DE2203576A1 - Projektionssystem - Google Patents
ProjektionssystemInfo
- Publication number
- DE2203576A1 DE2203576A1 DE19722203576 DE2203576A DE2203576A1 DE 2203576 A1 DE2203576 A1 DE 2203576A1 DE 19722203576 DE19722203576 DE 19722203576 DE 2203576 A DE2203576 A DE 2203576A DE 2203576 A1 DE2203576 A1 DE 2203576A1
- Authority
- DE
- Germany
- Prior art keywords
- medium
- projection system
- anthracene derivative
- deformable
- deformations
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000010894 electron beam technology Methods 0.000 claims description 5
- 230000000191 radiation effect Effects 0.000 claims description 5
- FCNCGHJSNVOIKE-UHFFFAOYSA-N 9,10-diphenylanthracene Chemical group C1=CC=CC=C1C(C1=CC=CC=C11)=C(C=CC=C2)C2=C1C1=CC=CC=C1 FCNCGHJSNVOIKE-UHFFFAOYSA-N 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 150000001454 anthracenes Chemical class 0.000 claims 6
- KOIMINKJYIDAOZ-UHFFFAOYSA-N 9,10-bis(4-phenylphenyl)anthracene Chemical group C1=CC=CC=C1C1=CC=C(C=2C3=CC=CC=C3C(C=3C=CC(=CC=3)C=3C=CC=CC=3)=C3C=CC=CC3=2)C=C1 KOIMINKJYIDAOZ-UHFFFAOYSA-N 0.000 claims 2
- FMVRRCDBALUUBI-UHFFFAOYSA-N 9,10-dibenzylanthracene Chemical group C=12C=CC=CC2=C(CC=2C=CC=CC=2)C2=CC=CC=C2C=1CC1=CC=CC=C1 FMVRRCDBALUUBI-UHFFFAOYSA-N 0.000 claims 1
- GWNJZSGBZMLRBW-UHFFFAOYSA-N 9,10-dinaphthalen-1-ylanthracene Chemical compound C12=CC=CC=C2C(C=2C3=CC=CC=C3C=CC=2)=C(C=CC=C2)C2=C1C1=CC=CC2=CC=CC=C12 GWNJZSGBZMLRBW-UHFFFAOYSA-N 0.000 claims 1
- 239000007788 liquid Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 230000005855 radiation Effects 0.000 description 9
- 239000000463 material Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 5
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 4
- 229940073608 benzyl chloride Drugs 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 239000012530 fluid Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- OURODNXVJUWPMZ-UHFFFAOYSA-N 1,2-diphenylanthracene Chemical compound C1=CC=CC=C1C1=CC=C(C=C2C(C=CC=C2)=C2)C2=C1C1=CC=CC=C1 OURODNXVJUWPMZ-UHFFFAOYSA-N 0.000 description 1
- 125000005577 anthracene group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007863 gel particle Substances 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- LAQFLZHBVPULPL-UHFFFAOYSA-N methyl(phenyl)silicon Chemical compound C[Si]C1=CC=CC=C1 LAQFLZHBVPULPL-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/74—Projection arrangements for image reproduction, e.g. using eidophor
- H04N5/7416—Projection arrangements for image reproduction, e.g. using eidophor involving the use of a spatial light modulator, e.g. a light valve, controlled by a video signal
- H04N5/7425—Projection arrangements for image reproduction, e.g. using eidophor involving the use of a spatial light modulator, e.g. a light valve, controlled by a video signal the modulator being a dielectric deformable layer controlled by an electron beam, e.g. eidophor projector
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Analysing Materials By The Use Of Radiation (AREA)
- Photoreceptors In Electrophotography (AREA)
- Optical Record Carriers And Manufacture Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11051971A | 1971-01-28 | 1971-01-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2203576A1 true DE2203576A1 (de) | 1972-08-17 |
Family
ID=22333458
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722203576 Pending DE2203576A1 (de) | 1971-01-28 | 1972-01-26 | Projektionssystem |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3715494A (enExample) |
| CA (1) | CA956494A (enExample) |
| DE (1) | DE2203576A1 (enExample) |
| FR (1) | FR2123497B1 (enExample) |
| GB (1) | GB1366320A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3764549A (en) * | 1973-01-11 | 1973-10-09 | Gen Electric | Light-modulating medium for image projection apparatus |
| US3928394A (en) * | 1973-01-11 | 1975-12-23 | Gen Electric | Benzyl and (benzyl)benzylanthraquinones |
| DE3904264A1 (de) * | 1989-02-08 | 1990-08-09 | Hertz Inst Heinrich | Fluid mit erhoehter bestaendigkeit gegen strahlungsschaedigungen |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2943147A (en) * | 1958-01-13 | 1960-06-28 | Gen Electric | Projection system |
| US3125636A (en) * | 1962-06-05 | 1964-03-17 | I zxch | |
| US3125635A (en) * | 1962-06-05 | 1964-03-17 | Projection system | |
| US3125637A (en) * | 1962-06-05 | 1964-03-17 | Composition and apparatus used in | |
| US3125634A (en) * | 1962-06-05 | 1964-03-17 | Cshs cahs | |
| US3288927A (en) * | 1964-01-02 | 1966-11-29 | Gen Electric | Projection system |
| DE1437667A1 (enExample) * | 1964-08-26 | |||
| US3317665A (en) * | 1964-08-26 | 1967-05-02 | Gen Electric | Projection system |
-
1971
- 1971-01-28 US US00110519A patent/US3715494A/en not_active Expired - Lifetime
- 1971-10-13 CA CA124,990A patent/CA956494A/en not_active Expired
- 1971-12-07 GB GB5667571A patent/GB1366320A/en not_active Expired
-
1972
- 1972-01-26 DE DE19722203576 patent/DE2203576A1/de active Pending
- 1972-01-28 FR FR7202826A patent/FR2123497B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2123497B1 (enExample) | 1975-10-24 |
| US3715494A (en) | 1973-02-06 |
| FR2123497A1 (enExample) | 1972-09-08 |
| CA956494A (en) | 1974-10-22 |
| GB1366320A (en) | 1974-09-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3114468C2 (enExample) | ||
| DE2740272C3 (de) | Verfahren zum Trennen von zwei Isotopen eines Stoffes | |
| DE2906652A1 (de) | Verfahren zur herstellung einer elektrophoretischen anzeige mit wachsumhuellten pigmentteilchen | |
| DE1949540B2 (de) | Thermoplastische Massen zur Herstellung von Dielektrika | |
| DE1130468B (de) | Fernsehprojektionsgeraet | |
| CH450510A (de) | Verfahren zur Herstellung eines selbsttragenden Kabels | |
| DE2203576A1 (de) | Projektionssystem | |
| DE1122701B (de) | Gegen Oxydation stabilisierte Formmasse | |
| DE1923131B2 (de) | Thermoplastische massen zur herstellung von dielektrika | |
| DE2556256A1 (de) | Pyrotechnische nebelsaetze | |
| DE1437678A1 (de) | Projektionssystem | |
| DE2731869B2 (de) | Elektrisch isolierende Flüssigkeit | |
| DE3143354C2 (de) | Verfahren zur Verbesserung der verdickenden, insbesondere gelbildenden, Wirkung von feinteiligem Siliciumdioxid | |
| DE838182C (de) | Verfahren zur Herstellung von Leuchtstoffmassen für Lummeszenzschichten, insbesondere von elektrischen Entladungsgefäßen | |
| DE2225172A1 (de) | Ablenkspulensystem insbesondere für eine Bildaufnahmeröhre | |
| DE1437677A1 (de) | Projektionssystem | |
| DE1949416C3 (de) | Fotoelektrophoretisches Abbildungsverfahren unter Verwendung von Ultraschall | |
| DE1275542B (de) | Arylsilikate und Verfahren zu deren Herstellung | |
| DE2608397A1 (de) | Dielektrische fluessigkeit | |
| EP0048871A1 (de) | Verfahren zur Herstellung von Keramikmaterial für Zinkoxid-Varistoren | |
| AT203213B (de) | Stabilisierte Mischung | |
| DE1589549A1 (de) | Elektrischer Wechselspannungs-Kondensator mit Kunststoffbaender enthaltendem Dielektrikum | |
| DE1815440A1 (de) | Verfahren und Vorrichtung zum elektrostatischen Aufladen von kleinen Teilchen | |
| DE2726637C3 (de) | Kathodochromes Material vom Carnegieit-Typ | |
| DE2012037C3 (de) | Entdröhnungsmittel für Bleche |