DE2422691A1 - Stabile bleichmittel - Google Patents
Stabile bleichmittelInfo
- Publication number
- DE2422691A1 DE2422691A1 DE19742422691 DE2422691A DE2422691A1 DE 2422691 A1 DE2422691 A1 DE 2422691A1 DE 19742422691 DE19742422691 DE 19742422691 DE 2422691 A DE2422691 A DE 2422691A DE 2422691 A1 DE2422691 A1 DE 2422691A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- agent
- bleach
- sulfate
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 73
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 66
- 239000003795 chemical substances by application Substances 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 41
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 33
- 235000019341 magnesium sulphate Nutrition 0.000 claims description 33
- -1 peroxyacid compound Chemical class 0.000 claims description 27
- 150000004965 peroxy acids Chemical class 0.000 claims description 26
- 239000003381 stabilizer Substances 0.000 claims description 25
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 24
- 230000036571 hydration Effects 0.000 claims description 21
- 238000006703 hydration reaction Methods 0.000 claims description 21
- 239000008187 granular material Substances 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 17
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 16
- 229910052936 alkali metal sulfate Inorganic materials 0.000 claims description 15
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 14
- 235000011152 sodium sulphate Nutrition 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 14
- KXEMXOYVVPLGSD-UHFFFAOYSA-N benzene-1,3-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC(C(=O)OO)=C1 KXEMXOYVVPLGSD-UHFFFAOYSA-N 0.000 claims description 10
- 239000003599 detergent Substances 0.000 claims description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical group [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 8
- 239000002245 particle Substances 0.000 claims description 8
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 claims description 6
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 239000012190 activator Substances 0.000 claims description 5
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 claims description 5
- 229910052939 potassium sulfate Inorganic materials 0.000 claims description 5
- 235000011151 potassium sulphates Nutrition 0.000 claims description 5
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 claims description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 4
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 claims description 3
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 claims description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 3
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 claims description 3
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims description 3
- 239000005639 Lauric acid Substances 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 3
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 claims description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- 235000010338 boric acid Nutrition 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 3
- 239000000174 gluconic acid Substances 0.000 claims description 3
- 235000012208 gluconic acid Nutrition 0.000 claims description 3
- 239000004220 glutamic acid Substances 0.000 claims description 3
- 235000013922 glutamic acid Nutrition 0.000 claims description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 3
- 239000011976 maleic acid Substances 0.000 claims description 3
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 claims description 3
- 229910000343 potassium bisulfate Inorganic materials 0.000 claims description 3
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 claims description 3
- 229910000342 sodium bisulfate Inorganic materials 0.000 claims description 3
- 239000011975 tartaric acid Substances 0.000 claims description 3
- 235000002906 tartaric acid Nutrition 0.000 claims description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 2
- 239000003945 anionic surfactant Substances 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 239000002563 ionic surfactant Substances 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 2
- 238000004061 bleaching Methods 0.000 description 25
- 230000000694 effects Effects 0.000 description 21
- 238000003860 storage Methods 0.000 description 17
- 239000002253 acid Substances 0.000 description 16
- 239000004744 fabric Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- 238000005406 washing Methods 0.000 description 11
- 239000000243 solution Substances 0.000 description 8
- 239000004615 ingredient Substances 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 230000006641 stabilisation Effects 0.000 description 5
- 238000011105 stabilization Methods 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 150000004967 organic peroxy acids Chemical class 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- ZJAFQAPHWPSKRZ-UHFFFAOYSA-N 4-nitrobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=C([N+]([O-])=O)C=C1 ZJAFQAPHWPSKRZ-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 159000000003 magnesium salts Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- ZUGHSJIRMAZPBK-UHFFFAOYSA-N 4-chlorobenzene-1,2-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(Cl)C=C1C(=O)OO ZUGHSJIRMAZPBK-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000006172 buffering agent Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 229910001425 magnesium ion Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 235000012149 noodles Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 238000013112 stability test Methods 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000271 synthetic detergent Substances 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- MKOIQZIVZSVNPT-UHFFFAOYSA-N 1-(2,3-diacetylphenyl)ethanone Chemical compound CC(=O)C1=CC=CC(C(C)=O)=C1C(C)=O MKOIQZIVZSVNPT-UHFFFAOYSA-N 0.000 description 1
- JUVDEAXMLQQRFP-UHFFFAOYSA-N 1h-imidazol-2-yl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1=NC=CN1 JUVDEAXMLQQRFP-UHFFFAOYSA-N 0.000 description 1
- CMHJKGDUDQZWBN-UHFFFAOYSA-N 2-(methylamino)-3-oxobutanoic acid Chemical compound CNC(C(C)=O)C(O)=O CMHJKGDUDQZWBN-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- DCNLTIGDTRBIJG-UHFFFAOYSA-N 2-chloro-1-(2-hydroxyphenyl)ethanone Chemical compound OC1=CC=CC=C1C(=O)CCl DCNLTIGDTRBIJG-UHFFFAOYSA-N 0.000 description 1
- ULQQGOGMQRGFFR-UHFFFAOYSA-N 2-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1Cl ULQQGOGMQRGFFR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008049 biological aging Effects 0.000 description 1
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical group N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- QPOWUYJWCJRLEE-UHFFFAOYSA-N dipyridin-2-ylmethanone Chemical compound C=1C=CC=NC=1C(=O)C1=CC=CC=N1 QPOWUYJWCJRLEE-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000012851 eutrophication Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 150000002194 fatty esters Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011361 granulated particle Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 229940081066 picolinic acid Drugs 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3945—Organic per-compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3937—Stabilising agents
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US35981773A | 1973-05-14 | 1973-05-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2422691A1 true DE2422691A1 (de) | 1974-12-05 |
Family
ID=23415399
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742422691 Withdrawn DE2422691A1 (de) | 1973-05-14 | 1974-05-10 | Stabile bleichmittel |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS5052375A (enrdf_load_stackoverflow) |
| AU (1) | AU6883374A (enrdf_load_stackoverflow) |
| BE (1) | BE814939A (enrdf_load_stackoverflow) |
| DE (1) | DE2422691A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2229766B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1456591A (enrdf_load_stackoverflow) |
| IT (1) | IT1013145B (enrdf_load_stackoverflow) |
| NL (1) | NL7406437A (enrdf_load_stackoverflow) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4287135A (en) | 1978-10-25 | 1981-09-01 | Reinhard Stober | Stabilized diperoxyalkanedioic acids and aromatic peroxycarboxylic acids |
| EP0047015A1 (en) * | 1980-09-01 | 1982-03-10 | Richardson-Vicks Pty. Ltd. | Sanitizing and bleaching composition |
| DE3320496A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zum phlegmatisieren von wasserunloeslichen peroxycarbonsaeuren |
| DE3515712A1 (de) * | 1985-05-02 | 1986-11-06 | Henkel KGaA, 4000 Düsseldorf | Bleichwirkstoff, seine herstellung und seine verwendung |
| EP0273334A1 (de) * | 1986-12-27 | 1988-07-06 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur Herstellung von rieselfähigen, stabilen Persäure-Konzentraten durch kompaktierende Granulation |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091544A (en) * | 1977-02-11 | 1978-05-30 | The Procter & Gamble Company | Drying process |
| US4325828A (en) * | 1980-03-27 | 1982-04-20 | Lever Brothers Company | Detergent bleach compositions |
| GB2094799B (en) | 1981-03-14 | 1985-01-03 | Sterwin Ag | Stabilised succinyl peroxide composition |
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| US5093021A (en) * | 1985-08-21 | 1992-03-03 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US4863626A (en) * | 1985-08-21 | 1989-09-05 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5167854A (en) * | 1985-08-21 | 1992-12-01 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| ATE72579T1 (de) * | 1985-08-21 | 1992-02-15 | Clorox Co | Stabiles persaeurebleichmittel. |
| US5211874A (en) * | 1985-08-21 | 1993-05-18 | The Clorox Company | Stable peracid and enzyme bleaching composition |
| ES2001074A6 (es) * | 1985-08-21 | 1988-04-16 | Clorox Co | Perfeccionamientos en la fabricacion de productos blanqueantes secos basados en diperacidos. |
| US5254287A (en) * | 1985-08-21 | 1993-10-19 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| CA1294510C (en) * | 1986-03-31 | 1992-01-21 | Stanton Lane Boyer | Stable liquid diperoxyacid bleach |
| EP0254331B1 (en) * | 1986-05-28 | 1990-05-09 | Akzo N.V. | Process for the preparation of agglomerates containing diperoxydodecanedioic acid, and their use in bleaching compositions |
| BE1000328A5 (fr) * | 1987-02-19 | 1988-10-25 | Interox Sa | Particules de composes peroxygenes stabilisees, procede pour leur fabrication, et compositions en contenant. |
| GB8710690D0 (en) * | 1987-05-06 | 1987-06-10 | Unilever Plc | Detergent bleach composition |
| US5296156A (en) * | 1988-11-25 | 1994-03-22 | Akzo N.V. | Bleaching granules |
| US5049298A (en) * | 1988-11-25 | 1991-09-17 | Akzo Nv | Process for the preparation of bleaching granules |
| DE69323516T3 (de) * | 1992-09-16 | 2003-03-27 | Unilever N.V., Rotterdam | Bleichmittel |
| DE19619646A1 (de) * | 1996-05-15 | 1997-11-20 | Henkel Kgaa | Stabilisierung von Alkalipercarbonat |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3637339A (en) * | 1968-03-07 | 1972-01-25 | Frederick William Gray | Stain removal |
-
1974
- 1974-05-10 AU AU68833/74A patent/AU6883374A/en not_active Expired
- 1974-05-10 DE DE19742422691 patent/DE2422691A1/de not_active Withdrawn
- 1974-05-10 IT IT5091174A patent/IT1013145B/it active
- 1974-05-13 FR FR7416504A patent/FR2229766B1/fr not_active Expired
- 1974-05-13 BE BE144245A patent/BE814939A/xx unknown
- 1974-05-14 NL NL7406437A patent/NL7406437A/xx not_active Application Discontinuation
- 1974-05-14 GB GB2123974A patent/GB1456591A/en not_active Expired
- 1974-05-14 JP JP49053790A patent/JPS5052375A/ja active Pending
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4287135A (en) | 1978-10-25 | 1981-09-01 | Reinhard Stober | Stabilized diperoxyalkanedioic acids and aromatic peroxycarboxylic acids |
| EP0047015A1 (en) * | 1980-09-01 | 1982-03-10 | Richardson-Vicks Pty. Ltd. | Sanitizing and bleaching composition |
| DE3320496A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zum phlegmatisieren von wasserunloeslichen peroxycarbonsaeuren |
| DE3515712A1 (de) * | 1985-05-02 | 1986-11-06 | Henkel KGaA, 4000 Düsseldorf | Bleichwirkstoff, seine herstellung und seine verwendung |
| EP0273334A1 (de) * | 1986-12-27 | 1988-07-06 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur Herstellung von rieselfähigen, stabilen Persäure-Konzentraten durch kompaktierende Granulation |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7406437A (enrdf_load_stackoverflow) | 1974-11-18 |
| FR2229766B1 (enrdf_load_stackoverflow) | 1978-11-17 |
| FR2229766A1 (enrdf_load_stackoverflow) | 1974-12-13 |
| IT1013145B (it) | 1977-03-30 |
| GB1456591A (en) | 1976-11-24 |
| BE814939A (fr) | 1974-11-13 |
| JPS5052375A (enrdf_load_stackoverflow) | 1975-05-09 |
| AU6883374A (en) | 1975-11-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2422691A1 (de) | Stabile bleichmittel | |
| DE2737864C2 (enrdf_load_stackoverflow) | ||
| DE3112854C2 (enrdf_load_stackoverflow) | ||
| DE69434227T3 (de) | Durchsichtige, isotrope, wässrige Bleichmittelzusammensetzung | |
| DE69100809T2 (de) | Wasserstoffperoxid enthaltende stabile Bleichmittelzusammensetzungen. | |
| DE2655971A1 (de) | Stabilisierte, aktivierte bleichmittelzusammensetzung | |
| DE2951196A1 (de) | Verfahren zur herstellung von optische aufheller enthaltenden waschpulvern mit stabilisiertem bzw. verbessertem aspekt | |
| DE1087738B (de) | Reinigungsmittel mit bleichender, oxydierender und desinfizierender Wirkung | |
| DE2420009C3 (enrdf_load_stackoverflow) | ||
| DE2609039B2 (de) | Verfahren zum Herstellen von beständigem Natriumpercarbonat | |
| DE2508412B2 (de) | Lagerbeständiges festes Bleichmittel | |
| DE69409406T2 (de) | Bleichmittel | |
| DE2217021A1 (de) | Reinigungsmittel mit Gehalt an stabilisierten RiechstofTmischungen | |
| EP0799154B1 (de) | Verfahren zur herstellung eines natriumpercarbonat-produktes | |
| DE2113732A1 (de) | Antimikrobielle Wirkstoffe enthaltende Wasch- und Waschhilfsmittel | |
| DE4113003A1 (de) | Eiweiss als bioabbaubarer stabilisator fuer die sauerstoffbleiche der textilwaesche | |
| EP0210132A1 (de) | Wässrige, alkalische, silikathaltige Zusammensetzung zum Bleichen von cellulosehaltigen Fasermaterialien in Gegenwart von Perverbindungen | |
| DE2616350C3 (enrdf_load_stackoverflow) | ||
| DE68921957T2 (de) | Teilchenförmige Zusammensetzung mit Bleichmittel und optischem Aufheller und deren Herstellung. | |
| DE3807921A1 (de) | Aktivator fuer anorganische perverbindungen | |
| DE2741671C2 (de) | Granulare Waschmittel | |
| DE69025728T2 (de) | Verfahren zum Erhöhen des Bleicheffektes beim Waschen und Verwendung bestimmter amphoterer Verbindungen in einer Waschmittelzusammensetzung zum Erhöhen des Bleicheffektes | |
| DE2418415A1 (de) | Phosphatfreies waschmittel | |
| DE69504515T2 (de) | Bleichmittelzusammensetzungen | |
| DE2144592B2 (de) | Waschmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |