DE2348411C3 - Vierkanal-Stereophoniedemodulator - Google Patents
Vierkanal-StereophoniedemodulatorInfo
- Publication number
- DE2348411C3 DE2348411C3 DE2348411A DE2348411A DE2348411C3 DE 2348411 C3 DE2348411 C3 DE 2348411C3 DE 2348411 A DE2348411 A DE 2348411A DE 2348411 A DE2348411 A DE 2348411A DE 2348411 C3 DE2348411 C3 DE 2348411C3
- Authority
- DE
- Germany
- Prior art keywords
- signal
- channel
- switch circuit
- frequency
- sub
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 4
- 230000005540 biological transmission Effects 0.000 description 4
- 238000000926 separation method Methods 0.000 description 2
- NCGICGYLBXGBGN-UHFFFAOYSA-N 3-morpholin-4-yl-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine;hydrochloride Chemical compound Cl.[N-]1OC(=N)C=[N+]1N1CCOCC1 NCGICGYLBXGBGN-UHFFFAOYSA-N 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 230000005236 sound signal Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04H—BROADCAST COMMUNICATION
- H04H20/00—Arrangements for broadcast or for distribution combined with broadcast
- H04H20/86—Arrangements characterised by the broadcast information itself
- H04H20/88—Stereophonic broadcast systems
- H04H20/89—Stereophonic broadcast systems using three or more audio channels, e.g. triphonic or quadraphonic
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Stereo-Broadcasting Methods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9851872A JPS5315602B2 (enExample) | 1972-09-29 | 1972-09-29 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2348411A1 DE2348411A1 (de) | 1974-04-18 |
| DE2348411B2 DE2348411B2 (de) | 1979-08-02 |
| DE2348411C3 true DE2348411C3 (de) | 1980-04-03 |
Family
ID=14221856
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2348411A Expired DE2348411C3 (de) | 1972-09-29 | 1973-09-26 | Vierkanal-Stereophoniedemodulator |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3909539A (enExample) |
| JP (1) | JPS5315602B2 (enExample) |
| CA (1) | CA1024219A (enExample) |
| DE (1) | DE2348411C3 (enExample) |
| FR (1) | FR2201581B1 (enExample) |
| GB (1) | GB1401562A (enExample) |
| NL (1) | NL7313375A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4061882A (en) * | 1976-08-13 | 1977-12-06 | Quadracast Systems, Inc. | Quadrature multiplying four-channel demodulator |
| JPS6322930A (ja) * | 1986-07-16 | 1988-01-30 | Yutani Heavy Ind Ltd | 建設機械の油圧回路 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1149396B (de) * | 1961-12-02 | 1963-05-30 | Telefunken Patent | Empfangsschaltung fuer kompatible Rundfunk-Stereophonie |
| US3308241A (en) * | 1963-01-23 | 1967-03-07 | Tokyo Shibaura Electric Co | Fm stereo demodulating device using a diode ring modulator switching circuit |
| DE1200364B (de) * | 1963-09-05 | 1965-09-09 | Telefunken Patent | Schaltungsanordnung zur Gewinnung der beiden Lautsprechersignale auf der Empfangsseite bei der kompatiblen Rundfunk-Stereophonie nach dem Multiplexverfahren |
| US3309464A (en) * | 1964-01-03 | 1967-03-14 | Philco Corp | Stereophonic receiver having crosstalk compensation means |
| FR1484513A (enExample) * | 1964-05-18 | 1967-09-28 | ||
| US3479463A (en) * | 1967-03-28 | 1969-11-18 | Zenith Radio Corp | Wave signal receiver |
| US3707603A (en) * | 1969-12-29 | 1972-12-26 | Rca Corp | Fm stereophonic receiver detection apparatus and disabling means |
| CA1021852A (en) * | 1970-02-25 | 1977-11-29 | Louis Dorren | Compatible four channel fm system |
| US3708623A (en) * | 1970-04-29 | 1973-01-02 | Quadracast Syst Inc | Compatible four channel fm system |
| US3721766A (en) * | 1970-11-16 | 1973-03-20 | Motorola Inc | Frequency multiplying circuit utilizing time gates and switching signals of differing phases |
| CA969240A (en) * | 1971-04-15 | 1975-06-10 | Sukeichi Miki | Four channel fm transmitter, receiver and transmission system |
| DE2261519C3 (de) * | 1971-12-16 | 1979-12-20 | Matsushita Electric Industrial Co., Ltd., Kadoma, Osaka (Japan) | Vierkanal-Stereophonie-Demodulationssystem |
-
1972
- 1972-09-29 JP JP9851872A patent/JPS5315602B2/ja not_active Expired
-
1973
- 1973-09-19 US US398849A patent/US3909539A/en not_active Expired - Lifetime
- 1973-09-20 GB GB4429073A patent/GB1401562A/en not_active Expired
- 1973-09-26 DE DE2348411A patent/DE2348411C3/de not_active Expired
- 1973-09-27 FR FR7334660A patent/FR2201581B1/fr not_active Expired
- 1973-09-28 CA CA182,156A patent/CA1024219A/en not_active Expired
- 1973-09-28 NL NL7313375A patent/NL7313375A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2348411A1 (de) | 1974-04-18 |
| CA1024219A (en) | 1978-01-10 |
| DE2348411B2 (de) | 1979-08-02 |
| FR2201581B1 (enExample) | 1976-11-19 |
| US3909539A (en) | 1975-09-30 |
| FR2201581A1 (enExample) | 1974-04-26 |
| NL7313375A (enExample) | 1974-04-02 |
| JPS5315602B2 (enExample) | 1978-05-26 |
| JPS4956503A (enExample) | 1974-06-01 |
| GB1401562A (en) | 1975-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2532002C3 (de) | Kompatibler Empfänger für monaurale sowie zusammengesetzte Zwei- und Vielkanal-Stereophonie-Signale | |
| DE1416141B2 (de) | Verfahren und anordnung zur stereophonischen tonuebertragung | |
| EP0084876A2 (de) | Demodulatoranordnung zur Demodulation von in Frequenzmodulation auf einer Trägerfrequenzwelle enthaltener Signale | |
| DE2439863C2 (de) | Vierkanal-Dekodiermatrix | |
| DE2145803C3 (de) | Verfahren und Fernsehempfänger zur übertragung zweier Fernseh-Tonkanäle | |
| DE2152055A1 (de) | Vervielfacherschaltung | |
| DE2322145C2 (de) | Tonsignalumsetzer | |
| DE2348411C3 (de) | Vierkanal-Stereophoniedemodulator | |
| DE2317123A1 (de) | Vorrichtung zur stereophonischen raumklanguebertragung | |
| DE2261519C3 (de) | Vierkanal-Stereophonie-Demodulationssystem | |
| DE3411911C2 (de) | Elektronische Schaltvorrichtung | |
| DE2218822C3 (de) | Vierkanal-FM-Übertragungssystem | |
| DE3005033C2 (de) | Stereomodulatorschaltung | |
| DE2411007A1 (de) | Matrix-vierkanaldekodiervorrichtung | |
| DE2026943C3 (de) | Schaltungsanordnung für ein Drahtfunksystem zur Verbindung mehrerer Signalquellen mit einer Vielzahl von Teilnehmern | |
| DE2359554B2 (de) | Dekodiereinrichtung fur zwei verschiedene Vierkanal-Matrixsysteme | |
| DE2556056A1 (de) | Stereophonie-demodulator | |
| DE2511098C2 (de) | Schaltungsanordnung zur Decodierung eines frequenzmodulierten Stereo-Rundfunksignals | |
| DE2645567C2 (de) | Schaltungsanordnung zur automatischen Abstimmsteuerung eines Fernsehempfängers | |
| DE2109557B2 (de) | Kompatibles Vierkanal-Rundfunkübertragungssystem | |
| DE3346059A1 (de) | Fm-stereoempfaenger | |
| DE4135747C2 (de) | Verfahren zur Übertragung mehrkanaliger Tonsignale über störbehaftete Kanäle | |
| DE1160038B (de) | Verfahren und Vorrichtung zur UEbertragung von zwei oder mehreren Signalen | |
| DE2914460A1 (de) | Fm-empfaenger | |
| DE2219944C3 (de) | Stereo-Decoder für einen FM-Stereo-Empfänger |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |