DE2249859B2 - Integrierte Verstärkerschalung - Google Patents
Integrierte VerstärkerschalungInfo
- Publication number
- DE2249859B2 DE2249859B2 DE2249859A DE2249859A DE2249859B2 DE 2249859 B2 DE2249859 B2 DE 2249859B2 DE 2249859 A DE2249859 A DE 2249859A DE 2249859 A DE2249859 A DE 2249859A DE 2249859 B2 DE2249859 B2 DE 2249859B2
- Authority
- DE
- Germany
- Prior art keywords
- stage
- input
- amplifier
- compensation
- transistor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000009415 formwork Methods 0.000 title 1
- 239000003990 capacitor Substances 0.000 claims description 23
- 230000003321 amplification Effects 0.000 claims description 12
- 238000003199 nucleic acid amplification method Methods 0.000 claims description 12
- 239000000758 substrate Substances 0.000 claims description 8
- 239000004065 semiconductor Substances 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 3
- 241000158147 Sator Species 0.000 claims description 2
- 238000010079 rubber tapping Methods 0.000 claims 4
- 230000005540 biological transmission Effects 0.000 description 4
- 238000010586 diagram Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000006866 deterioration Effects 0.000 description 3
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F3/00—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements
- H03F3/45—Differential amplifiers
- H03F3/45071—Differential amplifiers with semiconductor devices only
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Amplifiers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27076572A | 1972-07-11 | 1972-07-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2249859A1 DE2249859A1 (de) | 1974-01-17 |
| DE2249859B2 true DE2249859B2 (de) | 1975-01-02 |
Family
ID=23032704
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2249859A Withdrawn DE2249859B2 (de) | 1972-07-11 | 1972-10-11 | Integrierte Verstärkerschalung |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3801923A (enExample) |
| JP (1) | JPS5436447B2 (enExample) |
| DE (1) | DE2249859B2 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2821549A1 (de) * | 1977-05-18 | 1978-11-23 | Hitachi Ltd | Mehrstufen-verstaerkerschaltung |
| DE3445167A1 (de) * | 1983-12-14 | 1985-06-27 | National Semiconductor Corp., Santa Clara, Calif. | Totempoltransistor-ausgangsstufenschaltung |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4028564A (en) * | 1971-09-22 | 1977-06-07 | Robert Bosch G.M.B.H. | Compensated monolithic integrated current source |
| NL7505506A (nl) * | 1974-05-15 | 1975-11-18 | Analog Devices Inc | Transistorversterker van het darlington-type. |
| JPS6031124B2 (ja) * | 1975-10-21 | 1985-07-20 | 日本電信電話株式会社 | 演算増巾器 |
| US4034306A (en) * | 1976-04-16 | 1977-07-05 | Linear Technology Inc. | D.C. amplifier for use with low supply voltage |
| DE2905629C3 (de) * | 1978-02-15 | 1981-11-26 | Hitachi, Ltd., Tokyo | Differenzverstärker |
| US4157512A (en) * | 1978-04-07 | 1979-06-05 | Raytheon Company | Electronic circuitry having transistor feedbacks and lead networks compensation |
| JPS55679A (en) * | 1979-02-07 | 1980-01-07 | Hitachi Ltd | Differential amplifier circuit |
| DE3035720C2 (de) * | 1980-09-22 | 1990-12-06 | Vitalij Vasil'evič Andrianov | Als integrierter Schaltkreis aufgebauter Leistungsverstärker für Tonbandgeräte |
| US4453134A (en) * | 1981-08-24 | 1984-06-05 | International Telephone And Telegraph Corporation | High voltage operational amplifier |
| JPS5943612A (ja) * | 1982-09-04 | 1984-03-10 | Nippon Shiguneteitsukusu Kk | 演算増幅回路 |
| EP0586730B1 (de) * | 1992-09-09 | 1998-01-21 | Siemens Aktiengesellschaft | Schaltungsanordnung zum Umformen eines symmetrischen gegenphasigen Eingangssignales in ein unsymmetrisches einphasiges Ausgangssignal |
| US6614285B2 (en) * | 1998-04-03 | 2003-09-02 | Cirrus Logic, Inc. | Switched capacitor integrator having very low power and low distortion and noise |
| US7388436B2 (en) * | 2005-11-02 | 2008-06-17 | Marvell World Trade Ltd | High-bandwidth high-gain amplifier |
| US9698760B1 (en) * | 2014-01-31 | 2017-07-04 | Marvell International Ltd. | Continuous-time analog delay device |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3538449A (en) * | 1968-11-22 | 1970-11-03 | Motorola Inc | Lateral pnp-npn composite monolithic differential amplifier |
| US3670253A (en) * | 1970-06-18 | 1972-06-13 | Arthur L Newcomb Jr | A.c. power amplifier |
| US3673508A (en) * | 1970-08-10 | 1972-06-27 | Texas Instruments Inc | Solid state operational amplifier |
| US3699464A (en) * | 1971-02-25 | 1972-10-17 | Motorola Inc | Deadband amplifier circuit |
-
1972
- 1972-07-11 US US00270765A patent/US3801923A/en not_active Expired - Lifetime
- 1972-10-11 DE DE2249859A patent/DE2249859B2/de not_active Withdrawn
- 1972-12-06 JP JP12236872A patent/JPS5436447B2/ja not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2821549A1 (de) * | 1977-05-18 | 1978-11-23 | Hitachi Ltd | Mehrstufen-verstaerkerschaltung |
| DE3445167A1 (de) * | 1983-12-14 | 1985-06-27 | National Semiconductor Corp., Santa Clara, Calif. | Totempoltransistor-ausgangsstufenschaltung |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4939352A (enExample) | 1974-04-12 |
| JPS5436447B2 (enExample) | 1979-11-09 |
| US3801923A (en) | 1974-04-02 |
| DE2249859A1 (de) | 1974-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2249859B2 (de) | Integrierte Verstärkerschalung | |
| DE2851410C3 (de) | Elektronische Umschalteinrichtung | |
| DE1901804B2 (de) | Stabilisierter differentialverstaerker | |
| DE102004027298B4 (de) | Auf dem Chip ausgeführter Hochpassfilter mit großer Zeitkonstanten | |
| DE4001064A1 (de) | Rauscharmer hochgeschwindigkeitsdifferentialverstaerker und verfahren zum erzielen einer rauscharmen hochgeschwindigkeitsverstaerkung eines differentialeingangssignales | |
| AT392375B (de) | Elektronische schaltung mit einem geschuetzten transistor | |
| DE1958620B2 (de) | Differentialverstaerker | |
| DE3824556C2 (de) | Symmetrische Eingangsschaltung für Hochfrequenzverstärker | |
| DE1909721A1 (de) | Elektrische Schaltung zur Erzeugung von Vorspannungen | |
| DE2708055A1 (de) | Direkt koppelnder leistungsverstaerker | |
| EP0237086B1 (de) | Stromspiegelschaltung | |
| EP0334447A2 (de) | Schmitt-Trigger-Schaltung | |
| DE69318884T2 (de) | Abtast- und Haltschaltkreis mit ganzem Signalmodulationsausgleich unter Verwendung von bipolaren Transistoren eines Typs | |
| WO2018215030A1 (de) | Transimpedanzverstärker-schaltung | |
| EP0013943B1 (de) | Monolithisch integrierbare Tiefpass-Filterschaltung | |
| DE3136910A1 (de) | Signalunterbrechungsschaltung | |
| DE2635574C3 (de) | Stromspiegelschaltung | |
| DE2648080A1 (de) | Breitbandverstaerker | |
| DE2908741A1 (de) | Hf-breitbandverstaerker | |
| DE2151050A1 (de) | Differential-triggerschaltung | |
| DE2706574C2 (de) | Spannungsgesteuerte Verstärkerschaltung | |
| DE3408284C1 (de) | Unipolarer Stromverstärker für Fotodioden | |
| DE1537590A1 (de) | Differentialverstaerkerschaltung | |
| DE3146600A1 (de) | Ringstromquelle | |
| DE4003462A1 (de) | Verfahren fuer einen leistungsverstaerker mit geringer phasendrehung, insbesondere fuer eine variable induktive last |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8230 | Patent withdrawn |