DE2421503B2 - Verfahren zur Herstellung von Phenyl- oder Alkylphenylmono- oder diisoxyanaten - Google Patents
Verfahren zur Herstellung von Phenyl- oder Alkylphenylmono- oder diisoxyanatenInfo
- Publication number
- DE2421503B2 DE2421503B2 DE2421503A DE2421503A DE2421503B2 DE 2421503 B2 DE2421503 B2 DE 2421503B2 DE 2421503 A DE2421503 A DE 2421503A DE 2421503 A DE2421503 A DE 2421503A DE 2421503 B2 DE2421503 B2 DE 2421503B2
- Authority
- DE
- Germany
- Prior art keywords
- mol
- isocyanate
- dicarbamate
- toluene
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 29
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 5
- 125000005037 alkyl phenyl group Chemical group 0.000 title claims description 3
- 239000002904 solvent Substances 0.000 claims description 42
- 239000012948 isocyanate Substances 0.000 claims description 31
- 150000002513 isocyanates Chemical class 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- DCAYPVUWAIABOU-UHFFFAOYSA-N hexadecane Chemical compound CCCCCCCCCCCCCCCC DCAYPVUWAIABOU-UHFFFAOYSA-N 0.000 claims description 18
- 150000002148 esters Chemical class 0.000 claims description 14
- 230000015572 biosynthetic process Effects 0.000 claims description 11
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000005442 diisocyanate group Chemical group 0.000 claims description 8
- 239000011261 inert gas Substances 0.000 claims description 6
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 claims description 6
- OIAQMFOKAXHPNH-UHFFFAOYSA-N 1,2-diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1C1=CC=CC=C1 OIAQMFOKAXHPNH-UHFFFAOYSA-N 0.000 claims description 4
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- RZJRJXONCZWCBN-UHFFFAOYSA-N octadecane Chemical compound CCCCCCCCCCCCCCCCCC RZJRJXONCZWCBN-UHFFFAOYSA-N 0.000 claims description 4
- 239000004803 Di-2ethylhexylphthalate Substances 0.000 claims description 3
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 238000004821 distillation Methods 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 42
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 19
- 238000013459 approach Methods 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000003599 detergent Substances 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- PHYURWGMBQTCSY-UHFFFAOYSA-N ethyl n-[3-(ethoxycarbonylamino)-4-methylphenyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(C)C(NC(=O)OCC)=C1 PHYURWGMBQTCSY-UHFFFAOYSA-N 0.000 description 10
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 9
- -1 N-substituted carbamic acid Chemical class 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 6
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 6
- 238000000197 pyrolysis Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000012046 mixed solvent Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XCEPDLGXLQKFCO-UHFFFAOYSA-N 2-ethoxyethyl n-[3-(2-ethoxyethoxycarbonylamino)-4-methylphenyl]carbamate Chemical compound CCOCCOC(=O)NC1=CC=C(C)C(NC(=O)OCCOCC)=C1 XCEPDLGXLQKFCO-UHFFFAOYSA-N 0.000 description 2
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001030 gas--liquid chromatography Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- CNPWIVIIZHULCN-UHFFFAOYSA-N methyl n-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=C(C)C(NC(=O)OC)=C1 CNPWIVIIZHULCN-UHFFFAOYSA-N 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- SRHAONPLNDTLMO-UHFFFAOYSA-N propan-2-yl n-[2-methyl-5-(propan-2-yloxycarbonylamino)phenyl]carbamate Chemical compound CC(C)OC(=O)NC1=CC=C(C)C(NC(=O)OC(C)C)=C1 SRHAONPLNDTLMO-UHFFFAOYSA-N 0.000 description 2
- 238000005215 recombination Methods 0.000 description 2
- 230000006798 recombination Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 2
- PBWHJRFXUPLZDS-UHFFFAOYSA-N (1-Ethylpropyl)benzene Chemical compound CCC(CC)C1=CC=CC=C1 PBWHJRFXUPLZDS-UHFFFAOYSA-N 0.000 description 1
- BNHGVULTSGNVIX-UHFFFAOYSA-N 1-(2-ethoxyethoxy)ethanol Chemical compound CCOCCOC(C)O BNHGVULTSGNVIX-UHFFFAOYSA-N 0.000 description 1
- YIDSTEJLDQMWBR-UHFFFAOYSA-N 1-isocyanatododecane Chemical compound CCCCCCCCCCCCN=C=O YIDSTEJLDQMWBR-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- YHMQRKUXTUROID-UHFFFAOYSA-N 6-(phenylcarbamoyloxy)hexyl N-phenylcarbamate Chemical compound C=1C=CC=CC=1NC(=O)OCCCCCCOC(=O)NC1=CC=CC=C1 YHMQRKUXTUROID-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000006065 biodegradation reaction Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZTIMKJROOYMUMU-UHFFFAOYSA-N butyl n-phenylcarbamate Chemical compound CCCCOC(=O)NC1=CC=CC=C1 ZTIMKJROOYMUMU-UHFFFAOYSA-N 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 238000007233 catalytic pyrolysis Methods 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- PKPOVTYZGGYDIJ-UHFFFAOYSA-N dioctyl carbonate Chemical compound CCCCCCCCOC(=O)OCCCCCCCC PKPOVTYZGGYDIJ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 239000003759 ester based solvent Substances 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- QNJPOHYCQROUCT-UHFFFAOYSA-N ethyl n-[3-(ethoxycarbonylamino)-2-methylphenyl]carbamate Chemical compound CCOC(=O)NC1=CC=CC(NC(=O)OCC)=C1C QNJPOHYCQROUCT-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical group COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- BQFREXSKWBUSAP-UHFFFAOYSA-N methyl n-[3-(methoxycarbonylamino)phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(NC(=O)OC)=C1 BQFREXSKWBUSAP-UHFFFAOYSA-N 0.000 description 1
- IUERBKSXAYWVGE-UHFFFAOYSA-N n-(1-phenylethyl)aniline Chemical compound C=1C=CC=CC=1C(C)NC1=CC=CC=C1 IUERBKSXAYWVGE-UHFFFAOYSA-N 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000006233 propoxy propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AZOPMOSYNSRIOO-UHFFFAOYSA-N propyl n-[2-methyl-5-(propoxycarbonylamino)phenyl]carbamate Chemical compound CCCOC(=O)NC1=CC=C(C)C(NC(=O)OCCC)=C1 AZOPMOSYNSRIOO-UHFFFAOYSA-N 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US35730173A | 1973-05-04 | 1973-05-04 | |
| US44929174A | 1974-03-08 | 1974-03-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2421503A1 DE2421503A1 (de) | 1974-11-21 |
| DE2421503B2 true DE2421503B2 (de) | 1978-12-21 |
Family
ID=26999595
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2421503A Ceased DE2421503B2 (de) | 1973-05-04 | 1974-05-03 | Verfahren zur Herstellung von Phenyl- oder Alkylphenylmono- oder diisoxyanaten |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5030832A (https=) |
| AR (1) | AR202301A1 (https=) |
| AU (1) | AU477106B2 (https=) |
| CA (1) | CA1023379A (https=) |
| CH (1) | CH598199A5 (https=) |
| DD (1) | DD112990A5 (https=) |
| DE (1) | DE2421503B2 (https=) |
| ES (1) | ES425950A1 (https=) |
| FR (1) | FR2228056B1 (https=) |
| GB (1) | GB1458595A (https=) |
| HU (1) | HU171538B (https=) |
| IL (1) | IL44694A (https=) |
| IN (1) | IN141148B (https=) |
| LU (1) | LU69986A1 (https=) |
| MY (1) | MY7700322A (https=) |
| NL (1) | NL7405881A (https=) |
| NO (1) | NO140794C (https=) |
| PH (1) | PH11683A (https=) |
| RO (1) | RO63097A (https=) |
| SE (1) | SE419539B (https=) |
| YU (1) | YU120074A (https=) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5219624A (en) * | 1975-08-07 | 1977-02-15 | Mitsui Toatsu Chem Inc | Process for preparation of isocyanates |
| JPS5488222A (en) * | 1977-12-20 | 1979-07-13 | Mitsubishi Chem Ind Ltd | Preparation of isocyanate from carbamate |
| DE2819826A1 (de) | 1978-05-05 | 1979-11-08 | Bayer Ag | Verfahren zur herstellung von urethanen |
| JPS5576484U (https=) * | 1978-11-13 | 1980-05-26 | ||
| DE3009489A1 (de) | 1980-03-12 | 1981-09-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von urethanen |
| US4487713A (en) * | 1981-06-26 | 1984-12-11 | Exxon Research & Engineering Co. | Production of isocyanates from esters of aromatic carbamic acids (urethanes) |
| JPH02231461A (ja) * | 1989-03-06 | 1990-09-13 | Mitsubishi Gas Chem Co Inc | キシレンジイソシアネートの製造方法 |
| DE4141402A1 (de) * | 1991-12-16 | 1993-06-17 | Bayer Ag | Verfahren zur herstellung von hochreinen aromatischen di- und/oder polyurethanen |
| DE10209095A1 (de) | 2002-03-01 | 2003-09-11 | Basf Ag | Verfahren zur Herstellung von Isocyanaten |
| CN102652124B (zh) * | 2009-12-24 | 2015-05-13 | 三井化学株式会社 | 异氰酸酯残渣的处理方法及碳酸酯的处理方法 |
-
1974
- 1974-04-02 CA CA196,577A patent/CA1023379A/en not_active Expired
- 1974-04-11 AU AU67801/74A patent/AU477106B2/en not_active Expired
- 1974-04-16 SE SE7405108A patent/SE419539B/xx unknown
- 1974-04-23 IL IL44694A patent/IL44694A/xx unknown
- 1974-04-24 IN IN927/CAL/1974A patent/IN141148B/en unknown
- 1974-04-24 PH PH15776A patent/PH11683A/en unknown
- 1974-04-29 YU YU01200/74A patent/YU120074A/xx unknown
- 1974-05-02 NL NL7405881A patent/NL7405881A/xx unknown
- 1974-05-03 GB GB1957874A patent/GB1458595A/en not_active Expired
- 1974-05-03 AR AR253577A patent/AR202301A1/es active
- 1974-05-03 DE DE2421503A patent/DE2421503B2/de not_active Ceased
- 1974-05-03 ES ES425950A patent/ES425950A1/es not_active Expired
- 1974-05-03 FR FR747415446A patent/FR2228056B1/fr not_active Expired
- 1974-05-03 CH CH608974A patent/CH598199A5/xx not_active IP Right Cessation
- 1974-05-03 DD DD178284A patent/DD112990A5/xx unknown
- 1974-05-03 LU LU69986A patent/LU69986A1/xx unknown
- 1974-05-03 NO NO741607A patent/NO140794C/no unknown
- 1974-05-03 HU HU74AA00000769A patent/HU171538B/hu unknown
- 1974-05-03 RO RO7400078670A patent/RO63097A/ro unknown
- 1974-05-04 JP JP49050194A patent/JPS5030832A/ja active Pending
-
1977
- 1977-12-31 MY MY1977322A patent/MY7700322A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD112990A5 (https=) | 1975-05-12 |
| ES425950A1 (es) | 1976-09-16 |
| IL44694A0 (en) | 1974-06-30 |
| PH11683A (en) | 1978-05-19 |
| LU69986A1 (https=) | 1974-11-28 |
| JPS5030832A (https=) | 1975-03-27 |
| IN141148B (https=) | 1977-01-22 |
| CA1023379A (en) | 1977-12-27 |
| YU120074A (en) | 1982-06-18 |
| HU171538B (hu) | 1978-02-28 |
| SE419539B (sv) | 1981-08-10 |
| AR202301A1 (es) | 1975-05-30 |
| CH598199A5 (https=) | 1978-04-28 |
| NO140794C (no) | 1979-11-14 |
| IL44694A (en) | 1978-06-15 |
| AU6780174A (en) | 1975-10-16 |
| RO63097A (fr) | 1978-06-15 |
| NO140794B (no) | 1979-08-06 |
| FR2228056B1 (https=) | 1979-02-09 |
| NO741607L (no) | 1974-11-05 |
| AU477106B2 (en) | 1976-10-14 |
| DE2421503A1 (de) | 1974-11-21 |
| GB1458595A (en) | 1976-12-15 |
| NL7405881A (https=) | 1974-11-06 |
| MY7700322A (en) | 1977-12-31 |
| FR2228056A1 (https=) | 1974-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0061013B1 (de) | Verfahren zur Herstellung von Polyisocyanaten | |
| EP0092738B1 (de) | Verfahren zur kontinuierlichen thermischen Spaltung von Carbamidsäureestern | |
| EP0054817B1 (de) | Verfahren zur kontinuierlichen thermischen Spaltung von Carbamidsäureestern und die Verwendung von hierbei anfallenden Isocyanate und Carbamidsäureester aufweisenden Gemischen zur Herstellung von Isocyanaten | |
| DE2530001A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE2421503B2 (de) | Verfahren zur Herstellung von Phenyl- oder Alkylphenylmono- oder diisoxyanaten | |
| DE2526193B2 (de) | Verfahren zur Herstellung von Isocyanaten aus niedermolekularen Alkylestern einer einkernigen Carbaminsäure | |
| DD139576A5 (de) | Verfahren zur herstellung von diphenylmethanmono-und-dicarbamaten und polymethylen-polyphenylcarbamaten | |
| EP0100047B1 (de) | Verfahren zur Herstellung von Hexamethylen-diisocyanat-1,6 und/oder isomeren Diisocyanaten mit 6 Kohlenstoffatomen im Alkylenrest | |
| DE2512514C2 (de) | Verfahren zur Herstellung von aliphatischen Isocyanaten | |
| DE2756928A1 (de) | Verfahren zur kontinuierlichen herstellung von monoisocyanaten | |
| EP0396977B1 (de) | Verfahren zur Herstellung von Polyisocyanaten | |
| EP0749959B1 (de) | Verfahren zur Entfernung von Nebenprodukten aus Diurethanen | |
| DE69006475T2 (de) | Verfahren zur Herstellung von Isocyanatverbindung. | |
| EP0261604B1 (de) | Neue 2-(Alkoximethyl)-pentan-1,5-diisocyanate, - diurethane und dicarbamidsäurechloride, Verfahren zu ihrer Herstellung und deren Verwendung | |
| EP0000778B1 (de) | Verfahren zur Herstellung von Polyaminen der Diphenylmethanreihe | |
| EP0027954B1 (de) | Verfahren zur Herstellung von Urethanen und ihre Verwendung zur Herstellung von Isocyanaten | |
| EP0003570B1 (de) | Verfahren zur kontinuierlichen Aufarbeitung von bei der Phosgenierung von Monoaminen anfallenden Lösungen | |
| EP0396976A2 (de) | Verfahren zur Herstellung von Polyisocyanaten | |
| DE2336403A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE2142401C3 (de) | Verfahren zur Herstellung von epsilon-Caprolactam und O-Acetylcyclohexanonoxim | |
| DE60112001T2 (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE2639931C2 (de) | Verfahren zur Herstellung von aliphatischen Monoisocyanaten | |
| DE3204973A1 (de) | Verfahren zur herstellung von isocyanaten aus carbamaten | |
| DE4413580A1 (de) | Verfahren zur Herstellung von 1,4-Diisocyanatobutan (BDI) | |
| DE1643971A1 (de) | m- und p-Isopropenylphenyl-dimethylcarbinol und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8228 | New agent |
Free format text: SPOTT, G., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8235 | Patent refused |