DE2451035A1 - Jalousievorrichtung - Google Patents
JalousievorrichtungInfo
- Publication number
- DE2451035A1 DE2451035A1 DE19742451035 DE2451035A DE2451035A1 DE 2451035 A1 DE2451035 A1 DE 2451035A1 DE 19742451035 DE19742451035 DE 19742451035 DE 2451035 A DE2451035 A DE 2451035A DE 2451035 A1 DE2451035 A1 DE 2451035A1
- Authority
- DE
- Germany
- Prior art keywords
- blind body
- blind
- axles
- louvre
- slot
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005484 gravity Effects 0.000 claims description 8
- 230000009471 action Effects 0.000 claims description 5
- 230000000712 assembly Effects 0.000 claims description 4
- 238000000429 assembly Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims 1
- 230000007246 mechanism Effects 0.000 description 16
- 238000010276 construction Methods 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- LYKJEJVAXSGWAJ-UHFFFAOYSA-N compactone Natural products CC1(C)CCCC2(C)C1CC(=O)C3(O)CC(C)(CCC23)C=C LYKJEJVAXSGWAJ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B9/00—Screening or protective devices for wall or similar openings, with or without operating or securing mechanisms; Closures of similar construction
- E06B9/24—Screens or other constructions affording protection against light, especially against sunshine; Similar screens for privacy or appearance; Slat blinds
- E06B9/26—Lamellar or like blinds, e.g. venetian blinds
- E06B9/28—Lamellar or like blinds, e.g. venetian blinds with horizontal lamellae, e.g. non-liftable
- E06B9/30—Lamellar or like blinds, e.g. venetian blinds with horizontal lamellae, e.g. non-liftable liftable
- E06B9/302—Lamellar or like blinds, e.g. venetian blinds with horizontal lamellae, e.g. non-liftable liftable without ladder-tape, e.g. with lazy-tongs, with screw spindle
Landscapes
- Engineering & Computer Science (AREA)
- Structural Engineering (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Blinds (AREA)
- Specific Sealing Or Ventilating Devices For Doors And Windows (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00410426A US3853169A (en) | 1973-10-29 | 1973-10-29 | Rotatable track-mounted shutter blinds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2451035A1 true DE2451035A1 (de) | 1975-04-30 |
Family
ID=23624675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742451035 Pending DE2451035A1 (de) | 1973-10-29 | 1974-10-26 | Jalousievorrichtung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3853169A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS50155040A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2451035A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2249234A1 (cg-RX-API-DMAC10.html) |
| IT (1) | IT1023779B (cg-RX-API-DMAC10.html) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2725601C2 (de) * | 1977-06-07 | 1987-01-22 | Hunter Douglas Industries B.V., Rotterdam | Lamellenjalousie |
| CH650310A5 (de) * | 1981-04-27 | 1985-07-15 | Schenker Emil Ag | Rafflamellenstore. |
| DE3876309T2 (de) * | 1987-06-22 | 1993-06-24 | Parma Developments Ltd | Fensterladen. |
| JPH0645039Y2 (ja) * | 1987-12-15 | 1994-11-16 | 立川ブラインド工業株式会社 | たたみ込みシャッター |
| US5181548A (en) * | 1989-10-10 | 1993-01-26 | Matthews Arthur J | Emergency exit security window blinds |
| US5163494A (en) * | 1991-01-11 | 1992-11-17 | Macneil Daniel J | Sectional door installation |
| US5282514A (en) * | 1992-05-15 | 1994-02-01 | Felcetto Roy P | Window guard for venetian blind hung windows |
| US5316065A (en) * | 1992-12-18 | 1994-05-31 | Alligood Ira J | Burglar and storm-resistant cover for windows and doors |
| US5732507A (en) * | 1993-11-04 | 1998-03-31 | H.V. Aluminium Pty. Limited | Louvre assembly |
| US5501261A (en) * | 1994-10-17 | 1996-03-26 | Peale; Robert G. | Window treatment operating mechanism |
| US5620037A (en) * | 1995-05-08 | 1997-04-15 | Apostolo; Mauricio C. | Mortised removable storm shutter |
| ES2174653B1 (es) * | 1998-01-30 | 2004-11-01 | Angel Caparros Plaza | Celosia de lamas orientables. |
| US5924468A (en) * | 1998-02-17 | 1999-07-20 | Bisconti; Vincent | Retractable window protection device |
| US6021838A (en) * | 1998-06-11 | 2000-02-08 | Taffe; Lansley O. | Louvered security window |
| GB2344418B (en) * | 1998-09-01 | 2003-04-02 | David Huw Stephens | Heating and ventilation of dwellings |
| IL153793A0 (en) * | 2000-07-18 | 2003-07-31 | Brian Malcolm Wilkins | Combined window blind and security shutter |
| US20070193702A1 (en) * | 2006-02-23 | 2007-08-23 | Jin-Tang Hung | Apparatus for moving air shutter slats up and down |
| GB2443826A (en) * | 2006-11-16 | 2008-05-21 | Brian Malcom Wilkins | Window and combined defence shutter and blind |
| KR101181958B1 (ko) * | 2008-11-07 | 2012-09-11 | 박정원 | 다용도 창호 |
| GB201007328D0 (en) * | 2010-05-04 | 2010-06-16 | Gray Matter Alpha Ltd | Lourve vane system |
| ITMI20121911A1 (it) * | 2012-11-09 | 2014-05-10 | Frigerio Tende Da Sole S R L | Struttura di copertura a pale basculanti. |
| ZA201702185B (en) | 2016-07-20 | 2018-05-30 | Navus Consulting Cc | Slat for a blind and blind formed therefrom |
| AU201713687S (en) | 2017-01-25 | 2017-07-12 | Navus Consulting Cc | Slat for a blind |
| DK180193B1 (en) * | 2018-12-28 | 2020-08-04 | Jørn Krab Holding APS | System for closing an opening |
| US11655997B2 (en) * | 2019-12-20 | 2023-05-23 | Johnson Controls Tyco IP Holdings LLP | Damper blade assembly for HVAC system |
| IT202100031991A1 (it) * | 2021-12-21 | 2023-06-21 | Mergerb S R L | Tenda a lamelle. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2621723A (en) * | 1951-03-14 | 1952-12-16 | Nicholas L Etten | Blind structure |
| US2957520A (en) * | 1958-08-04 | 1960-10-25 | Paul J Howard | Venetian blind |
| US3520346A (en) * | 1968-08-19 | 1970-07-14 | Hollister R Green | Window blind |
| US3658112A (en) * | 1970-08-03 | 1972-04-25 | Kaneyoshi Imaizumi | Blind |
-
1973
- 1973-10-29 US US00410426A patent/US3853169A/en not_active Expired - Lifetime
-
1974
- 1974-10-24 FR FR7435685A patent/FR2249234A1/fr not_active Withdrawn
- 1974-10-26 DE DE19742451035 patent/DE2451035A1/de active Pending
- 1974-10-28 IT IT9608/74A patent/IT1023779B/it active
- 1974-10-29 JP JP49124801A patent/JPS50155040A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT1023779B (it) | 1978-05-30 |
| JPS50155040A (cg-RX-API-DMAC10.html) | 1975-12-13 |
| US3853169A (en) | 1974-12-10 |
| FR2249234A1 (cg-RX-API-DMAC10.html) | 1975-05-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2451035A1 (de) | Jalousievorrichtung | |
| DE69519764T2 (de) | Jalousierbarer Rolladen | |
| EP0017765B1 (de) | Hydraulische Hebevorrichtung | |
| CH663063A5 (de) | Lamellenstoren. | |
| DE29701748U1 (de) | Jalousie | |
| EP0653012B1 (de) | Jalousierbarer rolladen | |
| DE3403920A1 (de) | Jalousie fuer fenster- oder tueroeffnungen von bauwerken | |
| DE1559775B1 (de) | Vorrichtung zum OEffnen und Schliessen von Fenstern od.dgl. | |
| DE1584001C3 (de) | Beschlag für einen Schiebe-Schwenkflügel von Fenstern, Türen od.dgl | |
| DE202005006913U1 (de) | Fensterjalousien- und Rolloanordnung mit mehreren Stangen und Jalousien bzw. Rollos | |
| EP3524765A1 (de) | Absenkbare einbruchsicherung | |
| DE2749967C2 (de) | Vorrichtung zum Schrägstellen der Liegefläche an einem Liegemöbel | |
| DE19648177A1 (de) | Anhebesicherung für die Lamellen von Rolladen oder Storen | |
| EP1213439A2 (de) | Abdeckvorrichtung | |
| DE69720627T2 (de) | Arretierung für Rolladen, mit einer frei drehbaren Wickelwelle | |
| DE2616802A1 (de) | Halter fuer lotrecht regelbare fahrzeugsitze | |
| DE850561C (de) | Schiebefenster mit Baskuelverschluss | |
| DE2121294A1 (de) | Jalousie mit schwenk- und verschiebbaren Lamellen | |
| DE19532671A1 (de) | Verstellbare Liege | |
| DE2435477B1 (de) | Geräteanbauvorrichtung mit Abstützung der Oberlenker gegenüber den Unterlenkern durch Blattfedern, insbesondere für einen Schlepper | |
| DE3219862C2 (cg-RX-API-DMAC10.html) | ||
| DE156104C (cg-RX-API-DMAC10.html) | ||
| DE69309533T2 (de) | Bettstelle | |
| EP4070653A1 (de) | Höhenverstellbare aufnahmevorrichtungen für tiernahrung | |
| AT501233A1 (de) | Kopfteil |