DE2334611A1 - Herbizid - Google Patents
HerbizidInfo
- Publication number
- DE2334611A1 DE2334611A1 DE19732334611 DE2334611A DE2334611A1 DE 2334611 A1 DE2334611 A1 DE 2334611A1 DE 19732334611 DE19732334611 DE 19732334611 DE 2334611 A DE2334611 A DE 2334611A DE 2334611 A1 DE2334611 A1 DE 2334611A1
- Authority
- DE
- Germany
- Prior art keywords
- spp
- substituted
- salt
- benzothiadiazinon
- dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000002363 herbicidal effect Effects 0.000 title description 12
- 239000004009 herbicide Substances 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims description 38
- -1 isooctyl Chemical group 0.000 claims description 30
- 150000002148 esters Chemical class 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- QQOQZEZBLRCWHP-UHFFFAOYSA-N (Z)-2-(2,4-dichlorophenoxy)but-2-enoic acid Chemical compound ClC1=C(O/C(/C(=O)O)=CC)C=CC(=C1)Cl QQOQZEZBLRCWHP-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 74
- 241000196324 Embryophyta Species 0.000 description 59
- 244000038559 crop plants Species 0.000 description 52
- 241000209219 Hordeum Species 0.000 description 42
- 244000098338 Triticum aestivum Species 0.000 description 38
- 235000014820 Galium aparine Nutrition 0.000 description 36
- 240000005702 Galium aparine Species 0.000 description 36
- 239000000203 mixture Substances 0.000 description 34
- 241001666377 Apera Species 0.000 description 29
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 28
- 244000303225 Lamium amplexicaule Species 0.000 description 28
- 241001621841 Alopecurus myosuroides Species 0.000 description 26
- 150000001408 amides Chemical group 0.000 description 15
- 235000007238 Secale cereale Nutrition 0.000 description 12
- 244000082988 Secale cereale Species 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- 240000008042 Zea mays Species 0.000 description 9
- 235000007244 Zea mays Nutrition 0.000 description 9
- 159000000000 sodium salts Chemical class 0.000 description 9
- PKAUICCNAWQPAU-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)acetic acid;n-methylmethanamine Chemical compound CNC.CC1=CC(Cl)=CC=C1OCC(O)=O PKAUICCNAWQPAU-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 240000006597 Poa trivialis Species 0.000 description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 6
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 6
- 241001101998 Galium Species 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 150000004656 dimethylamines Chemical class 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 239000011575 calcium Chemical class 0.000 description 4
- 235000013877 carbamide Nutrition 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 241000743985 Alopecurus Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000520028 Lamium Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000468082 Sorocephalus alopecurus Species 0.000 description 3
- 240000006694 Stellaria media Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- CFIABBBIDUBPQY-UHFFFAOYSA-N diethylazanium;2-(2,4,5-trichlorophenoxy)acetate Chemical compound CC[NH2+]CC.[O-]C(=O)COC1=CC(Cl)=C(Cl)C=C1Cl CFIABBBIDUBPQY-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- LUDUIQAQFKIYND-UHFFFAOYSA-M potassium;2-(2,4,5-trichlorophenoxy)acetate Chemical compound [K+].[O-]C(=O)COC1=CC(Cl)=C(Cl)C=C1Cl LUDUIQAQFKIYND-UHFFFAOYSA-M 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- RFOHRSIAXQACDB-UHFFFAOYSA-M sodium;2-(2,4-dichlorophenoxy)acetate Chemical compound [Na+].[O-]C(=O)COC1=CC=C(Cl)C=C1Cl RFOHRSIAXQACDB-UHFFFAOYSA-M 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- IUQJDHJVPLLKFL-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetate;dimethylazanium Chemical compound CNC.OC(=O)COC1=CC=C(Cl)C=C1Cl IUQJDHJVPLLKFL-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical class NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 241000219317 Amaranthaceae Species 0.000 description 2
- 101001053401 Arabidopsis thaliana Acid beta-fructofuranosidase 3, vacuolar Proteins 0.000 description 2
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical class [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical class CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical class C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 241000013557 Plantaginaceae Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 241000647292 Tripleurospermum maritimum Species 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000000729 antidote Substances 0.000 description 2
- 229940075522 antidotes Drugs 0.000 description 2
- 239000003899 bactericide agent Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical class CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 230000001069 nematicidal effect Effects 0.000 description 2
- 239000005645 nematicide Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- SODPIMGUZLOIPE-UHFFFAOYSA-N (4-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- FTDGDIFUDKDKAW-UHFFFAOYSA-N 1,1a,5,5a,6,6a-hexahydrocyclopropa[a]indene Chemical group C12C(CC3CC=CC=C13)C2 FTDGDIFUDKDKAW-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical group C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- VPGSXIKVUASQIY-UHFFFAOYSA-N 1,2-dibutylnaphthalene Chemical compound C1=CC=CC2=C(CCCC)C(CCCC)=CC=C21 VPGSXIKVUASQIY-UHFFFAOYSA-N 0.000 description 1
- LTQKIFCNCIFEHG-UHFFFAOYSA-N 1,2-oxazole 1H-pyrimidin-2-one Chemical group C=1C=NOC=1.O=C1N=CC=CN1 LTQKIFCNCIFEHG-UHFFFAOYSA-N 0.000 description 1
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- ZLOTYHZOJPLLGG-UHFFFAOYSA-N 1-sulfanylidenethiadiazinane Chemical group S=S1CCCNN1 ZLOTYHZOJPLLGG-UHFFFAOYSA-N 0.000 description 1
- XUJLWPFSUCHPQL-UHFFFAOYSA-N 11-methyldodecan-1-ol Chemical compound CC(C)CCCCCCCCCCO XUJLWPFSUCHPQL-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical class CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- NOIXNOMHHWGUTG-UHFFFAOYSA-N 2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1C1=NN(CC(F)(F)F)C=C1C1=CC=NC=C1 NOIXNOMHHWGUTG-UHFFFAOYSA-N 0.000 description 1
- MUKYLHIZBOASDM-UHFFFAOYSA-N 2-[carbamimidoyl(methyl)amino]acetic acid 2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound NC(=N)N(C)CC(O)=O.OCC(O)C(O)C(O)C(O)C(O)=O MUKYLHIZBOASDM-UHFFFAOYSA-N 0.000 description 1
- REEXLQXWNOSJKO-UHFFFAOYSA-N 2h-1$l^{4},2,3-benzothiadiazine 1-oxide Chemical class C1=CC=C2S(=O)NN=CC2=C1 REEXLQXWNOSJKO-UHFFFAOYSA-N 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical group NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical group C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 241000206486 Adonis Species 0.000 description 1
- 241000125147 Aethusa cynapium Species 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241001533988 Agrostemma Species 0.000 description 1
- 241000219479 Aizoaceae Species 0.000 description 1
- 241000219496 Alnus Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 235000005750 Ammi majus Nutrition 0.000 description 1
- 244000160914 Ammi majus Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 241001377087 Amsinckia Species 0.000 description 1
- 241000208479 Anagallis arvensis Species 0.000 description 1
- 244000277177 Anchusa azurea Species 0.000 description 1
- 235000017106 Anchusa azurea Nutrition 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 241000208173 Apiaceae Species 0.000 description 1
- 241000219195 Arabidopsis thaliana Species 0.000 description 1
- 235000003826 Artemisia Nutrition 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- 241000219305 Atriplex Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000007563 Barbarea vulgaris Nutrition 0.000 description 1
- 240000008399 Barbarea vulgaris Species 0.000 description 1
- 241000143476 Bidens Species 0.000 description 1
- 241001072256 Boraginaceae Species 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000219193 Brassicaceae Species 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- WUFYJSIFTHYAGJ-UHFFFAOYSA-N C=1C=NSC=1.O=C1N=CC=CN1 Chemical group C=1C=NSC=1.O=C1N=CC=CN1 WUFYJSIFTHYAGJ-UHFFFAOYSA-N 0.000 description 1
- DJSWBVHIFNJAFN-UHFFFAOYSA-N CNC.ClC1=CC=C(OCC(=O)O)C=C1 Chemical compound CNC.ClC1=CC=C(OCC(=O)O)C=C1 DJSWBVHIFNJAFN-UHFFFAOYSA-N 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- 241000219321 Caryophyllaceae Species 0.000 description 1
- 241000209120 Cenchrus Species 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219294 Cerastium Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 244000037364 Cinnamomum aromaticum Species 0.000 description 1
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241000233838 Commelina Species 0.000 description 1
- 241000207782 Convolvulaceae Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 241000219992 Cuphea Species 0.000 description 1
- 241000207901 Cuscuta Species 0.000 description 1
- 241000234646 Cyperaceae Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241000202296 Delphinium Species 0.000 description 1
- 241000032170 Descurainia Species 0.000 description 1
- 240000001879 Digitalis lutea Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 241000865506 Diodia Species 0.000 description 1
- 241000004297 Draba Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 241001518935 Eragrostis Species 0.000 description 1
- 241000132521 Erigeron Species 0.000 description 1
- 241001071608 Erodium Species 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- 241000221017 Euphorbiaceae Species 0.000 description 1
- 241000220485 Fabaceae Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 244000044980 Fumaria officinalis Species 0.000 description 1
- 235000006961 Fumaria officinalis Nutrition 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241000246169 Genista Species 0.000 description 1
- 241000208150 Geraniaceae Species 0.000 description 1
- 235000005206 Hibiscus Nutrition 0.000 description 1
- 235000007185 Hibiscus lunariifolius Nutrition 0.000 description 1
- 244000284380 Hibiscus rosa sinensis Species 0.000 description 1
- 241001113566 Hydrocharitaceae Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000110847 Kochia Species 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 241000207923 Lamiaceae Species 0.000 description 1
- 235000006761 Lapsana communis Nutrition 0.000 description 1
- 240000002702 Lapsana communis Species 0.000 description 1
- 241000219729 Lathyrus Species 0.000 description 1
- 241000932234 Lepidium didymum Species 0.000 description 1
- 241000320639 Leptochloa Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000167853 Linaria Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical class [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001071917 Lithospermum Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 241000612166 Lysimachia Species 0.000 description 1
- 241000219991 Lythraceae Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000013939 Malva Nutrition 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 241000219071 Malvaceae Species 0.000 description 1
- 241000736305 Marsilea quadrifolia Species 0.000 description 1
- 241000736303 Marsileaceae Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 241000219823 Medicago Species 0.000 description 1
- 241000221026 Mercurialis annua Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 244000087461 Mollugo pentaphylla Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical class CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methyl urea Chemical compound CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- 241000721619 Najas Species 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 241001106046 Nicandra Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000219929 Onagraceae Species 0.000 description 1
- 241000208165 Oxalidaceae Species 0.000 description 1
- 235000016499 Oxalis corniculata Nutrition 0.000 description 1
- 240000007019 Oxalis corniculata Species 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241000218180 Papaveraceae Species 0.000 description 1
- 241000208181 Pelargonium Species 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 244000273256 Phragmites communis Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 244000064622 Physalis edulis Species 0.000 description 1
- 241001127637 Plantago Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000219050 Polygonaceae Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000196124 Polypodiaceae Species 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 241000219304 Portulacaceae Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241001092489 Potentilla Species 0.000 description 1
- 241000208476 Primulaceae Species 0.000 description 1
- 241001453830 Pteridium Species 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 241000218201 Ranunculaceae Species 0.000 description 1
- 241000218206 Ranunculus Species 0.000 description 1
- 241000220259 Raphanus Species 0.000 description 1
- 241000593769 Richardia <angiosperm> Species 0.000 description 1
- 235000004789 Rosa xanthina Nutrition 0.000 description 1
- 241000220222 Rosaceae Species 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- 241000219053 Rumex Species 0.000 description 1
- 241001632050 Salsola Species 0.000 description 1
- 241000219287 Saponaria Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000583552 Scleranthus annuus Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000219289 Silene Species 0.000 description 1
- 241000220263 Sisymbrium Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 241000488874 Sonchus Species 0.000 description 1
- 241000960310 Spergula Species 0.000 description 1
- 235000012308 Tagetes Nutrition 0.000 description 1
- 241000736851 Tagetes Species 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- 241000722118 Thlaspi Species 0.000 description 1
- 241000907897 Tilia Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000819233 Tribulus <sea snail> Species 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 241000249864 Tussilago Species 0.000 description 1
- 241000145124 Uniola Species 0.000 description 1
- 239000005659 Urtica spp. Substances 0.000 description 1
- 241000218215 Urticaceae Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- 241000159213 Zygophyllaceae Species 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000001448 anilines Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- BUSBFZWLPXDYIC-UHFFFAOYSA-N arsonic acid Chemical class O[AsH](O)=O BUSBFZWLPXDYIC-UHFFFAOYSA-N 0.000 description 1
- 244000030166 artemisia Species 0.000 description 1
- 235000009052 artemisia Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 150000005130 benzoxazines Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- TTZBPVOGYUZDEF-UHFFFAOYSA-N bis(2-hydroxyethyl)azanium;propanoate Chemical compound CCC([O-])=O.OCC[NH2+]CCO TTZBPVOGYUZDEF-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012972 dimethylethanolamine Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 150000002019 disulfides Chemical group 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QQSGDKKFXBGYON-UHFFFAOYSA-N ethoxy-methylperoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-$l^{5}-phosphane Chemical group CCOP(=S)(OOC)OC1=CC(C)=NC(C(C)C)=N1 QQSGDKKFXBGYON-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- MUJOIMFVNIBMKC-UHFFFAOYSA-N fludioxonil Chemical compound C=12OC(F)(F)OC2=CC=CC=1C1=CNC=C1C#N MUJOIMFVNIBMKC-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 150000001469 hydantoins Chemical group 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical group 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 239000010807 litter Substances 0.000 description 1
- 239000011777 magnesium Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- JOHLTMWXHJLNDE-UHFFFAOYSA-N methoxyurea Chemical compound CONC(N)=O JOHLTMWXHJLNDE-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- SKSVCKGZZUFGGC-UHFFFAOYSA-N n-methylmethanamine;propanoic acid Chemical compound C[NH2+]C.CCC([O-])=O SKSVCKGZZUFGGC-UHFFFAOYSA-N 0.000 description 1
- 150000002791 naphthoquinones Chemical group 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- QNMLMAVEXUCXRG-UHFFFAOYSA-N oxadiazinane-4,5-dione Chemical group O=C1CONNC1=O QNMLMAVEXUCXRG-UHFFFAOYSA-N 0.000 description 1
- 150000004866 oxadiazoles Chemical group 0.000 description 1
- YDCVQGAUCOROHB-UHFFFAOYSA-N oxadiazolidine-4,5-dione Chemical class O=C1NNOC1=O YDCVQGAUCOROHB-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- BNANYJKQNHOIPC-UHFFFAOYSA-N pentyl 2-(2,4,5-trichlorophenoxy)acetate Chemical compound CCCCCOC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl BNANYJKQNHOIPC-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- REJGOFYVRVIODZ-UHFFFAOYSA-N phosphanium;chloride Chemical group P.Cl REJGOFYVRVIODZ-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 150000003217 pyrazoles Chemical group 0.000 description 1
- BFZYLUGEHGYJKJ-UHFFFAOYSA-N pyrazolidine-3-thione Chemical group S=C1CCNN1 BFZYLUGEHGYJKJ-UHFFFAOYSA-N 0.000 description 1
- 150000004892 pyridazines Chemical group 0.000 description 1
- 150000005299 pyridinones Chemical group 0.000 description 1
- 150000003230 pyrimidines Chemical group 0.000 description 1
- 150000008318 pyrimidones Chemical group 0.000 description 1
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical class OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical group 0.000 description 1
- 150000004040 pyrrolidinones Chemical group 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003248 quinolines Chemical group 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- DHJHUXNTNSRSEX-UHFFFAOYSA-M sodium;2-(4-chloro-2-methylphenoxy)propanoate Chemical compound [Na+].[O-]C(=O)C(C)OC1=CC=C(Cl)C=C1C DHJHUXNTNSRSEX-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- OLPRIZQBWZMBAS-UHFFFAOYSA-N thiadiazolidine 1,1-dioxide Chemical group O=S1(=O)CCNN1 OLPRIZQBWZMBAS-UHFFFAOYSA-N 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical group 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 150000003585 thioureas Chemical group 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 150000003918 triazines Chemical group 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 229940047183 tribulus Drugs 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/88—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms six-membered rings with three ring hetero atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/30—Derivatives containing the group >N—CO—N aryl or >N—CS—N—aryl
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N2300/00—Combinations or mixtures of active ingredients covered by classes A01N27/00 - A01N65/48 with other active or formulation relevant ingredients, e.g. specific carrier materials or surfactants, covered by classes A01N25/00 - A01N65/48
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Description
in der X Methoxy und Y Chlor bedeutet, wenn R Wasserstoff
2
und R Methoxy bedeuten und wenn R Cyclohexyenyl bedeutet,
und R Methoxy bedeuten und wenn R Cyclohexyenyl bedeutet,
2
bedeuten R Wasserstoff Methyl oder OCH^ und X und Y Wasser
bedeuten R Wasserstoff Methyl oder OCH^ und X und Y Wasser
stoff, Chlor, Brom, Methyl, Halogenalkyl und Methoxy, und b) einer Verbindung der Formel
in der X und Y Chlor, Methyl, η 0 bis J5, R Wasserstoff,
niederes Alkyl, m 0 bis 2, R Alkyl, vorzugsweise Amyl
oder Isooctyl, R Wasserstoff und die Salze, z.B. Salze von Natrium, Kalium, Dimethylamin, Diäthanolamin, Diäthylamin
bedeutet oder die Salze oder Ester von 2,4-Dichlorphenoxycrotonsäure
bedeutet
409884/1381
- 2 - O.Z. 29
und gegebenenfalls 233ΛΒ11
c) einer Verbindung der Formel
1 2
in der R niederes Alkyl, R Wasserstoff und die Salze,
z.B. Salze von Ammonium, Natrium, Kalium, Lithium, Calcium, Magnesium, Äthylamin, Dimethylamin, Diäthylamin, Diäthanolamin,
Äthanolamin, Dimethyläthanolamin usw. bedeutet
eine bessere herbizide Wirkung als die Einzelwirkstoffe hat.
Die Mischungen können eine oder mehrere Verbindungen der Formel a) und Verbindungen der Formel b) und c) enthalten.
Die Mischungsverhältnisse können beliebig gewählt werden. Das Mischungsverhältnis der Wirkstoffe a) zu b) zu c) beträgt
0,1 bis 10 Teilea: 1 Teil b : 0,1 bis 10 Teile c (Gewichtsteile)
Die erfindungsgemäßen Mittel können in ihrer aufgewandten Menge schwanken. Die aufgewandte Menge hängt hauptsächlich von der
Art des gewünschten Effektes ab. Die Aufwandmenge liegt im allgemeinen zwischen 0,1 und JO oder mehr, vorzugsweise 0,2
bis 6 kg Wirkstoff pro Hektar. Die erfindungsgemäßen Mittel
können unter anderem im Vorpflanz-, Nachpflanz-, Voreaat-, Vorauflauf-, Nachauflaufverfahren oder während des Auflaufens
der Kultur- oder unerwünschten Pflanzen ein- oder mehrmals angewandt werden.
Die Mischungen sind geeignet in Nutzpflanzen, z.B. Triticum spp., Hordeum spp., Seeale cereale, Zea mays,
Sorghum spp., Alnus spp., Genista spp., Avena sativa, Tilia spp.
Die Mischungen sind geeignet, unerwünschte Pflanzen zu bekämpfen.
Außerdem können die Mischungen als Totalmittel an Gräben,
409884/1381 - 5 -
- 3 - O.Z, 29 965
Gewässern, Gleisanlagen, auf Kahlflächen, Ödland etc. angewandt
werden.
Die Anwendung erfolgt z.B. in Form von direkt versprühbaren Lösungen, Pulvern, Suspensionen oder Dispersionen, Emulsionen,
öldispersionen, Pasten, Stäubemitteln, Streumitteln, Granulaten durch Versprühen, Vernebeln, Verstäuben, Verstreuen oder
Gießen. Die Anwendungsformen richten sich ganz nach den Verwendungszwecken; sie sollten in jedem Fall möglichst die
feinste Verteilung der erfindungsgemäßen Wirkstoffe gewährleisten.
Zur Herstellung von direkt versprühbaren Lösungen, Emulsionen, Pasten und öldispersionen kommen Mineralölfraktionen von
mittlerem bis hohem Siedepunkt, wie Kerosin oder Dieselöl, ferner Kohlenteeröle usw., sowie öle pflanzlichen oder
tierischen Ursprungs, aliphatische, cyclische und aromatische Kohlenwasserstoffe, z.B. Benzol, Toluol, Xylol, Paraffin,
Tetrahydronaphthalin, alkylierte Naphthaline oder deren Derivate z.B. Methanol, Äthanol, Propanol, Butanol, Chloroform,
Tetrachlorkohlenstoff, Cyclohexanol, Cyclohexanon, Chlorbenzol, Isophoron usw., stark polare Lösungsmittel, wie z.B. Dimethylformamid,
Dimethylsulfoxid, N-Methylpyrrolidon, Wasser usw. in Betracht.
Wäßrige Anwendungsformen können aus Emulsionskonzentraten,
Pasten oder netzbaren Pulvern (Spritzpulvern), öldispersionen durch Zusatz von Wasser bereitet werden. Zur Herstellung von
Emulsionen, Pasten öder öldispersionen können die Substanzen
als solche oder in einem öl oder Lösungsmittel gelöst, mittels Netz-, Haft-, Dispergier- oder Emulgiermittel in Wasser
homogenisiert werden. Es können aber auch aus wirksamer Substanz, Netz-, Haft-, Dispergier- oder Emulgiermittel und
eventuell Lösungsmittel oder öl bestehende Konzentrate hergestellt
werden, die zur Verdünnung mit Wasser geeignet sind.
An oberflächenaktiven Stoffen sind zu nennen:
Alkali-, Erdalkali-, Ammoniumsalze von Ligninsulfonsäure, Naphthalinsulfonsäuren, Phenolsulfonsäuren, Alkylarylsulfonate,
409884/1381 - H -
- 4 - O.Z. 29 965
Alkylsulfate, Alkylsulfonate, Alkali- und ErdalkalisaLze der
Dibutylnaphthalinsulfonsäure, Lauryläthersulfat, Fettalkoholsulfate, fettsaure Alkali- und Erdalkalisalze, Salze
sulfatierter Hexadecanole, Heptadecanole, Octadecanole, Salze von sulfatiertem Fettalkoholglykoläther, Kondensationsprodukte von sulfoniertem Naphthalin und Naphthalinderivaten
mit Formaldehyd, Kondensationsprodukte des Naphthalins bzw. der Naphthalinsulfonsäuren mit Phenol und Formaldehyd, PoIyoxyäthylen-octylphenoläther,
äthoxyliertes Isooctylphenol-, Octylphenol-, Nonylphenol, Alkylphenolpolyglykoläther, Tributylphenylpolyglykoläther,
Alkylarylpolyätheralkohole, Isotridecylalkohol, Fettalkoholäthylenoxid-Kondensate, äthoxyliertes
Rizinusöl, Polyoxyäthylenalkyläther, äthoxyliertes Polyoxypropylen, Laurylalkoholpolyglykolätheracetal, Sorbitester,
Lignin, Sulfitablaugen und Methylcellulose.
Pulver, Streu- und Stäubemittel können durch Mischen oder gemeinsames Vermählen der wirksamen Substanzen mit einem
festen Trägerstoff hergestellt werden.
Granulate, z.B. Umhüllungs-, Imprägnierungs- und Homogengranulate,
können durch Bindung der Wirkstoffe an feste Trägerstoffe hergestellt werden. Feste Trägerstoffe sind z.B.
Mineralerden wie Silicagel, Kieselsäuren, Kieselgele, Silikate, Talkum, Kaolin, Attaclay, Kalkstein, Kalk, Kreide, Talkum,
Bolus, Löß, Ton, Dolomit, Diatomeenerde, Calcium- und Magnesiumsulfat, Magnesiumoxid, gemahlene Kunststoffe, Düngemittel,
wie z.B. Ammoniumsulfat, Ammoniumphosphat, Ammoniumnitrat, Harnstoffe und pflanzliche Produkte, wie Getreidemehl,
Baumrinden-, Holz- und Nußschalenmehl, Cellulosepulver und andere feste Trägerstoffe.
Die Formulierungen enthalten zwischen 0,1 und 95 Gewichtsprozent
Wirkstoff, vorzugsweise zwischen 0,5 und 90 Gewichtsprozent.
Zu den Mischungen oder Einzelwirkstoffen können öle verschiedenen
Typs, Herbizide, Fungizide, Nematozide, Insektizide, Bakterizide, Spurenelemente, Düngemittel, Antischaummittel
409884/1381 - 5 -
- 5 - O.Z. 29 965
(z.B. Silikone), Wachstumsregulatoren, Antidotmittel oder
andere herbizid wirksame Verbindungen, wie z.B.
substituierte Aniline substituierte Aryloxycarbonsäuren sowie deren Salze,
Ester und Amide substituierte Äther
substituierte Arsonsäuren sowie deren Salze, Ester und Amide
substituierte Benzimidazole substituierte Benzisothiazole substituierte Benzthiadiazinondioxide
substituierte Benzoxazine substituierte Benzoxazinone substituierte Benzthiadlazole
substituierte Biurete substituierte Chinoline substituierte Carbamate
substituierte aliphatische Carbonsäuren sowie deren Salze,
Ester und Amide substituierte aromatische Carbonsäuren sowie deren Salze,
Ester und Amide substituierte. Carbamoylalkyl-thiol- oder -dithlophbsphate
substituierte Chinazoline
substituierte Cycloalkylamidocarbonthiolsäuren sowie deren
Salze, Ester und Amide substituierte Cycloalkylcarbonamido-thiazole
substituierte Dicarbonsäuren sowie deren Salze, Ester und Amide
substituierte Dihydrobenzofuranylsulfonate substituierte Disulfide
substituierte Dipyridyliumsalze substituierte Dithiocarbamate
substituierte Dithiophosphorsäuren sowie deren Salze, Ester
und Amide
substituierte Harnstoffe substituierte Hexahydro-lH-carbothioate
substituierte Hydantoine substituierte Hydrazide substituierte Hydrazoniumsalze substituierte Isooxazolpyrimidone
substituierte Imidazole
409884/1381 . 6 .
- 6 - O.Z. 29
substituierte Isothiazolpyrimidone substituierte Ketone
substituierte Naphtochinone substituierte aliphatisch^ Nitrile
substituierte aromatische Nitrile substituierte Oxadiazole substituierte Oxadiazinone
substituierte Oxädiazolldindione substituierte Oxadiazinondione substituierte Phenole sowie deren Salze und Ester
substituierte Phosphonsäuren.sowie deren Salze, Ester und Amide
substituierte Phosphoniumchlorlde substituierte Phosphonalkylglyzine
substituierte Phosphite
substituierte Phosphorsäuren sowie deren Salze, Ester und Amide
substituierte Piperidine substituierte Pyrazole substituierte Pyrazolalkylcarbonsäuren sowie deren Salze,
Ester und Amide substituierte Pyrazoliumsalze substituierte Pyrazoliumalkylsulfate
substituierte Pyridazine substituierte Pyridazone substituierte Pyridincarbonsäuren sowie deren Salze, Ester
und Amide
substituierte Pyridine substituierte Pyridincarboxylate substituierte Pyridinone
substituierte Pyrimidine substituierte Pyrimidone substituierte Pyrrolidincarbonsaure sowie deren SaIz^
Ester und Amide
substituierte Pyrrolidine substituierte Pyrrolidone substituierte Arylsulfonsäuren sowie deren Salze, Ester
und Amide
substituierte Styrole substituierte Tetrahydro-oxadiazindione
substituierte Tetrahydro-oxadiazoldione
409884/1381 - 7 -
- 7 - 0·Ζ· 29 965
substituierte Tetrahydromethanoindene substituierte Tetrahydro-diazol-thione
substituierte Tetrahydro-thiadiazin-thione
substituierte Tetrahydro-thiadiazoldione substituierte aromatische Thiocarbonsäureamide
substituierte Thiocarbonsäuren sowie deren Salze, Ester und Amide substituierte Thiocarbamate
substituierte Thioharnstoffe substituierte Thlophosphorsäuren sowie deren Salze, Ester
und Amide substituierte Triazine substituierte Triazole substituierte Uracile substituierte Uretidinione
gegebenenfalls auch erst unmittelbar vor der Anwendung (Tankmix) zugesetzt werden. Die zuletzt genannten herbiziden Verbindungen
können auch vor oder nach den erfindungsgemäßen Einzelwirkstoffen oder Mischungen zur Anwendung gebracht
werden.
Die Zumischung dieser Mittel zu den erfindungsgemäßen Herbiziden kann im GewichtsverlSLtnis 1 : 10 bis 10 : 1 erfolgen.
Das Gleiche gilt für öle, Fungizide, Nematozide, Insektizide, Bakterizide, Antidotmittel und Wachstumsregulatoren.
Die.Mittel weisen einen starken herbiziden Effekt auf und
können deshalb als Unkrautvernichtungsmittel bzw. zur Bekämpfung unerwünschten Pflanzenwuchees verwende werden.
Ob die Mittel als totale oder selektive Mittel wirken, hängt hauptsächlich von der Wirkstoffmenge je Flächeneinheit
ab.
Unter Unkräuter bzw. unerwünschten Pflanzenwuchees sind alle monokotylen und dikotylen Pflanzen zu verstehen, die an Orten
aufwachsen, wo sie nicht erwünscht sind.
409884/1 381 " 8 '
| - 8 - | 0.Z. 29 9o5 |
| 2334611 | |
| ο können mit don erfindurig | Ggemäßen Mitteln beispielsweise |
| Gramineen, wie | |
| Cynodon spp. | Dactyl is spp. |
| Digitaria spp. | Avena spp. |
| Echinochloa spp. | ßromus spp. |
| Setaria spp. | Uniola spp. |
| Panicum spp. | Poa spp. |
| Alopecurus spp. | Leptochloa spp. |
| Lolium spp. | Brachiaria spp. |
| Sorghum spp. | Eleusine spp. |
| Agropyron spp. | Cenchrus spp. |
| Phalaris spp. | Eragrostis spp. |
| Apera spp. | Phragmites communis |
| und andere | |
| Cyperaceae, wie | |
| Carex spp. | Eleocharis spp. |
| Cyperus spp. | und andere |
| Scirpus spp. |
dikotyle- Unkräuter, wie Malvaceae, z.B.
Abutilon theoprasti Si dft spo.
Malva spp.
Compostiae, wie
Ambrosia spp. Lactuca spp. Senecio spp. Sonchus spp. Xanthlum spp.
Iva spp. Galinsoga spp. Taraxacum spp. Chrysanthemum spp. Bidens spp.
Cirsium spp.
Hibiscus spp, und andere
Centaurea spp. Tussilago spp. Lapsana communis Tagetes spp. Erigeron spp.
Anthemis spp. Matricaria spp. Artemisia spp.
und andere
40988W138 1
Convolvulaceae, wie Convolvulus spp. Ipomoea spp. Jaquemontia tamnifolia
Cruciferae, wie Barbarea vulgaris Brassica sppo
Capsella spp. Sisymbrium sppο Thlaspi sppο
Sinapis arvensis Raphanus spp.
O.Z. 29
Cuscuta spp. und andere
Arabidopsis thaliana Descurainia spp. Draba spp. Coronopus didymus
Lepidium spp. und andere
Geraniaceae, wie Erodium spp<,
Geranium spp.
und andere
Portulacaceae, wie Portulaca spp.
und andere
Primulaceae, wie Anagallis arvensis Lysimachia spp.
und andere
Richardia spp. Galium spp.
Diodia spp. und andere
Scrophulariaceae, wie Linaria spp. Veronica spp.
Digitalis spp und andere
Solaiaceae, wie Physalis spp.
Solanum spp. Datura spp.
Nicandra spp, und andere
409884/1381
- 10 -
Urticaceae, wie Urtica spp.
u.Z. 29
Violaceae, wie Viola spp.
und andere
Zygophyllaceae, wie
Tribulus terrestis und andere
Euphorbiaceae, wie
Mercurialis annua Euphorbia app.
Umbelliferae, wie Daucus carota Aethusa cynapium Ammi majus
und andere
Commelinaeae
Commelina spp.
und andere
Labiatae, wie
Lamium spp. Galeopsis spp, und andere
Leguminosae, wie Medicago spp. Trifolium spp.
Vicia spp. Lathyrus spp.
Sesbania exaltata Cassia spp. und andere
Plantaginaceae, wie Plantago spp.
und andere
Polygonaceae, wie Polygonum spp. Rumex spp.
Fagopyrum spp. und andere
und andere
409884/1381
Amaranthaceae, wie Amaranthus spp.
CZ. 29
und andere
Boraginaceae, wie Amsinckia spp. Myostis spp.
Lithospermum spp.
Anchusa spp. und andere
Caryophyllaceae, wie Stellaria spp. Spergula spp.l
Saponaria spp. Scleranthus annuus Silene spp.
Cerastium spp. Agrostemma githago
und andere
Chenopodiaceae, wie Chenopodium spp. Kochia spp. Salsola Kali
Atriplex spp» Monolepsis nuttalliana und andere
Lythraceae, wie Cuphea spp.
und andere
Oxalidaceae, wie Oxalis spp.
Ranunculaceae, wie Ranunculus spp. Delphinium spp.
Adonis spp, und andere
Papaveraceae, wie Papaver spp. Fumaria officinalis und andere
Onagraceae, wie Jussiaea spp.
und andere
Rosaceae, wie
Alchemillia spp. Potentilla spp.
409884/1381 und andere
- 12 -
Pctamogetonaceae, wie Iotamogeton spp.
O.Z. 29
und andere und andere und andere
Najadaceae, wie Najas spp.
Marsileaceae, wie
Marsilea quadrifolia
Polypodiaceae, wie
Pteridium aguilinum
Im Gewächshaus und im Freiland wurden die Verbindungen N-3-Chlor-4-methoxyphenyl-N'-methyl-N'-methoxyharnstoff
N-5-Chlor-4-methylphenyl-4-cyclohex-l-enyl-N',N1-dimethylharnstoff
N-3-Trifluormethylphenyl-N-cyclohex-l-enyl-N',N1-dimethylharnstoff
N-3-Trifluormethylphenyl-N-Qclohex-l-enyl-N1-methylharnstoff
N-^^-Dichlorphenyl-N-cyclohex-l-enyl-N1,N1-dimethylharnstoff
N-^-Chlorphenyl-N-cyclohex-l-enyl-N',N1-dimethylharnstoff
N-Phenyl-N-cyclohex-1-enyl-N1,N'-dimethylharnstoff
N-^-Chlorphenyl-N-cyclohex-l-enyl-N'-methylharnstoff
N-Phenyl-N-cyclohex-1-enyl-N'-methylharnstoff
N-4-Chlorphenyl-N-cyclohex-1-enyl-N'-methylharnstoff
N-3-Chlor-4-methoxyphenyl-N-cyclohex-l-enyl-N' -methylharnstoff
N-j5-Chlor-4-methoxyphenyl-N-cyclohex-l-enyl-N' ,N' -dimethylharnstof
f N-3-Chlor-4-methylphenyl-N-cyclohex-l-enyl-N' ,N' -dlmethylharnstoff
N-3-Trifluormethylphenyl-N-cyclohex-1-enyl-N'-methyl-N'-methoxyharnstoff
ot -(2,4-Dichlorphenoxy)-propionsäure-dimethylaminsalζ
<aC-(2-Methyl-4-chlorphenoxy )-propionsäure-dimethylaminsalz
oL-(2-Methylphenoxy)-propionsäure-dimethylaminsalz
oC-(2,4-Dichlorphenoxy)-propionsäure-natriumsalz
ei -(2,4,5-Trichlorphenoxy)-propionsäure-kaliumsalz
OC-(4-Chlorphenoxy)-propionsäure-dimethylaminsalζ
ei. -(2-Methy 1 phenoxy )-propionsäure-isooc tylester
409884/1381 - Ό -
- Ό - ('.Z. 29 965
ου- (2-Methy1-4-chiorphenoxy)-propionsäure-diäthanolaminsaIz
Ot-(2,4-Dichlorphenoxy)-propionsäure-isooctylester
2,4,5-Trichlorphenoxyessigsäure-amylester
2,4,b-Trichlorphenoxyessigsäure-diäthylaminsalζ
2,4-Dichlorphenoxyessigsäure-dimethylaminsalz
2-Methyl-4-chlcrphenoxyessigsäure-dimethylaminsalz
2,4,5-Trichiorphenoxyessigsäure-kaliumsalz
4-Chlorphenoxyessigsäure-dimethylaminsalζ
o6-(2-Methyi-^-chiorphenoxy)-propionsäure-natriumsalz
2-Chlorphenoxyessigsäure-dimethylaminsalζ
2,4-Dichiorphenoxyessigsäure-natriumsalζ
f*-(2,4-Dichicrphenoxy)-buttersäure-dimethylaminsalζ
/*"-(2-Me thy 1-4-chl orphenoxy )-buttersäure-natriumsalz
^■-(2,4,5-Trichlorphenoxy) -buttersäure-dimethy laminsalz
>*-(4-Chlorphenoxy)-buttersäure
/"-(2,4-Di chi orphenoxy )-buttersäure-isooctylester
3^-(2,4-Dichlorphenoxy)-crotonsäure-dimethylaminsalz
3-Methyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid
3-Äthyl-2,l,^-benzothiadiazinon-(4)-2,2-dioxid
3-Propyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid
5-Butyl-2,li3-benzothiadiazinon-(4)-2,2-dioxid
3-Isobutyl)-2,li3-benzothiadiazinon-(4)-2,2-dioxid
3-Isopropyl)-2,l,5-benzothiadiazinon-(4)-2,2-dioxid
3-Isopropyl)-2Jl,3-benzothiadiazinon-(4)-2,2-dioxid-natriumsalz
3-Isopropyl)-2,l,5-benzothiadiazinon-(4)-2,2-dioxid-dimethyl
aminsalz
3-Iscpropyl-2,li3-benzothiadiazinon.-(4)-2,2-dioxid-diathanol-
aminsalz
5-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-Methylaminsalz
5-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-Trimethylamin-
salz
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2,-dioxid-Äthylaminsalz
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-Diäthylamirmlz
3-Isopropyl-2,l,5-benzothiadiazinon-(4)-2,2-dioxid-Äthanolaminaalz
^-Isopropyl^,l,5-benzothiadiazinon-(4)-2,2-dioxid-Anilinsalz
>Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-Pyridinsalz
3-Isopropyl-2,1,3-benzothiadiazinon-(4)-2,2-diox±d-Phenylen-
diaminsalz
^Isopropyl-2,1,3-benzothiadiazinon-(4)-2,2-dioxid-cyclohexyl-
aminsalz - 14 -
A09884/1381
.•00/C11 - 14 - O.Z. 2S 965
j5-Isopropyl-2,1,3-benzothiadi azinon-(4)-2,2-dioxid-dodecylhexamethyleniminsalz
^-Isopropyl-2,1,3-benzothiadiazinon-(4)-2,2-dioxid-hydrazinsalz
^-Isopropyl-2, l,j5-benzothiadiazinon-(4)-2,2-dioxid-magnesiurnsalz
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-calciumsalz
3-Isopropyl-2,l,^-benzothiadiazinon-(4)-2,2-dioxid-ammoniumsalz
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-kaliumsalz
3-Isopropyl-2,1,J-benzothiadiazinon-(4)-2,2-dioxid-lithiumsalz
j5-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-natriumsalz
-2,l,3-benzothiadiazinon-(4)-2J2-dioxid-dimethylaminsalz
-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-diäthanolaminsat
3-sek.-Butyl-2,1,3-benzothiadiazinon-(4)-2,2-dioxid-natriumsalz
^-sek.-Butyl-2,1,3-benzothiadiazinon- (4)-2,2-dioxid-dimethylcirninsalz
J3-sek.-Butyl-2, 1,3-benzothiadiazinon- (4)-2,2-dioxid-diathariolaminsalz
3-n-Butyl-2,l,5-benzothiadiazinon-(4)-2f2-dloxid-natriumsalz
3-n-Butyl-2, l,5-benzothiadiazinon-(4 )-2,2-dioxiddimethylarninsr:lz
3-n-Butyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-diathanolaminsalz
3-n-Propyl-2,1,.5-benzothiadiazinon- (4)-2,2'dioxid-natriumsalz
3-n-Propyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-dimethylaminsalz
3-n-Propyl-2,li5-benzothiadiazinon-(4)-2,2-dioxid-diäthanolaminsalz
3-Äthyl-2,1,3-benzothiadiazinon-(4)-2,2-dioxid-natriumsalz
3-Methyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-natriumsalz
3-Methyl-2, l,3-benzothiadiazinon-(4)-2,2,-dioxid-dimethylarnin8alz
3-Methyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-diäthanolaminsfilz
in Mischung untereinander an den in den Beispielen genannten Pflanzen geprüft. Die aufgeführten Mittel haben eine entsprechende
biologische Wirkung wie die in den Beispielen 1 bis 12 aufgeführten Verbindungen.
Im Freiland wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 23 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Emulsion behandelt:
409884/1381 . 15
T l-m-Chlor-p-methoxyphenyl-^-methyl-^-methoxyharnstoff
II oi-(2,4-Dichlorphenoxy)-propionsäure-dimethylaminsalz
III c6-( 2 -Me thy 1-4 -chi orphenoxy) -propionsäure -dimethylaminsr-.l.
IV et- (2-Methylphenoxy )-propionsäure-dimethylaminsalz
mit je 0,25, 0,75, 1,25, 1,5 kg/ha a.S.
I + II, I + III, I + IV mit je 0,25 + 1,25, 1,25 + 0,25,
0,75 + 0,75 kg/ha a.S.
Nach 12 bis 15 Tagen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an den Kulturpflanzen zeigten als die Einzelwirkstoffe .
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381
Wirkstoff kg/ha a.S.
| 0,75 | r | 1,25 | 1,5 | 0,25 | II | 1,25 | 1,5 | 0,25 | III | 1,25 | 1,5 | 0,25 | IV | 1,25 | |
| 0,25 | 0 | 0 | 0 | 0 | 0,75 | 0 | 0 | 0 | 0,75 | 0 | 0 | 0 | 0,75 | 0 | |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| 0 | 50 | 75 | 87 | 0 | 0 | 0 | 3 | 0 | 0 | 5 | 10 | 0 | 0 | 0 | |
| 24 | 38 | 52 | 60 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| 15 | 14 | 18 | 20 | 10 | 0 | 70 | 75 | 15 | 0 | 60 | 70 | 5 | 0 | 20 | |
| 5 | 30 | 48 | 65 | 15 | 30 | 65 | 70 | 10 | 40 | 30 | 50 | 10 | 15 | 40 | |
| 20 | 35 | 20 | 25 | ||||||||||||
Nutzpflanzen: Triticum aestivum Hordeum vulgäre
Seeale cereale
unerwünschte Pflanzen: Alopecurus myosuroides Apera spica venti
Q0 Gal ium aparine Lamium amplexicaule
0 = ohne Schädigung 100 = totale Schädigung
0 0 0
26 46
CO CO
cn
| Wirkstoff | I | 0,25 | + II | 0,75 | 0,25 | I + III | 0,75 | I | 0,25 | + IV | 0,75 |
| kg/ha a.S. | 1,25 | 1,25 | 0,75 | 1,25 | 1,25 | 0,75 | .1,25 | 1,25 | 0,75 | ||
| 0,25 | 0,25 | 0,25 | |||||||||
| Nutzpflanzen: | O | 0 | 0 | 0 | 0 | 0 | |||||
| Triticum aestivum | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Hordeum vulgäre | O | 0 | 0 | 0 | o· | 0 | 0 | 0 | 0 | ||
| Seeale cereale | 0 | 0 | 0 | ||||||||
| unerwünschte Pflanzen: | 70 | 91 | 75 | 9o | 67 | 88 | |||||
| Alopecurus myosuroides | 60 | 100 | 75 | 58 | 100 | 85 | 56 | 98 | 72 | ||
| Apera spica venti | 100 | 90 | 80 | 100 | 87 | 92 | 64 | 84 | 66 | ||
| Galium aperine | 100 | 73 | 100 | 90 | 77 | 87 | 98 | 60 | 87 | ||
| Latnium amplexicaule | 97 | 100 | 94 | ||||||||
0 = ohne Schädigung 100 = totale Schädigung
Tm Freiland wurden verschied=ne Pflanzen bei einer Wuchshöhe
von 5 bis 25 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Paste behandelt:
I l-m-Chlor-p-methoxyphenyl-3-methyl-^-nethoxyharnstoff
II CL- (2,4-Dichlorphenoxy)-propionsäure-dimethylaminsal ζ III o&-(2-Methyl~4-chlorphenoxy)-propionsäure-dinethylaminsalz
IV o.-(2-Methylphenoxy)-propionsäure-dimethylaminsalz
mit je 1, 1,6, 2, 2,4, } und 4 kg/ha a.S.
I + II 1,6 + 2,4, 2,4 + 1,6, 2+2, 1 + 2, 2 + 1, 1+1 kg/ha a.S. I + m 1,6 + 2,4, 2,4 + 1,6, 2+2, 1 + 2, 2 + 1, 1+1 kg/ha a.S.
I + IV 1,6 % 2,4, 2,4 + 1,6, 2+2, 2+1, 1+2, 1+1 kg/ha a.S.
Nach 12 bis I5 Tagen wurde festgestellt, daß die Mischungen
eine bessere Verträglichkeit an den Kulturpflanzen zeigten als
die Einzelwirkstoffe bei entsprechenden Aufwandmengen.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381 - κ -
| Wirkstoff | 1 | 1, | 6 2 | I | 2, | 4 3 | it | 1 | 1,6 | II | 2, | 4 3 | 4 | 1 | 1,6 | III | 2, | 4 3 | 4 |
| kg/ha a.S. | 2 | 2 | |||||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 5 | 10 | 12 | 0 | 0 | 7 | 15 | 25 | 0 | 0 | 0 | 5 | 20 | |||
| Triticum aestivum | 0 | 0 | 0 | 5 | 10 | 14 | 0 | 0 | Ul | 12 | 15 | 22 | 0 | 0 | 0 | 0 | 15 | 20 | |
| Hordeum vulgäre | 0 | 0 | 0 | 7 | 10 | 16 | 0 | 0 | 10 | 8 | 25 | 30 | 0 | 0 | 0 | 0 | 10 | 17 | |
| Seeale cereale | 5 | 0 | |||||||||||||||||
| unerwünschte Pflanzen: | 70 | 90 | 100 | 100 | 100 | 100 | 0 | 5 | 8 | 10 | 14 | 0 | 10 | 12 | 15 | 20 | |||
| o Alopecurus myosuroides | 45 | 60 | 65 | 80 | 100 | 100 | 0 | 0 | 6 | 5 | 10 | 12 | 0 | 0 | 12 | 0 | 5 | 7 | |
| 40 Apera spica venti SO |
15 | 22 | 25 | 29 | 35' | 50 | 65 | 78 | 0 | 90 | 100 | 100 | 50 | 77 | 0 | 85 | 100 | 100 | |
| oo Galium aparine | 40 | 70 | 82 | 90 | 100 | 100 | 6o | 76 | 80 | 87 | 90 | DO | 25 | 50 | 85 | 64 | 70 | 95 | |
| ■»>. Lamium amplexicaule | 85 | 6o | |||||||||||||||||
= ohne Schädigung
= totale Schädigung
= totale Schädigung
CD CO OO
| Wirkstoff | 1 | 1,6 | 2 | IV | 2,4 | 3 | 4 |
| kg/ha a.S. | |||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 5 | 7 | |
| Triticum aestivum | 0 | 0 | 0 | 0 | 7 | 10 | |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | VJi | 8 | |
| Seeale cereale | |||||||
| unerwünschte Pflanzen: | 0 | 0 | 0 | 0 | 2 | 5 | |
| Alpecurus rayosuroides | 0 | 0 | 0 | 0 | VJl | 7 | |
| Apera spica venti | 18 | 25 | 32 | 35 | 42 | 50 | |
| Galium aparine | 35 | 47 | 56 | 68 | 80 | 90 | |
| Lamium amplexicaule | |||||||
0 = ohne Schädigung 100 = totale Schädigung ro ω
ω
Γύ O
co
co
OO
J>
00
| Wirkstoff | 1,6 | I + | II | 1 | 2 | 1 | 1,6 | I + | III | 1 | 2 | 1 | 1,6 | I + | IV | 1 | 2 | 1 |
| kg/ha a.S. | 2,4 | 2 | 2,4 | 2 | 2,4 | 2 | ||||||||||||
| Nutzoflanzen: | 7 | 5 | 0 | 0 | 0 | 0 | 0 | O | O | O | O | O | ||||||
| Tüticum aestivum | 12 | 5 | 5 | 10 | 0 | 0 | 0 | 5 | 0 | 0 | 0 | O | O | 5 | O | O | O | C |
| Hordeum vulgäre | 8 | 5 | 10 | 5 | 0 | 0 | 0 | 5 | 0 | 0 | 0 | O | O | 5 | O | O | O | O |
| Seeale cereale | 7 | 5 | 7 | 0 | 7 | O | ||||||||||||
| unerwünschte Pflanzen: | 100 | DO | DO | DO | 100 | DO | DO | DO | DO | DO | DO | DO | ||||||
| Alqpecurus myosuroides | 100 | DO | too | & | $ | 82 | 100 | 100 | DO | 90 | DO | 86 | DO | 100 | DO | 83 | DO | 84 |
| Apera spica venti | 100 | DO | DO | DO | DO | DO | 100 | 100 | DO | DO | DO | DO | 94 | 100 | DO | 84 | 83 | 80 |
| Galium aparine | 100 | DO | DO | DO | DO | DO | 100 | 100 | DO | DO | DO | DO | DO | 95 | 94 | DO | DO | DO |
| Lamium amplexicaule | DO | DO | 100 | DO | 100 | DO | ||||||||||||
O = ohne Schädigung
= totale Schädigung
= totale Schädigung
- 22 - U.Z. ?9 965
Beisnlel :>
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe
von 2 bis 21 cm mit folgenden Einzelwirkstoffen und
uer-sri Mischungen als Lösung behandelt:
I l-m-Chlor-p-methoxyphenyl-^-methyl-^-methoxyharnstoff
XII 2-Methyl-4-chlorphenoxyessigsäure-dimethylaminsalz
XI 2,4-Dichlorphenoxyessigsäure-dimethylaminsalz
XVIII -(2,4-Dichlorphenoxy)-butteraäure-dimethylaminsalz
mit je 0,75, 1, 1,25/ 2,0 kg/ha a.S.
I + XI, I + XII, I + XVIII mit je 0,75 + 1,25, 1,25 + 0,75,
1 + 1 kg'ha a.S.
Nach 12 bis 14 -Tagen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit
an den Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381
O CD OO
co OO
| Wirkstoff | 0,75 | I | 1 | 1,25 | 2 | 0,75 | XI | 1,25 | 2 | 0,75 | XII | 1,25 | 2 | 0,75 | XVIII | 1,25 | 2 |
| kg/ha a.S. | 1 | 1 | 1 | ||||||||||||||
| Nutzpflanzen: | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 ' | 0 | 0 | ||||
| Triticum aestivum | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Hordeum vulgäre | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Secale cereale | 0 | 0 | 0 | ||||||||||||||
| unerwünschte Pflanzen: | 50 | 70 | 80 | 100 | 0 | 0 | 5 | 0 | 0 | 0 | 0 | 0 | 5 | ||||
| Alopecurus myosuroides | 38 | ^9 | 52 | 65 | 0 | 0 | 0 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 5 | 10 | |
| Apera spica venti | 50 · | 70 | 85 | 100 | 30 | 0 - | 50 | 70 | 15 | 0 | 30 | 40 | 9 | 0 | 18 | 30 | |
| Matricaria maritima | 54 | 72 | 30 | 98 | 8 | 40 | 15 | 28 | 18 | 25 | 28 | 38 | 6 | 15 | 10 | 20 | |
| Stellaria media | 10 | 20 | 8 | ||||||||||||||
0 = ohne Schädigung
100 = totale Schädigung
100 = totale Schädigung
to
co 00 O3
00
| Wirkstoff | T | 0,75 | + XI | 1 | I | + XII | 1 | I + | XVIII | 1 |
| kg/ha a. S. | 1,25 | 1,25 | 1 | 0,75 | 1,25 | 1 | 0,75 | 1,25 | 1 | |
| 0,75 | 1,25 | 0.75 | 1,25 | 0,75 | ||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | ||||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Seeale cereale | 0 | 0 | 0 | 0 | 0 | |||||
| unerwünschte Pflanzen: | 96 | 100 | 100 | 100 | ||||||
| Alopecurus myosuroidQS | 85 | 100 | 96 | 97 | 100 | 95 | 95 | 100 | 97 | |
| Apera spica venti | 100 | 98 | 100 | 86 | 98 | 100 | 90 | 96 | 100 | |
| Matricaria maritima | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |
| Stellaria nedia | 100 | 100 | 100 | 100 | 100 | |||||
co
= ohne Schädigung
= totale Schädigung
= totale Schädigung
O,Z. 29
Im Freiland wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 2;5 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Dispersion behandelt:
I 1-(3-Chlor-4-methoxyphenyl)-^-methyl-^-meth.oxyharnstof f
III ot—(2-Methyl-4-chlorphenoxy)-propionsäure-dimethylaminsalz
V ct-(2,4-Dichlorphenoxy)-propionsäure-natriumsalz
VI et-(2,4,5-Trichlorphenoxy)-propionsäure-kaliumsalz
VIII c(-(2-Methylphenoxy)-propionsäure-isooctylester
XVIII ^(2,4-Dichlorphenoxy)-buttersäure-dimethylaminsalz
XXV ^-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid
XXVI 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxidnatriumsalz
XXVII 3-Isopropyl-l,2,^-benzothiadiazinon-(4)-2,2-dioxid-
dimethylaminsalz
XXVIII 3-Isopropyl-l,2,^-benzothiadiazinon-(4)-2,2-dioxid-
diäthanolaminsalz
mit je 0,25, 0,5, 1, 1,5, 2 kg/ha a.S.
I + III + XXV, I + III + XXVI, I + III + XVII, I + III + XXVIII, I + V + XXV, I + V + XXVI, I + V + XXVII, I + V + XXVIII,
I + VI + XXVIII, I + VIII + XXVIII, I + XVIII + XXVIII mit je 0,25 + 0,25 +1, 1 + 0,25 + 0,25, 0,25 + 1 + 0,25,
0,5 + 0,5 + 0,5, 1,5 + 0,25 + 0,25, 0,25 + 1,5 + 0,25, 0,25 + 0,25 + 1,5, 0,25 + 0,25 + 0,5, 0,25 + 0,5 + 0,25,
0,5 + 0,25 + 0,25 kg/ha a.S.
Nach 14 bis l6 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei gleicher Verträglichkeit
an den Kulturpflanzen zeigen als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
ΑΠ9884/1381
- 26 -
| Wirkstoff | 0,25 | 0,5 | I | 1 | 1,5 | 2 | 0,25 | 0,5 | III | 1,5 | 2 | 0,25 | V | 0,5 | 1 | 1,5 | 2 | 0,25 | VI | 0,5 | 1 | 1,5 | 2 | ι | |
| kg/ha a.S. | 1 | ro | |||||||||||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 5 | 10 | 16 | " | |||||
| Triticum aestivura | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 6 | 9 | 15 | |||||
| Hordeuin vulgäre . | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | Ό | 0 | 0 | 0 | 0 | 5 | 0 | 0 | 7 | 12 | 18 | K) | ||||
| Secale cereale | 0 | ||||||||||||||||||||||||
| unerwünschte Pflanzen: | 24 | 40 | 70 | 87 | 100 | 0 | 0 | 10 | 12 | 0 | 0 | 0 | 2 | 5 | 0 | 0 | 5 | 10 | 14 | ||||||
| <* O |
Alopecurus myosuroides | 0 | |||||||||||||||||||||||
| co co |
15 | 29 | 45 | 60 | 65 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 6 | 11 | ί6 | ||||||
| co ■{>· |
Apera spica venti | 5 | 11 | 15 | 20 | 25 | 15 | 30 | 0 | 70 | 85 | 15 | 35 | 50 | 75 | 64 | 17 | 40 | 57 | 85 | 95 | ||||
| 1^ | Galium aparine | 20 | 27 | 40 | 66 | 82 | 10 | 15 | 50 | 50 | 6o | 10 | 15 | 45 | 75 | 80 | 15 | 80 | 94 | 98 | |||||
| co | Lamium amplexicaule | 25 | |||||||||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
CD
co OO 00
CO 00
| Wirkstoff | - | unerwünschte Pflanzen: | 0,25 | VIII | 1 | 1,5 | 2 | 0,25 | XVIII | 1 | 1,5 | 2 | 0,25 | XXV | 1 | 1,5 | 2 | 0,25 | XXVII | 1 | 1,5 | 2 |
| kg/ha a.S. | Alopecurus myosuroides | 0,5 | 0,5 | 0,5 | 0,5 | |||||||||||||||||
| Nutzpflanzen: | Apera spica venti | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||
| Triticum aestivum | Galium aparine | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | o' | 0 | 0 | 0 | 0 | 0 | |
| Hordeum vulgäre | Lamium amplexicaule | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Seeale cereale | 0 | 0 | 0 | 0 | I ro |
|||||||||||||||||
| I | ||||||||||||||||||||||
| 0 | 0 | 0 | 5 | 0 | 0 | 5 | 5 | 3 | 10 | 15 | 20 | 0 | 12 | 16 | 21 r | |||||||
| 0 | 0 | 0 | 0 | 5 | 0 | 0 | 0 | 8 | 10 | 0 | 5 | 8 | 10 | 20 | 0 | 10 | 5 | 7 | 10 < | |||
| 5 | 0 | 18 | 25 | 35 | 9 | 0 | 18 | 25 | 30 | 15 | 5 | 6o | 75. | 80 | 20 | 0 | 50 | 60 | 15 ! | |||
| 10 | 10 | 35 | 46 | 60 | 10 | 12 | 25 | 3440 | 5 | 30 | 25 | 40 | 64 | 5 | 30 | 40 | 45 | 50 < H |
||||
| 18 | 15 | 10 | 10 |
0 = ohne Schädigung 100 = totale Schädigung
IN/
(O
00
co
CO OO
| Wirkstoff | 0,25 | 0, | XXVIII | 1, | 5 2 | 0,25 | o, | XXVI | 1, | 5 2 | I+XVIII+XXVIII | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+III+XXVII | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
| kg/ha a.S. | 5 1 | 5 ι | 1,5 0,25 0,25 |
1,5 0,25 0,25 |
||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Seeale cereale | 0 | 0 | 0 | 0 | ||||||||||||
| unerwünschte Pflanzen: | 0 | 10 | 15 | 19 | 0 | 0 | 15 | 18 | 84 | 90 | 80 | 90 | ||||
| Aipecurus myosuroides | 0 | 0 | 12 | 7 | 10 | 0 | 0 | 12 | 5 | 10 | 100 | 70 | 70 | 100 | 60 | 69 |
| Apera spica venti | 25 | 35 | 5 | 80 | 80 | 15 | 30 | 0 | 75 | 80 | 100 | 96 | 100 | 97 | 100 | 100 |
| Galium aparine | 6 | 10 | 65 | 50 | 60 | 5 | 10 | 60 | 40 | 54 | 97 | 95 | 100 | 88 | 100 | 100 |
| Lamium amplexicaule 0 = ohne Schädicnn« |
35 | 25 | 100 | 100 | ||||||||||||
ro
NJ
100 = totale Schädigung
| Wirkstoff I+V+XXVI | te te te ro ro Ui UiUi |
0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+VI+XXVIII | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+III+XXVI | O 1-1O te te ro ro Ul Ul |
H-OO te te ro ro UlUl |
1 0,25 0,25 |
I+III+XXVIII | O O O te te te ro Ui ro Ul Ul |
O OO te te te ro ro ui UiUl |
| kg/ha. a.S. 1 0 0 |
1,5 0,25 0,25 |
0,5 0,5 0,5 |
O OO te te te Ui ro ro UlUI |
||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | σ | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Seeale cereale | 0 | 0 | 0 | ||||||||||
| unerwünschte Pflanzen: | 300 | 80 | 90 | 85 | 90 | 72 | 85 | 100 | 73 | 80 | |||
| Alopecurus myosuroides | 97 | 63 | 66 | 100 | 70 | 68 | 87 | 58 | 58 | 80 | 78 | 58 | 70 |
| Apera spica venti | 90 | 100 | 100 | 98 | 100 | 100 | 66 | 100 | 100 | 87 | 54 | 97 | 90 |
| Galium aparine | 100 | 100 | 100 | 98 | 100 | 100 | 100 | 88 | 95 | 90 | 96 | 80 | 80 |
| Lamium amplexicaule | 100 | 90 | 80 |
0 = ohne Schädigung 100 = Totale Schädigung
ro
VD
Ni CO CJ
cn
| Wirfcfcoff I+V+XXVI | ui ro ro UlUl O OO te te te |
25 0, 5 0, 25 0, |
ro roui VJlUl |
I+VI+XXVIII | O OO te te te ro ui ro Ul UI O OC te te te |
ro ro ui UlUl |
I+VIII+XXVIII | OO O mm CMCM m |
te te te ro ui ro UT Ul O OO |
te te te ro ro ui UiUl |
I+XVIII+XXVIII | ui ro ro UlUl O OO te te te |
ro ui ro Ul Ul ο ο ο te te te |
5 25 25 |
I+III±XXVII | F-" OO te te ro ro UlUl |
0,25 1 1 0 0,25 0 |
,25 ,25 |
I OJ O |
| kg/ha a.S. 0, 0, 0, |
ο ο ο te te te ui ro ro UlUl |
O OO te te te |
ο ο ο
te te te |
ο ο ο te te te UlUiUi |
I | ||||||||||||||
| Nutzpflanzen: | O | o ■ | 0 | 0 | 0 | C | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||
| Triticum aestivum | O | 0 | 0 | 0 | 0 | 0 | 0 | ' 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
| Hordeum vulgäre | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ο . | 0 | 0 | 0 | 0 | 0 | 0 | ro Ca) |
||
| Secale cereale | 0 | 0 | OJ | ||||||||||||||||
| unerwünschte Pflanzen: | 70 | 72 | 84 | 73 | 80 | 78 | 73 | 90 | 77 | 70 | 90 | 85 | 75 | 98 | |||||
| Alopecurus myosuroides | 60 | 55 | 70 | 80 | 60 | 68 | 60 | 62 | 73 | 58 | 58 | 74 | 92 | 68 | 58 | 83 | |||
| Apera spica venti | 90 | 90 | 85 | 57 | 100 | 95 | 84 | 80 | 84 | 83 | 82 | 87 | 67 | 100 | 100 | 89 | |||
| Galium aparine | 84 | 80 | 80 | 100 | 100 | 97 | 78 | 85 | 87 | 78 | 79 | 83 | 100 | 100 | 83 | 92 | |||
| Lamium amplexicaule | 95 | 90 | |||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
CD
| Wirkstoff | I+V+XXVI | • | 93 | 0,25 0,25 1 |
0 | 0,25 1 0,25 |
1. OS 0,25 |
I+VI+XXVIII | 0,25 0,25 1 |
0,25 1 0,25 |
1 0,25 025 |
I+VIII+XXVIII | *-> O O ro ro UlUl |
OHO to ro Ul Ul |
1 0,25 025 |
' I+XVIII+XXVIII |
mm
CVJCVJ O O -ι |
0,25 1 0 0,25 |
1 ,25 025 |
|
| kg/ha a.S. | 0,5 0,5 0,5 |
70 | • | 0 | ooo UlUlUl |
0,5 0,5 0,5 |
I OOO I UiUiUi |
|||||||||||||
| Nutzpflanzen: | 100 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||
| Triticum aestivum | 0 | 94 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||
| Hordeum vulgäre | 0 | 85 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||
| Secale cereale | 0 | 59 | 0 | 0 | 0 | |||||||||||||||
| O | unerwünschte Pflanzen· | 100 | 70 | 97 | 80 | 85 | 100 | 84 | 70 | 97 | 86 | 78 | 100 | |||||||
| co 00 |
Alopecurus myosuroides | 96 | 58 | 80 | 88 | 62 | 6o | 85 | 92 | 6o | 58 | 90 | 94 | 65 | 60 | 85 | ||||
| 00 | Apera spica venti | 100 | 87 | 68 | 100 | 100 | 98 | 67 | 100 | 85 | 86 | 70 | 100 | 87 | 90 | |||||
| Galium aparine | 100 | 93 | 100 | 100 | 100 | 100 | 96 | 98 | 100 | 94 | 97 | 98 | 90 | 94 | ||||||
| 1381 | Lamlum amplexicaule | 100 | 96 | 90 |
0= ohne Schädigung 100 = totale Schädigung
OJ
| Wirkstoff | I+V+XXVIII | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
I+V+XXVII | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
I+V+XXV | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
I+III+XXV | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
I+III+XXVI | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
| kg/ha a.S. | 0,25 0,25 0,5 |
0,25 0,25 0,5 |
0,25 0,25 0,5 |
0,25 0,25 0,5 |
0,25 0,25 0,5 |
||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Secale cereale | 0 | 0 | 0 | 0 | 0 | ||||||||||
| unerwünschte Pflanzen: | 70 | 85 | 67 | 85 | 70 | 80 | 70 | 90 | 71 | 85 | |||||
| Alopecurus myosuroides | 75 | 55 | 70 | 72 | 53 | 70 | 75 | 59 | 68 | 72 | 60 | 70 | 72 | 62 | 68 |
| Apera spica venti | 60 | 98 | 90 | 58 | 97 | 85 | 63 | 93 | 80 | 63 | 92 | 86 | 60 | 93 | 87 |
| Galium aparine | 94 | 8o | 83 | 87 | 78 | 80 | 90 | 80 | 85 | 88 | 77 | 85 | 88 | 78 | 85 |
| Lamium amplexicaule | 80 | 77 | 83 | 85 | 80 |
0 = ohne Schädigung 100 = totale Schädigung
ro
Ni CO
CO
(Ji
co
00 00
CU 00
| Wirkstoff | I+III+XXVII | ooo to to to ro ui ro UI Ul |
0,5 0,25 0,25 |
I+VIII+XXVIII | 0,25 1,5 0,25 |
to to to
ui ro ro UIUl |
I+V+XXVIII | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+V+XXVtl | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+V+XXV |
Ot-O
to to to ro ui ro Ui Ui O |
0,25 ,25 1,5 |
| kg/ha a.S. | ooo to to to Ui ro ro UlUl |
OOt-
to to to ro ro ui UlUI |
1,5 0,25 0,25 |
O O I-1
to to to ro ro ui UlUI |
1,5 0,25 0,25 |
||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ■ ο | 0 | 0 | |||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | Ό | 0 | 0 |
| Seeale sereale | 0 | 0 | 0 | 0 | 0 | ||||||||||
| unerwünschte Pflanzen: | 72 | 8o | 78 | 92 | 70 | 86 | 70 | 88 | 74 | 85 | |||||
| Alopecurus myosuroides | 75 | 65 | 70 | 100 | 63 | 70 | 100 | 59 | 65 | 100 | 60 | 65 | 100 | 62 | 68 |
| Apera spica venti | 59 | 93 | 90 | 96 | 92 | 100 | 96 | 100 | 100 | 95 | 100 . | 100 | 92 | 100 | 100 |
| Galium aparlne | 90 | 80 | 82 | 90 | 100 | 100 | 97 | 100 | 100 | /96 | 100 | 100 | 88 | 100 | ioo £J |
| Lamiurn amplexlcaule | 78 | 100 | 100 | 100 | 100 | co | |||||||||
VjJ I
100 = totale Schädigung
co
co
co
co
co
| Wirkstoff | I+III+XXVIII | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+III+XXV | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+III+XXVI | 0,25 1,5 0,25 |
0,25 0,25 1,5 |
I+V+XXVIII | 0,25 1 0,25 |
ι-· O O to to ro ro UlUl |
1 0,25 0,25 |
| kg/ha a.S. | 1,5 0,25 0,25 |
1,5 0,25 3,25 |
1,5 0,25 0,25 |
ο ο ο UlUlUl |
|||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Seeale cereale | 0 | 0 | 0 | 0 | |||||||||
| unerwünschte Pflanzen: | 75 | 87 | 80 | 86 | 75 | 89 | 75 | 78 | 97 | ||||
| Alopecurus myosuroldes | 100 | 58 | 62 | 100 | 60 | 64 | 100 | 59 | 63 | 92 | 60 | 64 | 80 |
| Apera spica venti | 90 | 100 | 100 | 88 | 100 | 100 | 97 | 100 | 100 | 69 | 100 | 100 | 92 |
| Galium aparine | 98 | 100 | 100 | 96 | 100 | 100 | 90 | 100 | 100 | 100 | 100 | 98 | 95 |
| Lamium amplexicaule | 100 | 100 | 100 | 90 |
= ohne Schädigung
= totale Schädigung
= totale Schädigung
| Wirkstoff | I+V+XXVII | 0,25 1 0,25 |
0,25 0,25 1 |
1 0,25 0,25 |
I+V+XXV | 0,25 1 0,25 |
i-O O
ro ro UlUl |
1 0,25 0,25 |
I+III+XXVIII | 0,25 1 0,25 |
0 0 1 |
,25 ,25 |
1 0, 0, |
mm
CVlCVJ |
I+III+XXV | 0,25 1 0,25 |
0 0 1 |
,25 ,25 |
1 0 0 |
,25 ,25 |
I | NJ |
| kg/ha a.S. |
OO O
UIUlUl |
• | 0,5 0,5 0,5 |
O O O
wow UiUiUi |
0,5 0,5 0,5 |
Ul | cn | |||||||||||||||
| Nutzpflanzen: | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||
| Triticum aestivum | O | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Hordeum vulgäre | O | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Secale cereaLe | O | 0 | 0 | 0 | ||||||||||||||||||
| unerwünschte Pflanzen: | 68 | 85 | 100 | 70 | 78 | 100 | 70 | 85 | 96 | 75 | 85 | 100 | ||||||||||
| Alopecurus myosuroides | 90 | 61 . | 64 | 83 | 84 | 60 | 65 | 82 | 9o | 58 | 64 | 80 | 90 | 61 | 65 | 85 | ||||||
| Apera spica venti | 67 | 100 | 100 | 88 | 72 | 100 | 100 | 85 | 68 | 100 | 100 | 90 | 72 | 100 | 100 | 87 | ||||||
| G al ium aparine | 100 | 100 | 100 | 93 | 100 | 100 | 92 | 97 | 100 | 90 | 95 | 88 | 100 | 89 | 92 | 92 | ||||||
| Lamium amplexicaule | 90 | 90 | 90 | 87 | ||||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
- 56 - O-Z. 29 965
Im Freiland wurden verschiedene Pflanzen bei einer Wuchshöhe von 3 bis 26 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Dispersion behandelt:
I NO-Chlor-^-methoxyphenyl-N' -methyl-N1 -inethoxyharnstof f
III -(2-Methyl-4-chlorphenoxy)-propionsäure-dimethylaminsalz
V -(2,4-Dichlorphenoxy)-propionsäure-natriumaalz
VI -(2,4,5-Trichlorphenoxy)-propionsäure-kaliumsalz
VHE -(2-Methylphenoxy)-propionsäure-isooctylester XVIII -(2,5-Dichlorphenoxy)-buttersäure-dimethylaminsalz
XXV ^-Isopropyl^,l,3-benzothiadiazinon-(4)-2,2-dioxid
XXVI 5-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-
natriumsalz
XXVII 5-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxiddimethylarainsalz
XXVII 5-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxiddimethylarainsalz
XXVIII 3-Isopropyl-2,l,5-benzothiadiazinon-(4)-2i2-dioxiddläthanolatninsalz
mit je 1, 2, 3, 4 kg/ha a.S.
mit je 1, 2, 3, 4 kg/ha a.S.
+ III + XXVII, I + V + XXVI, I + VI + XXVIII, + VIII + XXVIII, I + XVIII + XXVIII
mit je 1+1+1, 2+1+1, 1+2+1, 1+1+2 kg/ha a.S.
Nach 14 bis 16 Tagen wurde festgestellt, daß die Mischungen eine bessere Verträglichkeit an den Kulturpflanzen als die
Einzelwirkstoffe bei entsprechenden Aufwandmengen zeigten.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381
| Wirkstoff | 1 | 45 | 2 | I | 3 | 4 | 1 | III | '3 | 4 | 1 | V | 2 | 3 | 4 | 1 | VI | 2 | 3 | 4 | 1 | VIII | 3 | 4 | I | |
| kg/ha a.S. | 0 | 15 | 0 | 10 | 12 | 0 | 2 | 5 | 20 | 0 | 0 | 10 | t 13 |
5 | 16 | 20 | 30 | 0 | 2 | 0 | 10 | -J | ||||
| Nutzpflanzen: | 0 | 40 | 0 | 10 | 12 | 0 | 0 | 5 | 20 | 0 | 0 | 10 | 13 | 5 | 16 | 20 | 30 | 0 | 0 | 0 | 10 | I | ||||
| Triticum aestivum | 0 | 100 = totale Schädigung | 0 | 10 | 14 | 0 | 0 | 15 | 2 o. | 0 | 10 | 10 | 15 | 6 | 15 | 30 | 37 | 0 | 0 | 0 | 10 | 233/ | ||||
| Hordeum vulgäre | 0 | 0 | Io | 16 | 0 | 0 | 10 | 17 | 0 | 5 | 10 | 15 | 7 | 18 | 24 | 32 | 0 | 0 | 0 | 12 | CD | |||||
| Secale cereale | 0 | 0 | ||||||||||||||||||||||||
| unerwünschte Pflanzen | Alopecurus myosuroides70 | too | DO | DO | 0 | 15 | 20 | 0 | 5 | 10 | 14 | 5 | 14 | 20 | 30 | 0 | 7 | 10 | ||||||||
| O co |
Apera spica venti | 65 | DO | DO | 0 | 12 | 5 | 7 | 0 | 0 | 10 | 15 | 6 | 16 | 23 | 34 | 0 | 5 | 10 | 12 | ||||||
| 00 00 |
Galium aparine | 25 | 35 | 50 | 50 | 0 | 100 | 100 | 50 | 84 | 100 | 100 | 57 | 95 | 100 | 100 | 18 | 5 | 48 | 60 | ||||||
| Lamium amplexicaule ο = ohne Schädigung |
82 | 100 | 100 | 25 | 85 | •70 | 95 | 45 | 8o | 85 | 100 | 80 | 98 | 100 | 100 | 35 | 35 | 80 | 100 | |||||||
| 1381 | 60 | 60 | ||||||||||||||||||||||||
| Wirkstoff | 1 | XVIII | 2 | 3 | 4 | 1 | XXV | 2 | 3 | 4 | 1 | XXVII | 3 | I | 4 | 1 | XXVIII | 2 | 3 | 4 | 1 | XXVI | 3 | 4 | I | |
| kg/ha a.S. | 2" | CVj | VjJ OO |
|||||||||||||||||||||||
| Nutzpflanzen: | 0 | 0 | 5 | 8 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||
| Triticum aestivum | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | Ό | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Hordeum vulgäre | 0 | 5 | 7 | 14 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ro | |||||
| Seeale cereale | 0 | 0 | CJ co |
|||||||||||||||||||||||
| O | ||||||||||||||||||||||||||
| to OO |
unerwünschte Pflanzen: | 0 | 5 | 7 | 10 | 10 | 20 | 30 | 34 | 12 | 30 | 34 | 12 | 19 | 25 | 32 | 12 | 23 | 30 | |||||||
| 00 | Alopecurus myosuroides | 0 | 10 | 14 | 18 | 8 | 20 | 30 | 40 | Ul | 21 | 17 | 25 | 5 | 7 | 12 | 18 | 0 | 18 | 15 | 21 | |||||
| Apera spica venti | 18 | 30 | 50 | 65 | 60 | 80 | 95 | 100 | 50 | 10 | 100 | 100 | 65 | 8o | 100 | 100 | 60 | 10 | 100 | 100 | ||||||
| Galium aparine | 25 | 40 | 75 | 100 | 25 | 64 | 70 | 100 | 40 | 75 | 60 | 78 | 35 | 50 | 80 | 87 | 25 | 80 | 75 | 86 | ||||||
| Lamium amplexicaule | 50 | 54 | ||||||||||||||||||||||||
0 * ohne Schädigung 100 - totale Schädigung
σ>
oo (XJ
CO OD
| Wirkstoff | 1 1 1 |
unerwünschte Pflanzen: | 95 | ΐ+τΐΐ+χχνίΐ | 1 2 1 |
1 1 2 |
1 1 1 |
I+V+XXVI | 1 2 1 |
1 1 2 |
1 1 1 |
I+VI+XXVIII | 1 2 1 |
1 1 2 |
1 1 1 |
I+VIII+XXVIII | 1 2 1 |
1 1 2 |
1 1 1 |
I+XVIII+XXVIII | 1 2 1 |
1 1 2 |
I |
| kg/ha a.S. | Alopecurus myosuroidesDO | 100 | 2 1 1 |
2 1 1 |
2 1 1 |
2 1 1 |
2 1 1 |
VD 100 ι |
|||||||||||||||
| Nutzpflanzen: | 0 | Apera spica venti | 100 | 0 | 0 | 0 | 0 | 0 | 5 | 16 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 97 | |||||
| Tiiticum aestivum | 0 | Galium aparine | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 6 | 5 | 15 | 6 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | loo ι | |
| Hordeum vulgäre | 0 | Lamium amplexicaule | 0 | 0 | 0 | 0 | 0 | 5 | 0 | 7 | 6 | 18 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 5 | O | 100 < 4 |
|
| Seeale cereale | 0 | 0 | 7 | 0 | 0 | ||||||||||||||||||
| 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |||||||||||
| 100 | 97 | 98 | 97 | 100 | 98 | 98 | 97 | 100 | 98 | 97 | 100 | 100 | 97 | 96 | 95 | 100 | 96 | ||||||
| 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 98 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||||
| 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||||
| 100 | 100 | 100 | 100 | 100 |
0 = ohne Schädigung 100 = totale Schädigung
CO
- 40 - O.Z. 29 965
Im Heiland wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 20 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Staub behandelt:
I l-m-Chlor-p-methoxyphenyl-3-methyl-^-methoxyharnstoff
XII 2-Methyl-4-chlorphenoxyessigsäure-dimethylaminsalz
XIII 2,4,5-Trichlorphenoxyessigsäure-kaliumsalz
XVI 2,4-Dichlorphenoxyessigsäure-natriumsalz
XXVI 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxidnatriumsalz
XXVII ^-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxiddimethylaminsalz
mit je 0,25, 0,5, 1 und 2 kg/ha a.S.
mit je 0,25, 0,5, 1 und 2 kg/ha a.S.
I + XVI + XXVI, I + XII + XXVII, I + XIII + XVI
mit je 0,25 + o,25 + o,5, 0,25 + 0,5 + 0,25, 0,5 + 0,25 + 0,25,
1 + 0,5 + 0,5, 0,5 + 1 + 0,5, 0,5 + 0,5 + 1 kg/ha a.S.
Nach 14 bis 16 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei gleicher Verträglichkeit
an den Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381 - 41 -
| Wirkstoff | 25 | I | 0,5 | 1 | 2 | 0,25 | XII | 1 | 2 | XIII | 0,25 | 0,5 | 1 | 2 | 0,25 | XVI | 1 | 2 |
| kg/ha a.S. 0, | 0,5 | 0,5 | ||||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 7 | 0 | 0 | 0 | ||||
| Triticum aastivum | 0 | 0 | 0 | 0 | 0 | 0 | Q | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | ||
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | ||
| Seeale cereale | 0 | 0 | ||||||||||||||||
| unerwünschte Pflanzen: | 24' | 40 | 70 | 100 | 0 | 0 | 0 | 0 | 0 | 5 | 10 | 0 | 0 | 5 | ||||
| Alopecurus myosuroides | 15 | 29 | 45 | 65 | 0 | 0 | 0 | 0 | 0 | 7 | 15 | 0 | 0 | 0 | 0 | |||
| Apera spica venti | 5 | 11 | 15 | 25 | 5 | 0 | 20 | 27 | 15 | 50 | 60 | 80 | 0 | 0 | 11 | 20 | ||
| Galium aparine | 20 | 27 | 40 | 82 | 20 | 10 | 80 | 95 | 18 | 40 | 75 | 90 | 15 | 5 | 45 | 60 | ||
| Lamium amplexicaule | ■ 30 | 20 | ||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
N) CO CO ■P-
| Wirkstoff | XXVI | 0,5 | 1 | 2 | XXVII | 0,25 | 0,5 | 1 | 2 |
| kg/ha a.S. | 3,25 | ||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ρ | |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Seeale cereale | 0 | ||||||||
| unerwünschte Pflanzen: | 0 | 12 | 18 | . 0 | 10 | 12 | 21 | ||
| Alopecurus myosuroides | 0 | 0 | 0 | 10 | 0 | 0 | 5 | 10 | |
| Apera spica venti | 0 | 30 | 6o | 80 | 20 | 30 | 50 | 75 | |
| Galium aparine | 15 | 10 | 25 | 54 | 5 ' | 10 | 40 | 50 | |
| Lamium amplexicaule | 5 |
0 = ohne Schädigung 100 - totale Schädigung
OJ
| Wirkstoff | I+XII+XXVII | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
I+XIII+XXVI | I O O O | ,25 ,5 ,25 |
ooo te te te M MUi UlUl |
I+XVI+XXVI | 0,25 0,5 0,25 |
0,5 0,25 0,25 |
1 | I+XII+XXVII | 0,5 1 0,5 |
0,5 0,5 1 |
I+XIII+XXVI | 0,5 1 0,5 |
0,5· 0,5 1 |
I+XVI+XXVI | 0,5 1 0,5 |
1 | 0 | » | |
| kg/ha a.S. | ooo te te te VJl MM VJiUl |
ooo te te te UI M M UlUl |
ooo Ul MM UlUl |
1 0,5 0,5 |
1 0,5 0,5 |
1 0,5 3,5 |
C) | ω ( |
|||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||
| Triticum aestivum | O | 0 | 0 | 0 | 0 | 0 | 0 | . 0 | 0 | 0 | 0 | "' 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Hordeum vulgäre | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0" | 0 | 0 | 0 | 0 | 0 | 95 | |||||
| *- | Seeale cereale | °· | 0 | 0 | 0 | 0 | 0 | 70 | ro OJi |
||||||||||||||
| co OO |
unerwünschte Pflanzen: | 72 | 83 | '73 | 80 | 72 | 84 | 94 | 96 | 100 | 95 | 83 | 10 0 | OJ) | |||||||||
| OO ■Ρ- |
Alopecurus myosuroides | 78 | 58 | 70 | 75 | 64 | 69 | 70 | 60 | 66 | 00 | 68 | 70 | 100 | 98 | 70 | 100 | 68 | KD | ||||
| Apera spica venti | 60 | 77 | 80 | 67 | 93 | 83 | 58 | 68 | 70 | 87 | 89 | 100 | 90 | 100 | 100 | 84 | 95 | ||||||
| co | Galium aperine | 90 | 98 | 97 | 90 | 100 | 97 | 80 | 84 | 89 | 92 | 100 | 100 | 100 | 100 | 100 | 90 | 100 | |||||
| 00 | Lamiutn amplexicaule | 94 | 98 | 85 | 100 | 100 | 100 | ||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
- 44- O.Z. 2Q
Im Freiland wurden verschiedene Pflanzen bei einer" Wuchshöhe
von 2 bis 20 cm mit folgenden Einzelwirkstoffen und deren Mischungen als Dispersion-Tankmix behandelt:
I l-m-Chlor-p-methoxyphenyl-^-methylO-methoxyharnstoff
XII 2-Methyl-4-chlorphenoxyessigsäure-dimethylaminsalz XIII 2,4,5-Trichlorphenoxyessigsäure-kaliumsalz
XVI 2,4-Dichlorphenoxyessigsäure-nafcr:Lumsalz
XXVI 3-Isopropyl-2,1,5-benzothiadiazinon-(4)-2,2-dioxid-
natriumsalz
XXVII 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxiddimethylaminsalz
mit je 1, 2, ^, 4 kg/ha a.S.
mit je 1, 2, ^, 4 kg/ha a.S.
I + XVI + XXVI, I + XII + XXVII, I + XIII + XXVI
mit je 1+1+1, 2+1+1, 1+2+1, 1+1+2 kg/ha a.S.
Nach 14 bis 16 Tagen wurde festgestellt, daß die Mischungen eine bessere Verträglichkeit an den Kulturpflanzen als die
Einzelwirkstoffe bei entsprechenden Aufwandmengen zeigten.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381
| Wirkstoff | 1 | unerwünschte Pflanzen: | 45 | 2 | I | 3 | 4 | 1 | 2 | XII | 4 | 1 | 2 | XIII | 4 | 1 | 2 | XVI | 4 | 1 | XXVI | 2 | 3 | 4 | I K- |
| kg/ha a.S. | Alopecurus myosuroidesTu | 15 | 3 | 3 | 3 | 30^ | |||||||||||||||||||
| Nutzpflanzen: | 0 | Apera spica venti | 40 | 0 | 10 | 12 | 0 | 0 | 25 | 0 | 7 | 24 | 0 | 0 | 15 | 0 | 0 | 0 | 0 | 21 ' | |||||
| Triticum aestivum | 0 | Galium aparine | 0 | 10 | 14 | 0 | 0 | 10 | 24 | 0 | 10 | 15 | 40 | 0 | 0 | .5 | 20 | 0 | 0 | 0 | 0 | 100 | |||
| Hordeum vulgäre | 0 | Lamium amplexicaule | 0 | 10 | 16 | 0 | 0 | 10 | 27 | 0 | 10 | 30 | 30 | 0 | 0 | 5 | 20 | 0 | 0 | 0 | 0 | 86 J |
|||
| Secale cereale | 10 | 17 | 5 | ||||||||||||||||||||||
| 100 | 100 | 100 | 0 | 0 | 5 | UI | 10 | 25 | 0 | 5 | IQ | 12 | 18 | 23 | |||||||||||
| 65 | 100 | 100 | 0 | 0 | 0 | 7 | 7 | 15 | 15 | 37 | 0 | 0 | 7 | Ul | 0 | 10 | 15 | ||||||||
| 25 | 35 | 50 | 20 | 27 | 0 | 40 | 60 | 8o | 20 | 100 | 11 | 20 | 0 | 43 | 60 | 80 | 100 | ||||||||
| 82 | 100 | 100 | 80 | 95 | ■30 | 100 | 75 | 90 | 100 | 100 | 45 | 60 | 35 | 100 | 25 | 54 | 75 | ||||||||
| 100 | 100 | 95 | |||||||||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
N) CO CO
| O | C- | O | O |
| O | O | O | O |
| O | O | O | O |
Wirkstoff XXVII
kg/ha a.S. 1 2 3 4
Nutzpflanzen;
Triticum aestivum
Hordeum vulgäre
Seeale cereale
Triticum aestivum
Hordeum vulgäre
Seeale cereale
** unerwünschte Pflanzen; ο ■
to Alopecurus myosuroides 12 21 JC ^4
oo -J=-
oo Apera spica venti 5 10 17 25 0^
ζ Galium aparine 50 75 100 100
Lamium amplexicaule 40 50 60 78
0 = ohB Schädigung ^
100 ■ totale Schädigung O>
| Wirkstoff | I+XVI+XXVI | 2 1 1 |
1 2 1 |
1 1 2 |
1 1 1 |
I+XII+XXVII | 1 2 1 |
1 1 2 |
1 1 1 |
I+XIII+XXVI | 1 2 1 |
1 1 2 |
| kg/ha a.S. | 1 1 1 |
I | 2 1 1 |
2 1 1 |
||||||||
| Nutzpflanzen: | O | 0 | 0 | 0 | 0 | 0 | 0 | 7 | 0 | |||
| Triticum aestivum | 0 | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 |
| Hordeum vulgäre | 0 | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 |
| Secale cereale | 0 | 0 | 0 | |||||||||
| unerwünschte Pflanzen: | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |||
| Alopecurus myosuroides | 100 | 100 | 100 | 98 | 100 | 100 | 100 | 97 | 100 | 100 | 100 | |
| Apera spica venti | SB | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 |
| Galium aparine | IOD | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 |
| Lamium ampleeicaule | Π) | 100 | 100 |
0 = ohne Schädigung 100 = totale Schädigung
- 48 - O.Z. 29 965
Beispiel 8 233Λ61 1
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 3 bis 25 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Dispersion behandelt:
I l-m-Chlor-4-methoxyphenyl-3-methyl-3-methoxyharnstoff
1, 1,5, 2, 3 kg/ha a.S.
. II oi-(2,4-Dichlorphenoxy)-propionsäure-dimethylaminsalz
. II oi-(2,4-Dichlorphenoxy)-propionsäure-dimethylaminsalz
1.5» 3kg/ha a.S.
III et-(2-Methyl-4-chlorphenoxy)-propionsäure-dimethylaminsalz
III et-(2-Methyl-4-chlorphenoxy)-propionsäure-dimethylaminsalz
1,5, 3 kg/ha a.S.
XI 2,4-Diehlorphenoxyessigsäure-dimethylaminsalz
XI 2,4-Diehlorphenoxyessigsäure-dimethylaminsalz
0,5, 2, 3 kg/ha a.S. XII 2-Methyl-4~chlorphenoxyessigsäure-dimethylaminsalz
0,25, 0,5, 2 kg/ha a.S. XVII 2,4,5-Trichlorphenoxyessigsäure-diäthylaminsalz
0,25, 0,5 2, 3 kg/ha a.S.
XVIII Üv'-(2,4-Dichlorphenoxy)-buttersäure-dimethylaminsalz
0,5, 3 kg/ha a.S.
I + III + XI: 1 + 1,5 + 0,5 kg/ha a.S. I + XII +XI: 1+0,5+0,5 kg/ha a.S.
I + XVII + II: 1 + 0,5 + 1,5 kg/ha a.S. I + XI + XIII: 1 + 0,5 + 1,5 kg/ha a.S. I + XIII + III: 1 + 0,5 + 1,5 kg/ha a.S.
I + XVII + III: 1 + 0,5 + 1,5 kg/ha a.S. I + XVII + XII: 1,5 + 0,25 + 0,25 kg/ha a.S.
I + XVIII + II: 1 + 0,5 + 1,5 kg/ha a.S. XIII 2,4,5-Trichlorphenoxyessigsäure-kaliumsalz
0,5, 2 und 3 kg/ha a.S.
Nach 14 bis 16 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei gleicher Verträglichkeit
an den Kulturpflanzen zeigten als die EinsLwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381 -49-
Wirkstoff
kg/ha a.S.
kg/ha a.S.
1 1,5 2 3
| II | 3 | III | 3 ) |
| 1,5 | 15 | ,5 | 5 |
| 0 | 15 | 0 | 15 |
| 0 | 25 | 0 | 10 |
| 0 | 10 | 0 | 15 |
| 3 | 10 | 10 | 5. |
| 0 | 100 | 0 | 105 |
| 75 | 90 | 70 | 70 |
| 70 | 50 |
XI
•·5 2
XII
0,25 0,5'2
0,25 0,5'2
XVII 0,25 0,5
XVIII XIII
0,5
0,5
Nutzpflanzen;
Triticum aestivum
Hordeum vulgäre
Seeale cereale
Triticum aestivum
Hordeum vulgäre
Seeale cereale
0 0 0 10 0 0 0 10 0 0 0 10
co unerwünschte Pflanzen;
■>· Alopecurus myosuroides 70 87 100 100
2l Apera spica venti 45 60 65100
£J Galium aparine 15 20 25 -» Lamium ampleaicaule 40 65 82
0 = ohne Schädigung 100 = totale Schädigung
005 0 0 10 005
0 5 5
0 7 10
10 ^O 40
35 90 EO
0 0 0 0 0 0
0 0 0 0 10 24 30 95
0 0 0
15 203)
24
0 Q
OOO5
32 90 DO
48 95 IGD
0 0 0
0 15
0 30 0 17
0 y
0 12 15
0 15 3 20
30 loo 8o £J 4o 100 90 to
| Wirkstoff | I+III+XI | I+XII+XI | I+XVII+II | I+XI+XIII | I+XIII+IIIj | +XVII+EI | Ι+ΧΥΠ+ΧΕ | I+WJIML | 5+1,5 | |
| kg/ha a.S. | 1+1,5+0,5 | 1+0,5+0,5 | 1+0,5+1,5 | 1+0,5+0,5 | 1+0,5+1,5 | +0,5+1,5 | I3QS+0,25 | 1+0, | ||
| Nutzpflanzen: | ||||||||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Hordeum vulgäre | 0 | ■ ο | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Seeale cereale | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| unerwünschte Pflanzen: | 1 | |||||||||
| O (O |
Alopecurus myosuroides | 100 | 95 | 100 | 100 | 100 | 100 | 100 | 98 | Ul O |
| OO | Apera spica venti | 90 | 84 | 87 | 87 | 95 | 90 | 100 | 90 | |
| ■Ο- | Galium aparine | 100 | 75 | 100 | 100 | 100 | 100 | 85 | 100 | |
| Lamium amplexicaule | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 233 | |
| U) 00 —* |
0 = ohne Schädigung |
100 = totale Schädigung
- 51 - O.Z. 29
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 19 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Dispersion behandelt:
XI 2,4-Dichlorphenoxyessigsäure-dimethylaminsalz
XII 2-Methyl-4-chlorphenoxyessigsäure-dimethylaminsalz
XVII 2,4,5-Trichlorphenoxyessigsäure-diäthylaminsalz
XXIV l-m-Chlor-p-methylphenyl-l-cyclohex-tenyl-^i^-dimethyl-
harnstoff
XXV j5-Isopropyl-2, l,j5-benzothladiazinon-(4)-2,2-dioxid
XXVI 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-
natriumsalz
XXVII 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-
XXVII 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-
dimethylaminsalz
XXVIII 3-Isopropyl-2,l,^-benzothiadiazinon-(4)-2,2-dioxiddiäthanolaminsalζ
mit je 0,25, 1 und 1,5 kg/ha a.S.
mit je 0,25, 1 und 1,5 kg/ha a.S.
XXIV + XI + XXVII, XXIV + XII + XXVII, XXIV + XVII + XXVIII
Nach 12 bis 15 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei gleicher Verträglichkeit
an den Kulturpflanzen zeigten als die Einzelwirkstoffe
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
40988Λ/1381 -52-
| Wirkstoff | XXIV | 1,5 | XI | 1 | 1,5 | XII | 1 | 1,5 | XVII | 1 | 1,5 | XXV | 0 | 1,5 | XXVI | 0 | 1,5 | XXVII | 0 | 1,5 |
| kg/ha a.S. 0 | ,25 1 | 0,25 | 0,25 | 0,25 | 0,25 ι | 0 | 0,25 1 | 0 | 0,25 1 | 0 | ||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||
| Triticum aestivum | 0 0 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 5 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
| Secale cereale | 0 0 | 15 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 12 | 0 | 0 | 12 | 0 |
| Zea mays | 0 0 | 0 | 0 | 0 | 0 | 60 | 0 | 60 | 0 | 50 | ||||||||||
| unerwünschte Pflanzen: | 70 | 0 | 0 | 0 | 0 | 3 | 5 | 29 | 15 | 29 | 15 | 40 | 16 | |||||||
| Alopecurus myosuroides | 30 55 | 16 | 0 | 20 | 25 | 0 | 20 | 25 | 0 | 70 | 75 | 3 | 75 | 0 | 75 | 0 | 60 | |||
| Galium aparine | 0 10 | 57 | 5 | 80 | 8o | 5 | 80 | 82 | 15 | 85 | 87 | 15 | 70 | 15 | 40 | 20 | 45 | |||
| Lamium amplexicaule | 5 35 | 20 | 20 | 20 | 5 | 5 | 5 | |||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
Ul
ro
N)
CO CJ
JN
Ui
| Wirkstoff | XXVIII | 1 | 1,5 | |
| kg/ha a.S. | 0,25 | |||
| Nutzpflanzen: | 0 | 0 | ||
| Triticum aestivum | 0 | 0 | 0 | |
| Hordeum vulgäre | 0 | 0 | 0 | |
| Secale cereale | 0 | 0 | 0 | |
| Zea mays | 0 | |||
| O co |
unerwünschte Pflanzen: | 12 | 15 | |
| 00 00 |
Alopcurus myosuroides | 0 | 65 | 80 |
| Galium aparine | 25 | 35 | 50 | |
| "ν. | Lamium amplexicaule | 6 |
-* 0 = ohne Schädigung 100 = 'totale Schädigung
Ca)
| Wirkstoff | XXIV+XI+XXVII | 0 1 0 |
te te
ro ro Ui Ui |
0,25 0,25 1 |
XXIV+XII+XXVII | 0,25 1 0,25 |
■-· ο ο
ro ro UiUi |
XXIV+XVII+XXVIIIIXXIV+XI+XXV |
m m
OJ CVJ O ■-· O |
μ-·ο ο
te te ro ro UlUl |
0,25 0,25 |
0,25 1 0,25 |
0,25 0,25 1 |
XXIV+XII+XXVI |
O t-O
te te ro ro Ui Ui |
0,25 0,25 1 |
. |
| kg/ha a.S. |
O O ι-·
ro ro UiUi |
1 0,25 0,25 |
O O ι-·
ro ro UlUl |
1 0,25 0,25 |
Ul -fr I |
||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 . | 0 | 0 | 5 | 0 | 0 | 0 | 0 | 0 | ro | |
| Hordeum vulgäre | 5 | 0 | 0 | 5 | 0 | 0 | Ul | 0 | 0 | 0 | 0 | 0 | 5 | 0 | 0 | CJ CJ |
|
| Seeale cereale | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Zea mays | 0 | 0 | 0 | 0 | |||||||||||||
| Unerwünschte Pflanzen: | 66 | 77 | 65 | 78 | 70 | 79 | 96 | 72 | 82 | 73 | 85 | ||||||
| Alopecurus myosuroides | 90 | 76 | 91 | 91 | 76 | 90 | 90 | 100 | 77 | 72 | 74 | 100 | 90 | 78 | 96 | ||
| Galium aparine | 70 | 100 | 100 | 71 | 100 | 100 | 87 | 100 | 100 | 85 | 70 | 96 | 80 | 100 | 95 | ||
| Lamium amplexicaule | 100 | 100 | 100 | 98 | |||||||||||||
ο = ohne Schädigung 100 - totale Schädigung
O)
- 55 - °·ζ· 2^ 965
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 24 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Paste behandelt:
XXIV NO-ChIor-4-methylphenyl-N-cyclohexrl-enyl-N1 ,N' -
dimethylharnstoff
III ot-(2-Methyl-4-chlorphfenoxy)-propionsäure-dimethylaminsalz
VI ce-(2,4,5-Trichlorphenoxy)-propionsäure-kaliumsalz
X a-(2,4-Dichlorphenoxy)-propionsäure-tiooctylester
XVIII 3L-(2,4-Dichlorphenoxy)-buttersäure-dimethylaminsalz
XXV 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid
XXVI 3-Isopropyl-2,l,3-benzothiadiazinon-{4)-2,2-dioxidnatriumsalz
XXVII 5-Isopropyl-2,1,3-benzothiadiazinon-(4)-2,2-dioxiddimethylaminsalz
XXVIII ^-Isopropyl^,l,3-benzothiadia2inon-(4)-2,2-dioxiddiäthanolaminsalz
mit je 0,25, 1, 1*5, 2, 3 kg/ha a.S.
XXIV + VI + XXVI, XXIV + III + XXVII, XXIV + X + XXVII, XXIV + XVIII + XXVIII, XXIV + VI + XXV
mit je 1 + 1 + 1,'1,5 + 0,25 +0,25, 0,25 + 1,5 + 0,25,
0,25 + 0,25 + 1,5 kg/ha a.S.
Nach 14 bis 16 Tagen wurde festgestellt, daß die Mischungen
eine bessere Verträglichkeit an den Kulturpflanzen als die Einzelwirkstoffe bei entsprechenden Aufwandmengen zeigten.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381 " 56 '
| Wirkstoff | XXIV | 0 | 1,5 | 2 | 3 | : | 0 | 1,5 | 2 | 3 | 70 | VI | 1 | 1,5 | 2 | 3 | 0,25 | 1 | X | 2 | 3 |
| kg/ha a.S. | 0,25 1 | 5 | [II | 0 | 0,25 | 1,5 | |||||||||||||||
| Nutzpflanzen: | 0 | 0 | 5 | 25 | 0,25 1 | 0 | 0 | 0 | 5 | 5 | 10 | 16 | 20 | 0 | 0 | 0 | 15 | ||||
| Triticum aestivum | 0 | 0 | 7 | 10 | ^o | 0 | 0 | 0 | 15 | 0 | 6 | 9 | 15 | 30 | 0 | 0 | 0 | 0 | 20 | ||
| Hordeum vulgäre | 0 | 5 | 8 | 14 | O | 0 | 0 | 10 | 0 | 7 | 12 | 18 | 24 | 0 | 0 | 0 | 0 | 25 | |||
| Secale cereale | 0 | 55 | 15 | 18 | 25 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | |
| Zea mays | 0 | 10 | 0 | 50 | 0 | 0 | |||||||||||||||
| unerwünschte Pflanzen: | 35 | 70 | 78 | 90 | 0 | 25 | 10 | 12 | 15 | 5 | 10 | 14 | 20 | 0 | 10 | 20 | 25 | ||||
| Alop^curus myosuroiedes | 50 | 16 | 20 | 25 | 70 | 85100 | 0 | 57 | 85 | 95 | 100 | 20 | 88 | 17 | IQD | 100 | |||||
| Gal ium aparlne | 0 | 57 | 70 | 95 | 0 | 50 | 60 | 17 | 80 | 94 | 98 | 100 | 20 | 65 | 94 | 80 | 90 | ||||
| Lamium amplexicaule | 5 | 15 | 15 | 75 | |||||||||||||||||
| 10 | |||||||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
u σ
CJ
F-CP
| Wirkstoff | 0, | XVIII | 1,5 | 2 | 3 | XXV | 0 | 1, | 5 2 | 3 | 0,25 | XXVI | 1, | 5 2 | 3 | 0,25 | XXVII | 1, | 5.2 | 3 |
| kg/ha a.S. | 25 1 | 0,25 l | 0 | 1 | 1 | |||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 5 | 0 | 0 | . 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Seeale cereale | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Zea mays | 0 | 0 | 60 | 0 | 0 | |||||||||||||||
| unerwünschte Pflanzen: | 0 | 5 | 5 | 7 | 25 | 15 | 20 | 30 | 0 | 15 | 18 | 23 | 0 | 16 | 21 | 30 | ||||
| Alopecurus myosuroidea | 9 | 0 | 25 | ^o | 50 | 3 | 75 | 80 | 95 | 15 | 12 | 75 | 80 | IOD | 20 | 12 | 60 | 75 | 100 | |
| Ga]jiim aparine | 10 | 18 | 34 | 40 | 75 | 15 | 40 | 64 | 70 | 5 | 60 | 40 | 54 | 75 | 5 | 50 | 45 | 50 | 60 | |
| Lamium amplexicaule | 25 | • 5 | 25 | 40 | ||||||||||||||||
0 =*,ohne Schädigung 100 =>
totale Schädigung
Ui
N) CO OJ
GD
| Wirkstoff | 0,25 | 1 | XXVIII | 2 | 0 |
| kg/ha a.S. | 1,5 | 0 | |||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | |
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | |
| Seeale cereale | 0 | 0 | 0 | 0 | 25 |
| Zea mays | 0 | 100 | |||
| unerwünschte Pflanzen: | 0 | 12 | 19 | 80 ■ | |
| Alopecurus myosuroides | 25 | 65 | 15 | 80 | |
| Galium aparine | 6 | 35 | 80 | 60 | |
| Lamium amplexicaule | 50 | ||||
Galium aparine 25 65 80 80100
ro
u> CO
00 CO
-* 0 = ohne Schädigung "Ji*
100 = totale Schädigung · —»
Ul 00
| Wirkstoff | 1 1 1 |
XXIV+VI+XXVI | 0,25 1,5 0,25 |
>-O O
te te te ui ro ro UlUl |
1 1 1 |
XXIV+III+XXVII | 0,25 1,5 0,25 |
t- O O
te te te ui ro ro UIUl |
1 1 1 |
1 0 0 |
XXIV+X+XXVII | 0,25 15 0,25 |
0 0 1 |
to to to
ui ro ro UiVJi |
1 1 1 |
XXIV+XVIII+XXVIII | 0,25 1,5 0,25 |
0 0 1 |
,25 ,25 ,5 |
Ul VO |
| kg/ha a.S. | 1,5 0,25 0,25 |
1,5 0,25 0,25 |
,5 ,25 ,25 |
1,5 0,25 0,25 |
||||||||||||||||
| Nutzpflanzen: | Ul | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | K) co |
|||||||
| Triticum aestivum | 6 | 0 | 9 | 0 | 5 | 0 | 0 | . 0 | 5 | 0 | 0 | 0 | 5 | 0 | O | 0 | OO | |||
| Hordeum vulgäre | 7 | 7 | 12 | 0 | 0 | 7 | 0 | 0 | 0 | 7 | 0 | 0 | 0 | 7 | 0 | 0 | cn | |||
| Seeale cereale | 0 | 5 | 0 | 0 | 0 | Ul | 0 | 0 | 0 | 5 | 0 | 0 | 0 | 5 | 0 | 0 | ||||
| Zea mays | 15 | 15 | 15 | 15 | ||||||||||||||||
| unerwünschte Pflanzen: | 100 | 76 | 8o | LOO | 76 | 82 | LOO | 8^ | 81 | 100 | 70 | 81 | ||||||||
| Alopecurus myosuroides | 100 | 100 | 100 | 100 | LOO | 100 | 100 | 100 | LOO | 100 | 100 | 100 | 100 | 100 | 84 | 100 | ||||
| Galium aparine | 100 | 82 | 100 | 100 | LOO | 100 | 100 | 100 | LOO | 98 | 100 | 100 | 100 | 86 | 100 | 100 | ||||
| Lamium amplexicaule | 100 | 100 | 100 | 100 | ||||||||||||||||
0 = ohne Schädigung 100 - totale Schädigung
Wirkstoff XXIV+VI+XXV
kg/ha a.S. 1 1,5 0,25 0,25
1 0,25 1,5 0,25 1 0,25 0,25 1,5
Nutzpflanzen: Triticum aestivum Hordeum vulgäre
Seeale cereale
Q Zea mays (ο
σο unerwünschte Pflanzen: -^, Alopecurus myosuroides
Galium aparine ^.^^ *ν^ *w *«^ ,^
00 Lamium amplexicaule 100 1001 100 100 CO
0 = ohne Schädigung ~~*
100 = totale Schädigung
| 5 | 0 | 10 | 0 |
| 6 | 0 | 9 | 0 |
| 7 | 0 | 12 | 0 |
| 0 | 0 | 0 | 0 |
| 97 | 100 | 85 | 87 |
| 100 | 100 | 100 | 100 |
| 100 | loo: | 100 | 100 |
CT\ O
- O.ζ. 29 96b
Im Gewächshaus wurden Versuchsgefäße mit lehmigem Sandboden
gefüllt und mit verschiedenen Samen besät. Danach wurde der so vorbereitete Boden mit folgenden Einzelwirkstoffen und
deren Mischungen als Dispersion behandelt:
XXIV N^-Chtor^-methylphenyl-N-cyclohex-l-enyl-N' ,N' -dimethyl-
harnstoff
XXIX öL-(2-Methyl-4-chlorphenoxy)-propionsäure-natriumsalz
VI c£-(2,4,5-Trichlorphenoxy)-propionsäure-kaliumsalz
V oü-(2,4-Dichlorphenoxy)-propionsäure-natriunsalz
XII 2-Methyl-4-chlorphenoxyessigsäure-dimethylaminsalz
XVI 2,4-Dichlorphenoxyessigsäure-natriumsalz
XVII 2,4,5-Trichlorphenoxyessigsäure-diäthylaminsalz
mit je 1, 2 und ~$ kg/ha a.S.
XXIV + XXIX, XXIV + V, XXIV + VI, XXIV + XII, XXIV + XVI, XXIV + XVII mit je 2 + 1, 1+2 und 1+1 kg/ha a.S.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine bessae herbizide Wirkung bei gleicher Verträglichkeit an den-Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381 " 62 ~
| Wirkstoff | 1 | XXIV | 3 | XXIX | 1 | 2 | 3 | 1 | V | 3 | 1 | VI | 3 | 1 | XII | 2 | 3 | 1 | XVI | 3 | ι· | XVII | 3 |
| kg/ha a.S. | 2 | 2 | 2 | 2 | 2 | ||||||||||||||||||
| Nutzpflanzen: | O | 14 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||
| Triticum aestivum | O | 10 | 15 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Hordeura vulgaris | O | 10 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Seeale cereale | 5 | 0 | 0 | 0 | 0 | ||||||||||||||||||
| unerwünschte Pflanzen: | 90 | 130 | 0 | 0 | 0 | 0 | 5 | 0 | 8 | 0 | 0 | 0 | 0 | 0 | 0 | 5 | |||||||
| Poa trivialis | 15 | 95 | 30 | 65 | 75 | 85 | 70 | 0 | 90 | 70 | 5 | 90 | 20 | 25 | 20 | 0 | 30 | 60 | 3 | 75 | |||
| Galium aparine | 20 | 80 | 80 | 25 | 65 | ||||||||||||||||||
100
ohne Schädigung totale Schädigung
ro
CO CD
| Wirkstoff | XXIV+XXIX | 1 | 1 | XXIV+V | 1 | 1 | XXIV+VI | 1 | 1 | XXIV+XII I | CVJ | 1 | 1 | CVJ | XXIV+XVI | 1 | 2 | IXXIV+XVII | 1 |
| kg/ha a.S. | 2 | 2 | 1 | 2 | 2 | 1 | 2 | 2 | 1 | 1 | 2 | 1 | 1 | 1—■ | 1 | 1 | 1 | 1 | |
| 1 | 1 | 1 | CU | 2 | |||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 10 | 0 | ||||||
| Triticum aestivum | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | |
| Hordeum vulgaris | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | VJl | 0 | 0 | VJl | 0 | O | VJi | 0 | 0 | |
| Gecale cereale | VJi | 5 | 5 | 0 | 0' | ||||||||||||||
| unerwünschte Pflanzen: | 100 | 100 | EO | IOD | XD | 100 | M) | IGO | IOD | LOO | JOO | IOD | 100 | ||||||
| Poa trivialis | 100 | 100 | 100 | 100 | ICD | 100 | IOD | KX) | 100 | 76 | 75 | 71 | IOD | 70 | 100 | IGD | 100 | ||
| Galium aparine | 100 | 100 | 100 | 77 | IOD |
0 = ohne Schädigung 100 - totale Schädigung
ON
CO CD
- 64 Beispiel 12
O.Z 29 965
233^611
Im Gewächshaus wurden Versuchsgefäße mit lehmigem Sandboden
gefüllt und mit verschiedenen Samen besät. Danach wurde der so vorbereitete Boden mit folgenden Einzelwirkstoffen und deren
Mischungen als Granulat behandelt:
I N-3-Chlor-4-methoxyphenyl-N'-methyl-N1-methoxyharnstoff
VI cL-(2,4,5-Trichlorphenoxy )-propionsäure-kaliumsalz
VII <jÜ.-(4-Chlorphenoxy)-propionsäure-dimeth/laminsalz
VIII d- (2-Methylphenoxy)-propionsäure-isooctylester
IX öi-(2-Methylphenoxy)-propionsäure-diäthylaminsalz
X #-(2,4-Dichlorphenoxy)-propionsäure-isooetylester
XII 2-Methyl-4-chlorphenoxyessigsäure-dimethylaminsalz
XIII 2,4,5-Triehlorphenoxyessigsäure-kaliumsalz
XIV 4-Chlorphenoxyessigsäure-dimethylaminsalz
XV 2-Chlorphenoxyessigsäure-dimethylaminsalz
XVI 2,4-Dichlorphenoxyessigsäure-natriumsalz
XIX ^-(2-Methyl-4-chlorphenoxy)-buttersäure-natrium
XX ^--(2,4,5-Trichlorphenoxy)-buttersäure-dimethylaminsalz
XXI ^--(4-Chlorphenoxy)-buttersäure
XXII T- (2,4-Dichlorphenoxy)-buttersäure-i sooetylester
XXIII f- (2,4-Dichlorphenoxy)-crotonsäure-dimethylaminsalz
mit je 1, 2 und j5 kg/ha a.s
I + VI, I + VII, I + VIII, + I IX, I + X, I + XII, I + XIII,
I + XIV, I + V, I + XVI, I + XIX, I + XV, I + XXI, I + XXII, I + XXIII mit je 2 + 1, 1+2, 1+1 kg/ha a.S.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an den Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen:
409884/1381
- 65 -
| Wirkstoff | 1 | I | 3 | 1 | VI | 3 | 1 | VII | 3 | 1 | VIII | 3 | 1 | 2 | IX | 3 | 1 | X | 3 | 1 | XII | 3 |
| Kg/ha a.S. | 2 | 2 | 2 | 2 | 2 | 2 | ||||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||
| Triticum aestivum | 0 | 0 | 14 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Hordeum vulgaris | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Seeale cereale | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||
| unerwünschte Pflanzen: | 80 | 97 | 0 | 8 | 0 | 5 | 0 | 7 | 0 | 0 | 5 | 0 | 5 | 0 | 0 | |||||||
| Poa trivialis | 10 | 90 | 35 | 70 | 5 | 90 | 65 | 0 | 85 | 18 | 3 | 50 | ro | 80 | 90 | 75 | 0 | 95 | 20 | 0 | 30 | |
| Galium aparine | 20 | 8o | 70 | 35 | 85 | 25 | ||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
| Wirkstoff | 1 | XIII | 3 | XIV | 1 | 2 | 3 | 1 | XV | 3 | 1 | XVI | .3 | 1 | XIX | 3 | • | 1 | XX | 3 | 1 | XXI | 3 | 7 |
| kg/ha a.S. | CVi | 2 | 2 | 2 | 2 | 2 | 87 | |||||||||||||||||
| Nutzpflanzen: | 0 | 1O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||
| Triticum aestiyum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
| Hordeum vulgaris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ■ 0 | 0 | 0 | 0 | 0 | 0 | |||
| Seeale cereale | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||
| unerwünschte Pflanzen: | 0 | 5 | 0 | 0 | 3 | 0 | 5 | 0 | 0 | 0 | 5 | 0 | 5 | 0 | ||||||||||
| Poa trivialis | 60 | 0 | 85 | 30 | 45 | 55 | 25 | 0 | 40 | 20 | 0 | 30 | 15 | 0 | 40 | 70 | 0 | 95 | 60 | 0 | ||||
| Galium aparine | 70 | 35 | 25 | 30 | 80 | 75 | ||||||||||||||||||
0 - ohne Schädigung 100 = totale Schädigung
CJ)
O (O op OO
OO
| Wirkstoff | 1 | XXII | 3 | 1 | XXIII | O | 2 | I+VI | 1 | I+VI I | 2 | 1 | 1 | I+VIII | 2 | 1 | 1 | 2 | I+IX | 1 | 2 | I+X | 1 |
| kg/ha a.S. | 2 | 2 | O | 1 | 1 | 1 | 1 | 2 | 1 | 1 | 2 | 1 | 1 | 1 | 1 | 1 | 1 | 1 | |||||
| O | 2 | CVI | CVJ | ||||||||||||||||||||
| Nutzpflanzen: | O | O | O | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||
| Triticum aestivum | O | O | O | O | O | •6 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | ||
| Hordeum vulgar!s | , O | O | O | O | O | 55 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| Seeale cereale | O | O | 0 | 0 | 0 | ||||||||||||||||||
| unerwünschte Pflanzen: | O | 5 | O | IGD | 100 | 100 | 100 | EO | 100 | DO | 300 | DO | DO | DO | 100 | ||||||||
| Poa trivialis | 20 | 55 : | 50 | O | 100 | 100 | IOD | 100 | 100 | 100 | 74 | 80 | 64 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
| Galium aparine | 35 | 45 | 100 | 100 | 100 | ||||||||||||||||||
0 = ohne Schädigung
100 = totale Schädigung
100 = totale Schädigung
CO
| Wirkstoff | 1 | I+XIl | [ | 1 | I+XIII |
η
(L |
1 | 1 | 2 | I+XIV | 1 | I+XV | 2 | 1 | 1 | I+XVI | 2 | 1 | 1 | 2 | I+XIX | 1 | 2 | I+XX | 1 |
| kg/ha a.S. | 1 | 1 | 2 | 1 | 1 | 1 | 1 | 1 | 2 | 1 | 1 | 2 | 1 | 1 | 1 | 1 | 1 | 1 | 1 | ||||||
| O | 2 | 0 | 2 | 2 | 2 | ||||||||||||||||||||
| Nutzpflanzen: | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||
| Triticum aestivum | 0 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | 10 | 0 | 0 | LO | 0 | 0 | ||||
| Hordeum vulgaris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Seeale cereale | 100 | 0 | lOO | 0 | 0 | 0 | |||||||||||||||||||
| unerwünschte Pflanzen: | 76 | 67 | XD | EO | ICD | DD | KD | EO | H) | ICD | ICD | DO | 100 | IGD | DO | 100 | IGD | ||||||||
| Poa trivialis | loo ; | DO | IGO | ICD | 90 | ICO | 76 | 81 | 8o | 70 | 76 | 70 | 67 | 70 | EO | 61 | LOD | 100 | 100 | ||||||
| Galium aparine | 70 | 91 | 75 | 100 | |||||||||||||||||||||
0 = ohne Schädigung 100 = totale Schädigung
o>
OO
co co
| Wirkstoff | Ϊ | I+XXI | 1 | 0 | I+XXII | 1 | ? | I+XXIII | 1 | |
| kg/ha a.S. | 10 | |||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | ||||
| Triticum aestivum | 10 | 0 | 0 | 100 | 0 | 0 | 10 | 0 | 0 | |
| Hordeum vulgaris | 0 | 0 | 0 | 76 | 0 | 0 | 0 | 0 | 0 | |
| Seeale cereale | 100 | 0 | 100 | 0 | 100 | 100 | 0 | |||
| 4098 | unerwünschte pflanzen: | 100 | 100 | 100 | 100 | 65 | 85 | IOD | 100 | |
| OO ^. |
Poa trivialis | 100 | 80 | 90 | 76 | |||||
| Galium aparine | ||||||||||
VO ι
0 = ohne Schädigung 100 = totale Schädigung OO (J)
Claims (1)
- Patentanspruchin der X Methoxy und Y Chlor bedeutet, wenn R Wasserstoffρ
und R Methoxy bedeuten und wenn R (Jclohexenyl bedeutet,bedeuten R2 Wasserstoff Methyl, oder OCH, und X und Y
Wasserstoff, Chlor, Brom, Methyl, Halogenalkyl und MethoxyT und
b) einer Verbindung der Formelin der X und Y Chlor, Methyl, N=O bis 3,R= Wasserstoff, niederes Alkyl, m = 0 bis 2, R = Alkyl, vorzugsweise Amyl, oder Isooctyl, R = Wasserstoff und die Salze bedeutet
oder die Salze oder Ester von 2,4-Dichlorphenoxycrotonsäureund gegebenenfallsc) einer Verbindung der Formel1 Pin der R niederes Alkyl, R Wasserstoff und die Salze bedeutet.BASF Aktiengesellschaft4M884/1381
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732334611 DE2334611A1 (de) | 1973-07-07 | 1973-07-07 | Herbizid |
| IL45012A IL45012A0 (en) | 1973-07-07 | 1974-06-11 | Herbicidal compositions containing a phenylurea derivative and a phenoxyaliphatic acid derivative |
| AU70013/74A AU7001374A (en) | 1973-07-07 | 1974-06-12 | Herbicide |
| NO742395A NO742395L (de) | 1973-07-07 | 1974-07-01 | |
| ZA00744216A ZA744216B (en) | 1973-07-07 | 1974-07-01 | Herbicide |
| FR7423308A FR2235646A1 (en) | 1973-07-07 | 1974-07-04 | High activity selective herbicide compsns. - contg. phenyl-urea, phenoxy-carboxylic acid and opt benzo-thia-diazinone dioxide |
| BR5535/74A BR7405535D0 (pt) | 1973-07-07 | 1974-07-04 | Composicoes herbicidas a base de diversas substancias ativas |
| NL7409073A NL7409073A (nl) | 1973-07-07 | 1974-07-04 | Werkwijze voor het bereiden van herbiciden. |
| DD179733A DD111274A5 (de) | 1973-07-07 | 1974-07-05 | |
| BE146265A BE817306A (fr) | 1973-07-07 | 1974-07-05 | Compositions herbicides selectives |
| LU70473A LU70473A1 (de) | 1973-07-07 | 1974-07-05 | |
| SE7408883A SE7408883L (de) | 1973-07-07 | 1974-07-05 | |
| DK361274A DK361274A (de) | 1973-07-07 | 1974-07-05 | |
| JP49076931A JPS5040743A (de) | 1973-07-07 | 1974-07-06 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732334611 DE2334611A1 (de) | 1973-07-07 | 1973-07-07 | Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2334611A1 true DE2334611A1 (de) | 1975-01-23 |
Family
ID=5886225
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732334611 Pending DE2334611A1 (de) | 1973-07-07 | 1973-07-07 | Herbizid |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5040743A (de) |
| AU (1) | AU7001374A (de) |
| BE (1) | BE817306A (de) |
| BR (1) | BR7405535D0 (de) |
| DD (1) | DD111274A5 (de) |
| DE (1) | DE2334611A1 (de) |
| DK (1) | DK361274A (de) |
| FR (1) | FR2235646A1 (de) |
| IL (1) | IL45012A0 (de) |
| LU (1) | LU70473A1 (de) |
| NL (1) | NL7409073A (de) |
| NO (1) | NO742395L (de) |
| SE (1) | SE7408883L (de) |
| ZA (1) | ZA744216B (de) |
-
1973
- 1973-07-07 DE DE19732334611 patent/DE2334611A1/de active Pending
-
1974
- 1974-06-11 IL IL45012A patent/IL45012A0/xx unknown
- 1974-06-12 AU AU70013/74A patent/AU7001374A/en not_active Expired
- 1974-07-01 ZA ZA00744216A patent/ZA744216B/xx unknown
- 1974-07-01 NO NO742395A patent/NO742395L/no unknown
- 1974-07-04 BR BR5535/74A patent/BR7405535D0/pt unknown
- 1974-07-04 FR FR7423308A patent/FR2235646A1/fr not_active Withdrawn
- 1974-07-04 NL NL7409073A patent/NL7409073A/xx unknown
- 1974-07-05 LU LU70473A patent/LU70473A1/xx unknown
- 1974-07-05 SE SE7408883A patent/SE7408883L/xx not_active Application Discontinuation
- 1974-07-05 DK DK361274A patent/DK361274A/da unknown
- 1974-07-05 DD DD179733A patent/DD111274A5/xx unknown
- 1974-07-05 BE BE146265A patent/BE817306A/xx unknown
- 1974-07-06 JP JP49076931A patent/JPS5040743A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE817306A (fr) | 1975-01-06 |
| JPS5040743A (de) | 1975-04-14 |
| SE7408883L (de) | 1975-01-08 |
| DD111274A5 (de) | 1975-02-12 |
| LU70473A1 (de) | 1974-11-28 |
| NO742395L (de) | 1975-02-03 |
| DK361274A (de) | 1975-02-24 |
| NL7409073A (nl) | 1975-01-09 |
| IL45012A0 (en) | 1974-09-10 |
| BR7405535D0 (pt) | 1975-05-06 |
| AU7001374A (en) | 1975-12-18 |
| FR2235646A1 (en) | 1975-01-31 |
| ZA744216B (en) | 1975-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2324592A1 (de) | Substituierte benzofuranylester | |
| DE2546845A1 (de) | Substituierte 2-(chinolyl-xy)- und 2-(isochinolyl-oxy)-carbonsaeurederivate | |
| DE2341594A1 (de) | Herbizid | |
| DE2417764A1 (de) | O-aminosulfonyl-glykolsaeureanilide | |
| DE2349114A1 (de) | 2,1,3-benzothiadiazin-(4)-on-2,2-dioxi- de | |
| DE2526643A1 (de) | Substituierte pyridazone | |
| DE2310757A1 (de) | Substituierte o-(aminosulfonyl)glykolsaeureanilide | |
| DE2334787A1 (de) | Herbizid | |
| DE2334611A1 (de) | Herbizid | |
| DE2404795A1 (de) | Pyrazoliumsalze | |
| DE2343293A1 (de) | Herbizid | |
| DE2453908A1 (de) | Herbizide mischungen | |
| DE2312045A1 (de) | Carbothiolate | |
| DE2355113A1 (de) | N,n'-disubstituierte 2,1,3-benzothiadiazin-(4)-on-2,2-dioxide | |
| DE2402370A1 (de) | Substituierte benzofuranylester | |
| DE2336444A1 (de) | Herbizid | |
| DE2351553A1 (de) | Herbizid | |
| DE2334601A1 (de) | Thiolcarbamate | |
| DE2341629A1 (de) | Herbizid | |
| DE2403037A1 (de) | Herbizid | |
| DE2425668C3 (de) | Herbizides Mittel auf Benzothiadiazinondioxid-Basis | |
| DE2329044A1 (de) | Herbizid | |
| DE2457688A1 (de) | Carbaminsaeurethiolester | |
| DE2333414A1 (de) | Herbizid | |
| DE2404311A1 (de) | Herbizid |