DE2204725B2 - Verfahren zur Herstellung von konzentrierten, flüssigen, salzarmen Färbepräparaten - Google Patents
Verfahren zur Herstellung von konzentrierten, flüssigen, salzarmen FärbepräparatenInfo
- Publication number
- DE2204725B2 DE2204725B2 DE2204725A DE2204725A DE2204725B2 DE 2204725 B2 DE2204725 B2 DE 2204725B2 DE 2204725 A DE2204725 A DE 2204725A DE 2204725 A DE2204725 A DE 2204725A DE 2204725 B2 DE2204725 B2 DE 2204725B2
- Authority
- DE
- Germany
- Prior art keywords
- dyes
- dye
- water
- concentrated
- low
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 20
- 239000007788 liquid Substances 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000975 dye Substances 0.000 claims description 76
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- 239000000243 solution Substances 0.000 claims description 28
- 230000003287 optical effect Effects 0.000 claims description 24
- 239000012528 membrane Substances 0.000 claims description 22
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 13
- 239000000725 suspension Substances 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 10
- 239000011780 sodium chloride Substances 0.000 claims description 7
- 230000000717 retained effect Effects 0.000 claims description 6
- 229920002301 cellulose acetate Polymers 0.000 claims description 5
- 238000000926 separation method Methods 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 4
- 238000004040 coloring Methods 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 239000012065 filter cake Substances 0.000 claims description 3
- 238000006386 neutralization reaction Methods 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims 1
- 239000007900 aqueous suspension Substances 0.000 claims 1
- 238000003825 pressing Methods 0.000 claims 1
- 239000002002 slurry Substances 0.000 claims 1
- 235000002639 sodium chloride Nutrition 0.000 description 19
- 239000011734 sodium Substances 0.000 description 14
- 150000003839 salts Chemical class 0.000 description 12
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 238000000108 ultra-filtration Methods 0.000 description 6
- 238000005185 salting out Methods 0.000 description 5
- 210000002268 wool Anatomy 0.000 description 5
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000004627 regenerated cellulose Substances 0.000 description 3
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 206010039587 Scarlet Fever Diseases 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 2
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000001007 phthalocyanine dye Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000985 reactive dye Substances 0.000 description 2
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 2
- 238000001223 reverse osmosis Methods 0.000 description 2
- 238000009938 salting Methods 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- -1 sulfonic acid chlorides Chemical class 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 239000010981 turquoise Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 description 1
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical class C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- AEDXWLKGHWACQH-UHFFFAOYSA-N 4-hydroxy-5-[(2,5,6-trichloropyrimidin-4-yl)amino]naphthalene-2,7-disulfonic acid Chemical compound OC1=CC(=CC2=CC(=CC(=C12)NC1=NC(=NC(=C1Cl)Cl)Cl)S(=O)(=O)O)S(=O)(=O)O AEDXWLKGHWACQH-UHFFFAOYSA-N 0.000 description 1
- WOBFDOBGCIHPCT-UHFFFAOYSA-N 5-(2H-triazol-4-yl)-2-[2-[4-(2H-triazol-4-yl)phenyl]ethenyl]benzenesulfonic acid Chemical compound N1N=NC(=C1)C=1C=C(C(=CC1)C=CC1=CC=C(C=C1)C=1N=NNC1)S(=O)(=O)O WOBFDOBGCIHPCT-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 241000985694 Polypodiopsida Species 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 240000007313 Tilia cordata Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000003113 alkalizing effect Effects 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 150000004700 cobalt complex Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- 125000000332 coumarinyl group Chemical class O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010612 desalination reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical group [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-O hydron;pyrimidine Chemical compound C1=CN=C[NH+]=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-O 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- HRRDCWDFRIJIQZ-UHFFFAOYSA-N naphthalene-1,8-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C(=O)O)=CC=CC2=C1 HRRDCWDFRIJIQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 150000004893 oxazines Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 229920005597 polymer membrane Polymers 0.000 description 1
- 150000003216 pyrazines Chemical class 0.000 description 1
- 150000003219 pyrazolines Chemical class 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- XHGIFBQQEGRTPB-UHFFFAOYSA-N tris(prop-2-enyl) phosphate Chemical compound C=CCOP(=O)(OCC=C)OCC=C XHGIFBQQEGRTPB-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B67/00—Influencing the physical, e.g. the dyeing or printing properties of dyestuffs without chemical reactions, e.g. by treating with solvents grinding or grinding assistants, coating of pigments or dyes; Process features in the making of dyestuff preparations; Dyestuff preparations of a special physical nature, e.g. tablets, films
- C09B67/0096—Purification; Precipitation; Filtration
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D61/00—Processes of separation using semi-permeable membranes, e.g. dialysis, osmosis or ultrafiltration; Apparatus, accessories or auxiliary operations specially adapted therefor
- B01D61/14—Ultrafiltration; Microfiltration
- B01D61/145—Ultrafiltration
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D63/00—Apparatus in general for separation processes using semi-permeable membranes
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Water Supply & Treatment (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH153571 | 1971-02-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2204725A1 DE2204725A1 (de) | 1973-01-18 |
| DE2204725B2 true DE2204725B2 (de) | 1974-02-07 |
Family
ID=4212692
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2204725A Pending DE2204725B2 (de) | 1971-02-02 | 1972-02-01 | Verfahren zur Herstellung von konzentrierten, flüssigen, salzarmen Färbepräparaten |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE778777A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2204725B2 (cg-RX-API-DMAC10.html) |
| ES (1) | ES399369A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2124359B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1359898A (cg-RX-API-DMAC10.html) |
| IL (1) | IL38678A0 (cg-RX-API-DMAC10.html) |
| IT (1) | IT949703B (cg-RX-API-DMAC10.html) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2805891C2 (de) * | 1978-02-13 | 1988-12-22 | Bayer Ag, 5090 Leverkusen | Konzentrierte Farbstoff- und Aufhellerlösungen, deren Herstellung und Verwendung |
| DE2934949A1 (de) * | 1979-08-29 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von fluessigen farbstoffpraeparationen |
| DE2948291A1 (de) * | 1979-11-30 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Fluessigkristalline phase eines azoreaktivfarbstoffs und deren verwendung zum faerben und bedrucken von natuerlichen und synthetischen substraten |
| DE2948293A1 (de) * | 1979-11-30 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Fluessigkristalline phase eines azoreaktivfarbstoffes und deren verwendung zum faerben und bedrucken von natuerlichen und synthetischen substraten |
| US4390342A (en) * | 1980-04-01 | 1983-06-28 | Ciba-Geigy Corporation | Process for the preparation of solid composition of water-soluble dyes |
| JPS6034993B2 (ja) * | 1980-05-06 | 1985-08-12 | キヤノン株式会社 | 記録液及びその製造法 |
| EP0041240B1 (de) * | 1980-06-04 | 1985-08-21 | Ciba-Geigy Ag | Verfahren zum Spritzfärben von Leder |
| DE3038393A1 (de) * | 1980-10-10 | 1982-05-19 | Bayer Ag, 5090 Leverkusen | Lederfaerbemittel und ihre herstellung |
| DE3174666D1 (en) * | 1981-03-06 | 1986-06-26 | Ciba Geigy Ag | Process for producing concentrated aqueous dyestuff preparations of anionic paper or wool dyes |
| CH647021A5 (de) * | 1981-09-22 | 1984-12-28 | Ciba Geigy Ag | Verfahren zur herstellung lagerstabiler aufhellerformulierungen. |
| CH648583A5 (de) | 1981-09-29 | 1985-03-29 | Ciba Geigy Ag | Verfahren zur herstellung von lagerstabilen farbstoffpraeparaten. |
| US4523924A (en) * | 1982-12-20 | 1985-06-18 | Ciba-Geigy Corporation | Process for the preparation of stable aqueous solutions of water-soluble reactive dyes by membrane separation |
| CH654424A5 (de) * | 1983-03-25 | 1986-02-14 | Ciba Geigy Ag | Verfahren zur verhinderung des gelierens von konzentrierten waessrigen photoaktivatorloesungen. |
| CH654121A5 (de) * | 1983-03-25 | 1986-01-31 | Ciba Geigy Ag | Verfahren zur herstellung von festen photoaktivatorpraeparaten. |
| JPS59182861A (ja) * | 1983-04-01 | 1984-10-17 | Canon Inc | 染料精製装置 |
| JPS59199765A (ja) * | 1983-04-27 | 1984-11-12 | Canon Inc | 染料精製装置 |
| DE3417411A1 (de) * | 1983-06-30 | 1985-01-03 | Canon K.K., Tokio/Tokyo | Tintenherstellungssystem |
| US4802989A (en) * | 1983-07-28 | 1989-02-07 | Canon Kabushiki Kaisha | System for purifying dye |
| DE3426931A1 (de) * | 1984-07-21 | 1986-01-23 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung fluessiger, salzarmer, waessriger reaktivfarbstoffzubereitungen |
| US4732613A (en) * | 1984-11-08 | 1988-03-22 | Canon Kabushiki Kaisha | Recording liquid |
| CH660493A5 (de) * | 1984-12-07 | 1987-04-30 | Ciba Geigy Ag | Verfahren zur herstellung konzentrierter salzarmer waessriger loesungen von aminotriazinyl-reaktivfarbstoffen. |
| CH667664A5 (de) * | 1985-03-29 | 1988-10-31 | Ciba Geigy Ag | Verfahren zur herstellung von praeparaten wasserloeslicher organischer farbstoffe. |
| ES2020344B3 (es) * | 1987-04-16 | 1991-08-01 | Ciba-Geigy Ag | Procedimiento para la obtencion de preparaciones colorantes acuosas concentradas. |
| DE19615260A1 (de) * | 1996-04-18 | 1997-10-23 | Bayer Ag | Verfahren zur Herstellung salzarmer, flüssiger Farbstoffpräparationen |
| AU4145897A (en) * | 1997-02-14 | 1998-09-08 | Warner-Jenkinson Company, Inc. | Method and apparatus for purifying water-insoluble compounds |
| DE19706238B4 (de) * | 1997-02-18 | 2005-09-01 | Bayer Chemicals Ag | Verfahren zur Herstellung von substituierten 4,4'-Diaminostilben-2,2'-disulfonsäuren |
| DE19839209A1 (de) * | 1998-08-28 | 2000-03-02 | Fraunhofer Ges Forschung | Verfahren zur Gewinnung von festen Stoffen aus Lösungen |
| US6670053B2 (en) * | 2002-02-26 | 2003-12-30 | Eastman Kodak Company | Organic electroluminescent devices with high luminance |
| DE102004025444A1 (de) * | 2004-05-19 | 2005-12-15 | Basf Ag | Verfahren zur Herstellung von Flüssigeinstellungen basischer Azofarbstoffe |
| DE102004025443A1 (de) * | 2004-05-19 | 2005-12-08 | Basf Ag | Verfahren zur Herstellung einer Flüssigformulierung von Salzen sulfonsaurer Azofarbstoffe |
| CN104629493B (zh) * | 2013-11-12 | 2018-01-16 | 浙江双冠染料有限公司 | 一种环保型ci分散橙29的制备方法 |
-
1972
- 1972-02-01 FR FR7203348A patent/FR2124359B1/fr not_active Expired
- 1972-02-01 IL IL38678A patent/IL38678A0/xx unknown
- 1972-02-01 BE BE778777A patent/BE778777A/xx unknown
- 1972-02-01 DE DE2204725A patent/DE2204725B2/de active Pending
- 1972-02-01 ES ES399369A patent/ES399369A1/es not_active Expired
- 1972-02-01 IT IT48066/72A patent/IT949703B/it active
- 1972-02-01 GB GB472972A patent/GB1359898A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1359898A (en) | 1974-07-17 |
| IL38678A0 (en) | 1972-04-27 |
| FR2124359A1 (cg-RX-API-DMAC10.html) | 1972-09-22 |
| ES399369A1 (es) | 1975-06-01 |
| IT949703B (it) | 1973-06-11 |
| BE778777A (fr) | 1972-08-01 |
| FR2124359B1 (cg-RX-API-DMAC10.html) | 1977-04-01 |
| DE2204725A1 (de) | 1973-01-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2204725B2 (de) | Verfahren zur Herstellung von konzentrierten, flüssigen, salzarmen Färbepräparaten | |
| EP0197006B1 (de) | Verfahren zur Herstellung von Präparaten wasserlöslicher organischer Farbstoffe | |
| EP0114031B2 (de) | Verfahren zur Herstellung lagerstabiler wässriger Farbstofflösungen von wasserlöslichen Reaktivfarbstoffen | |
| DE2805891C2 (de) | Konzentrierte Farbstoff- und Aufhellerlösungen, deren Herstellung und Verwendung | |
| EP0992547B1 (de) | Verfahren zur Herstellung von Farbstoffen und/oder Aufhellerzubereitungen | |
| EP0287515B1 (de) | Verfahren zur Herstellung von konzentrierten, wässrigen Farbstoffzubereitungen wasserlöslicher organischer Farbstoffe | |
| EP0169811B1 (de) | Verfahren zur Herstellung lagerstabiler wässriger Präparate von anionischen Farbstoffen | |
| EP0235081A1 (de) | Verfahren zur Reinigung von farbstoffhaltigen Abwässern | |
| EP0302015A2 (de) | Verfahren zur kontinuierlichen Aufarbeitung von wässrigen Rohfarbstoffsuspensionen | |
| DE3231299A1 (de) | Verfahren zur herstellung konzentrierter waesseriger zubereitungen von synthetischen anionischen dispergatoren und deren verwendung | |
| EP0126830B1 (de) | Verfahren zur Umwandlung schwerlöslicher Salze anionischer Farbstoffe und optischer Aufheller in leichter lösliche Salze mittels Kationenaustausch | |
| EP0029960A1 (de) | Wässrige, lösungsmittelfreie konzentrierte Präparationen von Reaktivfarbstoffen und Verfahren zu ihrer Herstellung | |
| EP0024667B1 (de) | Verfahren zur Herstellung flüssiger Farbstoffzusammensetzungen und deren Verwendung | |
| DE2051303B2 (de) | Polyhydroxyalkylaminsalze anionischer Farbstoffe | |
| DE2643214C2 (de) | Herstellung wäßriger Azofarbstoff-Dispersionen | |
| DE2743451A1 (de) | Polymere farbstoffe und verfahren zu ihrer herstellung | |
| DE3301870C2 (de) | Verfahren zur Herstellung von konzentrierten flüssigen Färbepräparaten | |
| CH660493A5 (de) | Verfahren zur herstellung konzentrierter salzarmer waessriger loesungen von aminotriazinyl-reaktivfarbstoffen. | |
| DE4110050A1 (de) | Verfahren zur gewinnung fester farbstoffe | |
| EP0992544B1 (de) | Disazofarbstoffe | |
| DE3148878A1 (de) | "fluessige, waessrige faerbepraeparationen von reaktivfarbstoffen und ihre verwendung" | |
| EP0049802A1 (de) | Lederfärbemittel und ihre Herstellung | |
| EP0043792A2 (de) | Färben von Papier | |
| CH617911A5 (en) | Process for removing water-soluble ionic compounds from aqueous solutions by ultrafiltration | |
| EP0539825B1 (de) | Lagerstabile Präparation von Reaktivfarbstoffen |