 fractional distillation Methods 0.000 description 4
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UKXDHEBARGMWMO-ONEGZZNKSA-N (e)-4-(2-methylpropoxy)-4-oxobut-2-enoic acid Chemical compound CC(C)COC(=O)\C=C\C(O)=O UKXDHEBARGMWMO-ONEGZZNKSA-N 0.000 description 3
- UKXDHEBARGMWMO-ARJAWSKDSA-N (z)-4-(2-methylpropoxy)-4-oxobut-2-enoic acid Chemical compound CC(C)COC(=O)\C=C/C(O)=O UKXDHEBARGMWMO-ARJAWSKDSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 239000000395 magnesium oxide Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- KTUQUZJOVNIKNZ-UHFFFAOYSA-N butan-1-ol;hydrate Chemical compound O.CCCCO KTUQUZJOVNIKNZ-UHFFFAOYSA-N 0.000 description 2
- YFFBWGUXPFAXRS-UHFFFAOYSA-N butyl 2-hydroxybutanoate Chemical compound CCCCOC(=O)C(O)CC YFFBWGUXPFAXRS-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000003918 potentiometric titration Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- CUEJHYHGUMAGBP-UHFFFAOYSA-N 2-[2-(1h-indol-5-yl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1C1=CC=C(NC=C2)C2=C1 CUEJHYHGUMAGBP-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-M 4-hydroxybutyrate Chemical compound OCCCC([O-])=O SJZRECIVHVDYJC-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 238000009530 blood pressure measurement Methods 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- JBSLOWBPDRZSMB-BQYQJAHWSA-N dibutyl (e)-but-2-enedioate Chemical compound CCCCOC(=O)\C=C\C(=O)OCCCC JBSLOWBPDRZSMB-BQYQJAHWSA-N 0.000 description 1
- LDCRTTXIJACKKU-ONEGZZNKSA-N dimethyl fumarate Chemical compound COC(=O)\C=C\C(=O)OC LDCRTTXIJACKKU-ONEGZZNKSA-N 0.000 description 1
- 229960004419 dimethyl fumarate Drugs 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- QYDYPVFESGNLHU-UHFFFAOYSA-N elaidic acid methyl ester Natural products CCCCCCCCC=CCCCCCCCC(=O)OC QYDYPVFESGNLHU-UHFFFAOYSA-N 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- UJRBGZUFZQJUJV-UHFFFAOYSA-N furan-2,5-dione 2-methylpropan-1-ol Chemical compound C(C(C)C)O.C1(C=C/C(=O)O1)=O UJRBGZUFZQJUJV-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- QYDYPVFESGNLHU-KHPPLWFESA-N methyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC QYDYPVFESGNLHU-KHPPLWFESA-N 0.000 description 1
- 229940073769 methyl oleate Drugs 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000003921 particle size analysis Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- TXXHDPDFNKHHGW-ZPUQHVIOSA-N trans,trans-muconic acid Chemical compound OC(=O)\C=C\C=C\C(O)=O TXXHDPDFNKHHGW-ZPUQHVIOSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/17—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrogenation of carbon-to-carbon double or triple bonds
- C07C29/177—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrogenation of carbon-to-carbon double or triple bonds with simultaneous reduction of a carboxy group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/08—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides with the hydroxy or O-metal group of organic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4292074A GB1454440A (en) | 1974-10-03 | 1974-10-03 | Process for the production of butane-1,4-diol from but-2-ene- 1,4-dioic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2543673A1 true DE2543673A1 (de) | 1976-04-15 |
Family
ID=10426556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752543673 Pending DE2543673A1 (de) | 1974-10-03 | 1975-09-30 | Verfahren zur herstellung von 1,4- butandiol aus 2-buten-1,4-dicarbonsaeure |
Country Status (4)
| Country | Link |
|---|---|
| BE (1) | BE834113A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2543673A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2286808A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1454440A (cg-RX-API-DMAC7.html) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2845905A1 (de) * | 1978-10-21 | 1980-04-24 | Huels Chemische Werke Ag | Verfahren zur kontinuierlichen herstellung von butandiol-1,4 |
| US4562283A (en) * | 1983-12-21 | 1985-12-31 | Basf Aktiengesellschaft | Continuous separation of maleic anhydride from gaseous reaction mixtures |
| JPS6115851A (ja) * | 1984-06-26 | 1986-01-23 | バスフ・アクチェンゲゼルシャフト | 1,4‐ブタンジオールの製法 |
| EP0447963A1 (de) * | 1990-03-21 | 1991-09-25 | BASF Aktiengesellschaft | Verfahren zur Herstellung von 1,4-Butandiol |
| WO1999055659A1 (de) * | 1998-04-23 | 1999-11-04 | Basf Aktiengesellschaft | Verfahren zur herstellung von 1,4-butandiol |
| US9776947B2 (en) | 2013-10-14 | 2017-10-03 | Johnson Matthey Davy Technologies Limited | Process for the production of dialkyl succinate from maleic anyhdride |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3106819A1 (de) * | 1981-02-24 | 1982-09-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 1,4-butandiol |
| GB8717989D0 (en) * | 1987-07-29 | 1987-09-03 | Davy Mckee Ltd | Catalyst |
| JP3080703B2 (ja) | 1991-07-17 | 2000-08-28 | 東燃株式会社 | γ‐ブチロラクトンの製造方法 |
| GB9324752D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324786D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324785D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324782D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324753D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324784D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324783D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| GB9324823D0 (en) * | 1993-12-02 | 1994-01-19 | Davy Mckee London | Process |
| DE4431220A1 (de) * | 1994-09-02 | 1996-03-07 | Bayer Ag | Verfahren zur Herstellung von Butandiol-1,4 aus Maleinsäureanhydrid |
| DE19807268A1 (de) * | 1998-02-20 | 1999-08-26 | Basf Ag | Verfahren zur Herstellung von Alkoholen |
| CN113603287B (zh) * | 2021-08-13 | 2023-07-25 | 中化环境科技工程有限公司 | 一种去除分散红染料废水中乙酸的方法 |
-
1974
- 1974-10-03 GB GB4292074A patent/GB1454440A/en not_active Expired
-
1975
- 1975-09-30 DE DE19752543673 patent/DE2543673A1/de active Pending
- 1975-10-02 BE BE1006922A patent/BE834113A/xx unknown
- 1975-10-02 FR FR7530284A patent/FR2286808A1/fr active Granted
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2845905A1 (de) * | 1978-10-21 | 1980-04-24 | Huels Chemische Werke Ag | Verfahren zur kontinuierlichen herstellung von butandiol-1,4 |
| US4562283A (en) * | 1983-12-21 | 1985-12-31 | Basf Aktiengesellschaft | Continuous separation of maleic anhydride from gaseous reaction mixtures |
| JPS6115851A (ja) * | 1984-06-26 | 1986-01-23 | バスフ・アクチェンゲゼルシャフト | 1,4‐ブタンジオールの製法 |
| EP0169396A1 (de) * | 1984-06-26 | 1986-01-29 | BASF Aktiengesellschaft | Verfahren zur Herstellung von 1,4-Butandiol |
| EP0447963A1 (de) * | 1990-03-21 | 1991-09-25 | BASF Aktiengesellschaft | Verfahren zur Herstellung von 1,4-Butandiol |
| US5073650A (en) * | 1990-03-21 | 1991-12-17 | Basf Aktiengesellschaft | Preparation of 1,4-butanediol |
| WO1999055659A1 (de) * | 1998-04-23 | 1999-11-04 | Basf Aktiengesellschaft | Verfahren zur herstellung von 1,4-butandiol |
| US6350924B1 (en) | 1998-04-23 | 2002-02-26 | Basf Aktiengesellschaft | Method for producing 1,4-butanediol |
| US9776947B2 (en) | 2013-10-14 | 2017-10-03 | Johnson Matthey Davy Technologies Limited | Process for the production of dialkyl succinate from maleic anyhdride |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1454440A (en) | 1976-11-03 |
| FR2286808A1 (fr) | 1976-04-30 |
| BE834113A (fr) | 1976-04-02 |
| FR2286808B1 (cg-RX-API-DMAC7.html) | 1978-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2543673A1 (de) | Verfahren zur herstellung von 1,4- butandiol aus 2-buten-1,4-dicarbonsaeure | |
| EP0378756B1 (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Diolen durch katalytische Hydrierung von Dicarbonsäureestern | |
| EP1682480B1 (de) | Verfahren zur herstellung von benzoesäureestern | |
| EP0463434B1 (de) | Verfahren zur Herstellung von monoethylenisch ungesättigten Carbonsäureestern | |
| DE2553959A1 (de) | Katalytisches verfahren zur herstellung von butan-1,4-diol aus 2-buten- 1,4-dicarbonsaeure | |
| DE3611302A1 (de) | Fluorierte, mehrwertige alkohole, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2940751A1 (de) | Verfahren zur reinigung von carbonylierungsprodukten von methylacetat | |
| EP0121760B1 (de) | Verfahren zur Herstellung von 3-Hydroxytetrahydrofuran | |
| DE2518974C2 (de) | Verfahren zur Herstellung von Sorbinsäure | |
| EP0950653B1 (de) | Verfahren zur Herstellung von Kaliummonoethylmalonat | |
| EP0583694B1 (de) | Verfahren zur Herstellung von Cyanessigsäurealkylestern | |
| DE3916402C2 (de) | Verfahren zur Herstellung mehrwertiger aromatischer Alkohole | |
| EP0286981B1 (de) | Verfahren zur Herstellung von Carbonsäuremethylestern | |
| EP0285835A2 (de) | Verfahren zur Direkthydrierung von Butterfett | |
| DE2812365A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und von alpha- cyano- und alpha-aethinylderivaten davon mit carbonsaeuren | |
| DE2111669A1 (de) | Herstellung von Alkoholen | |
| DE3325976C2 (cg-RX-API-DMAC7.html) | ||
| DE1270027B (de) | Verfahren zur Gewinnung von verduennter waessriger Ameisensaeure aus Aldolkondensations-Restlaugen | |
| EP0443391B1 (de) | Verfahren zur Gewinnung von Tetrahydrofuran aus Gemischen, die Tetrahydrofuran, 1,4-Butandiol, gamma-Butyrolacton und Bernsteinsäureester enthalten | |
| DE69706394T2 (de) | Kontinuierliches Verfahren zum Herstellen von Estern | |
| DE3225605C2 (cg-RX-API-DMAC7.html) | ||
| EP0583752A1 (de) | Verfahren zur Herstellung von 1,2:5,6-Di-O-isopropyliden derivaten von Monosacchariden, insbesondere von 1,2-5,6-Diaceton-D-glucose | |
| CH498828A (de) | Verfahren zur Herstellung von Äthylenketalen von y-Ketocarbonsäureestern | |
| DE2845060A1 (de) | Verfahren zur herstellung von estern des m-phenoxybenzylalkohols | |
| DE2043349A1 (en) | Geo2/sb catalyst for colourless polyesters |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |