DE2217581A1 - Elektronenfangschirm - Google Patents
ElektronenfangschirmInfo
- Publication number
- DE2217581A1 DE2217581A1 DE19722217581 DE2217581A DE2217581A1 DE 2217581 A1 DE2217581 A1 DE 2217581A1 DE 19722217581 DE19722217581 DE 19722217581 DE 2217581 A DE2217581 A DE 2217581A DE 2217581 A1 DE2217581 A1 DE 2217581A1
- Authority
- DE
- Germany
- Prior art keywords
- electron
- screen
- screen according
- flange
- frame
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005264 electron capture Effects 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 238000003466 welding Methods 0.000 claims description 3
- 230000005294 ferromagnetic effect Effects 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 239000011521 glass Substances 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 230000005291 magnetic effect Effects 0.000 description 4
- 230000006378 damage Effects 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 2
- 241001233037 catfish Species 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 239000000696 magnetic material Substances 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NMFHJNAPXOMSRX-PUPDPRJKSA-N [(1r)-3-(3,4-dimethoxyphenyl)-1-[3-(2-morpholin-4-ylethoxy)phenyl]propyl] (2s)-1-[(2s)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidine-2-carboxylate Chemical compound C([C@@H](OC(=O)[C@@H]1CCCCN1C(=O)[C@@H](CC)C=1C=C(OC)C(OC)=C(OC)C=1)C=1C=C(OCCN2CCOCC2)C=CC=1)CC1=CC=C(OC)C(OC)=C1 NMFHJNAPXOMSRX-PUPDPRJKSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000010893 electron trap Methods 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- 239000003302 ferromagnetic material Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000005415 magnetization Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/02—Electrodes; Screens; Mounting, supporting, spacing or insulating thereof
- H01J29/06—Screens for shielding; Masks interposed in the electron stream
Landscapes
- Electrodes For Cathode-Ray Tubes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81724369A | 1969-04-04 | 1969-04-04 | |
| IT4981471 | 1971-04-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2217581A1 true DE2217581A1 (de) | 1972-11-02 |
Family
ID=26329388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722217581 Pending DE2217581A1 (de) | 1969-04-04 | 1972-04-12 | Elektronenfangschirm |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3549932A (enrdf_load_stackoverflow) |
| DE (1) | DE2217581A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2133757B1 (enrdf_load_stackoverflow) |
| NL (1) | NL7205106A (enrdf_load_stackoverflow) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3737703A (en) * | 1970-07-31 | 1973-06-05 | Tokyo Shibaura Electric Co | Shadow mask frame construction |
| US3822453A (en) * | 1970-12-07 | 1974-07-09 | Rca Corp | Method of making cathode ray tube internal shields |
| US3700949A (en) * | 1971-01-21 | 1972-10-24 | Nippon Electric Co | Color television picture tube |
| FR2162065B1 (enrdf_load_stackoverflow) * | 1971-11-30 | 1977-08-26 | Hitachi Ltd | |
| US3808492A (en) * | 1971-12-21 | 1974-04-30 | Hitachi Ltd | Support frame for color selection electrode in color picture tube |
| JPS496876A (enrdf_load_stackoverflow) * | 1972-04-14 | 1974-01-22 | ||
| JPS48104461A (enrdf_load_stackoverflow) * | 1972-04-14 | 1973-12-27 | ||
| JPS494564U (enrdf_load_stackoverflow) * | 1972-04-14 | 1974-01-16 | ||
| JPS5320993Y2 (enrdf_load_stackoverflow) * | 1972-08-09 | 1978-06-02 | ||
| JPS4988467A (enrdf_load_stackoverflow) * | 1972-12-25 | 1974-08-23 | ||
| JPS502258U (enrdf_load_stackoverflow) * | 1973-05-02 | 1975-01-10 | ||
| US3867668A (en) * | 1973-11-29 | 1975-02-18 | Rca Corp | Cathode-ray tube having an internal-external magnetic shield and degaussing combination |
| JPS5536928Y2 (enrdf_load_stackoverflow) * | 1974-04-19 | 1980-08-30 | ||
| US3876898A (en) * | 1974-06-27 | 1975-04-08 | Gte Sylvania Inc | Shielding means for a cathode ray tube |
| US3969648A (en) * | 1974-09-03 | 1976-07-13 | Advent Corporation | Projection television tube system |
| JPS6032304B2 (ja) * | 1978-02-17 | 1985-07-27 | 日本電気株式会社 | カラ−受像管 |
| US4694216A (en) * | 1986-05-27 | 1987-09-15 | Rca Corporation | Cathode-ray tube having an internal magnetic shield |
| US5391957A (en) * | 1992-12-28 | 1995-02-21 | Zenith Electronics Corporation | Vibration damping means for a strip shadow mask |
| KR20040111690A (ko) * | 2002-05-24 | 2004-12-31 | 코닌클리케 필립스 일렉트로닉스 엔.브이. | 음극선관용 내부 자기 실드 |
-
1969
- 1969-04-04 US US817243A patent/US3549932A/en not_active Expired - Lifetime
-
1972
- 1972-04-12 DE DE19722217581 patent/DE2217581A1/de active Pending
- 1972-04-14 FR FR7213231A patent/FR2133757B1/fr not_active Expired
- 1972-04-14 NL NL7205106A patent/NL7205106A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3549932A (en) | 1970-12-22 |
| FR2133757B1 (enrdf_load_stackoverflow) | 1975-06-20 |
| NL7205106A (enrdf_load_stackoverflow) | 1972-10-19 |
| FR2133757A1 (enrdf_load_stackoverflow) | 1972-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2217581A1 (de) | Elektronenfangschirm | |
| DD243369A5 (de) | Elektronenstrahlroehre mit einer inneren magnetischen abschirmung | |
| AT259640B (de) | Farbfernseh-Bildröhre | |
| DE69504778T2 (de) | Farbbildröhre | |
| DE2416509A1 (de) | Magnetische korrektionsanordnung fuer eine kathodenstrahlroehre | |
| DE758468C (de) | Speichernde Bildsenderoehre, deren Mosaikelektrode mit langsamen Elektronen abgetastet wird | |
| DE2849416C2 (de) | Farbbildröhre mit magnetischer Abschirmkappe | |
| DE2114310B2 (de) | Kathodenstrahl-bildroehre | |
| DE2513281C2 (de) | Mehrstrahl-Elektronenstrahlerzeugungssystem für Farbkathodenstrahlröhren | |
| DE569580C (de) | Glimmverstaerkerroehre | |
| EP0138264A2 (de) | Farbbildwiedergaberöhre | |
| DE875243C (de) | Kathodenstrahlroehre | |
| DE2258720B2 (de) | Farbkathodenstrahlroehre mit nachbeschleunigung | |
| AT137430B (de) | Glimmlichtverstärkerröhre. | |
| DE897595C (de) | Entladungsroehre mit doppelter Steuerung des Entladungsstromes | |
| DE918824C (de) | Elektronenstrahloszillograph fuer Mehrfachaufnahmen mit in Strahlrichtung hinter dem Ablenksystem angeordneter, mit diesem eine kombinierte Linse bildender Elektrode | |
| DE1005200B (de) | Elektrodenvorsystem fuer Elektronenstrahlroehren, insbesondere Fernsehbildroehren | |
| DE1220526B (de) | Magnetisches Ablenksystem fuer Kathodenstrahlroehren | |
| DE615625C (de) | Glimmverstaerkerroehre | |
| AT166411B (de) | Elektrische Entladungsröhre | |
| AT142994B (de) | Hochspannungsentladungsgefäß mit gerichtetem Elektronenbündel, insbesondere Röntgenröhre. | |
| DE2206427C3 (de) | Vorrichtung zum Belichten einer auf die Innenfläche einer Bildröhrenfrontplatte aufgebrachten lichtempfindlichen Schicht | |
| DE841176C (de) | Elektronenroehre mit Leuchtschirm | |
| DE674522C (de) | Ablenkplattensystem fuer Braunsche Roehren, insbesondere fuer Fernsehzwecke | |
| DE1512571A1 (de) | Elektronenstrahlroehre mit einer Zielelektrode nach Art eines Leuchtschirmes |