DE2339923C3 - Mehrfach-Gasentladungsvorrichtung - Google Patents
Mehrfach-GasentladungsvorrichtungInfo
- Publication number
- DE2339923C3 DE2339923C3 DE2339923A DE2339923A DE2339923C3 DE 2339923 C3 DE2339923 C3 DE 2339923C3 DE 2339923 A DE2339923 A DE 2339923A DE 2339923 A DE2339923 A DE 2339923A DE 2339923 C3 DE2339923 C3 DE 2339923C3
- Authority
- DE
- Germany
- Prior art keywords
- gas
- discharge
- xenon
- dielectric
- gas discharge
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007789 gas Substances 0.000 claims description 67
- 239000000203 mixture Substances 0.000 claims description 25
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 claims description 20
- 229910052724 xenon Inorganic materials 0.000 claims description 19
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 18
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 13
- 229910052786 argon Inorganic materials 0.000 claims description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052754 neon Inorganic materials 0.000 claims description 5
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 claims description 5
- 229910052734 helium Inorganic materials 0.000 claims description 4
- 239000001307 helium Substances 0.000 claims description 4
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052743 krypton Inorganic materials 0.000 claims description 4
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 claims description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052753 mercury Inorganic materials 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 210000004027 cell Anatomy 0.000 description 35
- 239000004020 conductor Substances 0.000 description 26
- 230000003750 conditioning effect Effects 0.000 description 15
- 239000011521 glass Substances 0.000 description 11
- 238000003860 storage Methods 0.000 description 11
- 230000005855 radiation Effects 0.000 description 8
- 238000000034 method Methods 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000005684 electric field Effects 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 230000007704 transition Effects 0.000 description 4
- 230000000712 assembly Effects 0.000 description 3
- 238000000429 assembly Methods 0.000 description 3
- 239000003574 free electron Substances 0.000 description 3
- -1 freon Chemical compound 0.000 description 3
- 229910052756 noble gas Inorganic materials 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000005361 soda-lime glass Substances 0.000 description 3
- 125000006850 spacer group Chemical group 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- 230000000007 visual effect Effects 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-VVKOMZTBSA-N Dideuterium Chemical compound [2H][2H] UFHFLCQGNIYNRP-VVKOMZTBSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XEHUYCFKGDBCDL-UHFFFAOYSA-N S(=O)(=O)(O)[Se]S(=O)(=O)O.[Zn] Chemical compound S(=O)(=O)(O)[Se]S(=O)(=O)O.[Zn] XEHUYCFKGDBCDL-UHFFFAOYSA-N 0.000 description 1
- 229910018503 SF6 Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229910010165 TiCu Inorganic materials 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- CNZAMPLGEANWCA-UHFFFAOYSA-N [F].[Mg] Chemical compound [F].[Mg] CNZAMPLGEANWCA-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000002313 adhesive film Substances 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 238000009388 chemical precipitation Methods 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- 239000003989 dielectric material Substances 0.000 description 1
- UFHFLCQGNIYNRP-JMRXTUGHSA-N ditritium Chemical compound [3H][3H] UFHFLCQGNIYNRP-JMRXTUGHSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- CPBQJMYROZQQJC-UHFFFAOYSA-N helium neon Chemical class [He].[Ne] CPBQJMYROZQQJC-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 description 1
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 1
- DJZHPOJZOWHJPP-UHFFFAOYSA-N magnesium;dioxido(dioxo)tungsten Chemical compound [Mg+2].[O-][W]([O-])(=O)=O DJZHPOJZOWHJPP-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000006386 memory function Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 238000001259 photo etching Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- SFZCNBIFKDRMGX-UHFFFAOYSA-N sulfur hexafluoride Chemical compound FS(F)(F)(F)(F)F SFZCNBIFKDRMGX-UHFFFAOYSA-N 0.000 description 1
- 229960000909 sulfur hexafluoride Drugs 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 238000002207 thermal evaporation Methods 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical class [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 235000019352 zinc silicate Nutrition 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- UQMZPFKLYHOJDL-UHFFFAOYSA-N zinc;cadmium(2+);disulfide Chemical compound [S-2].[S-2].[Zn+2].[Cd+2] UQMZPFKLYHOJDL-UHFFFAOYSA-N 0.000 description 1
- RNWHGQJWIACOKP-UHFFFAOYSA-N zinc;oxygen(2-) Chemical class [O-2].[Zn+2] RNWHGQJWIACOKP-UHFFFAOYSA-N 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J17/00—Gas-filled discharge tubes with solid cathode
- H01J17/02—Details
- H01J17/20—Selection of substances for gas fillings; Specified operating pressures or temperatures
Landscapes
- Gas-Filled Discharge Tubes (AREA)
- Manufacture Of Electron Tubes, Discharge Lamp Vessels, Lead-In Wires, And The Like (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US279875A US3886393A (en) | 1972-08-11 | 1972-08-11 | Gas mixture for gas discharge device |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2339923A1 DE2339923A1 (de) | 1974-02-14 |
| DE2339923B2 DE2339923B2 (de) | 1976-02-26 |
| DE2339923C3 true DE2339923C3 (de) | 1980-09-18 |
Family
ID=23070725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2339923A Expired DE2339923C3 (de) | 1972-08-11 | 1973-08-07 | Mehrfach-Gasentladungsvorrichtung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3886393A (enExample) |
| JP (1) | JPS5422867B2 (enExample) |
| CA (1) | CA998087A (enExample) |
| DE (1) | DE2339923C3 (enExample) |
| FR (1) | FR2195835B1 (enExample) |
| GB (1) | GB1443558A (enExample) |
| IT (1) | IT989826B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4013912A (en) * | 1973-11-05 | 1977-03-22 | Owens-Illinois, Inc. | Gas mixture for glow discharge device |
| US4041345A (en) * | 1975-12-31 | 1977-08-09 | International Business Machines Corporation | Blue color AC gas discharge display panel and method |
| US4236096A (en) * | 1976-12-14 | 1980-11-25 | Siemens Aktiengesellschaft | Plasma image display device |
| US4147958A (en) * | 1977-06-30 | 1979-04-03 | International Business Machines Corporation | Multicolor gas discharge display memory panel |
| DE2748731C3 (de) | 1977-10-29 | 1980-11-27 | Original Hanau Heraeus Gmbh, 6450 Hanau | Gasentladungslampe mit Kontinuum im sichtbaren Spektralbereich |
| NL7811351A (nl) * | 1978-11-17 | 1980-05-20 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| NL7811350A (nl) * | 1978-11-17 | 1980-05-20 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| DE2929270A1 (de) * | 1979-07-19 | 1981-02-12 | Siemens Ag | Plasma-bildanzeigevorrichtung |
| DE3133743A1 (de) * | 1981-08-26 | 1983-03-10 | Battelle-Institut E.V., 6000 Frankfurt | Verfahren zur beseitigung der wechselwirkung zwischen nachbarzellen in gasentladungs-matrixbauelementen |
| JPH02244552A (ja) * | 1989-03-17 | 1990-09-28 | Toshiba Lighting & Technol Corp | 偏平断面蛍光ランプ |
| JP3532578B2 (ja) * | 1991-05-31 | 2004-05-31 | 三菱電機株式会社 | 放電ランプおよびこれを用いる画像表示装置 |
| US5914562A (en) * | 1995-02-06 | 1999-06-22 | Philips Electronics North America Corporation | Anodic bonded plasma addressed liquid crystal displays |
| DE69826977T2 (de) * | 1997-08-14 | 2005-03-10 | Matsushita Electric Industrial Co., Ltd., Kadoma | Gasentladungstafel und lichterzeugende gasvorrichtung |
| KR100723751B1 (ko) | 2000-01-26 | 2007-05-30 | 마츠시타 덴끼 산교 가부시키가이샤 | 가스방전 발광장치 및 그 제조방법 |
| JP4271902B2 (ja) * | 2002-05-27 | 2009-06-03 | 株式会社日立製作所 | プラズマディスプレイパネル及びそれを用いた画像表示装置 |
| RU2275709C1 (ru) * | 2004-11-12 | 2006-04-27 | Открытое акционерное общество "Научно-исследовательский институт газоразрядных приборов "Плазма" (ОАО "Плазма") | Газоразрядная индикаторная панель переменного тока |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2714682A (en) * | 1952-06-27 | 1955-08-02 | Westinghouse Electric Corp | Low pressure fluorescent and discharge lamps |
| US4027191A (en) * | 1970-12-16 | 1977-05-31 | Schaufele Robert F | Phosphor geometry for color displays from a multiple gaseous discharge display/memory panel |
| US3701916A (en) * | 1971-02-01 | 1972-10-31 | Burroughs Corp | Display panel having gas-filled cells utilizing phosphor materials |
| US3704386A (en) * | 1971-03-19 | 1972-11-28 | Burroughs Corp | Display panel and method of operating said panel to produce different colors of light output |
-
1972
- 1972-08-11 US US279875A patent/US3886393A/en not_active Expired - Lifetime
-
1973
- 1973-07-04 JP JP7560273A patent/JPS5422867B2/ja not_active Expired
- 1973-07-10 IT IT51382/73A patent/IT989826B/it active
- 1973-07-30 CA CA177,562A patent/CA998087A/en not_active Expired
- 1973-08-07 FR FR7328836A patent/FR2195835B1/fr not_active Expired
- 1973-08-07 DE DE2339923A patent/DE2339923C3/de not_active Expired
- 1973-08-10 GB GB3792873A patent/GB1443558A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2339923A1 (de) | 1974-02-14 |
| DE2339923B2 (de) | 1976-02-26 |
| IT989826B (it) | 1975-06-10 |
| GB1443558A (en) | 1976-07-21 |
| FR2195835A1 (enExample) | 1974-03-08 |
| US3886393A (en) | 1975-05-27 |
| FR2195835B1 (enExample) | 1977-08-26 |
| JPS5422867B2 (enExample) | 1979-08-09 |
| JPS4953761A (enExample) | 1974-05-24 |
| CA998087A (en) | 1976-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2339923C3 (de) | Mehrfach-Gasentladungsvorrichtung | |
| DE69828749T2 (de) | Plasma-Anzeigetafel | |
| DE2152418A1 (de) | Gasentladungsanzeige- und Speicherfeld mit Farbanzeige | |
| DE2506773A1 (de) | Gasentladungs-wiedergabefeld | |
| DE2429663A1 (de) | Gasentladungsanzeige/speichertafel mit raeumlicher entladungsuebertragung | |
| DE2249072C3 (de) | Verfahren zum Betreiben eines Mehrfach-Gasentladungs-Anzeige/Speicher-Feldes | |
| DE2249682A1 (de) | Monolithisch strukturierte gasentladungsvorrichtung und herstellungsverfahren | |
| DE2117919A1 (enExample) | ||
| US4109176A (en) | Insulating dielectric for gas discharge device | |
| US3896327A (en) | Monolithic gas discharge display device | |
| DE2136102C3 (de) | Gasentladungsfeld | |
| US3904915A (en) | Gas mixture for gas discharge device | |
| DE2557617A1 (de) | Verfahren zum herstellen von rohrverbindungen mit hilfe von loetglas | |
| DE2308083C3 (de) | Gasentladungs-Anzeigevorrichtung mit kapazitiver Speicherfunktion | |
| DE1959287B2 (de) | Gasentladungsanordnung fuer anzeigefelder | |
| DE2343244A1 (de) | Mehrfach-gasentladungs-anzeigevorrichtung | |
| DE2429549A1 (de) | Verfahren und einrichtung zur einfuehrung logischer verknuepfungen in anzeige/speichergasentladungsvorrichtungen durch raeumliche entladungsuebertragung | |
| DE2334684A1 (de) | Gasentladungs-anzeigetafel, in der fuer die bildpunkte verschiedene lichtintensitaetswerte gewaehlt werden koennen | |
| DE2139210C3 (enExample) | ||
| DE2701655A1 (de) | Verfahren und vorrichtung zum betrieb einer mehrzelligen gasentladungsanzeige/speichervorrichtung | |
| EP0021371A1 (de) | Plasma-Display | |
| DE2430129A1 (de) | Gasentladungs-datensichtgeraet-adressierung | |
| DE2318974A1 (de) | Gasentladungstafel mit breiten elektroden an randpilotzellen | |
| DE2123686A1 (de) | Anzeigevorrichtung oder -tafel | |
| DE2248375A1 (de) | Anzeigevorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |