DE2318786C3 - Verfahren zur Herstellung von γ-Aryloxyacetessigestern - Google Patents
Verfahren zur Herstellung von γ-AryloxyacetessigesternInfo
- Publication number
- DE2318786C3 DE2318786C3 DE19732318786 DE2318786A DE2318786C3 DE 2318786 C3 DE2318786 C3 DE 2318786C3 DE 19732318786 DE19732318786 DE 19732318786 DE 2318786 A DE2318786 A DE 2318786A DE 2318786 C3 DE2318786 C3 DE 2318786C3
- Authority
- DE
- Germany
- Prior art keywords
- ester
- chloro
- bromoacetoacetic
- esters
- aryloxyacetoacetic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002148 esters Chemical class 0.000 title claims description 31
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 22
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 239000000010 aprotic solvent Substances 0.000 claims description 7
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 5
- 229910000105 potassium hydride Inorganic materials 0.000 claims description 3
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 239000010949 copper Substances 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 150000004699 copper complex Chemical class 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000003158 alcohol group Chemical group 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000005809 transesterification reaction Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- KNFXXAGQEUUZAZ-UHFFFAOYSA-N ethyl ethaneperoxoate Chemical compound CCOOC(C)=O KNFXXAGQEUUZAZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- -1 tetramethyl sulfone Chemical class 0.000 description 2
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- OCOBFMZGRJOSOU-UHFFFAOYSA-N 3-o-tert-butyl 1-o-ethyl propanedioate Chemical compound CCOC(=O)CC(=O)OC(C)(C)C OCOBFMZGRJOSOU-UHFFFAOYSA-N 0.000 description 1
- GGNWBLGTJBNJRY-UHFFFAOYSA-N 3-oxo-4-phenoxybutanoic acid Chemical compound OC(=O)CC(=O)COC1=CC=CC=C1 GGNWBLGTJBNJRY-UHFFFAOYSA-N 0.000 description 1
- ILKNNHYSEPMBSD-UHFFFAOYSA-N 4-methoxyphenol Chemical compound COC1=CC=C(O)C=C1.COC1=CC=C(O)C=C1 ILKNNHYSEPMBSD-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- OHLRLMWUFVDREV-UHFFFAOYSA-N ethyl 4-chloro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)CCl OHLRLMWUFVDREV-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical class COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH591672A CH570354A5 (cg-RX-API-DMAC10.html) | 1972-04-21 | 1972-04-21 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2318786A1 DE2318786A1 (de) | 1973-10-31 |
| DE2318786B2 DE2318786B2 (de) | 1981-01-22 |
| DE2318786C3 true DE2318786C3 (de) | 1982-02-04 |
Family
ID=4301477
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732318786 Expired DE2318786C3 (de) | 1972-04-21 | 1973-04-13 | Verfahren zur Herstellung von γ-Aryloxyacetessigestern |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS4914436A (cg-RX-API-DMAC10.html) |
| AT (1) | AT322540B (cg-RX-API-DMAC10.html) |
| BE (1) | BE798554A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1007652A (cg-RX-API-DMAC10.html) |
| CH (1) | CH570354A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS163297B2 (cg-RX-API-DMAC10.html) |
| DD (1) | DD106031A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2318786C3 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2181087B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1361379A (cg-RX-API-DMAC10.html) |
| IT (1) | IT980278B (cg-RX-API-DMAC10.html) |
| LU (1) | LU67470A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7305362A (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5283422A (en) * | 1975-12-31 | 1977-07-12 | Kissei Pharmaceut Co Ltd | Preparation of phenoxyacetic acid ester derivatives |
| ATE13289T1 (de) * | 1981-10-01 | 1985-06-15 | Lonza Ag | Verfahren zur herstellung von 4alkoxyacetessigestern. |
| ATE11037T1 (de) * | 1981-10-01 | 1985-01-15 | Lonza Ag | Verfahren zur herstellung von 4alkoxyacetessigestern. |
-
1972
- 1972-04-21 CH CH591672A patent/CH570354A5/xx not_active IP Right Cessation
-
1973
- 1973-04-12 GB GB1759173A patent/GB1361379A/en not_active Expired
- 1973-04-13 DE DE19732318786 patent/DE2318786C3/de not_active Expired
- 1973-04-17 NL NL7305362A patent/NL7305362A/xx not_active Application Discontinuation
- 1973-04-17 CS CS274873A patent/CS163297B2/cs unknown
- 1973-04-18 DD DD17027773A patent/DD106031A5/xx unknown
- 1973-04-19 IT IT4954073A patent/IT980278B/it active
- 1973-04-19 AT AT353573A patent/AT322540B/de not_active IP Right Cessation
- 1973-04-19 CA CA169,198A patent/CA1007652A/en not_active Expired
- 1973-04-20 FR FR7314692A patent/FR2181087B1/fr not_active Expired
- 1973-04-20 LU LU67470D patent/LU67470A1/xx unknown
- 1973-04-20 BE BE130284A patent/BE798554A/xx not_active IP Right Cessation
- 1973-04-20 JP JP4565473A patent/JPS4914436A/ja active Pending
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4914436A (cg-RX-API-DMAC10.html) | 1974-02-07 |
| DE2318786B2 (de) | 1981-01-22 |
| CH570354A5 (cg-RX-API-DMAC10.html) | 1975-12-15 |
| AT322540B (de) | 1975-05-26 |
| DD106031A5 (cg-RX-API-DMAC10.html) | 1974-05-20 |
| CS163297B2 (cg-RX-API-DMAC10.html) | 1975-08-29 |
| DE2318786A1 (de) | 1973-10-31 |
| NL7305362A (cg-RX-API-DMAC10.html) | 1973-10-23 |
| BE798554A (fr) | 1973-10-22 |
| FR2181087B1 (cg-RX-API-DMAC10.html) | 1978-08-18 |
| IT980278B (it) | 1974-09-30 |
| FR2181087A1 (cg-RX-API-DMAC10.html) | 1973-11-30 |
| LU67470A1 (cg-RX-API-DMAC10.html) | 1973-10-23 |
| CA1007652A (en) | 1977-03-29 |
| GB1361379A (en) | 1974-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19949319A1 (de) | Verfahren zur Herstellung von Arylalkylethern | |
| DE2832532A1 (de) | Verfahren zur gewinnung von reinen 2-(perfluoralkyl)-aethanolen aus ihren gemischen mit 2-(perfluoralkyl)-aethylenen und gegebenenfalls 2-(perfluoralkyl)- aethylestern | |
| EP0082413B1 (de) | Verfahren zur Herstellung von 2-(Hydroxyphenoxy)-carbonsäureestern | |
| DE2902877A1 (de) | Verfahren zur herstellung von halogenierten benzonitrilen | |
| DE2244012C3 (de) | Verfahren zur Herstellung von Alkoxyacetessigestern | |
| DE2418715C2 (de) | Allensäureester | |
| DE2318786C3 (de) | Verfahren zur Herstellung von γ-Aryloxyacetessigestern | |
| EP0165521B1 (de) | Verfahren zur Herstellung eines Gemisches aus einem gegebenenfalls substituierten Zimtsäureester und einem gegebenenfalls substituierten Beta-Alkoxy-Beta-phenyl-propionsäureester sowie Verfahren zur Herstellung von gegebenenfalls substituierter Zimtsäure | |
| EP0064605B1 (de) | Verfahren zur Herstellung von Resorcinderivaten sowie Verwendung bestimmter Resorcinderivate als Riechstoffe | |
| EP0076378B1 (de) | Verfahren zur Herstellung von 4-Alkoxyacetessigestern | |
| EP1316546B1 (de) | Verfahren zur Herstellung von Beta-Ketonitrilen | |
| DE2533396C2 (de) | 3-Methyl-3-aryl-brenztraubensäureester und Verfahren zu ihrer Herstellung | |
| DE2404159C2 (de) | Verfahren zur Herstellung von 2-(4-Alkylphenyl)-propionsäuren und ihren Natrium-oder Kaliumsalzen | |
| DE19647117A1 (de) | Verfahren zur Herstellung gamma,delta-ungesättigten Ketonen durch Caroll-Reaktion in cyclischen Carbonaten oder gamma-Lactonen als Lösungsmittel | |
| DE2726393A1 (de) | Verfahren zur herstellung von 5- (quaternaeren-alkyl)resorcinen und zwischenprodukte hierfuer | |
| EP0028758B1 (de) | Verfahren zur Herstellung von Pivaloylbrenztraubensäurealkylestern und -cycloalkylestern | |
| DE3103308A1 (de) | Verfahren zur herstellung von (alpha)-hydroximethylenarylessigestern | |
| EP0076379B1 (de) | Verfahren zur Herstellung von 4-Alkoxyacetessigestern | |
| DE3037086A1 (de) | 3-(m-chloranilino-)acrylsaeureaethylester und ein verfahren zu dessen herstellung | |
| DE3441369A1 (de) | Verfahren zur herstellung von hydroxymethylen-alkoxyessigsaeureestern | |
| DE69611551T2 (de) | Herstellung von 6-brom-2-naphtholderivaten | |
| DE2734809A1 (de) | Verfahren zur herstellung von 2,3- dichlor-1-(c tief 1-7 )-alkoxybenzolen | |
| AT353774B (de) | Verfahren zur herstellung von hydrochinon- dialkylaethern | |
| EP0005472B1 (de) | Verfahren zur Herstellung substituierter gamma-Halogencarbonsäureester | |
| DE3046059C2 (de) | 4-Halogen-5,5-dialkoxypentansäureester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von 2,2-Dialkyl-3-formylcyclopropancarbonsäureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: VON FUENER, A., DIPL.-CHEM. DR.RER.NAT. EBBINGHAUS, D., DIPL.-ING., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |