DE234795C - - Google Patents
Info
- Publication number
- DE234795C DE234795C DENDAT234795D DE234795DA DE234795C DE 234795 C DE234795 C DE 234795C DE NDAT234795 D DENDAT234795 D DE NDAT234795D DE 234795D A DE234795D A DE 234795DA DE 234795 C DE234795 C DE 234795C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- phosphorus
- alcohol
- halides
- percent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052698 phosphorus Inorganic materials 0.000 claims description 4
- 239000011574 phosphorus Substances 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- AUWDOZOUJWEPBA-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethanol Chemical compound COC1=CC=C(CCO)C=C1 AUWDOZOUJWEPBA-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- -1 phosphorus halides Chemical class 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- PMIAMRAWHYEPNH-UHFFFAOYSA-N 1-(2-chloroethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCCl)C=C1 PMIAMRAWHYEPNH-UHFFFAOYSA-N 0.000 description 1
- HZEMCKHRVQSVQY-UHFFFAOYSA-N 2-(4-methoxyphenyl)prop-2-enoic acid Chemical compound COC1=CC=C(C(=C)C(O)=O)C=C1 HZEMCKHRVQSVQY-UHFFFAOYSA-N 0.000 description 1
- LTPVSOCPYWDIFU-UHFFFAOYSA-N 4-methoxyphenylethylamine Chemical compound COC1=CC=C(CCN)C=C1 LTPVSOCPYWDIFU-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- MZFZJDUMJNWMMD-UHFFFAOYSA-M [Br-].COC1=CC=C(C[Mg+])C=C1 Chemical compound [Br-].COC1=CC=C(C[Mg+])C=C1 MZFZJDUMJNWMMD-UHFFFAOYSA-M 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical class COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- CDZDPHPSWKHONZ-UHFFFAOYSA-N hypochlorous acid;phosphane Chemical compound P.ClO CDZDPHPSWKHONZ-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- DAVRGGJTJDTVQT-UHFFFAOYSA-N n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCC1=CC=CC=C1 DAVRGGJTJDTVQT-UHFFFAOYSA-N 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE234795C true DE234795C (index.php) |
Family
ID=494631
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT234795D Active DE234795C (index.php) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE234795C (index.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002017712A3 (en) * | 2000-09-01 | 2003-06-12 | Fmc Corp | Disubstituted benzenes as insecticides |
-
0
- DE DENDAT234795D patent/DE234795C/de active Active
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002017712A3 (en) * | 2000-09-01 | 2003-06-12 | Fmc Corp | Disubstituted benzenes as insecticides |
| US6753429B2 (en) | 2000-09-01 | 2004-06-22 | Fmc Corporation | 1,4-disubstituted benzenes as insecticides |
| AU2001286909B2 (en) * | 2000-09-01 | 2006-02-09 | Bayer Cropscience Ag | Disubstituted benzenes as insecticides |
| US7247756B2 (en) | 2000-09-01 | 2007-07-24 | Bayer Cropscience Ag | 1,4-disubstituted benzenes as insecticides |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| WO2007115799A1 (de) | Verfahren zur herstellung von kreatin, kreatin-monohydrat oder guanidinoessigsäure | |
| DE849109C (de) | Verfahren zur Herstellung aliphatischer Azoverbindungen | |
| DE2733747C2 (de) | Verfahren zur Herstellung von 2,2 Dichlorhydrazobenzol | |
| DE2601466A1 (de) | Verfahren zur sequestrierung von in wasser geloestem sauerstoff und hierzu geeignete zubereitungen | |
| EP0121758B1 (de) | Verfahren zur Herstellung von Fettsäureestern der Ascorbinsäure | |
| DE234795C (index.php) | ||
| DE69307658T2 (de) | Verfahren zur Herstellung von Alpha-Hydroxyisobuttersäureamide | |
| DE2138859B2 (de) | Verfahren zur Herstellung von 4-Oxocapronitril | |
| DE2648644A1 (de) | Verfahren zur herstellung von 4-phenoxy-phenolen | |
| EP0320447B1 (de) | Verfahren zur Herstellung von metallisierbaren Azofarbstoffen | |
| DE2145394A1 (de) | Verfahren zum Trennen von DL-Tryptophan-monohydrohalogenid in seine optisch aktiven Enantiomorphen | |
| DE571794C (de) | Verfahren zur katalytischen Reduktion von schwer reduzierbaren Verbindungen | |
| DE2749513A1 (de) | Verfahren zur herstellung von pentachlornitrobenzol | |
| DE2217494C2 (de) | Verfahren zur Herstellung von Alkoxypropionitrilen | |
| EP0029495A1 (de) | Verfahren zur Herstellung von 3-Cyanopropionsäureamid | |
| DE477050C (de) | Verfahren zur Darstellung von hydrocyclischen ªÏ-Aminoalkylverbindungen | |
| DE1418067B2 (index.php) | ||
| DE1618476C (index.php) | ||
| DE2940037A1 (de) | Monomeres n-methylenaminoacetonitril und verfahren zu seiner herstellung | |
| DE2518271A1 (de) | Verfahren zur herstellung aromatischer primaerer amine | |
| AT226220B (de) | Verfahren zur Herstellung von Phenyläthanolaminderivaten | |
| DE116871C (index.php) | ||
| DE2944480A1 (de) | Verfahren zur herstellung von phenylessigsaeure und von deren einfachen derivaten | |
| DE2019261C3 (de) | Verfahren zur Herstellung von Alkanon- oder Cycloalkanon-oximen durch partielle Reduktion von Nitroalkanen oder Nitrocycloalkanen | |
| DE1223366B (de) | Verfahren zur Herstellung von aliphatischen Isocyanaten |