DE2403432B2 - Gleichstrommotor mit mehrphasiger Ständerwicklung und durch n Hallgeneratoren gesteuerter elektronischer Kommutierungseinrichtung - Google Patents
Gleichstrommotor mit mehrphasiger Ständerwicklung und durch n Hallgeneratoren gesteuerter elektronischer KommutierungseinrichtungInfo
- Publication number
- DE2403432B2 DE2403432B2 DE2403432A DE2403432A DE2403432B2 DE 2403432 B2 DE2403432 B2 DE 2403432B2 DE 2403432 A DE2403432 A DE 2403432A DE 2403432 A DE2403432 A DE 2403432A DE 2403432 B2 DE2403432 B2 DE 2403432B2
- Authority
- DE
- Germany
- Prior art keywords
- amplifier
- amplifiers
- exclusive
- voltage
- motor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004804 winding Methods 0.000 title claims description 16
- 230000002441 reversible effect Effects 0.000 claims description 5
- 230000001419 dependent effect Effects 0.000 claims description 2
- 241001077660 Molo Species 0.000 claims 1
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 230000006866 deterioration Effects 0.000 description 4
- 238000006073 displacement reaction Methods 0.000 description 4
- 239000004065 semiconductor Substances 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 2
- 230000003321 amplification Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- NFBAXHOPROOJAW-UHFFFAOYSA-N phenindione Chemical compound O=C1C2=CC=CC=C2C(=O)C1C1=CC=CC=C1 NFBAXHOPROOJAW-UHFFFAOYSA-N 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02P—CONTROL OR REGULATION OF ELECTRIC MOTORS, ELECTRIC GENERATORS OR DYNAMO-ELECTRIC CONVERTERS; CONTROLLING TRANSFORMERS, REACTORS OR CHOKE COILS
- H02P6/00—Arrangements for controlling synchronous motors or other dynamo-electric motors using electronic commutation dependent on the rotor position; Electronic commutators therefor
- H02P6/14—Electronic commutators
- H02P6/15—Controlling commutation time
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Control Of Motors That Do Not Use Commutators (AREA)
- Brushless Motors (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2403432A DE2403432B2 (de) | 1974-01-24 | 1974-01-24 | Gleichstrommotor mit mehrphasiger Ständerwicklung und durch n Hallgeneratoren gesteuerter elektronischer Kommutierungseinrichtung |
| CH1671174A CH577246A5 (OSRAM) | 1974-01-24 | 1974-12-16 | |
| CS7500000145A CS186794B2 (en) | 1974-01-24 | 1975-01-08 | Connection for improving the commutation of the dc motor with the multiphase stator winding |
| IT19453/75A IT1028500B (it) | 1974-01-24 | 1975-01-21 | Motore elettrico a corrente continua con avvolgimento multifase dello statore e provvisto di dispositivo di commutazione elettronico controllato da n generatori a hall |
| JP50010394A JPS593120B2 (ja) | 1974-01-24 | 1975-01-24 | チヨクリユウデンドウキ |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2403432A DE2403432B2 (de) | 1974-01-24 | 1974-01-24 | Gleichstrommotor mit mehrphasiger Ständerwicklung und durch n Hallgeneratoren gesteuerter elektronischer Kommutierungseinrichtung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2403432A1 DE2403432A1 (de) | 1975-07-31 |
| DE2403432B2 true DE2403432B2 (de) | 1975-11-13 |
Family
ID=5905611
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2403432A Granted DE2403432B2 (de) | 1974-01-24 | 1974-01-24 | Gleichstrommotor mit mehrphasiger Ständerwicklung und durch n Hallgeneratoren gesteuerter elektronischer Kommutierungseinrichtung |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS593120B2 (OSRAM) |
| CH (1) | CH577246A5 (OSRAM) |
| CS (1) | CS186794B2 (OSRAM) |
| DE (1) | DE2403432B2 (OSRAM) |
| IT (1) | IT1028500B (OSRAM) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2556726A1 (de) * | 1975-12-17 | 1977-06-30 | Danfoss As | Steuerschaltung fuer einen selbstanlaufenden elektromotor |
| DE2727534A1 (de) * | 1977-06-18 | 1979-01-04 | Papst Motoren Kg | Steuerschaltung fuer einen elektronisch kommutierten gleichstrommotor |
| DE2900547A1 (de) * | 1979-01-08 | 1980-07-10 | Siemens Ag | Steuersignalgeber fuer die kommutierungseinrichtung eines kollektorlosen elektronikmotors |
| DE2901000A1 (de) * | 1979-01-12 | 1980-08-14 | Teldix Gmbh | Kollektorlose gleichstrommaschine |
| DE3819062A1 (de) * | 1988-06-04 | 1989-12-07 | Quick Rotan Elektromotoren | Verfahren zur steuerung von buerstenlosen elektromotoren sowie steuerschaltung hierfuer |
| DE3819064A1 (de) * | 1988-06-04 | 1989-12-07 | Quick Rotan Elektromotoren | Verfahren zur steuerung von buerstenlosen elektromotoren sowie steuerschaltung hierfuer |
| DE4331742A1 (de) * | 1993-09-20 | 1995-03-23 | Thomson Brandt Gmbh | Schaltung zur Steuerung mit mehreren Sensoren |
| RU2656882C1 (ru) * | 2017-07-11 | 2018-06-07 | федеральное государственное бюджетное образовательное учреждение высшего образования "Национальный исследовательский университет "МЭИ" (ФГБОУ ВО "НИУ "МЭИ") | Исполнительный агрегат электропривода |
| RU2663224C1 (ru) * | 2014-12-22 | 2018-08-02 | Найдек Корпорейшн | Способ оценивания положения и устройство управления положением |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5246419A (en) * | 1975-10-09 | 1977-04-13 | Matsushita Electric Ind Co Ltd | Electric motor |
| JPS5248008A (en) * | 1975-10-13 | 1977-04-16 | Matsushita Electric Ind Co Ltd | Motor |
| GB1596681A (en) * | 1977-01-19 | 1981-08-26 | Sony Corp | Drive circuits with speed control for brushless dc motors |
| DE2743661A1 (de) * | 1977-09-28 | 1979-03-29 | Siemens Ag | Gleichstrommotor mit mehrphasiger staenderwicklung und durch winkelstellungsgeber gesteuerter elektronischer kommutierungseinrichtung |
| DE3245033C2 (de) * | 1981-12-05 | 2003-05-28 | Papst Licensing Gmbh & Co Kg | Kollektorloser Gleichstrommotor |
| IT1198556B (it) * | 1983-04-15 | 1988-12-21 | Giampiero Tassinario | Motore a corrente continua senza collettore a commutazione elettronica |
| JPS60154725U (ja) * | 1984-03-19 | 1985-10-15 | 松下電器産業株式会社 | 燃焼装置 |
| EP0190240B1 (de) * | 1984-07-27 | 1990-02-07 | Papst-Motoren GmbH & Co. KG | Kollektorloser gleichstrommotor |
| DE3432946C2 (de) * | 1984-09-07 | 1994-08-04 | Pfeiffer Vakuumtechnik | Kollektorloser Gleichstrommotor mit eisenloser Statorwicklung |
| NL8503249A (nl) * | 1985-11-26 | 1987-06-16 | Philips Nv | Borstelloze gelijkstroommotor. |
| DE3800960A1 (de) * | 1988-01-15 | 1989-07-27 | Thomson Brandt Gmbh | Verfahren zur kommutierung von spulenstraengen eines gleichstrommotors |
| FR2636182A1 (fr) * | 1988-09-05 | 1990-03-09 | Technologique Sarl Comp | Circuit de commande pour moteur a courant continu sans collecteur, notamment d'un ventilateur |
| WO1996010863A1 (en) * | 1994-09-30 | 1996-04-11 | Itt Automotive Electrical Systems, Inc. | Dual mode controller for a brushless dc motor |
| EP0716499A1 (en) * | 1994-12-07 | 1996-06-12 | General Motors Corporation | Controller for a brushless DC Motor |
| GB2305033A (en) * | 1995-08-25 | 1997-03-26 | Norcroft Dynamics Ltd | Controlling brushless dc motors |
| WO1997025768A1 (de) * | 1996-01-10 | 1997-07-17 | Papst-Motoren Gmbh & Co. Kg | Verfahren zum starten eines elektronisch kommutierten gleichstrommotors, und motor zur durchführung eines solchen verfahrens |
| US6232695B1 (en) | 1996-02-08 | 2001-05-15 | Valeo Electrical Systems, Inc. | Programmable brush for DC motors |
| US6559571B1 (en) | 1996-02-08 | 2003-05-06 | Valeo Electrical Systems, Inc. | Programmable brush for DC motors |
| DE19720309A1 (de) * | 1997-05-15 | 1999-09-30 | Papst Motoren Gmbh & Co Kg | Elektronisch kommutierter Motor |
| DE19815896C2 (de) * | 1998-04-08 | 2000-03-30 | Siemens Ag | Drehzahl-Steuervorrichtung für einen elektronisch kommutierten mehrphasigen Elektromotor |
| RU2408127C1 (ru) * | 2009-12-09 | 2010-12-27 | Общество с ограниченной ответственностью "МЭЛ" | Бесконтактный электродвигатель постоянного тока |
| RU2597993C1 (ru) * | 2015-05-07 | 2016-09-20 | Владимир Викторович Ермишин | Многополюсный вентильный электродвигатель |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4938111A (OSRAM) * | 1972-08-16 | 1974-04-09 |
-
1974
- 1974-01-24 DE DE2403432A patent/DE2403432B2/de active Granted
- 1974-12-16 CH CH1671174A patent/CH577246A5/xx not_active IP Right Cessation
-
1975
- 1975-01-08 CS CS7500000145A patent/CS186794B2/cs unknown
- 1975-01-21 IT IT19453/75A patent/IT1028500B/it active
- 1975-01-24 JP JP50010394A patent/JPS593120B2/ja not_active Expired
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2556726A1 (de) * | 1975-12-17 | 1977-06-30 | Danfoss As | Steuerschaltung fuer einen selbstanlaufenden elektromotor |
| DE2727534A1 (de) * | 1977-06-18 | 1979-01-04 | Papst Motoren Kg | Steuerschaltung fuer einen elektronisch kommutierten gleichstrommotor |
| DE2900547A1 (de) * | 1979-01-08 | 1980-07-10 | Siemens Ag | Steuersignalgeber fuer die kommutierungseinrichtung eines kollektorlosen elektronikmotors |
| DE2901000A1 (de) * | 1979-01-12 | 1980-08-14 | Teldix Gmbh | Kollektorlose gleichstrommaschine |
| DE3819062A1 (de) * | 1988-06-04 | 1989-12-07 | Quick Rotan Elektromotoren | Verfahren zur steuerung von buerstenlosen elektromotoren sowie steuerschaltung hierfuer |
| DE3819064A1 (de) * | 1988-06-04 | 1989-12-07 | Quick Rotan Elektromotoren | Verfahren zur steuerung von buerstenlosen elektromotoren sowie steuerschaltung hierfuer |
| DE4331742A1 (de) * | 1993-09-20 | 1995-03-23 | Thomson Brandt Gmbh | Schaltung zur Steuerung mit mehreren Sensoren |
| RU2663224C1 (ru) * | 2014-12-22 | 2018-08-02 | Найдек Корпорейшн | Способ оценивания положения и устройство управления положением |
| US10976182B2 (en) | 2014-12-22 | 2021-04-13 | Nidec Corporation | Position estimation method and position control device |
| US11860002B2 (en) | 2014-12-22 | 2024-01-02 | Nidec Corporation | Position estimation method and position control device |
| US11860003B2 (en) | 2014-12-22 | 2024-01-02 | Nidec Corporation | Position estimation method and position control device |
| RU2656882C1 (ru) * | 2017-07-11 | 2018-06-07 | федеральное государственное бюджетное образовательное учреждение высшего образования "Национальный исследовательский университет "МЭИ" (ФГБОУ ВО "НИУ "МЭИ") | Исполнительный агрегат электропривода |
Also Published As
| Publication number | Publication date |
|---|---|
| CS186794B2 (en) | 1978-12-29 |
| IT1028500B (it) | 1979-01-30 |
| DE2403432A1 (de) | 1975-07-31 |
| JPS593120B2 (ja) | 1984-01-23 |
| JPS50104316A (OSRAM) | 1975-08-18 |
| CH577246A5 (OSRAM) | 1976-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2403432B2 (de) | Gleichstrommotor mit mehrphasiger Ständerwicklung und durch n Hallgeneratoren gesteuerter elektronischer Kommutierungseinrichtung | |
| DE3311876C2 (OSRAM) | ||
| DE69001891T2 (de) | Verfahren und vorrichtung zur sensorlosen regelung eines reluktanzmotors. | |
| DE19846831B4 (de) | Verfahren und Vorrichtung zur Ermittlung der Rotorstellung von Synchronmotoren | |
| DE2428718C3 (de) | Bürstenloser Gleichstrommotor | |
| DE3013550A1 (de) | Ansteuersystem fuer einen kommutatorlosen gleichstrommotor | |
| DE69029511T2 (de) | Reluktanzmotor | |
| DE2804561A1 (de) | Zweipulsiger kollektorloser gleichstrommotor | |
| DE2949017C2 (de) | Anordnung zum Steuern von Antriebs- und Bremsstrom eines bürstenlosen Gleichstrommotors | |
| EP0024300A1 (de) | Verfahren zur Pulsbreitensteuerung eines Gleichstrom-Umkehrstellers und Schaltungsanordnung zur Durchführung des Verfahrens | |
| DE2042107A1 (de) | Umschaltlogik fuer Umkehrstromrichter in kreisstromfreier Schaltung,insbesondere in kreisstromfreier Gegenparallelschaltung | |
| WO2010046386A2 (de) | Verfahren zum betreiben eines elektromotors | |
| DE2743411C3 (de) | Steuerschaltung zum schrittweisen Betreiben eines kollektorlosen Gleichstrommotors | |
| DE2236763C3 (de) | Verfahren und Anordnung zur Steuerung der Lage des Ständerstromvektors einer über einen Umrichter mit eingeprägtem Zwischenkreisstrom gespeisten Drehfeldmaschine | |
| DE2930907A1 (de) | Verfahren zur pulsbreitensteuerung eines gleichstrom-umkehrstellers und schaltungsanordnung zur durchfuehrung des verfahrens | |
| DE3324542C2 (OSRAM) | ||
| EP0373381A1 (de) | Verfahren zur Steuerung eines dreiphasigen Wechselrichters | |
| DE1513145B2 (de) | Anordnung zur steuerung der drehzahl und drehrichtung eines ueber antiparallel geschaltete thyristoren aus einem wechsels stromnetz gespeisten gleichstrommotors | |
| DE2341052A1 (de) | Gleichstrommotor mit geschwindigkeitsregelung ueber hall-generatoren | |
| DE19838227A1 (de) | Verfahren zur Bestimmung der Rotorlage eines Synchronmotors | |
| DE102012006010A1 (de) | Vorrichtung zur Bestimmung einer Läuferlage einer elektronisch kommutierten elektrischen Maschine | |
| DE1209595B (de) | Schaltung zur Verhinderung von Schaeden durch UEberlastung beim gleichzeitigen Leitendwerden von im Gegentaktbetrieb arbeitenden Halbleiterschaltelementen | |
| DE2540156A1 (de) | Anordnung zur getakteten stromregelung eines elektronisch kommutierten gleichstrommotors | |
| DE3423403A1 (de) | Elektrischer asynchronmotor | |
| DE2616781A1 (de) | Statische regenerative gleichstrommotor-steuereinrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E771 | Valid patent as to the heymanns-index 1977, willingness to grant licences | ||
| 8339 | Ceased/non-payment of the annual fee |