DE2402760C3 - Hochdruck-Entladungslampe - Google Patents
Hochdruck-EntladungslampeInfo
- Publication number
- DE2402760C3 DE2402760C3 DE2402760A DE2402760A DE2402760C3 DE 2402760 C3 DE2402760 C3 DE 2402760C3 DE 2402760 A DE2402760 A DE 2402760A DE 2402760 A DE2402760 A DE 2402760A DE 2402760 C3 DE2402760 C3 DE 2402760C3
- Authority
- DE
- Germany
- Prior art keywords
- aluminum
- lamp
- discharge lamp
- alkali metal
- halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052782 aluminium Inorganic materials 0.000 claims description 15
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 13
- -1 lithium halide Chemical class 0.000 claims description 13
- 150000008045 alkali metal halides Chemical class 0.000 claims description 12
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 12
- 239000007789 gas Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 235000009518 sodium iodide Nutrition 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- 238000007792 addition Methods 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 229910052756 noble gas Inorganic materials 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical compound [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000000295 emission spectrum Methods 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000035611 feeding Effects 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940100892 mercury compound Drugs 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000004436 sodium atom Chemical group 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB346973A GB1444023A (en) | 1973-01-23 | 1973-01-23 | Electric discharge lamps |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2402760A1 DE2402760A1 (de) | 1974-07-25 |
| DE2402760B2 DE2402760B2 (de) | 1979-05-31 |
| DE2402760C3 true DE2402760C3 (de) | 1980-01-31 |
Family
ID=9758912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2402760A Expired DE2402760C3 (de) | 1973-01-23 | 1974-01-22 | Hochdruck-Entladungslampe |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3867664A (enExample) |
| JP (1) | JPS5837662B2 (enExample) |
| BE (1) | BE810033A (enExample) |
| CA (1) | CA988988A (enExample) |
| DE (1) | DE2402760C3 (enExample) |
| DK (1) | DK138969B (enExample) |
| FR (1) | FR2214968B1 (enExample) |
| GB (1) | GB1444023A (enExample) |
| IE (1) | IE38771B1 (enExample) |
| IT (1) | IT1003493B (enExample) |
| LU (1) | LU69211A1 (enExample) |
| NL (1) | NL182925C (enExample) |
| SE (1) | SE383228B (enExample) |
| ZA (1) | ZA74411B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2422411A1 (de) * | 1974-05-09 | 1975-12-11 | Philips Patentverwaltung | Hochdruckquecksilberdampfentladungslampe |
| US4135110A (en) * | 1975-02-13 | 1979-01-16 | Thorn Electrical Industries Limited | Electrical discharge lamp |
| DE2826733C2 (de) * | 1977-07-05 | 1982-07-29 | General Electric Co., Schenectady, N.Y. | Hochdruck-Metalldampf-Entladungslampe |
| GB2133925B (en) * | 1982-12-29 | 1987-02-18 | Gen Electric | Control of radial distributions in high intensity discharge lamps |
| US4591759A (en) * | 1984-09-10 | 1986-05-27 | General Electric Company | Ingredients for solenoidal metal halide arc lamps |
| US4705987A (en) * | 1985-10-03 | 1987-11-10 | The United States Of America As Represented By The United States Department Of Energy | Very high efficacy electrodeless high intensity discharge lamps |
| US6157141A (en) * | 1998-05-05 | 2000-12-05 | Osram Sylvania Inc. | Blue light electrodeless high intensity discharge lamp system |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2102866A5 (enExample) * | 1970-08-27 | 1972-04-07 | Eclairage Lab | |
| US3771009A (en) * | 1971-12-27 | 1973-11-06 | Gte Laboratories Inc | Electrode discharge device with electrode-activating fill |
-
1973
- 1973-01-23 GB GB346973A patent/GB1444023A/en not_active Expired
-
1974
- 1974-01-18 IE IE115/74A patent/IE38771B1/xx unknown
- 1974-01-18 CA CA190,463A patent/CA988988A/en not_active Expired
- 1974-01-21 US US434927A patent/US3867664A/en not_active Expired - Lifetime
- 1974-01-21 LU LU69211A patent/LU69211A1/xx unknown
- 1974-01-21 ZA ZA740411A patent/ZA74411B/xx unknown
- 1974-01-22 BE BE140068A patent/BE810033A/xx unknown
- 1974-01-22 DE DE2402760A patent/DE2402760C3/de not_active Expired
- 1974-01-22 SE SE7400810A patent/SE383228B/xx not_active IP Right Cessation
- 1974-01-22 JP JP49009062A patent/JPS5837662B2/ja not_active Expired
- 1974-01-23 FR FR7402283A patent/FR2214968B1/fr not_active Expired
- 1974-01-23 IT IT19697/74A patent/IT1003493B/it active
- 1974-01-23 NL NLAANVRAGE7400944,A patent/NL182925C/xx not_active IP Right Cessation
- 1974-01-23 DK DK36374AA patent/DK138969B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU6481974A (en) | 1975-07-24 |
| JPS49104479A (enExample) | 1974-10-03 |
| GB1444023A (en) | 1976-07-28 |
| DK138969B (da) | 1978-11-20 |
| DE2402760A1 (de) | 1974-07-25 |
| NL182925C (nl) | 1988-06-01 |
| LU69211A1 (enExample) | 1974-04-08 |
| DK138969C (enExample) | 1979-05-28 |
| BE810033A (fr) | 1974-05-16 |
| FR2214968A1 (enExample) | 1974-08-19 |
| JPS5837662B2 (ja) | 1983-08-17 |
| ZA74411B (en) | 1974-11-27 |
| IE38771B1 (en) | 1978-05-24 |
| SE383228B (sv) | 1976-03-01 |
| IT1003493B (it) | 1976-06-10 |
| CA988988A (en) | 1976-05-11 |
| NL7400944A (enExample) | 1974-07-25 |
| DE2402760B2 (de) | 1979-05-31 |
| IE38771L (en) | 1974-07-23 |
| FR2214968B1 (enExample) | 1978-10-27 |
| US3867664A (en) | 1975-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE3813421A1 (de) | Hochdruck-quecksilberdampfentladungslampe | |
| EP0453893B1 (de) | Hochdruckentladungslampe | |
| EP0535311A1 (de) | Hochdruckentladungslampe kleiner Leistung | |
| EP0637056B1 (de) | Hochdruckentladungslampe | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE3110812C2 (enExample) | ||
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE3210809A1 (de) | Hochleistungs-miniatur-metallhalogenid-bogenentladungslampe | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE2550661C3 (de) | Quecksilberdampf - Hochdrucklampe | |
| DE2201831A1 (de) | Bogenentladungsvorrichtung | |
| DE2456757C2 (de) | Metallhalogenid-Hochdruckgasentladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE7016628U (de) | Wandstabilisierte hochdruck-quecksilberdampf-entladungslampe mit jodid. | |
| DE3404661A1 (de) | Hochdruck-metalldampflampe mit verbesserter farbwiedergabe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE2023770C3 (de) | Hochleistungsbogenlampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE2736311C2 (de) | Quecksilberdampf-Hochdruckentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: THORN EMI LTD., LONDON, GB |