CA1042890A - 5-nitropyrimidine derivatives and their use in agents for influencing plant growth - Google Patents
5-nitropyrimidine derivatives and their use in agents for influencing plant growthInfo
- Publication number
- CA1042890A CA1042890A CA226,551A CA226551A CA1042890A CA 1042890 A CA1042890 A CA 1042890A CA 226551 A CA226551 A CA 226551A CA 1042890 A CA1042890 A CA 1042890A
- Authority
- CA
- Canada
- Prior art keywords
- nitro
- radical
- carbon atoms
- pyrimidine
- pentyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NOYDQGFVFOQSAJ-UHFFFAOYSA-N 5-nitropyrimidine Chemical class [O-][N+](=O)C1=CN=CN=C1 NOYDQGFVFOQSAJ-UHFFFAOYSA-N 0.000 title claims abstract description 8
- 230000008635 plant growth Effects 0.000 title claims description 6
- 241000196324 Embryophyta Species 0.000 claims abstract description 41
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 30
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 15
- 230000012010 growth Effects 0.000 claims abstract description 13
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 241000252254 Catostomidae Species 0.000 claims abstract description 10
- 235000013339 cereals Nutrition 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims abstract description 3
- 125000000000 cycloalkoxy group Chemical group 0.000 claims abstract description 3
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 2
- -1 alkyl radical Chemical class 0.000 claims description 55
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 16
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- 244000061176 Nicotiana tabacum Species 0.000 claims description 4
- 241000209504 Poaceae Species 0.000 claims description 4
- 244000038559 crop plants Species 0.000 claims description 4
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 claims description 2
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 28
- 239000002253 acid Substances 0.000 abstract description 15
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 2
- 125000004663 dialkyl amino group Chemical group 0.000 abstract description 2
- 125000005108 alkenylthio group Chemical group 0.000 abstract 1
- 125000005366 cycloalkylthio group Chemical group 0.000 abstract 1
- 230000003467 diminishing effect Effects 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 67
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 54
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 51
- 239000013543 active substance Substances 0.000 description 50
- 239000000243 solution Substances 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- 239000000460 chlorine Substances 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000003921 oil Substances 0.000 description 19
- 229940086542 triethylamine Drugs 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 238000000605 extraction Methods 0.000 description 9
- 244000025254 Cannabis sativa Species 0.000 description 8
- 239000000969 carrier Substances 0.000 description 8
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 239000005995 Aluminium silicate Substances 0.000 description 6
- 244000068988 Glycine max Species 0.000 description 6
- 235000010469 Glycine max Nutrition 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000000370 acceptor Substances 0.000 description 6
- 235000012211 aluminium silicate Nutrition 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000006072 paste Substances 0.000 description 6
- PQPFFKCJENSZKL-UHFFFAOYSA-N pentan-3-amine Chemical compound CCC(N)CC PQPFFKCJENSZKL-UHFFFAOYSA-N 0.000 description 6
- 229920001223 polyethylene glycol Polymers 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 150000003230 pyrimidines Chemical class 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000002202 Polyethylene glycol Substances 0.000 description 5
- 239000002270 dispersing agent Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000004009 herbicide Substances 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- RBGNCLAOWBJWLD-UHFFFAOYSA-N 4,6-dichloro-2-ethyl-5-nitropyrimidine Chemical compound CCC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 RBGNCLAOWBJWLD-UHFFFAOYSA-N 0.000 description 4
- OYMWJQKIGRASTJ-UHFFFAOYSA-N 6-chloro-n-cyclopropyl-2-ethyl-5-nitropyrimidin-4-amine Chemical compound CCC1=NC(Cl)=C([N+]([O-])=O)C(NC2CC2)=N1 OYMWJQKIGRASTJ-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- 241000219146 Gossypium Species 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 238000005377 adsorption chromatography Methods 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UQOKRDJILZMZKU-UHFFFAOYSA-N 2-nitropyrimidine Chemical class [O-][N+](=O)C1=NC=CC=N1 UQOKRDJILZMZKU-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- CFKQSPVFOGYDJD-UHFFFAOYSA-N n-butyl-4-methyl-5-nitropyrimidin-2-amine Chemical compound CCCCNC1=NC=C([N+]([O-])=O)C(C)=N1 CFKQSPVFOGYDJD-UHFFFAOYSA-N 0.000 description 3
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 2
- WMEBBBPWNKSXLF-UHFFFAOYSA-N 2-chloro-5-nitro-n-pentan-3-yl-6-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(Cl)=NC(C(C)C)=C1[N+]([O-])=O WMEBBBPWNKSXLF-UHFFFAOYSA-N 0.000 description 2
- YJCAJZCDJPUTJQ-UHFFFAOYSA-N 4,6-dichloro-5-nitro-2-(trifluoromethyl)pyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=C(C(F)(F)F)N=C1Cl YJCAJZCDJPUTJQ-UHFFFAOYSA-N 0.000 description 2
- QLQHMNSOEMZVEV-UHFFFAOYSA-N 4,6-dichloro-5-nitro-2-propan-2-ylpyrimidine Chemical compound CC(C)C1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 QLQHMNSOEMZVEV-UHFFFAOYSA-N 0.000 description 2
- PVZYYMYZWPILOC-UHFFFAOYSA-N 5-nitro-6-propan-2-yl-1h-pyrimidine-2,4-dione Chemical compound CC(C)C=1NC(=O)NC(=O)C=1[N+]([O-])=O PVZYYMYZWPILOC-UHFFFAOYSA-N 0.000 description 2
- WRCDUOJAUJNUGU-UHFFFAOYSA-N 6-chloro-2-ethyl-5-nitro-n-propan-2-ylpyrimidin-4-amine Chemical compound CCC1=NC(Cl)=C([N+]([O-])=O)C(NC(C)C)=N1 WRCDUOJAUJNUGU-UHFFFAOYSA-N 0.000 description 2
- ZHHKGQSQHPZWRK-UHFFFAOYSA-N 6-chloro-n,2-diethyl-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(CC)=NC(Cl)=C1[N+]([O-])=O ZHHKGQSQHPZWRK-UHFFFAOYSA-N 0.000 description 2
- IIOGRFLQNPYQDG-UHFFFAOYSA-N 6-ethoxy-n-ethyl-2-methylsulfanyl-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(SC)=NC(OCC)=C1[N+]([O-])=O IIOGRFLQNPYQDG-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 240000004296 Lolium perenne Species 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 2
- 239000002518 antifoaming agent Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 229940105329 carboxymethylcellulose Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 235000021186 dishes Nutrition 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 230000009036 growth inhibition Effects 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 231100000208 phytotoxic Toxicity 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- 235000012219 potassium aluminium silicate Nutrition 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- JCRNSBKSAQHNIN-UHFFFAOYSA-N 2,4-dibutylnaphthalene-1-sulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(CCCC)=CC(CCCC)=C21 JCRNSBKSAQHNIN-UHFFFAOYSA-N 0.000 description 1
- NBCOZXBHPKSFSA-UHFFFAOYSA-N 2,4-dichloro-6-methyl-5-nitropyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O NBCOZXBHPKSFSA-UHFFFAOYSA-N 0.000 description 1
- XKQCIGUJYRPGNI-UHFFFAOYSA-N 2,6-diethoxy-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCOC1=NC(NC(CC)CC)=C([N+]([O-])=O)C(OCC)=N1 XKQCIGUJYRPGNI-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- UTEBQRZTQJELFL-UHFFFAOYSA-N 2-butyl-6-ethoxy-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCCCC1=NC(NC(CC)CC)=C([N+]([O-])=O)C(OCC)=N1 UTEBQRZTQJELFL-UHFFFAOYSA-N 0.000 description 1
- OFCBNMYNAHUDGE-UHFFFAOYSA-N 2-chloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=CN=C(Cl)N=C1 OFCBNMYNAHUDGE-UHFFFAOYSA-N 0.000 description 1
- LNRIEBFNWGMXKP-UHFFFAOYSA-N 2-ethylsulfanylethanol Chemical compound CCSCCO LNRIEBFNWGMXKP-UHFFFAOYSA-N 0.000 description 1
- IULJSGIJJZZUMF-UHFFFAOYSA-N 2-hydroxybenzenesulfonic acid Chemical compound OC1=CC=CC=C1S(O)(=O)=O IULJSGIJJZZUMF-UHFFFAOYSA-N 0.000 description 1
- JKQBSRGIAUESBM-UHFFFAOYSA-N 2-methoxy-5-nitro-n-pentan-3-yl-6-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(OC)=NC(C(C)C)=C1[N+]([O-])=O JKQBSRGIAUESBM-UHFFFAOYSA-N 0.000 description 1
- ASQUQUOEFDHYGP-UHFFFAOYSA-N 2-methoxyethanolate Chemical compound COCC[O-] ASQUQUOEFDHYGP-UHFFFAOYSA-N 0.000 description 1
- ANPFECTUZFYWFI-UHFFFAOYSA-N 2-methylsulfanyl-5-nitro-n-pentan-3-yl-6-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(SC)=NC(C(C)C)=C1[N+]([O-])=O ANPFECTUZFYWFI-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- PXHGIJXICPQDQB-UHFFFAOYSA-N 4,6-dichloro-3-nitro-2-propan-2-ylpyridine Chemical compound CC(C)C1=NC(Cl)=CC(Cl)=C1[N+]([O-])=O PXHGIJXICPQDQB-UHFFFAOYSA-N 0.000 description 1
- HCTISZQLTGAYOX-UHFFFAOYSA-N 4,6-dichloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=CN=C1Cl HCTISZQLTGAYOX-UHFFFAOYSA-N 0.000 description 1
- SFKXPXMIMNGHLS-UHFFFAOYSA-N 4,6-dichloro-n,n-dimethyl-5-nitropyrimidin-2-amine Chemical compound CN(C)C1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 SFKXPXMIMNGHLS-UHFFFAOYSA-N 0.000 description 1
- YDYDQRORJGNHQK-UHFFFAOYSA-N 4-chloro-2-nitropyrimidine Chemical compound [O-][N+](=O)C1=NC=CC(Cl)=N1 YDYDQRORJGNHQK-UHFFFAOYSA-N 0.000 description 1
- YVIKOQTWBLFBGQ-UHFFFAOYSA-N 4-chloro-6-methyl-5-nitropyrimidine Chemical compound CC1=NC=NC(Cl)=C1[N+]([O-])=O YVIKOQTWBLFBGQ-UHFFFAOYSA-N 0.000 description 1
- JTNFCNXZXZMCBY-UHFFFAOYSA-N 4-methyl-5-nitropyrimidine Chemical compound CC1=NC=NC=C1[N+]([O-])=O JTNFCNXZXZMCBY-UHFFFAOYSA-N 0.000 description 1
- IUPXWOAZKBCBLN-UHFFFAOYSA-N 5-nitropyrimidin-4-amine Chemical class NC1=NC=NC=C1[N+]([O-])=O IUPXWOAZKBCBLN-UHFFFAOYSA-N 0.000 description 1
- KUCFBGFPXUXWBQ-UHFFFAOYSA-N 5-nitropyrimidine-4,6-diamine Chemical class NC1=NC=NC(N)=C1[N+]([O-])=O KUCFBGFPXUXWBQ-UHFFFAOYSA-N 0.000 description 1
- XKBSRDXOGJGSKR-UHFFFAOYSA-N 6-chloro-2-methyl-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(C)=NC(Cl)=C1[N+]([O-])=O XKBSRDXOGJGSKR-UHFFFAOYSA-N 0.000 description 1
- GWOXMJMLRBZMPA-UHFFFAOYSA-N 6-chloro-2-methylsulfanyl-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(SC)=NC(Cl)=C1[N+]([O-])=O GWOXMJMLRBZMPA-UHFFFAOYSA-N 0.000 description 1
- NVOIMFJQRBPZDN-UHFFFAOYSA-N 6-chloro-2-methylsulfanyl-5-nitro-n-propan-2-ylpyrimidin-4-amine Chemical compound CSC1=NC(Cl)=C([N+]([O-])=O)C(NC(C)C)=N1 NVOIMFJQRBPZDN-UHFFFAOYSA-N 0.000 description 1
- DVHVWBZICJBDLP-UHFFFAOYSA-N 6-chloro-5-nitro-n-pentan-3-yl-2-propan-2-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(C(C)C)=NC(Cl)=C1[N+]([O-])=O DVHVWBZICJBDLP-UHFFFAOYSA-N 0.000 description 1
- SSHOLUMMTRPGOA-UHFFFAOYSA-N 6-chloro-n-ethyl-2-methylsulfanyl-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(SC)=NC(Cl)=C1[N+]([O-])=O SSHOLUMMTRPGOA-UHFFFAOYSA-N 0.000 description 1
- DQIKTXUQOOFXHB-UHFFFAOYSA-N 6-cyclopropyloxy-2-methyl-5-nitro-n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=NC(C)=NC(OC2CC2)=C1[N+]([O-])=O DQIKTXUQOOFXHB-UHFFFAOYSA-N 0.000 description 1
- HBICHOFXJIQFHY-UHFFFAOYSA-N 6-ethoxy-5-nitro-n-pentan-3-yl-2-propan-2-ylpyrimidin-4-amine Chemical compound CCOC1=NC(C(C)C)=NC(NC(CC)CC)=C1[N+]([O-])=O HBICHOFXJIQFHY-UHFFFAOYSA-N 0.000 description 1
- QPIMNPVKIBHLPU-UHFFFAOYSA-N 6-propan-2-yl-1h-pyrimidine-2,4-dione Chemical compound CC(C)C1=CC(=O)NC(=O)N1 QPIMNPVKIBHLPU-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000006463 Brassica alba Nutrition 0.000 description 1
- 244000140786 Brassica hirta Species 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 101100520660 Drosophila melanogaster Poc1 gene Proteins 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241000410074 Festuca ovina Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- HSRJKNPTNIJEKV-UHFFFAOYSA-N Guaifenesin Chemical compound COC1=CC=CC=C1OCC(O)CO HSRJKNPTNIJEKV-UHFFFAOYSA-N 0.000 description 1
- 241001365546 Gymnodinium impatiens Species 0.000 description 1
- 229910004039 HBF4 Inorganic materials 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000010624 Medicago sativa Nutrition 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229910020656 PBr5 Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 241000209049 Poa pratensis Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000857233 Rottboellia Species 0.000 description 1
- 101100520662 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PBA1 gene Proteins 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 240000003829 Sorghum propinquum Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 240000001949 Taraxacum officinale Species 0.000 description 1
- 235000005187 Taraxacum officinale ssp. officinale Nutrition 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940115440 aluminum sodium silicate Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000019993 champagne Nutrition 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000007931 coated granule Substances 0.000 description 1
- 239000000306 component Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- CMKBCTPCXZNQKX-UHFFFAOYSA-N cyclohexanethiol Chemical compound SC1CCCCC1 CMKBCTPCXZNQKX-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- DYFIVHNTJCEYOT-UHFFFAOYSA-L disodium;1,2-dibutylnaphthalene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.C1=CC=CC2=C(CCCC)C(CCCC)=CC=C21 DYFIVHNTJCEYOT-UHFFFAOYSA-L 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 230000028245 fruit abscission Effects 0.000 description 1
- 235000012055 fruits and vegetables Nutrition 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical class CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- XHXXWWGGXFUMAJ-UHFFFAOYSA-N methanethiol;sodium Chemical compound [Na].SC XHXXWWGGXFUMAJ-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000004370 n-butenyl group Chemical group [H]\C([H])=C(/[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IQRPDXWTBWUYGX-UHFFFAOYSA-N n-cyclopropyl-6-ethoxy-2-ethyl-5-nitropyrimidin-4-amine Chemical compound CCOC1=NC(CC)=NC(NC2CC2)=C1[N+]([O-])=O IQRPDXWTBWUYGX-UHFFFAOYSA-N 0.000 description 1
- UMARQXAMNHQGLQ-UHFFFAOYSA-N n-ethyl-2,6-bis(methylsulfanyl)-5-nitropyrimidin-4-amine Chemical compound CCNC1=NC(SC)=NC(SC)=C1[N+]([O-])=O UMARQXAMNHQGLQ-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- QLPJYKPJILNGCP-UHFFFAOYSA-N n-pentan-3-ylpyrimidin-4-amine Chemical compound CCC(CC)NC1=CC=NC=N1 QLPJYKPJILNGCP-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ONZPESXXVCIPSY-UHFFFAOYSA-N n-propan-2-ylpyrimidin-4-amine Chemical compound CC(C)NC1=CC=NC=N1 ONZPESXXVCIPSY-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AQIXEPGDORPWBJ-UHFFFAOYSA-N pentan-3-ol Chemical compound CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000441 potassium aluminium silicate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical class OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000429 sodium aluminium silicate Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- DMISPMWSSHKUGL-UHFFFAOYSA-N sodium;1-ethylsulfanylethanolate Chemical compound [Na+].CCSC(C)[O-] DMISPMWSSHKUGL-UHFFFAOYSA-N 0.000 description 1
- SLQXUIRYBQDRRB-UHFFFAOYSA-N sodium;cyclopentanolate Chemical compound [Na+].[O-]C1CCCC1 SLQXUIRYBQDRRB-UHFFFAOYSA-N 0.000 description 1
- XPPNOKDUODWJDF-UHFFFAOYSA-N sodium;cyclopropanolate Chemical compound [Na+].[O-]C1CC1 XPPNOKDUODWJDF-UHFFFAOYSA-N 0.000 description 1
- KPGNTWPHBLZNCH-UHFFFAOYSA-N sodium;prop-2-en-1-olate Chemical compound [Na+].[O-]CC=C KPGNTWPHBLZNCH-UHFFFAOYSA-N 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/553—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with halogen atoms or nitro radicals directly attached to ring carbon atoms, e.g. fluorouracil
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/56—One oxygen atom and one sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/58—Two sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH642674A CH595061A5 (enExample) | 1974-05-10 | 1974-05-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1042890A true CA1042890A (en) | 1978-11-21 |
Family
ID=4309440
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA226,551A Expired CA1042890A (en) | 1974-05-10 | 1975-05-08 | 5-nitropyrimidine derivatives and their use in agents for influencing plant growth |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4014677A (enExample) |
| JP (1) | JPS50155624A (enExample) |
| AT (1) | AT344750B (enExample) |
| AU (1) | AU498132B2 (enExample) |
| BE (1) | BE828869A (enExample) |
| CA (1) | CA1042890A (enExample) |
| CH (1) | CH595061A5 (enExample) |
| DE (1) | DE2520381A1 (enExample) |
| ES (1) | ES437518A1 (enExample) |
| FR (1) | FR2270249B1 (enExample) |
| GB (1) | GB1501935A (enExample) |
| IL (1) | IL47256A (enExample) |
| NL (1) | NL7505503A (enExample) |
| ZA (1) | ZA752999B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL57416A (en) * | 1978-05-30 | 1983-03-31 | Smith Kline French Lab | Nitro compounds,processes for preparing them and compositions containing them |
| US4405624A (en) * | 1978-05-30 | 1983-09-20 | Smith Kline & French Laboratories Limited | Nitro-substituted dihydropyrroles and tetrahydropyridines, compositions, compounds, and medicinal use |
| US4560402A (en) * | 1979-08-15 | 1985-12-24 | Ciba Geigy Corporation | 2,4-Diamo-5-(alkylsulfinyl) or alkylsulphonyl)-6-halopyrimidines |
| US4402730A (en) * | 1980-01-25 | 1983-09-06 | Sandoz Ltd. | Pyrimidine derivatives and their use as herbicides |
| US4505910A (en) * | 1983-06-30 | 1985-03-19 | American Home Products Corporation | Amino-pyrimidine derivatives, compositions and use |
| PH21918A (en) * | 1983-07-25 | 1988-04-08 | Ciba Geigy Ag | N-(2-nitrophenyl)-5-aminopyrimidine derivatives,the preparation and use thereof |
| DE3905364A1 (de) * | 1989-02-22 | 1990-08-23 | Hoechst Ag | Substituierte pyrimidin-derivate, verfahren zu ihrer herstellung und ihre verwendung als tool |
| DE19917785A1 (de) * | 1999-04-20 | 2000-10-26 | Bayer Ag | 2,4-Diamino-pyrimidin-Derivate |
| TWI355894B (en) | 2003-12-19 | 2012-01-11 | Du Pont | Herbicidal pyrimidines |
| ZA200604258B (en) * | 2003-12-19 | 2008-07-30 | Du Pont | Herbicidal pyrimidines |
| GB0512844D0 (en) * | 2005-06-23 | 2005-08-03 | Novartis Ag | Organic compounds |
| WO2007120706A2 (en) * | 2006-04-10 | 2007-10-25 | E. I. Du Pont De Nemours And Company | Herbicidal mixtures |
| GB0725218D0 (en) * | 2007-12-24 | 2008-02-06 | Syngenta Ltd | Chemical compounds |
| WO2010077613A1 (en) * | 2008-12-09 | 2010-07-08 | Gilead Sciences, Inc. | Modulators of toll-like receptors |
| EP2229813A1 (de) * | 2009-03-21 | 2010-09-22 | Bayer CropScience AG | Pyrimidin-4-ylpropandinitril-derivate, Verfahren zu deren Herstellung sowie deren Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3126271A (en) * | 1964-03-24 | Method of controlling weeds | ||
| US3118754A (en) * | 1961-10-10 | 1964-01-21 | Pfizer & Co C | Process for stimulating plant growth |
| US3382247A (en) * | 1965-11-01 | 1968-05-07 | Upjohn Co | 6-amino-1, 2-dihydro-1-hydroxy-2-imino-4-phenoxypyrimidines |
| US3806333A (en) * | 1969-04-02 | 1974-04-23 | Monsanto Chemicals | Herbicidal composition and method employing pyridine derivatives |
| CH558137A (de) * | 1971-05-17 | 1975-01-31 | Ciba Geigy Ag | Mittel zur beeinflussung des pflanzenwachstums. |
| US3926997A (en) * | 1971-05-17 | 1975-12-16 | Ciba Geigy Corp | 2-Alkylthio-4,6-bis(substituted amino)-5-nitropyrimidines |
| CH574206A5 (enExample) * | 1972-11-16 | 1976-04-15 | Ciba Geigy Ag |
-
1974
- 1974-05-10 CH CH642674A patent/CH595061A5/xx not_active IP Right Cessation
-
1975
- 1975-05-07 FR FR7514416A patent/FR2270249B1/fr not_active Expired
- 1975-05-07 US US05/575,308 patent/US4014677A/en not_active Expired - Lifetime
- 1975-05-07 DE DE19752520381 patent/DE2520381A1/de not_active Ceased
- 1975-05-08 IL IL47256A patent/IL47256A/xx unknown
- 1975-05-08 CA CA226,551A patent/CA1042890A/en not_active Expired
- 1975-05-09 ES ES437518A patent/ES437518A1/es not_active Expired
- 1975-05-09 AT AT355675A patent/AT344750B/de not_active IP Right Cessation
- 1975-05-09 ZA ZA00752999A patent/ZA752999B/xx unknown
- 1975-05-09 BE BE156175A patent/BE828869A/xx unknown
- 1975-05-09 NL NL7505503A patent/NL7505503A/xx not_active Application Discontinuation
- 1975-05-09 GB GB19641/75A patent/GB1501935A/en not_active Expired
- 1975-05-10 JP JP50056686A patent/JPS50155624A/ja active Pending
- 1975-05-12 AU AU81055/75A patent/AU498132B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2270249A1 (enExample) | 1975-12-05 |
| FR2270249B1 (enExample) | 1978-09-01 |
| CH595061A5 (enExample) | 1978-01-31 |
| ES437518A1 (es) | 1977-01-01 |
| AU498132B2 (en) | 1979-02-15 |
| ZA752999B (en) | 1976-04-28 |
| US4014677A (en) | 1977-03-29 |
| AU8105575A (en) | 1976-11-18 |
| NL7505503A (nl) | 1975-11-12 |
| IL47256A0 (en) | 1975-07-28 |
| ATA355675A (de) | 1977-12-15 |
| JPS50155624A (enExample) | 1975-12-16 |
| GB1501935A (en) | 1978-02-22 |
| BE828869A (fr) | 1975-11-10 |
| AT344750B (de) | 1978-08-10 |
| IL47256A (en) | 1979-01-31 |
| DE2520381A1 (de) | 1975-11-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1042890A (en) | 5-nitropyrimidine derivatives and their use in agents for influencing plant growth | |
| US3948914A (en) | 5-Nitropyrimidine derivatives | |
| US4988704A (en) | Pyrimidine derivative, process for preparing same and argicultural or horticultural fungicidal composition containing same | |
| US3823135A (en) | Pyrimidone herbicides | |
| FI95376C (fi) | Mikrobisidiset 2-anilino-pyrimidiinijohdannaiset | |
| WO1989002891A1 (fr) | Composes heterocycliques | |
| HU182473B (en) | Herbicide and growth-inhibiting compositions and process for producing the active agents | |
| AU2423392A (en) | Benzenesulfonamide derivatives as herbicides | |
| US4927451A (en) | 3-aryldihydrouracils | |
| US4116674A (en) | Process of severely damaging or killing unwanted plants with pyrimidine compounds | |
| CA1064493A (en) | Pyrimidine derivatives | |
| CS209533B2 (en) | Herbicide means | |
| DE2223644A1 (de) | Mittel zur Beeinflussung des Pflanzenwachstums | |
| US4220770A (en) | Triazine compounds | |
| CA1053259A (en) | Unsaturated haloacetamides and their use as herbicides and as plant-growth regulators | |
| US4657579A (en) | Novel N-(5-pyrimidinyl)-chloroacetamides | |
| US4459151A (en) | Herbicidally active fluorine-containing 4,6-diamino-s-triazines | |
| US4055411A (en) | Agents for inhibiting plant growth | |
| US4066437A (en) | Triazolidine compounds useful as herbicides | |
| US3926997A (en) | 2-Alkylthio-4,6-bis(substituted amino)-5-nitropyrimidines | |
| EP0457581A1 (en) | Herbicidal sulfonylurea derivatives | |
| US3969101A (en) | Agent for controlling plant growth | |
| FI98914C (fi) | Pestisidiset 2-hydratsiini-pyrimidiinijohdannaiset | |
| US4560402A (en) | 2,4-Diamo-5-(alkylsulfinyl) or alkylsulphonyl)-6-halopyrimidines | |
| US3940391A (en) | 3,4-Dihydro-1,2,4-triazine compounds |