DE2451929C3 - Stabilisierte Polyphenylenäther-Harzmasse - Google Patents
Stabilisierte Polyphenylenäther-HarzmasseInfo
- Publication number
- DE2451929C3 DE2451929C3 DE742451929A DE2451929A DE2451929C3 DE 2451929 C3 DE2451929 C3 DE 2451929C3 DE 742451929 A DE742451929 A DE 742451929A DE 2451929 A DE2451929 A DE 2451929A DE 2451929 C3 DE2451929 C3 DE 2451929C3
- Authority
- DE
- Germany
- Prior art keywords
- bis
- acid
- polyphenylene ether
- carbon atoms
- hydrazide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011342 resin composition Substances 0.000 title claims description 11
- 229920001955 polyphenylene ether Polymers 0.000 title description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 30
- 229920001577 copolymer Polymers 0.000 claims description 12
- 229920000642 polymer Polymers 0.000 claims description 12
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 239000003381 stabilizer Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 229920001519 homopolymer Polymers 0.000 claims description 3
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 239000011347 resin Substances 0.000 description 15
- 229920005989 resin Polymers 0.000 description 15
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 12
- 239000004793 Polystyrene Substances 0.000 description 10
- 125000003118 aryl group Chemical group 0.000 description 10
- 229920002223 polystyrene Polymers 0.000 description 10
- 239000002253 acid Substances 0.000 description 7
- 239000001361 adipic acid Substances 0.000 description 7
- 235000011037 adipic acid Nutrition 0.000 description 7
- 230000000704 physical effect Effects 0.000 description 7
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 5
- -1 polyphenylene Polymers 0.000 description 5
- 238000002845 discoloration Methods 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 229920002857 polybutadiene Polymers 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 239000005062 Polybutadiene Substances 0.000 description 3
- 229920000265 Polyparaphenylene Polymers 0.000 description 3
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 239000012760 heat stabilizer Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 238000003878 thermal aging Methods 0.000 description 3
- YKJFUZBSMHHVDA-UHFFFAOYSA-N 10-(2,2-dimethoxyhydrazinyl)-10-oxodecanoic acid Chemical compound CON(NC(CCCCCCCCC(=O)O)=O)OC YKJFUZBSMHHVDA-UHFFFAOYSA-N 0.000 description 2
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical compound COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 2
- NXSQQKKFGJHACS-UHFFFAOYSA-N 2-methyl-6-propylphenol Chemical compound CCCC1=CC=CC(C)=C1O NXSQQKKFGJHACS-UHFFFAOYSA-N 0.000 description 2
- CIRRFAQIWQFQSS-UHFFFAOYSA-N 6-ethyl-o-cresol Chemical compound CCC1=CC=CC(C)=C1O CIRRFAQIWQFQSS-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N Nonanedioid acid Natural products OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- QOKVYXVBSRWSOD-UHFFFAOYSA-N 10-(2,2-diacetylhydrazinyl)-10-oxodecanoic acid Chemical compound C(C)(=O)N(NC(CCCCCCCCC(=O)O)=O)C(C)=O QOKVYXVBSRWSOD-UHFFFAOYSA-N 0.000 description 1
- NCCNZPFRALYMEG-UHFFFAOYSA-N 10-(2,2-dibenzoylhydrazinyl)-10-oxodecanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCCCCCC(=O)O)=O)C(C1=CC=CC=C1)=O NCCNZPFRALYMEG-UHFFFAOYSA-N 0.000 description 1
- WGCOJSGVXOMWKK-UHFFFAOYSA-N 10-(2,2-diphenylhydrazinyl)-10-oxodecanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCCCCCC(=O)O)=O)C1=CC=CC=C1 WGCOJSGVXOMWKK-UHFFFAOYSA-N 0.000 description 1
- WKFGBTFBHBNHFA-UHFFFAOYSA-N 10-(N-(diacetylamino)anilino)-10-oxodecanoic acid Chemical compound OC(=O)CCCCCCCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 WKFGBTFBHBNHFA-UHFFFAOYSA-N 0.000 description 1
- CGFHDBXKYSYMEL-UHFFFAOYSA-N 10-[2,2-bis(2-methylphenyl)hydrazinyl]-10-oxodecanoic acid Chemical compound C1(=C(C=CC=C1)N(NC(CCCCCCCCC(=O)O)=O)C1=C(C=CC=C1)C)C CGFHDBXKYSYMEL-UHFFFAOYSA-N 0.000 description 1
- BPRYUXCVCCNUFE-UHFFFAOYSA-N 2,4,6-trimethylphenol Chemical compound CC1=CC(C)=C(O)C(C)=C1 BPRYUXCVCCNUFE-UHFFFAOYSA-N 0.000 description 1
- METWAQRCMRWDAW-UHFFFAOYSA-N 2,6-diethylphenol Chemical compound CCC1=CC=CC(CC)=C1O METWAQRCMRWDAW-UHFFFAOYSA-N 0.000 description 1
- ATGFTMUSEPZNJD-UHFFFAOYSA-N 2,6-diphenylphenol Chemical compound OC1=C(C=2C=CC=CC=2)C=CC=C1C1=CC=CC=C1 ATGFTMUSEPZNJD-UHFFFAOYSA-N 0.000 description 1
- KTMBVSDBOVYQFE-UHFFFAOYSA-N 2-(dimethylaminocarbamoyl)benzoic acid Chemical compound CN(C)NC(=O)C1=CC=CC=C1C(O)=O KTMBVSDBOVYQFE-UHFFFAOYSA-N 0.000 description 1
- AXKDYXSRYSKAEQ-UHFFFAOYSA-N 2-[(2-methyl-N-(2-methylphenyl)anilino)carbamoyl]benzoic acid Chemical compound C1(=C(C=CC=C1)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C1=C(C=CC=C1)C)C AXKDYXSRYSKAEQ-UHFFFAOYSA-N 0.000 description 1
- RVIBPIAGIOWPNU-UHFFFAOYSA-N 2-[(N-phenylanilino)carbamoyl]benzoic acid Chemical compound C1(=CC=CC=C1)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C1=CC=CC=C1 RVIBPIAGIOWPNU-UHFFFAOYSA-N 0.000 description 1
- HVTLDKRMORSVRP-UHFFFAOYSA-N 2-[(diacetylamino)-phenylcarbamoyl]benzoic acid Chemical compound C=1C=CC=CC=1N(N(C(=O)C)C(C)=O)C(=O)C1=CC=CC=C1C(O)=O HVTLDKRMORSVRP-UHFFFAOYSA-N 0.000 description 1
- XQXHMJZZLQWEBJ-UHFFFAOYSA-N 2-[(diacetylamino)carbamoyl]benzoic acid Chemical compound C(C)(=O)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C(C)=O XQXHMJZZLQWEBJ-UHFFFAOYSA-N 0.000 description 1
- JOUIWLDISZFHMJ-UHFFFAOYSA-N 2-[(dibenzoylamino)carbamoyl]benzoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C(C1=CC=CC=C1)=O JOUIWLDISZFHMJ-UHFFFAOYSA-N 0.000 description 1
- WYFBFQMVFIAJKU-UHFFFAOYSA-N 2-[(dimethoxyamino)carbamoyl]benzoic acid Chemical compound CON(NC(C=1C(C(=O)O)=CC=CC=1)=O)OC WYFBFQMVFIAJKU-UHFFFAOYSA-N 0.000 description 1
- WBHAUHHMPXBZCQ-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound COC1=CC=CC(C)=C1O WBHAUHHMPXBZCQ-UHFFFAOYSA-N 0.000 description 1
- PGJXFACHLLIKFG-UHFFFAOYSA-N 2-methyl-6-phenylphenol Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1O PGJXFACHLLIKFG-UHFFFAOYSA-N 0.000 description 1
- QQOMQLYQAXGHSU-UHFFFAOYSA-N 236TMPh Natural products CC1=CC=C(C)C(O)=C1C QQOMQLYQAXGHSU-UHFFFAOYSA-N 0.000 description 1
- LOPIYORHGQINPF-UHFFFAOYSA-N 3-(2,2-dibenzoylhydrazinyl)-3-oxopropanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CC(=O)O)=O)C(C1=CC=CC=C1)=O LOPIYORHGQINPF-UHFFFAOYSA-N 0.000 description 1
- VOAJSONLUJBGAB-UHFFFAOYSA-N 3-(2,2-dimethoxyhydrazinyl)-3-oxopropanoic acid Chemical compound CON(NC(CC(=O)O)=O)OC VOAJSONLUJBGAB-UHFFFAOYSA-N 0.000 description 1
- UFVJMKPEHJTFIL-UHFFFAOYSA-N 3-(2,2-dimethylhydrazinyl)-3-oxopropanoic acid Chemical compound CN(C)NC(=O)CC(O)=O UFVJMKPEHJTFIL-UHFFFAOYSA-N 0.000 description 1
- XEQCHEPHDDOYKC-UHFFFAOYSA-N 3-(2,2-diphenylhydrazinyl)-3-oxopropanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CC(=O)O)=O)C1=CC=CC=C1 XEQCHEPHDDOYKC-UHFFFAOYSA-N 0.000 description 1
- TYCHCHCSYMCKPY-UHFFFAOYSA-N 3-(dimethylaminocarbamoyl)benzoic acid Chemical compound CN(C)NC(=O)C1=CC=CC(C(O)=O)=C1 TYCHCHCSYMCKPY-UHFFFAOYSA-N 0.000 description 1
- ZXOMEZCFYUWPPQ-UHFFFAOYSA-N 3-[(2-methyl-N-(2-methylphenyl)anilino)carbamoyl]benzoic acid Chemical compound C1(=C(C=CC=C1)N(NC(C1=CC(C(=O)O)=CC=C1)=O)C1=C(C=CC=C1)C)C ZXOMEZCFYUWPPQ-UHFFFAOYSA-N 0.000 description 1
- BAOVCOIGNPSGER-UHFFFAOYSA-N 3-[(diacetylamino)-phenylcarbamoyl]benzoic acid Chemical compound C=1C=CC=CC=1N(N(C(=O)C)C(C)=O)C(=O)C1=CC=CC(C(O)=O)=C1 BAOVCOIGNPSGER-UHFFFAOYSA-N 0.000 description 1
- DTADVBPPYXIFNP-UHFFFAOYSA-N 3-[(diacetylamino)carbamoyl]benzoic acid Chemical compound C(C)(=O)N(NC(C1=CC(C(=O)O)=CC=C1)=O)C(C)=O DTADVBPPYXIFNP-UHFFFAOYSA-N 0.000 description 1
- ZOOLMOWWKXJTJG-UHFFFAOYSA-N 3-[(dimethoxyamino)carbamoyl]benzoic acid Chemical compound CON(NC(C1=CC(C(=O)O)=CC=C1)=O)OC ZOOLMOWWKXJTJG-UHFFFAOYSA-N 0.000 description 1
- MBCWCTAHJMFEHF-UHFFFAOYSA-N 3-[2,2-bis(2-oxopropyl)hydrazinyl]-3-oxopropanoic acid Chemical compound C(C)(=O)CN(NC(CC(=O)O)=O)CC(C)=O MBCWCTAHJMFEHF-UHFFFAOYSA-N 0.000 description 1
- LOCDORPLQWXKQX-UHFFFAOYSA-N 3-[[bis(2-oxopropyl)amino]carbamoyl]benzoic acid Chemical compound C(C)(=O)CN(NC(C1=CC(C(=O)O)=CC=C1)=O)CC(C)=O LOCDORPLQWXKQX-UHFFFAOYSA-N 0.000 description 1
- FODYWQMZYSCRAX-UHFFFAOYSA-N 4-(2,2-diacetylhydrazinyl)-4-oxobutanoic acid Chemical compound C(C)(=O)N(NC(CCC(=O)O)=O)C(C)=O FODYWQMZYSCRAX-UHFFFAOYSA-N 0.000 description 1
- AYPBXKQBEUYRIV-UHFFFAOYSA-N 4-(2,2-dibenzoylhydrazinyl)-4-oxobutanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCC(=O)O)=O)C(C1=CC=CC=C1)=O AYPBXKQBEUYRIV-UHFFFAOYSA-N 0.000 description 1
- UCPBLZXUQYTNRD-UHFFFAOYSA-N 4-(2,2-diphenylhydrazinyl)-4-oxobutanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCC(=O)O)=O)C1=CC=CC=C1 UCPBLZXUQYTNRD-UHFFFAOYSA-N 0.000 description 1
- AATLQJBLMOSMDZ-UHFFFAOYSA-N 4-(N-(diacetylamino)anilino)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 AATLQJBLMOSMDZ-UHFFFAOYSA-N 0.000 description 1
- BGEPNPHMLMMQKV-UHFFFAOYSA-N 4-(dimethylaminocarbamoyl)benzoic acid Chemical compound CN(C)NC(=O)C1=CC=C(C(O)=O)C=C1 BGEPNPHMLMMQKV-UHFFFAOYSA-N 0.000 description 1
- VCBZUFCMSHXMHT-UHFFFAOYSA-N 4-[(diacetylamino)-phenylcarbamoyl]benzoic acid Chemical compound C=1C=CC=CC=1N(N(C(=O)C)C(C)=O)C(=O)C1=CC=C(C(O)=O)C=C1 VCBZUFCMSHXMHT-UHFFFAOYSA-N 0.000 description 1
- MXOZSWPTBCMKKO-UHFFFAOYSA-N 4-[(diacetylamino)carbamoyl]benzoic acid Chemical compound C(C)(=O)N(NC(C1=CC=C(C(=O)O)C=C1)=O)C(C)=O MXOZSWPTBCMKKO-UHFFFAOYSA-N 0.000 description 1
- NILNBTVFETYIFJ-UHFFFAOYSA-N 4-[(dibenzoylamino)carbamoyl]benzoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(C1=CC=C(C(=O)O)C=C1)=O)C(C1=CC=CC=C1)=O NILNBTVFETYIFJ-UHFFFAOYSA-N 0.000 description 1
- ANLBTTSAFNINND-UHFFFAOYSA-N 4-[(dimethoxyamino)carbamoyl]benzoic acid Chemical compound CON(NC(C1=CC=C(C(=O)O)C=C1)=O)OC ANLBTTSAFNINND-UHFFFAOYSA-N 0.000 description 1
- ZLVFYUORUHNMBO-UHFFFAOYSA-N 4-bromo-2,6-dimethylphenol Chemical compound CC1=CC(Br)=CC(C)=C1O ZLVFYUORUHNMBO-UHFFFAOYSA-N 0.000 description 1
- VWYKSJIPZHRLNO-UHFFFAOYSA-N 4-chloro-2,6-dimethylphenol Chemical compound CC1=CC(Cl)=CC(C)=C1O VWYKSJIPZHRLNO-UHFFFAOYSA-N 0.000 description 1
- PRRINTZNQPGZHB-UHFFFAOYSA-N 4-ethyl-2,6-dimethylphenol Chemical compound CCC1=CC(C)=C(O)C(C)=C1 PRRINTZNQPGZHB-UHFFFAOYSA-N 0.000 description 1
- NROBNHWTRKNQAJ-UHFFFAOYSA-N 5-[2,2-bis(2-oxopropyl)hydrazinyl]-5-oxopentanoic acid Chemical compound C(C)(=O)CN(NC(CCCC(=O)O)=O)CC(C)=O NROBNHWTRKNQAJ-UHFFFAOYSA-N 0.000 description 1
- UTXVNEOBKXBFLO-UHFFFAOYSA-N 6-(2,2-dibenzoylhydrazinyl)-6-oxohexanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCC(=O)O)=O)C(C1=CC=CC=C1)=O UTXVNEOBKXBFLO-UHFFFAOYSA-N 0.000 description 1
- OOPQSDNLDOYGRA-UHFFFAOYSA-N 6-(2,2-diphenylhydrazinyl)-6-oxohexanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCC(=O)O)=O)C1=CC=CC=C1 OOPQSDNLDOYGRA-UHFFFAOYSA-N 0.000 description 1
- OPASULVTNJHOHQ-UHFFFAOYSA-N 6-(N-(diacetylamino)anilino)-6-oxohexanoic acid Chemical compound OC(=O)CCCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 OPASULVTNJHOHQ-UHFFFAOYSA-N 0.000 description 1
- OHMVNYPHQKOVHA-UHFFFAOYSA-N 6-[2,2-bis(2-methylphenyl)hydrazinyl]-6-oxohexanoic acid Chemical compound C1(=C(C=CC=C1)N(NC(CCCCC(=O)O)=O)C1=C(C=CC=C1)C)C OHMVNYPHQKOVHA-UHFFFAOYSA-N 0.000 description 1
- VLCSSYJEEQIRLC-UHFFFAOYSA-N 8-(2,2-dimethoxyhydrazinyl)-8-oxooctanoic acid Chemical compound CON(NC(CCCCCCC(=O)O)=O)OC VLCSSYJEEQIRLC-UHFFFAOYSA-N 0.000 description 1
- TUHBKRPJSFDWFX-UHFFFAOYSA-N 8-(2,2-dimethylhydrazinyl)-8-oxooctanoic acid Chemical compound CN(NC(CCCCCCC(=O)O)=O)C TUHBKRPJSFDWFX-UHFFFAOYSA-N 0.000 description 1
- KSSTUXUBQQMHSS-UHFFFAOYSA-N 8-(2,2-diphenylhydrazinyl)-8-oxooctanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCCCC(=O)O)=O)C1=CC=CC=C1 KSSTUXUBQQMHSS-UHFFFAOYSA-N 0.000 description 1
- OCYGHIYCAJYXHE-UHFFFAOYSA-N 8-(N-(diacetylamino)anilino)-8-oxooctanoic acid Chemical compound OC(=O)CCCCCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 OCYGHIYCAJYXHE-UHFFFAOYSA-N 0.000 description 1
- OFQMVLUIRJFNEU-UHFFFAOYSA-N 8-[2,2-bis(2-oxopropyl)hydrazinyl]-8-oxooctanoic acid Chemical compound C(C)(=O)CN(NC(CCCCCCC(=O)O)=O)CC(C)=O OFQMVLUIRJFNEU-UHFFFAOYSA-N 0.000 description 1
- GEKDCMXVEUYFEM-UHFFFAOYSA-N 9-(2,2-diacetylhydrazinyl)-9-oxononanoic acid Chemical compound C(C)(=O)N(NC(CCCCCCCC(=O)O)=O)C(C)=O GEKDCMXVEUYFEM-UHFFFAOYSA-N 0.000 description 1
- JFUMWWCDWZGHTE-UHFFFAOYSA-N 9-(2,2-dibenzoylhydrazinyl)-9-oxononanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCCCCC(=O)O)=O)C(C1=CC=CC=C1)=O JFUMWWCDWZGHTE-UHFFFAOYSA-N 0.000 description 1
- TYFFRFAPWXBYRP-UHFFFAOYSA-N 9-(2,2-dimethoxyhydrazinyl)-9-oxononanoic acid Chemical compound CON(NC(CCCCCCCC(=O)O)=O)OC TYFFRFAPWXBYRP-UHFFFAOYSA-N 0.000 description 1
- INVBCNARYVPDSD-UHFFFAOYSA-N 9-(2,2-dimethylhydrazinyl)-9-oxononanoic acid Chemical compound CN(NC(CCCCCCCC(=O)O)=O)C INVBCNARYVPDSD-UHFFFAOYSA-N 0.000 description 1
- HOBQOOCZPXXXRI-UHFFFAOYSA-N 9-(2,2-diphenylhydrazinyl)-9-oxononanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCCCCC(=O)O)=O)C1=CC=CC=C1 HOBQOOCZPXXXRI-UHFFFAOYSA-N 0.000 description 1
- 229920003026 Acene Polymers 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920000459 Nitrile rubber Polymers 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- TYFQFVWCELRYAO-UHFFFAOYSA-N Suberic acid Natural products OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- LKDQSBXRCTVDAO-UHFFFAOYSA-N benzene benzene-1,3-dicarboxylic acid Chemical compound C1=CC=CC=C1.C1=CC=CC=C1.C(C1=CC(C(=O)O)=CC=C1)(=O)O LKDQSBXRCTVDAO-UHFFFAOYSA-N 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- UICBCXONCUFSOI-UHFFFAOYSA-N n'-phenylacetohydrazide Chemical compound CC(=O)NNC1=CC=CC=C1 UICBCXONCUFSOI-UHFFFAOYSA-N 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N n-Decanedioic acid Natural products OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001596 poly (chlorostyrenes) Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000007958 sleep Effects 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/22—Compounds containing nitrogen bound to another nitrogen atom
- C08K5/24—Derivatives of hydrazine
- C08K5/25—Carboxylic acid hydrazides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48123732A JPS5125265B2 (enExample) | 1973-11-02 | 1973-11-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2451929A1 DE2451929A1 (de) | 1975-05-07 |
| DE2451929B2 DE2451929B2 (de) | 1978-07-20 |
| DE2451929C3 true DE2451929C3 (de) | 1979-03-08 |
Family
ID=14867965
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE742451929A Expired DE2451929C3 (de) | 1973-11-02 | 1974-10-31 | Stabilisierte Polyphenylenäther-Harzmasse |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3954904A (enExample) |
| JP (1) | JPS5125265B2 (enExample) |
| DE (1) | DE2451929C3 (enExample) |
| GB (1) | GB1458840A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4153644A (en) * | 1974-12-26 | 1979-05-08 | Mitsubishi Gas Chemical Company, Inc. | Resin composition containing polyphenylene oxide |
| US4113797A (en) * | 1976-03-29 | 1978-09-12 | General Electric Company | Thermoplastic molding compositions of rubber modified copolymers of a vinyl aromatic compound and an α,β-unsaturated cyclic anhydride |
| US4057599A (en) * | 1976-10-18 | 1977-11-08 | General Electric Company | Process for the preparation of vinyl aromatic-modified polyphenylene ethers |
| US4110311A (en) * | 1976-12-13 | 1978-08-29 | General Electric Company | Molecular weight control of polyphenylene ethers |
| US4116939A (en) * | 1976-12-20 | 1978-09-26 | General Electric Company | Intrinsic viscosity control of polyphenylene ether reaction mixtures |
| JPS57115485A (en) * | 1981-01-06 | 1982-07-17 | Adeka Argus Chem Co Ltd | Stabilized organic material composition |
| JPS5991580U (ja) * | 1982-12-13 | 1984-06-21 | 石井 素巳子 | エア−カ−テン発生装置つき冷蔵庫 |
| NL8403863A (nl) * | 1984-12-20 | 1986-07-16 | Gen Electric | Polymeermengsel, dat een polyfenyleenether en een dihydrazide stabilisator bevat. |
| US5395890A (en) * | 1987-09-14 | 1995-03-07 | Idemitsu Kosan Co., Ltd. | Styrene-based resin composition |
| JPH0788466B2 (ja) * | 1986-10-14 | 1995-09-27 | 住友ダウ株式会社 | ポリフェニレンエーテル系耐熱性樹脂組成物 |
| JPH0757828B2 (ja) * | 1990-09-27 | 1995-06-21 | 株式会社ブリヂストン | ゴム組成物 |
| CN108586321B (zh) * | 2018-05-24 | 2020-07-24 | 万华化学集团股份有限公司 | 一种受阻胺化合物及其制备方法和用途 |
| CN118239859B (zh) * | 2024-03-20 | 2025-10-17 | 中策橡胶集团股份有限公司 | 一种酰肼化合物、橡胶组合物及其制备方法和应用 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1184948B (de) * | 1963-06-04 | 1965-01-07 | Bayer Ag | Stabilisierung von Polyurethankunststoffen, einschliesslich Schaumstoffen, gegen Verfaerbung und Oxydation durch stickstoffhaltige Verbindungen |
| NL141540B (nl) * | 1965-01-06 | 1974-03-15 | Gen Electric | Werkwijze voor het bereiden van een polystyreen bevattend polymeermengsel, dat tot voortbrengsels met een grote buig- en treksterkte kan worden verwerkt, alsmede dergelijke voortbrengsels. |
| NL142712B (nl) * | 1966-05-18 | 1974-07-15 | Polychemie Aku Ge Nv | Werkwijze voor het stabiliseren van polyfenyleenethers. |
| US3462515A (en) * | 1967-01-17 | 1969-08-19 | Gen Electric | Vinyl polymer grafts on polycarbonates |
| US3639508A (en) * | 1969-01-03 | 1972-02-01 | Gen Electric | Thermoplastic blends of polyarylene oxide and block polymer and method for making them |
-
1973
- 1973-11-02 JP JP48123732A patent/JPS5125265B2/ja not_active Expired
-
1974
- 1974-10-30 US US05/519,195 patent/US3954904A/en not_active Expired - Lifetime
- 1974-10-31 DE DE742451929A patent/DE2451929C3/de not_active Expired
- 1974-11-01 GB GB4742974A patent/GB1458840A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1458840A (en) | 1976-12-15 |
| JPS5074653A (enExample) | 1975-06-19 |
| DE2451929A1 (de) | 1975-05-07 |
| JPS5125265B2 (enExample) | 1976-07-29 |
| DE2451929B2 (de) | 1978-07-20 |
| US3954904A (en) | 1976-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2451929C3 (de) | Stabilisierte Polyphenylenäther-Harzmasse | |
| DE2454124C3 (de) | Stabilisierte Polyphenylenäther-Harzmassen | |
| DE68925581T2 (de) | Stabilisiertes polyphenylenätherharz | |
| DE68923910T2 (de) | Polyphenylenätherharze und Zusammensetzungen mit verringertem Geruch und Verfahren zur Verringerung des Geruchs. | |
| DE3131440A1 (de) | Verfahren zur herstellung von polyphenylenether enthaltenden formmassen | |
| DE2061116B2 (de) | Verfahren zur herstellung von polyphenylenoxiden | |
| US3465062A (en) | Stable polyphenylene ether composition | |
| US4255321A (en) | Stabilized polyphenylene ether | |
| US3420792A (en) | Stabilized polyphenylene ether | |
| US5194476A (en) | Compositions of polyphenylene oxide or mixtures of polyphenylene oxide with beta-diketones | |
| US3379875A (en) | Stabilized polyphenylene oxide composition | |
| DE2243323C2 (de) | Stabilisierte Formmassen aus Polyoxymethylenen | |
| DE1720857A1 (de) | Gegen oxydativen Abbau stabilisierte Polyphenylenoxydmasse | |
| CH496644A (de) | Verfahren zur Herstellung von (4-Hydroxy-3,5-dialkylbenzyl)-carbonsäureestern und Verwendung derselben | |
| DE2229550C3 (de) | Stabilisierte Masse aus einem Polyphenylenäther und einem Polystyrolharz | |
| DE2638855A1 (de) | Verwendung von quadratsaeureamiden als stabilisierungsmittel fuer geformte oder nicht geformte kunststoffe | |
| DE2112973A1 (de) | Aromatische Polyesterzusammensetzung | |
| EP0308803A2 (de) | Stabilisierte, aromatische Polyetherketone enthaltende Mischung und deren Verwendung zur Herstellung von Formteilen | |
| DE1962677C3 (de) | Verfahren zur Herstellung von Polyp he nylenoxiden | |
| DE1105161B (de) | Verfahren zum Stabilisieren von makromolekularem Polyformaldehyd | |
| DE2222230B2 (de) | Thermoplastische formmassen | |
| US3414536A (en) | Polyphenylene ethers stabilized with phosphoramides and tetra-alkylam-monium-tetraflouroborate | |
| AT237896B (de) | Oxymethylenpolymerenzusammensetzung | |
| DE3909487A1 (de) | Polyarylethersulfone fuer lichttechnische anwendungen | |
| DE1694258C (de) | Gegen Licht- und Wärmeeinwirkung stabilisierte Polyphenylenoxide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |