DE2502201A1 - Verfahren zur herstellung von l-alkoxycarbonyl-2-alkoxy-l,2-dihydrochinolinen - Google Patents
Verfahren zur herstellung von l-alkoxycarbonyl-2-alkoxy-l,2-dihydrochinolinenInfo
- Publication number
- DE2502201A1 DE2502201A1 DE19752502201 DE2502201A DE2502201A1 DE 2502201 A1 DE2502201 A1 DE 2502201A1 DE 19752502201 DE19752502201 DE 19752502201 DE 2502201 A DE2502201 A DE 2502201A DE 2502201 A1 DE2502201 A1 DE 2502201A1
- Authority
- DE
- Germany
- Prior art keywords
- water
- quinoline
- acid ester
- aliphatic
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 29
- 238000004519 manufacturing process Methods 0.000 title description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 23
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 18
- -1 aliphatic chlorocarbonic acid ester Chemical class 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 230000003472 neutralizing effect Effects 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 2
- 239000000159 acid neutralizing agent Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 4
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000204801 Muraenidae Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- YMMIPTDBIDNQLD-UHFFFAOYSA-N ethyl 2-hydroxy-2h-quinoline-1-carboxylate Chemical compound C1=CC=C2N(C(=O)OCC)C(O)C=CC2=C1 YMMIPTDBIDNQLD-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- MIAQYFPRVWFWPK-UHFFFAOYSA-N cyclohexa-1,5-diene-1,4-diol Chemical compound OC1CC=C(O)C=C1 MIAQYFPRVWFWPK-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- VNUNSFSBZVGJCV-UHFFFAOYSA-N ethyl 2-[(1-ethoxycarbonyl-2h-quinolin-2-yl)oxy]-2h-quinoline-1-carboxylate Chemical compound C1=CC2=CC=CC=C2N(C(=O)OCC)C1OC1N(C(=O)OCC)C2=CC=CC=C2C=C1 VNUNSFSBZVGJCV-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752502201 DE2502201A1 (de) | 1975-01-21 | 1975-01-21 | Verfahren zur herstellung von l-alkoxycarbonyl-2-alkoxy-l,2-dihydrochinolinen |
| BE1007038A BE836005A (nl) | 1975-01-21 | 1975-11-27 | Werkwijze voor de bereiding van 1-alkoxycarbonyl-2-alkoxy-1,2-dihydrochinolinen |
| CA243,777A CA1074321A (en) | 1975-01-21 | 1976-01-19 | Process for the preparation of 1-alkoxycarbonyl-2-alkoxy-1,2-dihydroquinolines |
| IT4767976A IT1052947B (it) | 1975-01-21 | 1976-01-19 | Procedimento per preparare 1-alcossi carbonil 2 alcossi 1.2 diidrochinoline e prodotti ottenuto |
| CH66576A CH619214A5 (en) | 1975-01-21 | 1976-01-20 | Process for the preparation of optionally substituted 1-alkoxycarbonyl-2-alkoxy-1,2-dihydroquinolines |
| FR7601426A FR2298541A1 (fr) | 1975-01-21 | 1976-01-20 | Procede pour preparer des alcoxycarbonyl-1 alcoxy-2 dihydro-1,2 quinoleines |
| GB213476A GB1520032A (en) | 1975-01-21 | 1976-01-20 | Process for the preparation of 1-alkoxycarbonyl 2 alkoxy 1,2 dihydroquinolines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752502201 DE2502201A1 (de) | 1975-01-21 | 1975-01-21 | Verfahren zur herstellung von l-alkoxycarbonyl-2-alkoxy-l,2-dihydrochinolinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2502201A1 true DE2502201A1 (de) | 1976-07-22 |
Family
ID=5936886
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752502201 Withdrawn DE2502201A1 (de) | 1975-01-21 | 1975-01-21 | Verfahren zur herstellung von l-alkoxycarbonyl-2-alkoxy-l,2-dihydrochinolinen |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE836005A (show.php) |
| CA (1) | CA1074321A (show.php) |
| CH (1) | CH619214A5 (show.php) |
| DE (1) | DE2502201A1 (show.php) |
| FR (1) | FR2298541A1 (show.php) |
| GB (1) | GB1520032A (show.php) |
| IT (1) | IT1052947B (show.php) |
-
1975
- 1975-01-21 DE DE19752502201 patent/DE2502201A1/de not_active Withdrawn
- 1975-11-27 BE BE1007038A patent/BE836005A/xx unknown
-
1976
- 1976-01-19 IT IT4767976A patent/IT1052947B/it active
- 1976-01-19 CA CA243,777A patent/CA1074321A/en not_active Expired
- 1976-01-20 GB GB213476A patent/GB1520032A/en not_active Expired
- 1976-01-20 CH CH66576A patent/CH619214A5/de not_active IP Right Cessation
- 1976-01-20 FR FR7601426A patent/FR2298541A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IT1052947B (it) | 1981-08-31 |
| BE836005A (nl) | 1976-05-28 |
| CA1074321A (en) | 1980-03-25 |
| FR2298541B1 (show.php) | 1979-08-10 |
| GB1520032A (en) | 1978-08-02 |
| FR2298541A1 (fr) | 1976-08-20 |
| CH619214A5 (en) | 1980-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0044416B1 (de) | Triazolidin-3,5-dion-oxyalkylverbindungen und Verfahren zu ihrer Herstellung | |
| DE3132332C2 (show.php) | ||
| EP0798293A1 (de) | Verfahren zur Herstellung von N-Methyl-N'-nitroguanidin | |
| EP0000542B1 (de) | Verfahren zur Herstellung von Trifluormethylphenolen | |
| EP0314620A1 (de) | Verfahren zur Herstellung von 3-[2'H-Benzotriazol-(2')-yl]-4-hydroxybenzolsulfonsäuren und deren Salzen | |
| DE2502201A1 (de) | Verfahren zur herstellung von l-alkoxycarbonyl-2-alkoxy-l,2-dihydrochinolinen | |
| DE4123608C1 (show.php) | ||
| EP0212301A2 (de) | Verfahren zur Herstellung von 2-Aminophenyl-thioethern | |
| DE19515976C1 (de) | beta-Azidoethansulfonylazid, Verfahren zu seiner Herstellung und seine Verwendung in Verfahren zur Herstellung von Taurinamid und Taurolidin | |
| EP0026312A1 (de) | 1,2,4-Triglycidyl-triazolidin-3,5-dione, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0018473A1 (de) | Verfahren zur Herstellung von beta-Alkoxy-acrylnitrilen, 3-Amino-acrylnitrilen und 2-Cyano-vinylestern | |
| DE1129947B (de) | Verfahren zur Herstellung von 1, 4-Bis-(p-carboxystyryl)-benzolen | |
| EP0191385B1 (de) | Verfahren zur Herstellung von Thiocyanatomethylthiobenzothiazolen | |
| EP0002477B1 (de) | Verfahren zur Herstellung von 1,1-Dihalogen-4-methyl-1,3-pentadienen | |
| EP0012868A1 (de) | 1,2,3-Thiadiazol-5-yl-thioglycolsäure, deren Derivate sowie Verfahren zu deren Herstellung | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| DE1920499C3 (de) | Verfahren zur Herstellung von Nitriliumchlorosulfaten und einige Nitriliumchlorosulfate | |
| EP0248334B1 (de) | Verfahren zur Herstellung von 2-Nitro-4-sulfamyl-diphenylamin-Farbstoffen | |
| EP0122479A1 (de) | 3-Chlor-1,1-dialkoxyacetone und Verfahren zu ihrer Herstellung | |
| DE4304797B4 (de) | Verbessertes Verfahren zur Herstellung von 4,4-Diaryl-3,1-benzoxazinen | |
| DE1543957C (de) | Verfahren zur Herstellung von Bishydroxy dialkylbenzyl) sulfiden Ausscheidung aus 1242617 | |
| AT228772B (de) | Verfahren zur Herstellung von neuen basisch substituierten Malonsäuredinitrilen | |
| EP0150411A1 (de) | Verfahren zur Herstellung substituierter Chinazolin-2.4(1H.3H)-dione | |
| DE3324399A1 (de) | Verfahren zur herstellung von 2-alkylsulfonylalkylenpyrimidinen | |
| DE1089749B (de) | Verfahren zur kontinuierlichen Herstellung von Vinylthioaethern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |