DE2206011A1 - 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung - Google Patents
1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendungInfo
- Publication number
- DE2206011A1 DE2206011A1 DE2206011A DE2206011A DE2206011A1 DE 2206011 A1 DE2206011 A1 DE 2206011A1 DE 2206011 A DE2206011 A DE 2206011A DE 2206011 A DE2206011 A DE 2206011A DE 2206011 A1 DE2206011 A1 DE 2206011A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- acyl
- aminosulfonyl
- imino
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 11
- 230000000855 fungicidal effect Effects 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- 241000233866 Fungi Species 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 239000004606 Fillers/Extenders Substances 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 3
- 239000000417 fungicide Substances 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000001266 acyl halides Chemical class 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000007981 azolines Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- RDXVLCGHLINORZ-UHFFFAOYSA-N 2-aminobenzimidazole-1-sulfonamide Chemical class NS(=O)(=O)N1C(=NC2=C1C=CC=C2)N RDXVLCGHLINORZ-UHFFFAOYSA-N 0.000 claims 1
- AEKNYBWUEYNWMJ-QWOOXDRHSA-N Pramiconazole Chemical group O=C1N(C(C)C)CCN1C1=CC=C(N2CCN(CC2)C=2C=CC(OC[C@@H]3O[C@](CN4N=CN=C4)(CO3)C=3C(=CC(F)=CC=3)F)=CC=2)C=C1 AEKNYBWUEYNWMJ-QWOOXDRHSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 30
- 241000196324 Embryophyta Species 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 206010061217 Infestation Diseases 0.000 description 11
- -1 methoxy, ethoxy, isopropoxy Chemical group 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 230000009885 systemic effect Effects 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- JBAOXNRYELBOKN-UHFFFAOYSA-N 2-amino-n,n-dimethylbenzimidazole-1-sulfonamide Chemical compound C1=CC=C2N(S(=O)(=O)N(C)C)C(N)=NC2=C1 JBAOXNRYELBOKN-UHFFFAOYSA-N 0.000 description 5
- 241000227653 Lycopersicon Species 0.000 description 5
- 241000233614 Phytophthora Species 0.000 description 5
- 150000001556 benzimidazoles Chemical class 0.000 description 5
- 239000002270 dispersing agent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 241000233622 Phytophthora infestans Species 0.000 description 4
- 125000002877 alkyl aryl group Chemical group 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- JWYUFVNJZUSCSM-UHFFFAOYSA-N 2-aminobenzimidazole Chemical compound C1=CC=C2NC(N)=NC2=C1 JWYUFVNJZUSCSM-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- GZDFHIJNHHMENY-UHFFFAOYSA-N Dimethyl dicarbonate Chemical compound COC(=O)OC(=O)OC GZDFHIJNHHMENY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 235000010300 dimethyl dicarbonate Nutrition 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000002464 fungitoxic effect Effects 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- PWZKLYAAEFVOTR-UHFFFAOYSA-N 2-amino-N,N-diethylbenzimidazole-1-sulfonamide Chemical compound C(C)N(S(=O)(=O)N1C(=NC2=C1C=CC=C2)N)CC PWZKLYAAEFVOTR-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical class NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 231100000162 fungitoxic Toxicity 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- XDXIDHANDJYSQA-UHFFFAOYSA-N n,n-dimethylbenzimidazole-1-sulfonamide Chemical compound C1=CC=C2N(S(=O)(=O)N(C)C)C=NC2=C1 XDXIDHANDJYSQA-UHFFFAOYSA-N 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE795099D BE795099A (fr) | 1972-02-09 | Nouvelles 1-acyl-3-aminosulfonyl-2-imino-benzimidazolines, leur procede de preparation et leur application comme fongicides | |
| DE2206011A DE2206011A1 (de) | 1972-02-09 | 1972-02-09 | 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung |
| US00329000A US3850954A (en) | 1972-02-09 | 1973-02-02 | 1-acyl-3-aminosulfonyl-2-imino-benzimidazolines |
| RO7300073743A RO62817A (fr) | 1972-02-09 | 1973-02-06 | Procede pour la preparation des 1-acyle-3-aminosulfonyle-2-benzimidazoles |
| NL7301664A NL7301664A (enExample) | 1972-02-09 | 1973-02-06 | |
| IL41469A IL41469A0 (en) | 1972-02-09 | 1973-02-06 | 1-acyl-3-aminosulphonyl-2-iminobenzimidazolines,their production and their use as fungicides |
| BR73921A BR7300921D0 (pt) | 1972-02-09 | 1973-02-07 | Processo para a preparacao de l-acil-3-aminos-sulfonil-2-imino-benzimidazolinas e composicao fungicida a base desta |
| TR17131A TR17131A (tr) | 1972-02-09 | 1973-02-07 | 1-asil-3-aminosuelfonil-2-imino-benzimidazolinler,bunlarin imaline dair usuller ve bunlarin mantar oeldueruecue olarak kullanilmasi |
| IT20132/73A IT978898B (it) | 1972-02-09 | 1973-02-07 | I acil 3 amminosolfonil 2 immi no benzimidazoline procedimento per la loro preparazione e loro impiego come prodotti fungicidi |
| DD168718A DD103787A5 (enExample) | 1972-02-09 | 1973-02-07 | |
| GB619473A GB1366062A (en) | 1972-02-09 | 1973-02-08 | 1-acyl-3-amino-sulphonyl-2-imino-benzimidazolines process for their production and their use as fungicides |
| DK69973AA DK130970B (da) | 1972-02-09 | 1973-02-08 | 1-Acyl-3-aminosulfonyl-2-imino-benzimidazoliner med fungicid virkning. |
| IE197/73A IE37270B1 (en) | 1972-02-09 | 1973-02-08 | 1-acyl-3-aminosulphonyl-2-imino-benzimidazolines process for their production and their use as fungicides |
| ZA730893A ZA73893B (en) | 1972-02-09 | 1973-02-08 | 1-acyl-3-aminosulphonyl-2-imino-benzimidazolines process for their production and their use as fungicides |
| HUBA2864A HU165882B (enExample) | 1972-02-09 | 1973-02-08 | |
| JP48015795A JPS4891070A (enExample) | 1972-02-09 | 1973-02-09 | |
| JP48015796A JPS4891226A (enExample) | 1972-02-09 | 1973-02-09 | |
| FR7304645A FR2171357B1 (enExample) | 1972-02-09 | 1973-02-09 | |
| AT120973A AT321031B (de) | 1972-02-09 | 1973-02-09 | Fungizides Mittel |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2206011A DE2206011A1 (de) | 1972-02-09 | 1972-02-09 | 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2206011A1 true DE2206011A1 (de) | 1973-08-23 |
Family
ID=5835454
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2206011A Pending DE2206011A1 (de) | 1972-02-09 | 1972-02-09 | 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3850954A (enExample) |
| JP (2) | JPS4891070A (enExample) |
| AT (1) | AT321031B (enExample) |
| BE (1) | BE795099A (enExample) |
| BR (1) | BR7300921D0 (enExample) |
| DD (1) | DD103787A5 (enExample) |
| DE (1) | DE2206011A1 (enExample) |
| DK (1) | DK130970B (enExample) |
| FR (1) | FR2171357B1 (enExample) |
| GB (1) | GB1366062A (enExample) |
| HU (1) | HU165882B (enExample) |
| IE (1) | IE37270B1 (enExample) |
| IL (1) | IL41469A0 (enExample) |
| IT (1) | IT978898B (enExample) |
| NL (1) | NL7301664A (enExample) |
| RO (1) | RO62817A (enExample) |
| TR (1) | TR17131A (enExample) |
| ZA (1) | ZA73893B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4018790A (en) * | 1975-05-08 | 1977-04-19 | Eli Lilly And Company | Substituted 1-sulfonylbenzimidazoles |
| US4243813A (en) * | 1974-07-01 | 1981-01-06 | Eli Lilly And Company | Substituted 1-sulfonylbenzimidazoles |
| US4196125A (en) * | 1974-07-01 | 1980-04-01 | Eli Lilly And Company | Substituted 1-sulfonylbenzimidazoles |
| MX3654E (es) * | 1975-08-28 | 1981-04-14 | Lilly Co Eli | Procedimiento para preparar compuestos de sulfonilbencimidazol |
| US4174454A (en) * | 1975-08-28 | 1979-11-13 | Eli Lilly And Company | Alkylidenylmethyl-substituted 1-sulfonylbenzimidazoles |
| US4118573A (en) * | 1975-11-24 | 1978-10-03 | Eli Lilly And Company | Substituted 1-sulfonylbenzimidazoles |
| US4230868A (en) * | 1979-04-17 | 1980-10-28 | Eli Lilly And Company | α-Alkyl-α-hydroxybenzyl-substituted 1-sulfonylbenzimidazoles |
| US4289782A (en) * | 1979-04-17 | 1981-09-15 | Eli Lilly And Company | Antiviral 1-sulfonylbenzimidazoles |
| US4316021A (en) * | 1979-08-13 | 1982-02-16 | Eli Lilly And Company | Substituted 1-sulfonylbenzimidazoles |
| US4338329A (en) * | 1979-11-14 | 1982-07-06 | Eli Lilly And Company | Antiviral method employing 1-sulfonylbenzimidazoles |
| US4401817A (en) * | 1981-04-20 | 1983-08-30 | Eli Lilly And Company | Carbonyl-substituted 1-sulfonylbenzimidazoles |
-
0
- BE BE795099D patent/BE795099A/xx unknown
-
1972
- 1972-02-09 DE DE2206011A patent/DE2206011A1/de active Pending
-
1973
- 1973-02-02 US US00329000A patent/US3850954A/en not_active Expired - Lifetime
- 1973-02-06 RO RO7300073743A patent/RO62817A/ro unknown
- 1973-02-06 NL NL7301664A patent/NL7301664A/xx unknown
- 1973-02-06 IL IL41469A patent/IL41469A0/xx unknown
- 1973-02-07 IT IT20132/73A patent/IT978898B/it active
- 1973-02-07 TR TR17131A patent/TR17131A/xx unknown
- 1973-02-07 DD DD168718A patent/DD103787A5/xx unknown
- 1973-02-07 BR BR73921A patent/BR7300921D0/pt unknown
- 1973-02-08 HU HUBA2864A patent/HU165882B/hu unknown
- 1973-02-08 DK DK69973AA patent/DK130970B/da unknown
- 1973-02-08 GB GB619473A patent/GB1366062A/en not_active Expired
- 1973-02-08 ZA ZA730893A patent/ZA73893B/xx unknown
- 1973-02-08 IE IE197/73A patent/IE37270B1/xx unknown
- 1973-02-09 JP JP48015795A patent/JPS4891070A/ja active Pending
- 1973-02-09 AT AT120973A patent/AT321031B/de not_active IP Right Cessation
- 1973-02-09 FR FR7304645A patent/FR2171357B1/fr not_active Expired
- 1973-02-09 JP JP48015796A patent/JPS4891226A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| HU165882B (enExample) | 1974-12-28 |
| IL41469A0 (en) | 1973-04-30 |
| IT978898B (it) | 1974-09-20 |
| BR7300921D0 (pt) | 1973-09-13 |
| IE37270B1 (en) | 1977-06-08 |
| TR17131A (tr) | 1974-04-25 |
| DD103787A5 (enExample) | 1974-02-12 |
| NL7301664A (enExample) | 1973-08-13 |
| JPS4891226A (enExample) | 1973-11-28 |
| RO62817A (fr) | 1977-10-15 |
| IE37270L (en) | 1973-08-09 |
| FR2171357B1 (enExample) | 1976-09-10 |
| GB1366062A (en) | 1974-09-11 |
| FR2171357A1 (enExample) | 1973-09-21 |
| ZA73893B (en) | 1973-11-28 |
| AT321031B (de) | 1975-03-10 |
| US3850954A (en) | 1974-11-26 |
| DK130970B (da) | 1975-05-12 |
| BE795099A (fr) | 1973-08-07 |
| JPS4891070A (enExample) | 1973-11-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3786365T2 (de) | 5H-1,3,4-Thiadiazolo[3,2-a]pyrimidin-5-on-Derivate und diese enthaltende Gartenbau- und landwirtschaftliche Fungizidmittel. | |
| DE2206011A1 (de) | 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung | |
| DE2206010A1 (de) | 1-aminosulfonyl-2-amino-benzimidazole, verfahren zu ihrer herstellung und ihre fungizide verwendung | |
| DE2145418A1 (de) | Arylazo-thiocarbonsaeure-dialkylamide | |
| DE1109695B (de) | Verfahren zur Herstellung von Substitutionsprodukten des 2,3-Dimercaptochinoxalins | |
| DE2201062A1 (de) | N-alkoxycarbonyl- bzw. n-alkylthiocarbonyl-2-(2'-thienyl)-benzimidazole, ein verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE2648074A1 (de) | N-chloracetyl-n-phenyl-alaninester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE1767924A1 (de) | 1-Phenyl-4,4-dialkyl-thiosemicarbazide | |
| DE2740848A1 (de) | Substituierte n-phenyl-bernsteinsaeureimide, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| EP0154273B1 (de) | Fungizide Mittel | |
| EP0003520B1 (de) | Spiro-Derivate von 3-(3,5-Dihalogenphenyl)-oxazolidin-2,4-dionen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE1142599B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE2626828A1 (de) | Neue carbamidsaeureoximester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE2410184A1 (de) | Chinonoxim-acylhydrazon-derivate, verfahren zu ihrer herstellung, sowie ihre verwendung als fungizide | |
| DE2242785A1 (de) | 1-alkylsulfonyl-2-trifluormethylbenzimidazole, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitenmittel | |
| DE2002800C3 (de) | Benzo [b] thiophen-l,l-dioxidverbindungen und Verfahren zu ihrer Herstellung | |
| DE2022494A1 (de) | Fungizide Mittel | |
| DE2144125A1 (de) | Dithiocarbamidsaure salze von harnstoff-derivaten, verfahren zu ihrer herstellung und ihre fungizide und mikrobizide verwendung | |
| DE2311983A1 (de) | N-(fluordichlormethylthio)-n-(trifluormethyl)-aminobenzhydroxamsaeuren und deren salze, verfahren zu ihrer herstellung und ihre fungizide verwendung | |
| EP0014887B1 (de) | Spiro-Derivate von 3-(3,5-Dihalogenphenyl)-oxazolidin-2-thion-4-onen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2852924A1 (de) | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE1930540C (de) | Alkoxycarbony lthioureidobenzole und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| AT268230B (de) | Verfahren zur Herstellung von neuen acylierten Trichloracetaldehydaminalen | |
| DE2160020A1 (de) | Perchlor-imidazo-pyrimidin, verfahren zu seiner herstellung, sowie seine verwendung als fungizid | |
| DE2408897A1 (de) | Chinonoxim-acylhydrazone, verfahren zu ihrer herstellung, sowie ihre verwendung als fungizide |