DE2256275B2 - Harnstoffe, verfahren zu ihrer herstellung und herbicide zusammensetzungen - Google Patents
Harnstoffe, verfahren zu ihrer herstellung und herbicide zusammensetzungenInfo
- Publication number
- DE2256275B2 DE2256275B2 DE19722256275 DE2256275A DE2256275B2 DE 2256275 B2 DE2256275 B2 DE 2256275B2 DE 19722256275 DE19722256275 DE 19722256275 DE 2256275 A DE2256275 A DE 2256275A DE 2256275 B2 DE2256275 B2 DE 2256275B2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- urea
- general formula
- compound
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 title claims description 52
- 239000004202 carbamide Substances 0.000 title claims description 37
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title claims description 14
- 230000002363 herbicidal effect Effects 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000000460 chlorine Substances 0.000 claims description 54
- 150000001875 compounds Chemical class 0.000 claims description 37
- -1 ethylmercapto Chemical class 0.000 claims description 32
- 235000013877 carbamide Nutrition 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 8
- 239000012948 isocyanate Substances 0.000 claims description 7
- 150000002513 isocyanates Chemical class 0.000 claims description 7
- 150000003672 ureas Chemical class 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 210000002700 urine Anatomy 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 claims description 2
- TVEQKOSLTMJGQS-UHFFFAOYSA-N 1-ethylsulfanyl-1-methyl-3-[3-(trifluoromethyl)phenyl]urea Chemical compound CCSN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 TVEQKOSLTMJGQS-UHFFFAOYSA-N 0.000 claims 1
- PUKOPAHEBUGCII-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1-methyl-1-propan-2-ylsulfanylurea Chemical compound CC(C)SN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 PUKOPAHEBUGCII-UHFFFAOYSA-N 0.000 claims 1
- IUCVIQYDYIUNIO-UHFFFAOYSA-N 3-(3-chloro-4-methoxyphenyl)-1-ethylsulfanyl-1-methylurea Chemical compound CCSN(C)C(=O)NC1=CC=C(OC)C(Cl)=C1 IUCVIQYDYIUNIO-UHFFFAOYSA-N 0.000 claims 1
- ISMTXJJSGZMYDH-UHFFFAOYSA-N 3-(4-bromophenyl)-1-ethylsulfanyl-1-methylurea Chemical compound CCSN(C)C(=O)NC1=CC=C(Br)C=C1 ISMTXJJSGZMYDH-UHFFFAOYSA-N 0.000 claims 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 claims 1
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- 238000004458 analytical method Methods 0.000 description 22
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 238000003756 stirring Methods 0.000 description 19
- 238000004821 distillation Methods 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 241000196324 Embryophyta Species 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 14
- 239000000741 silica gel Substances 0.000 description 14
- 229910002027 silica gel Inorganic materials 0.000 description 14
- 229960001866 silicon dioxide Drugs 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 10
- 239000005573 Linuron Substances 0.000 description 10
- CYESCLHCWJKRKM-UHFFFAOYSA-N DCPU Natural products NC(=O)NC1=CC=C(Cl)C(Cl)=C1 CYESCLHCWJKRKM-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 9
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- IDQHRQQSSQDLTR-UHFFFAOYSA-N diuron-desmethyl Chemical compound CNC(=O)NC1=CC=C(Cl)C(Cl)=C1 IDQHRQQSSQDLTR-UHFFFAOYSA-N 0.000 description 6
- 239000007800 oxidant agent Substances 0.000 description 6
- 150000003457 sulfones Chemical class 0.000 description 6
- KWTCAZADHRCBIP-UHFFFAOYSA-N morpholin-4-yl thiohypochlorite Chemical compound ClSN1CCOCC1 KWTCAZADHRCBIP-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- UHMZHYUCMREDRI-UHFFFAOYSA-N ethyl thiohypochlorite Chemical compound CCSCl UHMZHYUCMREDRI-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 150000003462 sulfoxides Chemical class 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 3
- 240000002245 Acer pensylvanicum Species 0.000 description 3
- 244000000626 Daucus carota Species 0.000 description 3
- 235000002767 Daucus carota Nutrition 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- LUBBRUTUSIXJAL-UHFFFAOYSA-N 1-(chloromethylsulfonyl)-3-(3,4-dichlorophenyl)-1-methylurea Chemical compound ClCS(=O)(=O)N(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 LUBBRUTUSIXJAL-UHFFFAOYSA-N 0.000 description 2
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- SVHSGMUHOWTROJ-UHFFFAOYSA-N 1-butyl-1-(3,4-dichlorophenyl)-3-methylurea Chemical compound CCCCN(C(=O)NC)C1=CC=C(Cl)C(Cl)=C1 SVHSGMUHOWTROJ-UHFFFAOYSA-N 0.000 description 2
- YWHRNWZTCCNWSH-UHFFFAOYSA-N 3-(3-chloro-4-methoxylphenyl)-1-methylurea Chemical compound CNC(=O)NC1=CC=C(OC)C(Cl)=C1 YWHRNWZTCCNWSH-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- CETBSQOFQKLHHZ-UHFFFAOYSA-N Diethyl disulfide Chemical compound CCSSCC CETBSQOFQKLHHZ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- ALVPFGSHPUPROW-UHFFFAOYSA-N dipropyl disulfide Chemical compound CCCSSCCC ALVPFGSHPUPROW-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000004452 microanalysis Methods 0.000 description 2
- 239000003415 peat Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GAFWRUXZGSUTHS-UHFFFAOYSA-N (3-chloro-4-methylphenyl)urea Chemical compound CC1=CC=C(NC(N)=O)C=C1Cl GAFWRUXZGSUTHS-UHFFFAOYSA-N 0.000 description 1
- FYWJWWMKCARWQG-UHFFFAOYSA-N 1,2-dichloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1Cl FYWJWWMKCARWQG-UHFFFAOYSA-N 0.000 description 1
- CKKOPZCHWBZUSQ-UHFFFAOYSA-N 1-[[2-(3-bromo-4-ethoxyphenyl)acetyl]amino]-3-methylthiourea Chemical compound CCOC1=CC=C(CC(=O)NNC(=S)NC)C=C1Br CKKOPZCHWBZUSQ-UHFFFAOYSA-N 0.000 description 1
- GCFTXPIUTLJFKJ-UHFFFAOYSA-N 1-bromo-1-phenylurea Chemical compound NC(=O)N(Br)C1=CC=CC=C1 GCFTXPIUTLJFKJ-UHFFFAOYSA-N 0.000 description 1
- GVVIHPIQHJFMTM-UHFFFAOYSA-N 1-methyl-1-methylsulfonyl-3-[3-(trifluoromethyl)phenyl]urea Chemical compound CS(=O)(=O)N(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 GVVIHPIQHJFMTM-UHFFFAOYSA-N 0.000 description 1
- JZTOBGSCZLVBMZ-UHFFFAOYSA-N 1-methyl-1-morpholin-4-ylsulfanyl-3-[3-(trifluoromethyl)phenyl]urea Chemical compound C=1C=CC(C(F)(F)F)=CC=1NC(=O)N(C)SN1CCOCC1 JZTOBGSCZLVBMZ-UHFFFAOYSA-N 0.000 description 1
- YJEMCKWPSRVQFL-UHFFFAOYSA-N 1-tert-butylsulfanyl-3-(3,4-dichlorophenyl)-1-methylurea Chemical compound CC(C)(C)SN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 YJEMCKWPSRVQFL-UHFFFAOYSA-N 0.000 description 1
- RPAJWWXZIQJVJF-UHFFFAOYSA-N 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfinylphenol Chemical compound OC1=C(Cl)C=C(Cl)C=C1S(=O)C1=CC(Cl)=CC(Cl)=C1O RPAJWWXZIQJVJF-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- MFUVCHZWGSJKEQ-UHFFFAOYSA-N 3,4-dichlorphenylisocyanate Chemical compound ClC1=CC=C(N=C=O)C=C1Cl MFUVCHZWGSJKEQ-UHFFFAOYSA-N 0.000 description 1
- PQORFRJFBPYIHN-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1-methyl-1-propylsulfanylurea Chemical compound CCCSN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 PQORFRJFBPYIHN-UHFFFAOYSA-N 0.000 description 1
- SYEIFOJHOPCOOR-UHFFFAOYSA-N 3-(3-chloro-4-methylphenyl)-1-ethylsulfanyl-1-methylurea Chemical compound CCSN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 SYEIFOJHOPCOOR-UHFFFAOYSA-N 0.000 description 1
- GUMFWXBSFOHZDC-UHFFFAOYSA-N 3-(3-chloro-4-methylphenyl)-1-methylurea Chemical compound CNC(=O)NC1=CC=C(C)C(Cl)=C1 GUMFWXBSFOHZDC-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 241000208838 Asteraceae Species 0.000 description 1
- 235000021537 Beetroot Nutrition 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- CUDSBWGCGSUXDB-UHFFFAOYSA-N Dibutyl disulfide Chemical compound CCCCSSCCCC CUDSBWGCGSUXDB-UHFFFAOYSA-N 0.000 description 1
- LZAZXBXPKRULLB-UHFFFAOYSA-N Diisopropyl disulfide Chemical compound CC(C)SSC(C)C LZAZXBXPKRULLB-UHFFFAOYSA-N 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HTJMVIQSJWQKEM-UHFFFAOYSA-N N-(2,2-dimethylpropyl)thiohydroxylamine Chemical compound N(S)CC(C)(C)C HTJMVIQSJWQKEM-UHFFFAOYSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 241001085205 Prenanthella exigua Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- FQEIBEOBXKJAMZ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]urea Chemical compound NC(=O)NC1=CC=CC(C(F)(F)F)=C1 FQEIBEOBXKJAMZ-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- GVXYYRZMASRTPS-UHFFFAOYSA-N dimethylsulfanium chloride Chemical compound [Cl-].C[SH+]C GVXYYRZMASRTPS-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- LRCFXGAMWKDGLA-UHFFFAOYSA-N dioxosilane;hydrate Chemical compound O.O=[Si]=O LRCFXGAMWKDGLA-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- DDCYYCUMAFYDDU-UHFFFAOYSA-N methyl thiohypochlorite Chemical compound CSCl DDCYYCUMAFYDDU-UHFFFAOYSA-N 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QPBGVICDOBKDAS-UHFFFAOYSA-N n-butyl-3,4-dichloroaniline Chemical compound CCCCNC1=CC=C(Cl)C(Cl)=C1 QPBGVICDOBKDAS-UHFFFAOYSA-N 0.000 description 1
- ZAZJZCVQFZPMMO-UHFFFAOYSA-N n-methyl-n-methylsulfonylcarbamoyl chloride Chemical compound ClC(=O)N(C)S(C)(=O)=O ZAZJZCVQFZPMMO-UHFFFAOYSA-N 0.000 description 1
- UHNHTTIUNATJKL-UHFFFAOYSA-N n-methylmethanesulfonamide Chemical compound CNS(C)(=O)=O UHNHTTIUNATJKL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- DRINJBFRTLBHNF-UHFFFAOYSA-N propane-2-sulfonyl chloride Chemical compound CC(C)S(Cl)(=O)=O DRINJBFRTLBHNF-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229960004029 silicic acid Drugs 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/02—Sulfinic acids; Derivatives thereof
- C07C313/06—Sulfinamides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/55—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/08—Sulfenic acids; Derivatives thereof
- C07C313/18—Sulfenamides
- C07C313/26—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C313/30—Y being a hetero atom
- C07C313/34—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfenylureas
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/28—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7141102A FR2161767B1 (enExample) | 1971-11-17 | 1971-11-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2256275A1 DE2256275A1 (de) | 1973-05-24 |
| DE2256275B2 true DE2256275B2 (de) | 1976-09-09 |
Family
ID=9085897
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722256275 Granted DE2256275B2 (de) | 1971-11-17 | 1972-11-16 | Harnstoffe, verfahren zu ihrer herstellung und herbicide zusammensetzungen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4045209A (enExample) |
| JP (1) | JPS4861453A (enExample) |
| BE (1) | BE791449A (enExample) |
| CA (1) | CA981262A (enExample) |
| CH (2) | CH561010A5 (enExample) |
| DE (1) | DE2256275B2 (enExample) |
| DK (1) | DK141820B (enExample) |
| FR (1) | FR2161767B1 (enExample) |
| GB (1) | GB1385397A (enExample) |
| IT (1) | IT973598B (enExample) |
| NL (1) | NL7215496A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0590555A1 (de) * | 1992-10-01 | 1994-04-06 | BASF Aktiengesellschaft | Verfahren zur Herstellung von aromatischen Harnstoffen, die eine Thioeter-oder Sulfonylgruppe aufweisen |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2297212A1 (fr) * | 1975-01-13 | 1976-08-06 | Stauffer Chemical Co | Composes nouveaux consistant en des thiomethyl aryl urees et leur application en tant qu'herbicides |
| AU503917B1 (en) * | 1977-05-23 | 1979-09-27 | Nippon Soda Co., Ltd. | Cyclohexane-1, 3-dione derivatives |
| US4090864A (en) * | 1977-05-31 | 1978-05-23 | Stauffer Chemical Company | Herbicidal acetamidothiomethyl ureas |
| US4365990A (en) * | 1979-09-21 | 1982-12-28 | Stauffer Chemical Company | Sulfonylurea herbicidal antidotes |
| US5216026A (en) * | 1990-07-17 | 1993-06-01 | Eli Lilly And Company | Antitumor compositions and methods of treatment |
| DE4107692A1 (de) * | 1991-03-09 | 1992-09-17 | Basf Ag | Verdoppelte phenylazo- oder naphthylazobenzole mit mehreren reaktiven gruppen sowie deren zwischenprodukte |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3124447A (en) * | 1964-03-10 | Herbicidal ratingxco n nveesion scale | ||
| US3112342A (en) * | 1960-10-03 | 1963-11-26 | Du Pont | 1-methoxy-1-methyl-3-(3-chloro-4-cumenyl) urea |
| NL134755C (enExample) * | 1961-01-19 | |||
| US3276855A (en) * | 1962-01-04 | 1966-10-04 | Velsicol Chemical Corp | N-alkylmercapto-ureas and a method for controlling weeds |
| US3288586A (en) * | 1963-11-07 | 1966-11-29 | Du Pont | Herbicidal methods employing an addition compound of 3-(3, 4-dichlorophenyl)-1-methyl-1-methoxyurea and dodecylbenzenesulfonic acid |
| US3502705A (en) * | 1967-06-26 | 1970-03-24 | Chevron Res | N-carboxyacyl-n'-hydrocarbylthio ureas |
| CH505071A (de) * | 1968-04-26 | 1971-03-31 | Hoffmann La Roche | Verfahren zur Herstellung von Sulfonylharnstoffderivaten |
| US3652630A (en) * | 1969-01-07 | 1972-03-28 | Chevron Res | N-polyhalovinylthio ureas |
| BE758433A (fr) * | 1969-10-13 | 1971-05-04 | Ciba Geigy | N-o-fluorophenylurees, leur preparation et leur utilisation comme pesticides. |
| US3697572A (en) * | 1970-05-28 | 1972-10-10 | Chevron Res | N-aryl-n'alkyl-n'arylthio ureas as herbicides |
| US3812209A (en) * | 1970-11-09 | 1974-05-21 | Chevron Res | 1-hydrocarbyldithio-3-aryl ureas |
-
0
- BE BE791449D patent/BE791449A/xx unknown
-
1971
- 1971-11-17 FR FR7141102A patent/FR2161767B1/fr not_active Expired
-
1972
- 1972-11-01 CH CH734674A patent/CH561010A5/xx not_active IP Right Cessation
- 1972-11-01 CH CH1592672A patent/CH561690A5/xx not_active IP Right Cessation
- 1972-11-16 NL NL7215496A patent/NL7215496A/xx not_active Application Discontinuation
- 1972-11-16 IT IT54089/72A patent/IT973598B/it active
- 1972-11-16 JP JP47114346A patent/JPS4861453A/ja active Pending
- 1972-11-16 DE DE19722256275 patent/DE2256275B2/de active Granted
- 1972-11-16 CA CA156,682A patent/CA981262A/en not_active Expired
- 1972-11-17 GB GB5330472A patent/GB1385397A/en not_active Expired
- 1972-11-17 DK DK572772AA patent/DK141820B/da unknown
-
1975
- 1975-09-22 US US05/615,401 patent/US4045209A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0590555A1 (de) * | 1992-10-01 | 1994-04-06 | BASF Aktiengesellschaft | Verfahren zur Herstellung von aromatischen Harnstoffen, die eine Thioeter-oder Sulfonylgruppe aufweisen |
Also Published As
| Publication number | Publication date |
|---|---|
| US4045209A (en) | 1977-08-30 |
| DE2256275A1 (de) | 1973-05-24 |
| DK141820B (da) | 1980-06-23 |
| IT973598B (it) | 1974-06-10 |
| CA981262A (en) | 1976-01-06 |
| GB1385397A (en) | 1975-02-26 |
| CH561690A5 (enExample) | 1975-05-15 |
| DK141820C (enExample) | 1980-11-24 |
| JPS4861453A (enExample) | 1973-08-28 |
| CH561010A5 (enExample) | 1975-04-30 |
| FR2161767B1 (enExample) | 1974-05-31 |
| FR2161767A1 (enExample) | 1973-07-13 |
| NL7215496A (enExample) | 1973-05-21 |
| BE791449A (fr) | 1973-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69028461T2 (de) | Triazin-derivate und unkrautvertilgungsmittel daraus | |
| DE60127772T2 (de) | Derivate von Phenyl(thio)harnstoff und Phenyl(thio)carbamat Fungiziden | |
| EP0306696A1 (de) | Substituierte Guanidine | |
| EP0096003B2 (de) | Neue Sulfonyl(thio)harnstoffe, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und/oder Wachstumsregulatoren | |
| DE112020001084T5 (de) | Arylsulfid mit Benzylaminstruktur und dessen Syntheseverfahren und Anwendung | |
| EP0244360A2 (de) | Substituierte Pyrimidine | |
| DE69126836T2 (de) | Herbizide | |
| DD285921A5 (de) | Mittel mit herbizider und pflanzenwuchsregulierender wirkung | |
| DE3750857T2 (de) | Imidazolsulfonamid-Derivate, Herbizide und Verfahren zur Bekämpfung von Schadpflanzen. | |
| CH640108A5 (de) | Unkrautvernichtungsmittel. | |
| DE2256275B2 (de) | Harnstoffe, verfahren zu ihrer herstellung und herbicide zusammensetzungen | |
| DE2543888C3 (de) | l-Phenyl-S-alkyl-S-benzylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| EP0056969B1 (de) | Substituierte Phenylsulfonylharnstoff-Derivate, Verfahren und neue Zwischenprodukte zu deren Herstellung sowie diese Derivate als Wirkstoffe enthaltende herbizide Mittel | |
| CH637636A5 (de) | Phenylisothiocyanate, verfahren zu ihrer herstellung und diese enthaltende fungizide praeparate. | |
| EP0129764A2 (de) | Substituierte Phenylsulfonylguanidin-Derivate | |
| EP0136455A1 (de) | Substituierte Phenylsulfonylguanidin-Derivate | |
| EP0122231B1 (de) | Herbizides Mittel | |
| DE2554866A1 (de) | Fungizide zusammensetzung | |
| EP0141319B1 (de) | Substituierte Phenoxyalkancarbonsäureester | |
| EP0075172B1 (de) | N-Sulfenylierte Benzylsulfonamide, ein Verfahren und ihre Verwendung als Mikrobizide | |
| EP0062254A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE69123761T2 (de) | Sulfamidosulfonamidderivate und herbizide | |
| EP0097614B1 (de) | Schädlingsbekämpfungsmittel | |
| DE2050979C2 (de) | 3-(5-Sulfamoyl-1,3,4-thiadiazol-2-yl)-harnstoffverbindungen | |
| EP0153601A1 (de) | 2-Alkoxyaminosulfonylbenzolsulfonyl-harnstoff-Derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |