DE2408813A1 - N-carbamoyloxypyridiniumsalze und verfahren zur herstellung derselben - Google Patents
N-carbamoyloxypyridiniumsalze und verfahren zur herstellung derselbenInfo
- Publication number
- DE2408813A1 DE2408813A1 DE19742408813 DE2408813A DE2408813A1 DE 2408813 A1 DE2408813 A1 DE 2408813A1 DE 19742408813 DE19742408813 DE 19742408813 DE 2408813 A DE2408813 A DE 2408813A DE 2408813 A1 DE2408813 A1 DE 2408813A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- aryl
- alkyl
- stands
- pyridine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- CZJWRCGMJPIJSJ-UHFFFAOYSA-O pyridin-1-ium-1-yl carbamate Chemical class NC(=O)O[N+]1=CC=CC=C1 CZJWRCGMJPIJSJ-UHFFFAOYSA-O 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 7
- 239000000460 chlorine Substances 0.000 claims description 16
- -1 sodium fluoroborate Chemical compound 0.000 claims description 16
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical class [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 claims description 5
- 229910001488 sodium perchlorate Inorganic materials 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 3
- 125000005281 alkyl ureido group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- 150000002431 hydrogen Chemical group 0.000 claims 2
- 125000004193 piperazinyl group Chemical group 0.000 claims 2
- 229920006395 saturated elastomer Polymers 0.000 claims 2
- 229910021538 borax Inorganic materials 0.000 claims 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 claims 1
- 235000010339 sodium tetraborate Nutrition 0.000 claims 1
- 239000004328 sodium tetraborate Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 11
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 150000001805 chlorine compounds Chemical class 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 235000013877 carbamide Nutrition 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 230000001476 alcoholic effect Effects 0.000 description 5
- 239000012038 nucleophile Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229940125758 compound 15 Drugs 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QGFLEQOBTFAZFQ-UHFFFAOYSA-N [Cl-].C(N)(=O)O[N+]1=CC=CC=C1 Chemical compound [Cl-].C(N)(=O)O[N+]1=CC=CC=C1 QGFLEQOBTFAZFQ-UHFFFAOYSA-N 0.000 description 2
- VYWQTJWGWLKBQA-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;chloride Chemical compound Cl.NC(N)=O VYWQTJWGWLKBQA-UHFFFAOYSA-N 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- HTZLCTZGXSXMAS-UHFFFAOYSA-N morpholine-4-carboxamide;hydrochloride Chemical compound Cl.NC(=O)N1CCOCC1 HTZLCTZGXSXMAS-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- CFZKDDTWZYUZKS-UHFFFAOYSA-N picoline N-oxide Chemical compound CC1=CC=CC=[N+]1[O-] CFZKDDTWZYUZKS-UHFFFAOYSA-N 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- QBNLGSOBSNKMBN-UHFFFAOYSA-N 2,4,6-trimethyl-1-oxidopyridin-1-ium Chemical compound CC1=CC(C)=[N+]([O-])C(C)=C1 QBNLGSOBSNKMBN-UHFFFAOYSA-N 0.000 description 1
- SPTGLTSDLLDPOO-UHFFFAOYSA-M 2,4,6-trimethylpyrylium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.CC1=CC(C)=[O+]C(C)=C1 SPTGLTSDLLDPOO-UHFFFAOYSA-M 0.000 description 1
- ZOJJJVRLKLQJNV-UHFFFAOYSA-N 2-(2,2-dimethoxyethoxy)-1,1-dimethoxyethane Chemical compound COC(OC)COCC(OC)OC ZOJJJVRLKLQJNV-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QDACQOOLIVCDNP-UHFFFAOYSA-N 2-nitro-1-oxidopyridin-1-ium Chemical class [O-][N+](=O)C1=CC=CC=[N+]1[O-] QDACQOOLIVCDNP-UHFFFAOYSA-N 0.000 description 1
- PNMIRZKQNUFAAP-UHFFFAOYSA-N 3-methylpyridine;perchloric acid Chemical compound OCl(=O)(=O)=O.CC1=CC=CN=C1 PNMIRZKQNUFAAP-UHFFFAOYSA-N 0.000 description 1
- DPJVRASYWYOFSJ-UHFFFAOYSA-N 4-chloro-1-oxidopyridin-1-ium Chemical compound [O-][N+]1=CC=C(Cl)C=C1 DPJVRASYWYOFSJ-UHFFFAOYSA-N 0.000 description 1
- RXKNNAKAVAHBNK-UHFFFAOYSA-N 4-nitropyridine-n-oxide Chemical compound [O-][N+](=O)C1=CC=[N+]([O-])C=C1 RXKNNAKAVAHBNK-UHFFFAOYSA-N 0.000 description 1
- XFJBGINZIMNZBW-CRAIPNDOSA-N 5-chloro-2-[4-[(1r,2s)-2-[2-(5-methylsulfonylpyridin-2-yl)oxyethyl]cyclopropyl]piperidin-1-yl]pyrimidine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OCC[C@H]1[C@@H](C2CCN(CC2)C=2N=CC(Cl)=CN=2)C1 XFJBGINZIMNZBW-CRAIPNDOSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- 229910020808 NaBF Inorganic materials 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000021120 animal protein Nutrition 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- CWYNXQHYFSPMAD-UHFFFAOYSA-N ethyl n-(1-oxidopyridin-1-ium-3-yl)carbamate Chemical compound CCOC(=O)NC1=CC=C[N+]([O-])=C1 CWYNXQHYFSPMAD-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical group O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical group C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- HVDONSGJXJFNRV-UHFFFAOYSA-M n,n-diphenylpyridin-1-ium-1-carboxamide;chloride Chemical compound [Cl-].C=1C=CC=C[N+]=1C(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 HVDONSGJXJFNRV-UHFFFAOYSA-M 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UGZVCHWAXABBHR-UHFFFAOYSA-O pyridin-1-ium-1-carboxamide Chemical class NC(=O)[N+]1=CC=CC=C1 UGZVCHWAXABBHR-UHFFFAOYSA-O 0.000 description 1
- WJRJWFSYISIKLM-UHFFFAOYSA-N pyridin-1-ium-1-yl carbamate perchlorate Chemical compound Cl(=O)(=O)(=O)[O-].C(N)(=O)O[N+]1=CC=CC=C1 WJRJWFSYISIKLM-UHFFFAOYSA-N 0.000 description 1
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- AVWRKZWQTYIKIY-UHFFFAOYSA-N ureidocarboxylic acid Natural products NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742408813 DE2408813A1 (de) | 1974-02-23 | 1974-02-23 | N-carbamoyloxypyridiniumsalze und verfahren zur herstellung derselben |
| BE1006467A BE825684A (nl) | 1974-02-23 | 1975-02-19 | N-carbamoyloxypyridiniumzouten en werkwijze voor het bereiding daarvan |
| CH220375A CH613694A5 (en) | 1974-02-23 | 1975-02-21 | Process for the preparation of N-carbamoylpyridinium salts |
| CA220,553A CA1068692A (en) | 1974-02-23 | 1975-02-21 | N-carbamoyloxypyridinium salts and a process for their preparation |
| GB733375A GB1487283A (en) | 1974-02-23 | 1975-02-21 | N-carbamoyloxypyridinium salts and a process for their preparation |
| FR7505530A FR2262036B1 (en:Method) | 1974-02-23 | 1975-02-21 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742408813 DE2408813A1 (de) | 1974-02-23 | 1974-02-23 | N-carbamoyloxypyridiniumsalze und verfahren zur herstellung derselben |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2408813A1 true DE2408813A1 (de) | 1975-09-04 |
Family
ID=5908294
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742408813 Pending DE2408813A1 (de) | 1974-02-23 | 1974-02-23 | N-carbamoyloxypyridiniumsalze und verfahren zur herstellung derselben |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE825684A (en:Method) |
| CA (1) | CA1068692A (en:Method) |
| CH (1) | CH613694A5 (en:Method) |
| DE (1) | DE2408813A1 (en:Method) |
| FR (1) | FR2262036B1 (en:Method) |
| GB (1) | GB1487283A (en:Method) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2446501A1 (fr) * | 1979-01-11 | 1980-08-08 | Gaf Corp | Materiau photographique comportant une couche antistatique a base de polymere acide carboxylique |
| EP1089305A3 (en) * | 1999-09-29 | 2004-09-08 | Fuji Photo Film Co., Ltd. | Electrolyte composition, photoelectric conversion device and photo-electrochemical cell |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60222479A (ja) * | 1984-04-20 | 1985-11-07 | Nippon Tokushu Noyaku Seizo Kk | テトラヒドロキノリン―１―イルカルボニルイミダゾール誘導体、その製法並びに除草又は農園芸用殺菌剤 |
| JPS6160682A (ja) * | 1984-08-30 | 1986-03-28 | Nippon Tokushu Noyaku Seizo Kk | テトラヒドロキノリン−１−イルカルボニルイミダゾ−ル誘導体、その中間体、それらの製法並びに除草又は農園芸用殺菌剤 |
| JPS61227506A (ja) * | 1985-04-01 | 1986-10-09 | Nippon Tokushu Noyaku Seizo Kk | カルバモイルイミダゾ−ル類、その中間体、それらの製法並びに除草剤又は農園芸用殺菌剤 |
| US4843163A (en) * | 1987-12-02 | 1989-06-27 | Smithkline Beckman Corporation | Certain 3-(2-phenethyl)-1-carbamoyloxypyridinium halide intermediates |
| CA2585645C (en) | 2004-10-29 | 2014-10-21 | Musc Foundation For Research Development | Ceramides and apoptosis-signaling ligand |
| US8093393B2 (en) | 2004-10-29 | 2012-01-10 | Musc Foundation For Research Development | Cationic ceramides, and analogs thereof, and their use for preventing or treating cancer |
| WO2010054223A1 (en) | 2008-11-06 | 2010-05-14 | Musc Foundation For Research Development | Lysosomotropic inhibitors of acid ceramidase |
-
1974
- 1974-02-23 DE DE19742408813 patent/DE2408813A1/de active Pending
-
1975
- 1975-02-19 BE BE1006467A patent/BE825684A/xx unknown
- 1975-02-21 CH CH220375A patent/CH613694A5/xx not_active IP Right Cessation
- 1975-02-21 CA CA220,553A patent/CA1068692A/en not_active Expired
- 1975-02-21 FR FR7505530A patent/FR2262036B1/fr not_active Expired
- 1975-02-21 GB GB733375A patent/GB1487283A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2446501A1 (fr) * | 1979-01-11 | 1980-08-08 | Gaf Corp | Materiau photographique comportant une couche antistatique a base de polymere acide carboxylique |
| EP1089305A3 (en) * | 1999-09-29 | 2004-09-08 | Fuji Photo Film Co., Ltd. | Electrolyte composition, photoelectric conversion device and photo-electrochemical cell |
Also Published As
| Publication number | Publication date |
|---|---|
| CH613694A5 (en) | 1979-10-15 |
| BE825684A (nl) | 1975-08-19 |
| GB1487283A (en) | 1977-09-28 |
| CA1068692A (en) | 1979-12-25 |
| FR2262036B1 (en:Method) | 1979-04-20 |
| FR2262036A1 (en:Method) | 1975-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795808C2 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| DE2065236C3 (de) | Phosphonsäuresalze, ihre Herstellung und Verwendung | |
| DE3840954A1 (de) | Herstellung von 2-chlornicotinsaeureestern | |
| DE2408813A1 (de) | N-carbamoyloxypyridiniumsalze und verfahren zur herstellung derselben | |
| EP1444205B1 (de) | Verfahren zur herstellung von 2-halogenpyridincarbonsäureamiden | |
| DE2858737C2 (en:Method) | ||
| DE2809720C2 (en:Method) | ||
| DE2756638A1 (de) | Imidazoline, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln | |
| DE2206366B2 (de) | Verfahren zur Herstellung von substituierten Diaminocarbonylderivaten | |
| DD271326A5 (de) | Verfahren zur herstellung von dialkyloxalacetaten | |
| DE2836077A1 (de) | Herstellung von 2,3,5-trichlorpyridin | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| EP0461501A1 (de) | Verfahren zur Herstellung von Chinolincarbonsäuren | |
| EP0694534A1 (de) | 3-Substituierte Chinolin-5-carbonsäurederivate und Verfahren zu ihrer Herstellung | |
| DE69710773T2 (de) | Verfahren zur herstellung von halogenierten heteroarylverbindungen | |
| DE2814330A1 (de) | Verfahren zur herstellung eines 2,6-dichlorpyridin-derivats | |
| DE4302013C1 (de) | Verfahren zur Herstellung reiner Phenothiazinfarbstoffe | |
| EP1162197B1 (de) | Verfahren zur Herstellung von Pyridinen durch Oxidation von Dihydropyridinen mittels Methylnitrit | |
| DE3111518C2 (de) | Verfahren zur Herstellung von Carbamoylsulfonsäuresalzen | |
| EP0427161B1 (de) | Picolylselenobenzamide von Aminopyridinen, Anilinen und Picolylaminen | |
| DE1445916C (de) | Verfahren zur Herstellung von Verbindungen der Oxazolreihe | |
| DE60103986T2 (de) | Verbessertes verfahren zur herstellung von n,n-disubstituiertem p-phenylendiamin | |
| DE1445982A1 (de) | Verfahren fuer die Herstellung von 4-Amin-5-Arylazopyrimidin-Derivaten | |
| AT236936B (de) | Verfahren zur Herstellung von neuen 4-(Pyridoylamidoacylamino)-1-phenyl-2,3-dimethylpyrazolonen-(5) oder deren Salzen | |
| DE2201673C3 (de) | Verfahren zur Herstellung von 3.5- Dinitro-2-amino-benzonitril |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OHN | Withdrawal |