DE2407744A1 - Chinolin-3-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel - Google Patents
Chinolin-3-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittelInfo
- Publication number
- DE2407744A1 DE2407744A1 DE19742407744 DE2407744A DE2407744A1 DE 2407744 A1 DE2407744 A1 DE 2407744A1 DE 19742407744 DE19742407744 DE 19742407744 DE 2407744 A DE2407744 A DE 2407744A DE 2407744 A1 DE2407744 A1 DE 2407744A1
- Authority
- DE
- Germany
- Prior art keywords
- oxo
- dihydro
- tetrazol
- ethyl
- quinoline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 46
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 12
- JXXYYPJPGVUSCO-UHFFFAOYSA-N n-(2h-tetrazol-5-yl)quinoline-3-carboxamide Chemical class C=1N=C2C=CC=CC2=CC=1C(=O)NC=1N=NNN=1 JXXYYPJPGVUSCO-UHFFFAOYSA-N 0.000 title claims description 5
- -1 nitro, hydroxy, methoxy Chemical group 0.000 claims description 112
- 239000002253 acid Substances 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 150000002148 esters Chemical class 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 239000003814 drug Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000004480 active ingredient Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 159000000000 sodium salts Chemical class 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 150000004703 alkoxides Chemical class 0.000 claims description 2
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 150000004683 dihydrates Chemical class 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 1
- 230000003197 catalytic effect Effects 0.000 claims 1
- 239000008024 pharmaceutical diluent Substances 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 51
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 32
- 239000007787 solid Substances 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- 239000000203 mixture Substances 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- RIICGUOPZNBDLE-UHFFFAOYSA-N 1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1=CC=C2N(CCO)C=C(C(O)=O)C(=O)C2=C1 RIICGUOPZNBDLE-UHFFFAOYSA-N 0.000 description 13
- 229960000583 acetic acid Drugs 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000002168 alkylating agent Substances 0.000 description 12
- 229940100198 alkylating agent Drugs 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 6
- BLTDCIWCFCUQCB-UHFFFAOYSA-N quinoline-3-carboxamide Chemical compound C1=CC=CC2=CC(C(=O)N)=CN=C21 BLTDCIWCFCUQCB-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- SKKHQZCXXSAJCP-UHFFFAOYSA-N 1-ethyl-6-hydroxy-4-oxoquinoline-3-carboxylic acid Chemical compound OC1=CC=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 SKKHQZCXXSAJCP-UHFFFAOYSA-N 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- FDTKSXZUNFFUTD-UHFFFAOYSA-N 6-hydroxy-4-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=C(O)C=C2C(=O)C(C(=O)O)=CNC2=C1 FDTKSXZUNFFUTD-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 4
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 4
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 4
- 229940008406 diethyl sulfate Drugs 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000010986 ammonium phosphatide Nutrition 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- GMQZCXRSOWOGAH-UHFFFAOYSA-N 4-oxo-1-propan-2-ylquinoline-3-carboxylic acid Chemical compound C1=CC=C2N(C(C)C)C=C(C(O)=O)C(=O)C2=C1 GMQZCXRSOWOGAH-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229910003445 palladium oxide Inorganic materials 0.000 description 2
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 2
- CCWROOWBCZEPAQ-UHFFFAOYSA-N 1-benzyl-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC=CC=C2C(=O)C(C(=O)O)=CN1CC1=CC=CC=C1 CCWROOWBCZEPAQ-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- BZUPVJUPNAZPNX-UHFFFAOYSA-N 1-ethyl-4-oxo-7-(trifluoromethyl)quinoline-3-carboxylic acid Chemical compound C1=C(C(F)(F)F)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 BZUPVJUPNAZPNX-UHFFFAOYSA-N 0.000 description 1
- ZSEJADLCFCHIGX-UHFFFAOYSA-N 1-ethyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=CC=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 ZSEJADLCFCHIGX-UHFFFAOYSA-N 0.000 description 1
- MOPWOAGQHVEDAT-UHFFFAOYSA-N 1-ethyl-7-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(F)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MOPWOAGQHVEDAT-UHFFFAOYSA-N 0.000 description 1
- YLXQJGROERLNSR-UHFFFAOYSA-N 1-ethyl-7-hydroxy-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(O)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 YLXQJGROERLNSR-UHFFFAOYSA-N 0.000 description 1
- WBHKMAPRABNYBR-UHFFFAOYSA-N 1-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=CC=C2N(C)C=C(C(O)=O)C(=O)C2=C1 WBHKMAPRABNYBR-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- OGIQUQKNJJTLSZ-UHFFFAOYSA-N 4-butylaniline Chemical compound CCCCC1=CC=C(N)C=C1 OGIQUQKNJJTLSZ-UHFFFAOYSA-N 0.000 description 1
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 1
- UMGYNDKFPNCPGA-UHFFFAOYSA-N 6-butyl-4-oxo-1h-quinoline-3-carboxylic acid Chemical compound N1C=C(C(O)=O)C(=O)C2=CC(CCCC)=CC=C21 UMGYNDKFPNCPGA-UHFFFAOYSA-N 0.000 description 1
- PVKUHQGATOVVJR-UHFFFAOYSA-N 6-methoxy-4-oxo-3h-quinoline-3-carboxylic acid Chemical compound N1=CC(C(O)=O)C(=O)C2=CC(OC)=CC=C21 PVKUHQGATOVVJR-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000004984 dialkylaminoalkoxy group Chemical group 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- AWSUKWGIGJRPDU-UHFFFAOYSA-N ethyl 1-(2-methoxyethyl)-4-oxoquinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CN(CCOC)C2=C1 AWSUKWGIGJRPDU-UHFFFAOYSA-N 0.000 description 1
- RWZQZQCEKZIQHV-UHFFFAOYSA-N ethyl 1-benzyl-4-oxoquinoline-3-carboxylate Chemical compound C12=CC=CC=C2C(=O)C(C(=O)OCC)=CN1CC1=CC=CC=C1 RWZQZQCEKZIQHV-UHFFFAOYSA-N 0.000 description 1
- GGBREFQGSWQVOP-UHFFFAOYSA-N ethyl 1-ethyl-6-methoxy-4-oxoquinoline-3-carboxylate Chemical compound C1=C(OC)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 GGBREFQGSWQVOP-UHFFFAOYSA-N 0.000 description 1
- FRSYIBLQNGWKES-UHFFFAOYSA-N ethyl 1-ethyl-7-fluoro-4-oxoquinoline-3-carboxylate Chemical compound FC1=CC=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 FRSYIBLQNGWKES-UHFFFAOYSA-N 0.000 description 1
- YBEOYBKKSWUSBR-UHFFFAOYSA-N ethyl 4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 YBEOYBKKSWUSBR-UHFFFAOYSA-N 0.000 description 1
- LPLCLELTFXHIOG-UHFFFAOYSA-N ethyl 6-butyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound N1C=C(C(=O)OCC)C(=O)C2=CC(CCCC)=CC=C21 LPLCLELTFXHIOG-UHFFFAOYSA-N 0.000 description 1
- LDZCUWZFXKDMHH-UHFFFAOYSA-N ethyl 7-fluoro-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=C(F)C=CC2=C(O)C(C(=O)OCC)=CN=C21 LDZCUWZFXKDMHH-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229910052811 halogen oxide Inorganic materials 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 1
- 125000005191 hydroxyalkylamino group Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- OXGAFKDACJZTKH-UHFFFAOYSA-N n-(2-bromoethyl)-2-phenylethanamine Chemical compound BrCCNCCC1=CC=CC=C1 OXGAFKDACJZTKH-UHFFFAOYSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- LRTFPLFDLJYEKT-UHFFFAOYSA-N para-isopropylaniline Chemical compound CC(C)C1=CC=C(N)C=C1 LRTFPLFDLJYEKT-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000003033 spasmogenic effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB924973A GB1433774A (en) | 1973-02-26 | 1973-02-26 | Heterocyclic compounds apparatus for conveying articles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2407744A1 true DE2407744A1 (de) | 1974-08-29 |
Family
ID=9868317
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742407744 Pending DE2407744A1 (de) | 1973-02-26 | 1974-02-18 | Chinolin-3-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel |
Country Status (14)
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4264604A (en) | 1977-07-01 | 1981-04-28 | Ciba-Geigy Corporation | Quinolonecarboxylic acid derivatives as bactericides |
| WO1999010347A1 (en) * | 1997-08-25 | 1999-03-04 | Neurogen Corporation | Substituted 4-oxo-napthyridine-3-carboxamides as gaba brain receptor ligands |
| WO1999043661A3 (en) * | 1998-02-26 | 2000-01-06 | Neurogen Corp | Substituted cycloalkyl-4-oxonicotinic carboxamides; gaba brain receptor ligands |
| US6034100A (en) * | 1993-03-10 | 2000-03-07 | Otsuka Pharmaceutical Co., Ltd. | Method for inhibiting cytokine secretion |
| US6143760A (en) * | 1997-08-25 | 2000-11-07 | Neurogen Corporation | Substituted 4-oxo-napthyridine-3-carboxamides: GABA brain receptor ligands |
| WO2006002421A3 (en) * | 2004-06-24 | 2006-09-21 | Vertex Pharma | Modulators of atp-binding cassette transporters |
| US8354427B2 (en) | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| US8410274B2 (en) | 2005-12-28 | 2013-04-02 | Vertex Pharmaceuticals | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| EP2502913A3 (en) * | 2004-06-24 | 2013-11-27 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| RU2525115C2 (ru) * | 2004-06-24 | 2014-08-10 | Вертекс Фармасьютикалз Инкорпорейтед | Способ модуляции транспортеров атф-связывающей кассеты |
| US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
| US9701639B2 (en) | 2014-10-07 | 2017-07-11 | Vertex Pharmaceuticals Incorporated | Co-crystals of modulators of cystic fibrosis transmembrane conductance regulator |
| US9751839B2 (en) | 2009-03-20 | 2017-09-05 | Vertex Pharmaceuticals Incorporated | Process for making modulators of cystic fibrosis transmembrane conductance regulator |
| US10272046B2 (en) | 2012-02-27 | 2019-04-30 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US10646481B2 (en) | 2008-08-13 | 2020-05-12 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2324304A2 (fr) * | 1975-09-22 | 1977-04-15 | Roussel Uclaf | Nouveaux derives de l'acide 3-quinoleine carboxylique, leur procede de preparation et leur application comme medicament |
| US4186201A (en) | 1977-02-07 | 1980-01-29 | Riker Laboratories, Inc. | Methods of using 8(tetrazol-5-ylcarbamoyl)isoquinoline compounds |
| US4390541A (en) | 1980-12-19 | 1983-06-28 | Lilly Industries Limited | Quinolone derivatives and their use in a method of controlling an immediate hypersensitivity disease |
| FR2509728A1 (fr) * | 1981-07-17 | 1983-01-21 | Roussel Uclaf | Nouveaux derives de la quinoleine, leurs sels, procede de preparation, application a titre de medicaments et compositions les renfermant |
| US4377579A (en) | 1981-12-03 | 1983-03-22 | Minnesota Mining And Manufacturing Company | N-(Tetrazol-5-yl)phenazine-1-carboxamides |
| FR2537140B1 (fr) * | 1982-12-07 | 1986-07-18 | Roussel Uclaf | Nouveaux derives de la 4-hydroxy-3-quinoleine carboxamide, leur sels, procede de preparation, application a titre de medicaments, et compositions les renfermant |
| EP0298134B1 (en) * | 1987-01-20 | 1992-11-11 | Dainippon Pharmaceutical Co., Ltd. | Aromatic heterocyclic carboxylic acid amide derivatives, process for their preparation, and pharmaceutical composition containing same |
| US4959363A (en) * | 1989-06-23 | 1990-09-25 | Sterling Drug Inc. | Quinolonecarboxamide compounds, their preparation and use as antivirals. |
| BR0309965A (pt) * | 2002-05-14 | 2005-03-01 | Univ California | ácidos carboxìlicos com quinolona substituìda, seus derivados, local de ação, e usos dos mesmos |
| KR20060041254A (ko) | 2003-07-24 | 2006-05-11 | 아스텔라스세이야쿠 가부시키가이샤 | 퀴놀론 유도체 또는 그의 염 |
| EP2821401B1 (en) | 2012-03-02 | 2020-09-09 | Takeda Pharmaceutical Company Limited | Dihydroquinolinone compounds as modulators of the muscarininc m1 receptor |
| EP2921480B1 (en) | 2012-11-19 | 2017-10-11 | Takeda Pharmaceutical Company Limited | Nitrogen-containing heterocyclic compound |
| CN105330602B (zh) * | 2015-12-07 | 2018-02-09 | 江南大学 | 一种癸氧喹酯类似物及其应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1383088A (en) * | 1972-07-03 | 1975-02-05 | Allen & Hanburys Ltd | Pharmacologically active quinaldamide derivatives |
-
1973
- 1973-02-26 GB GB924973A patent/GB1433774A/en not_active Expired
-
1974
- 1974-02-08 IE IE00249/74A patent/IE38886B1/xx unknown
- 1974-02-11 ZA ZA740883A patent/ZA74883B/xx unknown
- 1974-02-14 AU AU65592/74A patent/AU474797B2/en not_active Expired
- 1974-02-14 SE SE7401984A patent/SE7401984L/xx unknown
- 1974-02-18 CH CH224374A patent/CH602707A5/xx not_active IP Right Cessation
- 1974-02-18 DE DE19742407744 patent/DE2407744A1/de active Pending
- 1974-02-19 BE BE141102A patent/BE811246A/xx unknown
- 1974-02-22 LU LU69479A patent/LU69479A1/xx unknown
- 1974-02-25 AT AT149974A patent/AT329562B/de not_active IP Right Cessation
- 1974-02-25 FR FR7406327A patent/FR2218896B1/fr not_active Expired
- 1974-02-25 JP JP49022232A patent/JPS5029574A/ja active Pending
- 1974-02-26 CA CA193,476A patent/CA1025856A/en not_active Expired
- 1974-02-26 NL NL7402613A patent/NL7402613A/xx not_active Application Discontinuation
Cited By (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4264604A (en) | 1977-07-01 | 1981-04-28 | Ciba-Geigy Corporation | Quinolonecarboxylic acid derivatives as bactericides |
| US6034100A (en) * | 1993-03-10 | 2000-03-07 | Otsuka Pharmaceutical Co., Ltd. | Method for inhibiting cytokine secretion |
| WO1999010347A1 (en) * | 1997-08-25 | 1999-03-04 | Neurogen Corporation | Substituted 4-oxo-napthyridine-3-carboxamides as gaba brain receptor ligands |
| US6143760A (en) * | 1997-08-25 | 2000-11-07 | Neurogen Corporation | Substituted 4-oxo-napthyridine-3-carboxamides: GABA brain receptor ligands |
| US6399604B1 (en) | 1997-08-25 | 2002-06-04 | Neurogen Corporation | Substituted 4-OXO-napthyridine-3-carboxamides; GABA brain receptor ligands |
| WO1999043661A3 (en) * | 1998-02-26 | 2000-01-06 | Neurogen Corp | Substituted cycloalkyl-4-oxonicotinic carboxamides; gaba brain receptor ligands |
| US6194427B1 (en) | 1998-02-26 | 2001-02-27 | Neurogen Corporation | Substituted cycloalkyl-4-Oxonicotinic carboxamides; gaba brain receptor ligands |
| US6448259B1 (en) | 1998-02-26 | 2002-09-10 | Neurogen Corporation | Substituted cycloalkyl-4-oxonicotinic carboxamides; GABA brain receptor ligands |
| US8324242B2 (en) | 2004-06-24 | 2012-12-04 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| EP2502913A3 (en) * | 2004-06-24 | 2013-11-27 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8101767B2 (en) | 2004-06-24 | 2012-01-24 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| EP2489659A1 (en) * | 2004-06-24 | 2012-08-22 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| EP2530075A3 (en) * | 2004-06-24 | 2014-12-24 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8354427B2 (en) | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| US10662192B2 (en) | 2004-06-24 | 2020-05-26 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US7495103B2 (en) | 2004-06-24 | 2009-02-24 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| EP2502914A3 (en) * | 2004-06-24 | 2013-12-04 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8614327B2 (en) | 2004-06-24 | 2013-12-24 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8629162B2 (en) | 2004-06-24 | 2014-01-14 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8741925B2 (en) | 2004-06-24 | 2014-06-03 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| WO2006002421A3 (en) * | 2004-06-24 | 2006-09-21 | Vertex Pharma | Modulators of atp-binding cassette transporters |
| RU2525115C2 (ru) * | 2004-06-24 | 2014-08-10 | Вертекс Фармасьютикалз Инкорпорейтед | Способ модуляции транспортеров атф-связывающей кассеты |
| US9090619B2 (en) | 2004-06-24 | 2015-07-28 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8829204B2 (en) | 2004-06-24 | 2014-09-09 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| US8754224B2 (en) | 2005-12-28 | 2014-06-17 | Vertex Pharmaceuticals Incorporated | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US11291662B2 (en) | 2005-12-28 | 2022-04-05 | Vertex Pharmaceuticals Incorporated | Solid forms of n-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US9139530B2 (en) | 2005-12-28 | 2015-09-22 | Vertex Pharmaceuticals Incorporated | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US9670163B2 (en) | 2005-12-28 | 2017-06-06 | Vertex Pharmaceuticals Incorporated | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US9931334B2 (en) | 2005-12-28 | 2018-04-03 | Vertex Pharmaceuticals Incorporated | Solid forms of N[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US10537565B2 (en) | 2005-12-28 | 2020-01-21 | Vertex Pharmaceuticals Incorporated | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US8410274B2 (en) | 2005-12-28 | 2013-04-02 | Vertex Pharmaceuticals | Solid forms of N-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US11564916B2 (en) | 2008-08-13 | 2023-01-31 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US10646481B2 (en) | 2008-08-13 | 2020-05-12 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US9751839B2 (en) | 2009-03-20 | 2017-09-05 | Vertex Pharmaceuticals Incorporated | Process for making modulators of cystic fibrosis transmembrane conductance regulator |
| US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
| US10272046B2 (en) | 2012-02-27 | 2019-04-30 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US11147770B2 (en) | 2012-02-27 | 2021-10-19 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US11752106B2 (en) | 2012-02-27 | 2023-09-12 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US12214083B2 (en) | 2012-02-27 | 2025-02-04 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US9701639B2 (en) | 2014-10-07 | 2017-07-11 | Vertex Pharmaceuticals Incorporated | Co-crystals of modulators of cystic fibrosis transmembrane conductance regulator |
Also Published As
| Publication number | Publication date |
|---|---|
| AT329562B (de) | 1976-05-25 |
| ZA74883B (en) | 1974-12-24 |
| FR2218896B1 (enrdf_load_html_response) | 1977-09-09 |
| IE38886B1 (en) | 1978-06-21 |
| NL7402613A (enrdf_load_html_response) | 1974-08-28 |
| ATA149974A (de) | 1975-08-15 |
| IE38886L (en) | 1974-08-26 |
| CA1025856A (en) | 1978-02-07 |
| JPS5029574A (enrdf_load_html_response) | 1975-03-25 |
| CH602707A5 (enrdf_load_html_response) | 1978-07-31 |
| AU474797B2 (en) | 1976-08-05 |
| FR2218896A1 (enrdf_load_html_response) | 1974-09-20 |
| GB1433774A (en) | 1976-04-28 |
| SE7401984L (enrdf_load_html_response) | 1974-08-27 |
| AU6559274A (en) | 1975-08-14 |
| BE811246A (fr) | 1974-08-19 |
| LU69479A1 (enrdf_load_html_response) | 1975-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2407744A1 (de) | Chinolin-3-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| US3700673A (en) | 3-4-dihydrobenzo(b) (1,7)naphthyridin-1(2h)-ones | |
| DE2058295C3 (de) | Xanthen-9-on-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3011490C2 (enrdf_load_html_response) | ||
| DE3433924C2 (enrdf_load_html_response) | ||
| DE69021444T2 (de) | Pteridin-4 (3H)-onen, Verfahren zu ihrer Herstellung und sie enthaltende Medikamente. | |
| DE3001328C2 (enrdf_load_html_response) | ||
| EP0006506B1 (de) | 1,2-Dihydro-chinolin-2-on-Derivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| EP0013894B1 (de) | Neue Arylether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE1695556B2 (de) | 3Alkyl-l,2,3,4,4a,9-hexahydropyrazino [1,2-f] morphanthridinderivate | |
| DE2415763A1 (de) | Neue benzochinolizine, verfahren zu ihrer herstellung und diese enthaltende mittel | |
| DE2802493C2 (enrdf_load_html_response) | ||
| DE3004750A1 (de) | Neue heterotricyclische derivate, verfahren zu deren herstellung, ihre verwendung als arzneimittel und sie enthaltenden pharmazeutischen zusammensetzungen | |
| DE2628189A1 (de) | 3-phenylindoline, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2446821A1 (de) | Substituierte 1,3-dimethyl-1hpyrazol eckige klammer auf 3,4b eckige klammer zu -chinoline | |
| DE2332731A1 (de) | Chinolin-carbonsaeure-(2)-verbindungen, verfahren zu ihrer herstellung sowie solche verbindungen enthaltende arzneimittelpraeparate | |
| DE2418344A1 (de) | Derivate von 3-nitrocumarinen enthaltende arzneimittel, neue 3-nitrocumarine und verfahren zu ihrer herstellung | |
| DE2656468A1 (de) | N-(benzthiazol-2-yl)-oxamidsaeure- derivate und verfahren zu ihrer herstellung | |
| DE2410852A1 (de) | Neue chinoxalin-2-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese enthaltende mittel | |
| DE3813531A1 (de) | Neue 2-aminoalkyl-4-benzyl-1-(2h)-phthalazinon-derivate | |
| JPS6365672B2 (enrdf_load_html_response) | ||
| DD223451A5 (de) | Verfahren zur herstellung von chinolonen | |
| DE3132915A1 (de) | 1,5-diphenylpyrazolin-3-on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0086340B1 (en) | 3-(1h-tetrazol-5-yl)-4(3h)-quinazolinones | |
| DD201890A5 (de) | Verfahren zur herstellung neuartiger chinolonverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |