DE2520381A1 - Neue 5-nitropyrimidinderivate und ihre verwendung in mitteln zur beeinflussung des pflanzenwachstums - Google Patents
Neue 5-nitropyrimidinderivate und ihre verwendung in mitteln zur beeinflussung des pflanzenwachstumsInfo
- Publication number
- DE2520381A1 DE2520381A1 DE19752520381 DE2520381A DE2520381A1 DE 2520381 A1 DE2520381 A1 DE 2520381A1 DE 19752520381 DE19752520381 DE 19752520381 DE 2520381 A DE2520381 A DE 2520381A DE 2520381 A1 DE2520381 A1 DE 2520381A1
- Authority
- DE
- Germany
- Prior art keywords
- nitro
- pyrimidine
- pentyl
- mol
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 230000008635 plant growth Effects 0.000 title claims description 9
- -1 alkyl radical Chemical class 0.000 claims description 54
- 239000004480 active ingredient Substances 0.000 claims description 46
- 241000196324 Embryophyta Species 0.000 claims description 42
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 235000013339 cereals Nutrition 0.000 claims description 11
- NOYDQGFVFOQSAJ-UHFFFAOYSA-N 5-nitropyrimidine Chemical class [O-][N+](=O)C1=CN=CN=C1 NOYDQGFVFOQSAJ-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 230000012010 growth Effects 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- 244000061176 Nicotiana tabacum Species 0.000 claims description 5
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 3
- 241000209504 Poaceae Species 0.000 claims description 2
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000005108 alkenylthio group Chemical group 0.000 claims 1
- 230000033228 biological regulation Effects 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 239000002085 irritant Substances 0.000 claims 1
- 231100000021 irritant Toxicity 0.000 claims 1
- 230000026267 regulation of growth Effects 0.000 claims 1
- 230000001105 regulatory effect Effects 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 74
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 70
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 54
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- 239000000460 chlorine Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 26
- 239000000203 mixture Substances 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000012259 ether extract Substances 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- 239000000839 emulsion Substances 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 150000003230 pyrimidines Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- RBGNCLAOWBJWLD-UHFFFAOYSA-N 4,6-dichloro-2-ethyl-5-nitropyrimidine Chemical compound CCC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 RBGNCLAOWBJWLD-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000005995 Aluminium silicate Substances 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- 235000010469 Glycine max Nutrition 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 6
- 235000012211 aluminium silicate Nutrition 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- PQPFFKCJENSZKL-UHFFFAOYSA-N pentan-3-amine Chemical compound CCC(N)CC PQPFFKCJENSZKL-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 208000002193 Pain Diseases 0.000 description 5
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000002270 dispersing agent Substances 0.000 description 5
- 230000002363 herbicidal effect Effects 0.000 description 5
- 239000004009 herbicide Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 229920000151 polyglycol Polymers 0.000 description 5
- 239000010695 polyglycol Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- WRCDUOJAUJNUGU-UHFFFAOYSA-N 6-chloro-2-ethyl-5-nitro-n-propan-2-ylpyrimidin-4-amine Chemical compound CCC1=NC(Cl)=C([N+]([O-])=O)C(NC(C)C)=N1 WRCDUOJAUJNUGU-UHFFFAOYSA-N 0.000 description 4
- 241000219146 Gossypium Species 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- 238000005377 adsorption chromatography Methods 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- OYMWJQKIGRASTJ-UHFFFAOYSA-N 6-chloro-n-cyclopropyl-2-ethyl-5-nitropyrimidin-4-amine Chemical compound CCC1=NC(Cl)=C([N+]([O-])=O)C(NC2CC2)=N1 OYMWJQKIGRASTJ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- XAWPMCSBONFQEC-UHFFFAOYSA-N 2,4-dichloro-5-nitro-6-propan-2-ylpyrimidine Chemical compound CC(C)C1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O XAWPMCSBONFQEC-UHFFFAOYSA-N 0.000 description 2
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 2
- WMEBBBPWNKSXLF-UHFFFAOYSA-N 2-chloro-5-nitro-n-pentan-3-yl-6-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(Cl)=NC(C(C)C)=C1[N+]([O-])=O WMEBBBPWNKSXLF-UHFFFAOYSA-N 0.000 description 2
- UQOKRDJILZMZKU-UHFFFAOYSA-N 2-nitropyrimidine Chemical class [O-][N+](=O)C1=NC=CC=N1 UQOKRDJILZMZKU-UHFFFAOYSA-N 0.000 description 2
- OPXGPTXSLFZVCA-UHFFFAOYSA-N 4,6-dichloro-2-methyl-5-nitropyrimidine Chemical compound CC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 OPXGPTXSLFZVCA-UHFFFAOYSA-N 0.000 description 2
- GHAWBARMICSLQS-UHFFFAOYSA-N 4,6-dichloro-2-methylsulfanyl-5-nitropyrimidine Chemical compound CSC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 GHAWBARMICSLQS-UHFFFAOYSA-N 0.000 description 2
- YJCAJZCDJPUTJQ-UHFFFAOYSA-N 4,6-dichloro-5-nitro-2-(trifluoromethyl)pyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=C(C(F)(F)F)N=C1Cl YJCAJZCDJPUTJQ-UHFFFAOYSA-N 0.000 description 2
- QLQHMNSOEMZVEV-UHFFFAOYSA-N 4,6-dichloro-5-nitro-2-propan-2-ylpyrimidine Chemical compound CC(C)C1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 QLQHMNSOEMZVEV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 240000004296 Lolium perenne Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000009036 growth inhibition Effects 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NUTVORGGYDQIDD-UHFFFAOYSA-N 1-ethylsulfanylethanol Chemical compound CCSC(C)O NUTVORGGYDQIDD-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- NBCOZXBHPKSFSA-UHFFFAOYSA-N 2,4-dichloro-6-methyl-5-nitropyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O NBCOZXBHPKSFSA-UHFFFAOYSA-N 0.000 description 1
- XKQCIGUJYRPGNI-UHFFFAOYSA-N 2,6-diethoxy-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCOC1=NC(NC(CC)CC)=C([N+]([O-])=O)C(OCC)=N1 XKQCIGUJYRPGNI-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- JNBSKCDUWHAODZ-UHFFFAOYSA-N 2-butyl-4,6-dichloro-5-nitropyrimidine Chemical compound CCCCC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 JNBSKCDUWHAODZ-UHFFFAOYSA-N 0.000 description 1
- VEGDTJSOPAFRPY-UHFFFAOYSA-N 2-butyl-6-chloro-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCCCC1=NC(Cl)=C([N+]([O-])=O)C(NC(CC)CC)=N1 VEGDTJSOPAFRPY-UHFFFAOYSA-N 0.000 description 1
- RXXOFJDSHUEKPM-UHFFFAOYSA-N 2-ethoxy-5-nitropyrimidine Chemical compound CCOC1=NC=C([N+]([O-])=O)C=N1 RXXOFJDSHUEKPM-UHFFFAOYSA-N 0.000 description 1
- VSCUCHUDCLERMY-UHFFFAOYSA-N 2-ethoxybutane Chemical compound CCOC(C)CC VSCUCHUDCLERMY-UHFFFAOYSA-N 0.000 description 1
- LNRIEBFNWGMXKP-UHFFFAOYSA-N 2-ethylsulfanylethanol Chemical compound CCSCCO LNRIEBFNWGMXKP-UHFFFAOYSA-N 0.000 description 1
- JKQBSRGIAUESBM-UHFFFAOYSA-N 2-methoxy-5-nitro-n-pentan-3-yl-6-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(OC)=NC(C(C)C)=C1[N+]([O-])=O JKQBSRGIAUESBM-UHFFFAOYSA-N 0.000 description 1
- ANPFECTUZFYWFI-UHFFFAOYSA-N 2-methylsulfanyl-5-nitro-n-pentan-3-yl-6-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(SC)=NC(C(C)C)=C1[N+]([O-])=O ANPFECTUZFYWFI-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FOGYNLXERPKEGN-UHFFFAOYSA-N 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid Chemical compound COC1=CC=CC(CC(CS(O)(=O)=O)OC=2C(=CC(CCCS(O)(=O)=O)=CC=2)OC)=C1O FOGYNLXERPKEGN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SMHDBCKFPUPUIE-UHFFFAOYSA-N 4,6-dichloro-5-nitro-2-propylpyrimidine Chemical compound CCCC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 SMHDBCKFPUPUIE-UHFFFAOYSA-N 0.000 description 1
- HCTISZQLTGAYOX-UHFFFAOYSA-N 4,6-dichloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=CN=C1Cl HCTISZQLTGAYOX-UHFFFAOYSA-N 0.000 description 1
- DUFGYCAXVIUXIP-UHFFFAOYSA-N 4,6-dihydroxypyrimidine Chemical class OC1=CC(O)=NC=N1 DUFGYCAXVIUXIP-UHFFFAOYSA-N 0.000 description 1
- CPLTUVUVJVLHMF-UHFFFAOYSA-N 4-chloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=CN=CN=C1Cl CPLTUVUVJVLHMF-UHFFFAOYSA-N 0.000 description 1
- JTNFCNXZXZMCBY-UHFFFAOYSA-N 4-methyl-5-nitropyrimidine Chemical compound CC1=NC=NC=C1[N+]([O-])=O JTNFCNXZXZMCBY-UHFFFAOYSA-N 0.000 description 1
- PVZYYMYZWPILOC-UHFFFAOYSA-N 5-nitro-6-propan-2-yl-1h-pyrimidine-2,4-dione Chemical compound CC(C)C=1NC(=O)NC(=O)C=1[N+]([O-])=O PVZYYMYZWPILOC-UHFFFAOYSA-N 0.000 description 1
- IUPXWOAZKBCBLN-UHFFFAOYSA-N 5-nitropyrimidin-4-amine Chemical class NC1=NC=NC=C1[N+]([O-])=O IUPXWOAZKBCBLN-UHFFFAOYSA-N 0.000 description 1
- XKBSRDXOGJGSKR-UHFFFAOYSA-N 6-chloro-2-methyl-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(C)=NC(Cl)=C1[N+]([O-])=O XKBSRDXOGJGSKR-UHFFFAOYSA-N 0.000 description 1
- GWOXMJMLRBZMPA-UHFFFAOYSA-N 6-chloro-2-methylsulfanyl-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(SC)=NC(Cl)=C1[N+]([O-])=O GWOXMJMLRBZMPA-UHFFFAOYSA-N 0.000 description 1
- NVOIMFJQRBPZDN-UHFFFAOYSA-N 6-chloro-2-methylsulfanyl-5-nitro-n-propan-2-ylpyrimidin-4-amine Chemical compound CSC1=NC(Cl)=C([N+]([O-])=O)C(NC(C)C)=N1 NVOIMFJQRBPZDN-UHFFFAOYSA-N 0.000 description 1
- DVHVWBZICJBDLP-UHFFFAOYSA-N 6-chloro-5-nitro-n-pentan-3-yl-2-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(C(C)C)=NC(Cl)=C1[N+]([O-])=O DVHVWBZICJBDLP-UHFFFAOYSA-N 0.000 description 1
- ZHHKGQSQHPZWRK-UHFFFAOYSA-N 6-chloro-n,2-diethyl-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(CC)=NC(Cl)=C1[N+]([O-])=O ZHHKGQSQHPZWRK-UHFFFAOYSA-N 0.000 description 1
- SSHOLUMMTRPGOA-UHFFFAOYSA-N 6-chloro-n-ethyl-2-methylsulfanyl-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(SC)=NC(Cl)=C1[N+]([O-])=O SSHOLUMMTRPGOA-UHFFFAOYSA-N 0.000 description 1
- UBZQKNLAOBUZMO-UHFFFAOYSA-N 6-chloro-n-ethyl-5-nitro-2-(trifluoromethyl)pyrimidin-4-amine Chemical compound CCNC1=NC(C(F)(F)F)=NC(Cl)=C1[N+]([O-])=O UBZQKNLAOBUZMO-UHFFFAOYSA-N 0.000 description 1
- DQIKTXUQOOFXHB-UHFFFAOYSA-N 6-cyclopropyloxy-2-methyl-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(C)=NC(OC2CC2)=C1[N+]([O-])=O DQIKTXUQOOFXHB-UHFFFAOYSA-N 0.000 description 1
- IIOGRFLQNPYQDG-UHFFFAOYSA-N 6-ethoxy-n-ethyl-2-methylsulfanyl-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(SC)=NC(OCC)=C1[N+]([O-])=O IIOGRFLQNPYQDG-UHFFFAOYSA-N 0.000 description 1
- GWEJPUMJAQFCBN-UHFFFAOYSA-N 6-hydroxy-1h-pyrimidine-2,4-dione Chemical class OC1=CC(=O)NC(=O)N1 GWEJPUMJAQFCBN-UHFFFAOYSA-N 0.000 description 1
- QPIMNPVKIBHLPU-UHFFFAOYSA-N 6-propan-2-yl-1h-pyrimidine-2,4-dione Chemical compound CC(C)C1=CC(=O)NC(=O)N1 QPIMNPVKIBHLPU-UHFFFAOYSA-N 0.000 description 1
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000006463 Brassica alba Nutrition 0.000 description 1
- 244000140786 Brassica hirta Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241000410074 Festuca ovina Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 241001495448 Impatiens <genus> Species 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 241000209049 Poa pratensis Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 241000857233 Rottboellia Species 0.000 description 1
- 244000082988 Secale cereale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 241000404546 Soliva Species 0.000 description 1
- 240000003829 Sorghum propinquum Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 240000001949 Taraxacum officinale Species 0.000 description 1
- 235000005187 Taraxacum officinale ssp. officinale Nutrition 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000863032 Trieres Species 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 241001520823 Zoysia Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- SXQXMCWCWVCFPC-UHFFFAOYSA-N aluminum;potassium;dioxido(oxo)silane Chemical compound [Al+3].[K+].[O-][Si]([O-])=O.[O-][Si]([O-])=O SXQXMCWCWVCFPC-UHFFFAOYSA-N 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000034303 cell budding Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000019993 champagne Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- CMKBCTPCXZNQKX-UHFFFAOYSA-N cyclohexanethiol Chemical compound SC1CCCCC1 CMKBCTPCXZNQKX-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- NVVZQXQBYZPMLJ-UHFFFAOYSA-N formaldehyde;naphthalene-1-sulfonic acid Chemical compound O=C.C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 NVVZQXQBYZPMLJ-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000005094 fruit set Effects 0.000 description 1
- 235000012055 fruits and vegetables Nutrition 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical class CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229930190166 impatien Natural products 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000010807 litter Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- XHXXWWGGXFUMAJ-UHFFFAOYSA-N methanethiol;sodium Chemical compound [Na].SC XHXXWWGGXFUMAJ-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- UMARQXAMNHQGLQ-UHFFFAOYSA-N n-ethyl-2,6-bis(methylsulfanyl)-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(SC)=NC(SC)=C1[N+]([O-])=O UMARQXAMNHQGLQ-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- QLPJYKPJILNGCP-UHFFFAOYSA-N n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=CC=NC=N1 QLPJYKPJILNGCP-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CJYBMNVOWYJIOQ-UHFFFAOYSA-N n-propylpyrimidin-2-amine Chemical compound CCCNC1=NC=CC=N1 CJYBMNVOWYJIOQ-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 235000006286 nutrient intake Nutrition 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AQIXEPGDORPWBJ-UHFFFAOYSA-N pentan-3-ol Chemical compound CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical class OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- OYRRZWATULMEPF-UHFFFAOYSA-N pyrimidin-4-amine Chemical class NC1=CC=NC=N1 OYRRZWATULMEPF-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- SRAWNDFHGTVUNZ-UHFFFAOYSA-M sodium;3,6-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(CCCC)=CC2=CC(CCCC)=CC=C21 SRAWNDFHGTVUNZ-UHFFFAOYSA-M 0.000 description 1
- SLQXUIRYBQDRRB-UHFFFAOYSA-N sodium;cyclopentanolate Chemical compound [Na+].[O-]C1CCCC1 SLQXUIRYBQDRRB-UHFFFAOYSA-N 0.000 description 1
- XPPNOKDUODWJDF-UHFFFAOYSA-N sodium;cyclopropanolate Chemical compound [Na+].[O-]C1CC1 XPPNOKDUODWJDF-UHFFFAOYSA-N 0.000 description 1
- KPGNTWPHBLZNCH-UHFFFAOYSA-N sodium;prop-2-en-1-olate Chemical compound [Na+].[O-]CC=C KPGNTWPHBLZNCH-UHFFFAOYSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/553—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with halogen atoms or nitro radicals directly attached to ring carbon atoms, e.g. fluorouracil
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/56—One oxygen atom and one sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/58—Two sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH642674A CH595061A5 (enExample) | 1974-05-10 | 1974-05-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2520381A1 true DE2520381A1 (de) | 1975-11-20 |
Family
ID=4309440
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752520381 Ceased DE2520381A1 (de) | 1974-05-10 | 1975-05-07 | Neue 5-nitropyrimidinderivate und ihre verwendung in mitteln zur beeinflussung des pflanzenwachstums |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4014677A (enExample) |
| JP (1) | JPS50155624A (enExample) |
| AT (1) | AT344750B (enExample) |
| AU (1) | AU498132B2 (enExample) |
| BE (1) | BE828869A (enExample) |
| CA (1) | CA1042890A (enExample) |
| CH (1) | CH595061A5 (enExample) |
| DE (1) | DE2520381A1 (enExample) |
| ES (1) | ES437518A1 (enExample) |
| FR (1) | FR2270249B1 (enExample) |
| GB (1) | GB1501935A (enExample) |
| IL (1) | IL47256A (enExample) |
| NL (1) | NL7505503A (enExample) |
| ZA (1) | ZA752999B (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005984A1 (en) * | 1978-05-30 | 1979-12-12 | Smith Kline & French Laboratories Limited | Nitro compounds, processes for preparing them and compositions containing them |
| US4405624A (en) * | 1978-05-30 | 1983-09-20 | Smith Kline & French Laboratories Limited | Nitro-substituted dihydropyrroles and tetrahydropyridines, compositions, compounds, and medicinal use |
| EP0132826A1 (de) * | 1983-07-25 | 1985-02-13 | Ciba-Geigy Ag | N-(2-Nitrophenyl)-5-aminopyrimidin-Derivate, deren Herstellung und Verwendung |
| EP0384370A1 (de) * | 1989-02-22 | 1990-08-29 | Hoechst Aktiengesellschaft | Substituierte Pyrimidin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Tool |
| WO2000063182A3 (de) * | 1999-04-20 | 2001-10-11 | Bayer Ag | 2,4-diamino-pyrimidin-derivate und ihre verwendung als mikrobizide und heribizide |
| WO2006136442A1 (en) * | 2005-06-23 | 2006-12-28 | Novartis Ag | Pyrimidine derivatives for the treatment op gaba b mediated nervous system disorders |
| EP2229813A1 (de) * | 2009-03-21 | 2010-09-22 | Bayer CropScience AG | Pyrimidin-4-ylpropandinitril-derivate, Verfahren zu deren Herstellung sowie deren Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4560402A (en) * | 1979-08-15 | 1985-12-24 | Ciba Geigy Corporation | 2,4-Diamo-5-(alkylsulfinyl) or alkylsulphonyl)-6-halopyrimidines |
| US4402730A (en) * | 1980-01-25 | 1983-09-06 | Sandoz Ltd. | Pyrimidine derivatives and their use as herbicides |
| US4505910A (en) * | 1983-06-30 | 1985-03-19 | American Home Products Corporation | Amino-pyrimidine derivatives, compositions and use |
| TWI355894B (en) | 2003-12-19 | 2012-01-11 | Du Pont | Herbicidal pyrimidines |
| ZA200604258B (en) * | 2003-12-19 | 2008-07-30 | Du Pont | Herbicidal pyrimidines |
| WO2007120706A2 (en) * | 2006-04-10 | 2007-10-25 | E. I. Du Pont De Nemours And Company | Herbicidal mixtures |
| GB0725218D0 (en) * | 2007-12-24 | 2008-02-06 | Syngenta Ltd | Chemical compounds |
| WO2010077613A1 (en) * | 2008-12-09 | 2010-07-08 | Gilead Sciences, Inc. | Modulators of toll-like receptors |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3126271A (en) * | 1964-03-24 | Method of controlling weeds | ||
| US3118754A (en) * | 1961-10-10 | 1964-01-21 | Pfizer & Co C | Process for stimulating plant growth |
| US3382247A (en) * | 1965-11-01 | 1968-05-07 | Upjohn Co | 6-amino-1, 2-dihydro-1-hydroxy-2-imino-4-phenoxypyrimidines |
| US3806333A (en) * | 1969-04-02 | 1974-04-23 | Monsanto Chemicals | Herbicidal composition and method employing pyridine derivatives |
| CH558137A (de) * | 1971-05-17 | 1975-01-31 | Ciba Geigy Ag | Mittel zur beeinflussung des pflanzenwachstums. |
| US3926997A (en) * | 1971-05-17 | 1975-12-16 | Ciba Geigy Corp | 2-Alkylthio-4,6-bis(substituted amino)-5-nitropyrimidines |
| CH574206A5 (enExample) * | 1972-11-16 | 1976-04-15 | Ciba Geigy Ag |
-
1974
- 1974-05-10 CH CH642674A patent/CH595061A5/xx not_active IP Right Cessation
-
1975
- 1975-05-07 FR FR7514416A patent/FR2270249B1/fr not_active Expired
- 1975-05-07 US US05/575,308 patent/US4014677A/en not_active Expired - Lifetime
- 1975-05-07 DE DE19752520381 patent/DE2520381A1/de not_active Ceased
- 1975-05-08 IL IL47256A patent/IL47256A/xx unknown
- 1975-05-08 CA CA226,551A patent/CA1042890A/en not_active Expired
- 1975-05-09 ES ES437518A patent/ES437518A1/es not_active Expired
- 1975-05-09 AT AT355675A patent/AT344750B/de not_active IP Right Cessation
- 1975-05-09 ZA ZA00752999A patent/ZA752999B/xx unknown
- 1975-05-09 BE BE156175A patent/BE828869A/xx unknown
- 1975-05-09 NL NL7505503A patent/NL7505503A/xx not_active Application Discontinuation
- 1975-05-09 GB GB19641/75A patent/GB1501935A/en not_active Expired
- 1975-05-10 JP JP50056686A patent/JPS50155624A/ja active Pending
- 1975-05-12 AU AU81055/75A patent/AU498132B2/en not_active Expired
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005984A1 (en) * | 1978-05-30 | 1979-12-12 | Smith Kline & French Laboratories Limited | Nitro compounds, processes for preparing them and compositions containing them |
| US4405624A (en) * | 1978-05-30 | 1983-09-20 | Smith Kline & French Laboratories Limited | Nitro-substituted dihydropyrroles and tetrahydropyridines, compositions, compounds, and medicinal use |
| US4656176A (en) * | 1978-05-30 | 1987-04-07 | Smithkline & French Laboratories Limited | 2-thiazolyl, oxazolyl, triazolyl and thiadiazolyl alkylamino-3-nitro-heterocyclic compounds |
| EP0132826A1 (de) * | 1983-07-25 | 1985-02-13 | Ciba-Geigy Ag | N-(2-Nitrophenyl)-5-aminopyrimidin-Derivate, deren Herstellung und Verwendung |
| US4840662A (en) * | 1983-07-25 | 1989-06-20 | Ciba-Geigy Corporation | N-(2-nitrophenyl)-5-aminopyrimidine derivatives and useful for controlling harmful micro-organisms |
| EP0384370A1 (de) * | 1989-02-22 | 1990-08-29 | Hoechst Aktiengesellschaft | Substituierte Pyrimidin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Tool |
| US5138058A (en) * | 1989-02-22 | 1992-08-11 | Hoechst Aktiengesellschaft | Piperazine substituted pyrimidine derivatives and physiologically tolerated salts thereof |
| WO2000063182A3 (de) * | 1999-04-20 | 2001-10-11 | Bayer Ag | 2,4-diamino-pyrimidin-derivate und ihre verwendung als mikrobizide und heribizide |
| WO2006136442A1 (en) * | 2005-06-23 | 2006-12-28 | Novartis Ag | Pyrimidine derivatives for the treatment op gaba b mediated nervous system disorders |
| EP2229813A1 (de) * | 2009-03-21 | 2010-09-22 | Bayer CropScience AG | Pyrimidin-4-ylpropandinitril-derivate, Verfahren zu deren Herstellung sowie deren Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
| WO2010108611A1 (de) | 2009-03-21 | 2010-09-30 | Bayer Cropscience Ag | Pyrimidin-4-ylpropandinitril - derivate, verfahren zu deren herstellung sowie deren verwendung als herbizide und pflanzenwachstumsregulatoren |
| US8309557B2 (en) | 2009-03-21 | 2012-11-13 | Bayer Intellectual Property Gmbh | Pyrimidin-4-ylpropanedinitrile derivatives, processes for their preparation and their use as herbicides and plant growth regulators |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2270249A1 (enExample) | 1975-12-05 |
| FR2270249B1 (enExample) | 1978-09-01 |
| CH595061A5 (enExample) | 1978-01-31 |
| ES437518A1 (es) | 1977-01-01 |
| AU498132B2 (en) | 1979-02-15 |
| ZA752999B (en) | 1976-04-28 |
| US4014677A (en) | 1977-03-29 |
| AU8105575A (en) | 1976-11-18 |
| NL7505503A (nl) | 1975-11-12 |
| IL47256A0 (en) | 1975-07-28 |
| ATA355675A (de) | 1977-12-15 |
| JPS50155624A (enExample) | 1975-12-16 |
| CA1042890A (en) | 1978-11-21 |
| GB1501935A (en) | 1978-02-22 |
| BE828869A (fr) | 1975-11-10 |
| AT344750B (de) | 1978-08-10 |
| IL47256A (en) | 1979-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0323487B1 (de) | Heterocyclische verbindungen | |
| EP0436680B1 (de) | Heterocyclische verbindungen | |
| DE2520381A1 (de) | Neue 5-nitropyrimidinderivate und ihre verwendung in mitteln zur beeinflussung des pflanzenwachstums | |
| DE2356644A1 (de) | Mittel zur hemmung des pflanzenwachstums | |
| EP0003114A1 (de) | Herbizid wirksame ungesättigte Ester von 4-(3',5'-Dihalogenpyridyl -(2')-oxy)-alpha-phenoxypropionsäuren, Verfahren zu ihrer Herstellung sowie sie enthaltende herbizide Mittel und deren Verwendung | |
| US4927451A (en) | 3-aryldihydrouracils | |
| EP0473551A1 (de) | 3-Aryluracil-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Unkrautbekämpfungsmittel | |
| DE2734827A1 (de) | Verfahren zum hemmen des wachstums von unerwuenschten pflanzen | |
| EP0103537B1 (de) | N-Arylsulfonyl-N'-triazolylharnstoffe | |
| CH617833A5 (enExample) | ||
| DE2223644A1 (de) | Mittel zur Beeinflussung des Pflanzenwachstums | |
| DD231716A5 (de) | Herbizide mittel | |
| EP0096004B1 (de) | Neue Sulfonyl(thio)harnstoffe, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und/oder Wachstumsregulatoren | |
| EP0300313A2 (de) | Substituierte Triazine | |
| EP0184752A2 (de) | Neue 2,4-Diaminopyrimidine | |
| DE2532767A1 (de) | Triazin-derivate als schaedlingsbekaempfungsmittel | |
| DE2405479C2 (de) | N-substituierte Chloracetanilide, Verfahren zu deren Herstellung und Mittel zur Beeinflussung des Pflanzenwachstums | |
| EP0409369A2 (de) | Substituierte Pyrimidinyloxy-(thio)- und Triazinyloxy(thio)-acrylsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Mittel mit herbizider, fungizider und pflanzenwachstumsregulierender Wirkung | |
| EP0422751B1 (de) | Substituierte 2-Pyrimidinyl- und 2-Triazinylessigsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Mittel mit herbizider, Fungizider und Pflanzenwachstumsregulierender Wirkung | |
| EP0073974A2 (de) | Fluorhaltige 4,6-Diamino-s-triazine, Verfahren und neue Zwischenprodukte zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0049416B1 (de) | Substituierte 6-Halogen-tert.-butyl-1,2,4-triazin-5-one, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2815689A1 (de) | Triazin-verbindungen, verfahren zur herstellung dieser triazin-verbindungen, ferner herbizide mittel | |
| DE2856750A1 (de) | Herbizid wirksame 1.2.4-triazin-5-on- derivate | |
| EP0065189B1 (de) | Heterocyclische Dihalogenacetamide, Verfahren zu ihrer Herstellung und herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Dihalogenacetamide als antagonistische Mittel enthalten | |
| EP0024260B1 (de) | Neue Pyrimidin-Verbindungen, deren Herstellung, Zwischenprodukte dazu und herbizide Mittel, welche die Pyrimidinverbindungen als Wirkstoffe enthalten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR |
|
| 8131 | Rejection |