DE2201280A1 - Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellung - Google Patents
Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellungInfo
- Publication number
- DE2201280A1 DE2201280A1 DE19722201280 DE2201280A DE2201280A1 DE 2201280 A1 DE2201280 A1 DE 2201280A1 DE 19722201280 DE19722201280 DE 19722201280 DE 2201280 A DE2201280 A DE 2201280A DE 2201280 A1 DE2201280 A1 DE 2201280A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- oso
- chloro
- dye
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 9
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical class [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 5
- 239000000985 reactive dye Substances 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000975 dye Substances 0.000 claims description 52
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 239000000987 azo dye Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000005597 hydrazone group Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- -1 naphthalene radicals Chemical class 0.000 description 39
- 239000002253 acid Substances 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000843 powder Substances 0.000 description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- MLIREBYILWEBDM-UHFFFAOYSA-N anhydrous cyanoacetic acid Natural products OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 8
- 238000004043 dyeing Methods 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 229920003043 Cellulose fiber Polymers 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Inorganic materials [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- 238000001291 vacuum drying Methods 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 6
- 239000001632 sodium acetate Substances 0.000 description 6
- 235000017281 sodium acetate Nutrition 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000012954 diazonium Substances 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000004627 regenerated cellulose Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- 238000005185 salting out Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 150000003931 anilides Chemical class 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- 150000003918 triazines Chemical class 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- QQLILYBIARWEIF-UHFFFAOYSA-N 2-(2-hydroxyethylsulfonyl)ethanol Chemical compound OCCS(=O)(=O)CCO QQLILYBIARWEIF-UHFFFAOYSA-N 0.000 description 2
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical class NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- WMUBNWIGNSIRDH-UHFFFAOYSA-N 2,3,3-trichloroprop-2-enoic acid Chemical compound OC(=O)C(Cl)=C(Cl)Cl WMUBNWIGNSIRDH-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- CZHWBISSOIPPNL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=C(F)N=C(F)N=C1F CZHWBISSOIPPNL-UHFFFAOYSA-N 0.000 description 1
- MIVVPUZFDSCZJE-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC=NC(S(C)(=O)=O)=N1 MIVVPUZFDSCZJE-UHFFFAOYSA-N 0.000 description 1
- YXYCPKOAGWDZKX-UHFFFAOYSA-N 2,4-difluoro-5-(trifluoromethyl)pyrimidine Chemical compound FC1=NC=C(C(F)(F)F)C(F)=N1 YXYCPKOAGWDZKX-UHFFFAOYSA-N 0.000 description 1
- FKSSZHRRUUZKCM-UHFFFAOYSA-N 2,4-difluoro-6-(trifluoromethyl)pyrimidine Chemical compound FC1=CC(C(F)(F)F)=NC(F)=N1 FKSSZHRRUUZKCM-UHFFFAOYSA-N 0.000 description 1
- YKLOPWRWWFKUBX-UHFFFAOYSA-N 2,4-difluoro-6-methylpyrimidine Chemical compound CC1=CC(F)=NC(F)=N1 YKLOPWRWWFKUBX-UHFFFAOYSA-N 0.000 description 1
- ZCHHTEOFXSGDMW-UHFFFAOYSA-N 2,4-difluoro-6-phenylpyrimidine Chemical compound FC1=NC(F)=CC(C=2C=CC=CC=2)=N1 ZCHHTEOFXSGDMW-UHFFFAOYSA-N 0.000 description 1
- AOSHQVWIJNXEMB-UHFFFAOYSA-N 2,4-difluoropyrimidine-5-carbonitrile Chemical compound FC1=NC=C(C#N)C(F)=N1 AOSHQVWIJNXEMB-UHFFFAOYSA-N 0.000 description 1
- YZRMBOOBRWRVJU-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyrimidine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=NC(S(C)(=O)=O)=N1 YZRMBOOBRWRVJU-UHFFFAOYSA-N 0.000 description 1
- AMBBZHXGKGNTMI-UHFFFAOYSA-N 2,6-dichloro-4-ethoxy-1h-triazine Chemical compound CCOC1=NN(Cl)NC(Cl)=C1 AMBBZHXGKGNTMI-UHFFFAOYSA-N 0.000 description 1
- NNZQKAANXSXDNP-UHFFFAOYSA-N 2,6-dichloro-4-ethylsulfanyl-1h-triazine Chemical compound CCSC1=NN(Cl)NC(Cl)=C1 NNZQKAANXSXDNP-UHFFFAOYSA-N 0.000 description 1
- IOXIFBCDVPDGJV-UHFFFAOYSA-N 2,6-dichloro-4-methoxy-1h-triazine Chemical compound COC1=NN(Cl)NC(Cl)=C1 IOXIFBCDVPDGJV-UHFFFAOYSA-N 0.000 description 1
- BHAFVZAFEVCQGJ-UHFFFAOYSA-N 2,6-dichloro-4-phenylsulfanyl-1h-triazine Chemical compound ClN1NC(Cl)=CC(SC=2C=CC=CC=2)=N1 BHAFVZAFEVCQGJ-UHFFFAOYSA-N 0.000 description 1
- JOHYJBDEGASSCP-UHFFFAOYSA-N 2,6-dichloro-n-ethyl-1h-triazin-4-amine Chemical compound CCNC1=NN(Cl)NC(Cl)=C1 JOHYJBDEGASSCP-UHFFFAOYSA-N 0.000 description 1
- NUYJCMGJLNVOML-UHFFFAOYSA-N 2,6-dichloropyrimidine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=NC(Cl)=N1 NUYJCMGJLNVOML-UHFFFAOYSA-N 0.000 description 1
- WFJGZGDYFGUMCA-UHFFFAOYSA-N 2,6-difluoropyrimidine-4-carbonitrile Chemical compound FC1=CC(C#N)=NC(F)=N1 WFJGZGDYFGUMCA-UHFFFAOYSA-N 0.000 description 1
- IDDLHNUKISKRRT-UHFFFAOYSA-N 2-(4-chloro-6-methylpyrimidin-2-yl)sulfonylethanesulfonic acid Chemical compound CC1=CC(Cl)=NC(S(=O)(=O)CCS(O)(=O)=O)=N1 IDDLHNUKISKRRT-UHFFFAOYSA-N 0.000 description 1
- ILNFTPTWDOAAEV-UHFFFAOYSA-N 2-(4-chloropyrimidin-2-yl)sulfonylacetic acid Chemical compound OC(=O)CS(=O)(=O)C1=NC=CC(Cl)=N1 ILNFTPTWDOAAEV-UHFFFAOYSA-N 0.000 description 1
- GSCQMQCAMLKDEI-UHFFFAOYSA-N 2-(benzenesulfonyl)-4-chloropyrimidine Chemical compound ClC1=CC=NC(S(=O)(=O)C=2C=CC=CC=2)=N1 GSCQMQCAMLKDEI-UHFFFAOYSA-N 0.000 description 1
- WCBVOPMSONYWEB-UHFFFAOYSA-N 2-aminoacetyl chloride Chemical compound NCC(Cl)=O WCBVOPMSONYWEB-UHFFFAOYSA-N 0.000 description 1
- OBCQPUSRAUNDAB-UHFFFAOYSA-N 2-bromoprop-2-enoyl chloride Chemical compound ClC(=O)C(Br)=C OBCQPUSRAUNDAB-UHFFFAOYSA-N 0.000 description 1
- GNCXQZIDAGRNHH-UHFFFAOYSA-N 2-chloroquinoxaline-6-carbonyl chloride Chemical compound N1=C(Cl)C=NC2=CC(C(=O)Cl)=CC=C21 GNCXQZIDAGRNHH-UHFFFAOYSA-N 0.000 description 1
- GEQZTCMVWVDEDF-UHFFFAOYSA-N 2-cyanoacetyl chloride Chemical class ClC(=O)CC#N GEQZTCMVWVDEDF-UHFFFAOYSA-N 0.000 description 1
- CTSAKABLTRMUQJ-UHFFFAOYSA-N 2-sulfonyl-3h-1,3-benzothiazole Chemical class C1=CC=C2SC(=S(=O)=O)NC2=C1 CTSAKABLTRMUQJ-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- QPZGKMLYCRNKCK-UHFFFAOYSA-N 3-(benzenesulfonyl)propanoyl chloride Chemical compound ClC(=O)CCS(=O)(=O)C1=CC=CC=C1 QPZGKMLYCRNKCK-UHFFFAOYSA-N 0.000 description 1
- BUHGCLPAHGFCLE-UHFFFAOYSA-N 3-chloro-6-methylsulfonylpyridazine Chemical compound CS(=O)(=O)C1=CC=C(Cl)N=N1 BUHGCLPAHGFCLE-UHFFFAOYSA-N 0.000 description 1
- QIMCIIVGSIZXFU-UHFFFAOYSA-N 3-chloroquinoxaline-2-carbonyl chloride Chemical compound C1=CC=C2N=C(Cl)C(C(=O)Cl)=NC2=C1 QIMCIIVGSIZXFU-UHFFFAOYSA-N 0.000 description 1
- CZHSCSBBYUJCLI-UHFFFAOYSA-N 3-methylsulfonylpropanoyl chloride Chemical compound CS(=O)(=O)CCC(Cl)=O CZHSCSBBYUJCLI-UHFFFAOYSA-N 0.000 description 1
- ACYSJALOFWHUEX-UHFFFAOYSA-N 4-chloro-2,6-difluoropyrimidine Chemical compound FC1=CC(Cl)=NC(F)=N1 ACYSJALOFWHUEX-UHFFFAOYSA-N 0.000 description 1
- WGNKUINKIVFGBC-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonyl-5-nitropyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1[N+]([O-])=O WGNKUINKIVFGBC-UHFFFAOYSA-N 0.000 description 1
- BYJUMOSWVALFCO-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine-5-sulfonyl chloride Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1S(Cl)(=O)=O BYJUMOSWVALFCO-UHFFFAOYSA-N 0.000 description 1
- LNJVTFNEAPYZIU-UHFFFAOYSA-N 4-chloro-6-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=CC(Cl)=NC=N1 LNJVTFNEAPYZIU-UHFFFAOYSA-N 0.000 description 1
- KNDOFJFSHZCKGT-UHFFFAOYSA-N 4-chloroquinoline Chemical compound C1=CC=C2C(Cl)=CC=NC2=C1 KNDOFJFSHZCKGT-UHFFFAOYSA-N 0.000 description 1
- ZXELQTCXDSGFGP-UHFFFAOYSA-N 4-methyl-2,6-bis(trichloromethylsulfonyl)pyrimidine Chemical compound CC1=CC(S(=O)(=O)C(Cl)(Cl)Cl)=NC(S(=O)(=O)C(Cl)(Cl)Cl)=N1 ZXELQTCXDSGFGP-UHFFFAOYSA-N 0.000 description 1
- ZPVSFHWMXABGPU-UHFFFAOYSA-N 4-nitroquinoline Chemical compound C1=CC=C2C([N+](=O)[O-])=CC=NC2=C1 ZPVSFHWMXABGPU-UHFFFAOYSA-N 0.000 description 1
- FATRNESSGITUQV-UHFFFAOYSA-N 5-bromo-4-chloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Br)C(Cl)=N1 FATRNESSGITUQV-UHFFFAOYSA-N 0.000 description 1
- XKHYTPKPHOHPIJ-UHFFFAOYSA-N 5-bromo-4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Br XKHYTPKPHOHPIJ-UHFFFAOYSA-N 0.000 description 1
- RMULVUFPLMJWOK-UHFFFAOYSA-N 5-chloro-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Cl RMULVUFPLMJWOK-UHFFFAOYSA-N 0.000 description 1
- XZSZSTCLQANXKU-UHFFFAOYSA-N 5-chloro-2,4-difluoropyrimidine Chemical compound FC1=NC=C(Cl)C(F)=N1 XZSZSTCLQANXKU-UHFFFAOYSA-N 0.000 description 1
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 1
- ZLNPDTOTEVIMMY-UHFFFAOYSA-N 5-chloropyrimidine Chemical compound ClC1=CN=CN=C1 ZLNPDTOTEVIMMY-UHFFFAOYSA-N 0.000 description 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 description 1
- OZDPATQEBXWLPZ-UHFFFAOYSA-N 6-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(C(O)=O)=N1 OZDPATQEBXWLPZ-UHFFFAOYSA-N 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- WMNXQGZTJUFUOW-UHFFFAOYSA-N CS(=O)(=O)C1=C(C(=NC=N1)S(=O)(=O)C)Cl Chemical compound CS(=O)(=O)C1=C(C(=NC=N1)S(=O)(=O)C)Cl WMNXQGZTJUFUOW-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical class O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 125000001153 fluoro group Chemical class F* 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- USPGWRYCHDAJCB-UHFFFAOYSA-N methyl 2,4-difluoropyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(F)N=C1F USPGWRYCHDAJCB-UHFFFAOYSA-N 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- FKORGLNGEASTQE-UHFFFAOYSA-N naphthalene-1,3-disulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC(S(O)(=O)=O)=C21 FKORGLNGEASTQE-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical group C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 229920006306 polyurethane fiber Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical group CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical compound N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/008—Monoazo dyes
- C09B62/0086—Monoazo dyes with coupling component containing a reactive methylene group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (10)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19722201280 DE2201280A1 (de) | 1972-01-12 | 1972-01-12 | Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellung |
IN65/CAL/73A IN139721B (en:Method) | 1972-01-12 | 1973-01-09 | |
JP48005364A JPS6011065B2 (ja) | 1972-01-12 | 1973-01-10 | モノアゾ系の水溶性反応性染料の製法 |
IT19136/73A IT978096B (it) | 1972-01-12 | 1973-01-10 | Coloranti reattivi idrosolubili della serie monoazoica e procedi mento per la loro preparazione |
US05/322,374 US3957751A (en) | 1972-01-12 | 1973-01-10 | Water-soluble reactive dyestuffs of the monoazo series containing an active methylene coupling component |
AR246055A AR193312A1 (es) | 1972-01-12 | 1973-01-10 | Colorantes reactivos hidrosolubles de la serie monoazo y procedimiento para su preparacion |
CH28873A CH582738A5 (en:Method) | 1972-01-12 | 1973-01-10 | |
GB155973A GB1406913A (en) | 1972-01-12 | 1973-01-11 | Water-soluble reactive dyestuffs of the monoazo series and processes for preparing them |
BR73222A BR7300222D0 (pt) | 1972-01-12 | 1973-01-11 | Processo para a preparacao de corantes reativos hidrossoluveis da serie monoazoica |
FR7301056A FR2168022B1 (en:Method) | 1972-01-12 | 1973-01-12 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19722201280 DE2201280A1 (de) | 1972-01-12 | 1972-01-12 | Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellung |
Publications (1)
Publication Number | Publication Date |
---|---|
DE2201280A1 true DE2201280A1 (de) | 1973-07-19 |
Family
ID=5832796
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19722201280 Pending DE2201280A1 (de) | 1972-01-12 | 1972-01-12 | Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellung |
Country Status (10)
Country | Link |
---|---|
US (1) | US3957751A (en:Method) |
JP (1) | JPS6011065B2 (en:Method) |
AR (1) | AR193312A1 (en:Method) |
BR (1) | BR7300222D0 (en:Method) |
CH (1) | CH582738A5 (en:Method) |
DE (1) | DE2201280A1 (en:Method) |
FR (1) | FR2168022B1 (en:Method) |
GB (1) | GB1406913A (en:Method) |
IN (1) | IN139721B (en:Method) |
IT (1) | IT978096B (en:Method) |
Families Citing this family (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2807260C2 (de) * | 1978-02-21 | 1986-10-09 | Hoechst Ag, 6230 Frankfurt | Wasserlösliche Farbstoffe, Verfahren zu deren Herstellung, ihre Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Fasermaterialien |
US4301068A (en) * | 1979-12-05 | 1981-11-17 | Eastman Kodak Company | Azo dyes from a 2-aminothiophene having 1 or 2 sulfated hydroxyalkoxycarbonyl or N-(hydrocyalkyl) carbamoyl groups on its ring |
US4301070A (en) * | 1979-12-05 | 1981-11-17 | Eastman Kodak Company | Azo dyes from a 5-aminopyrazole bearing 1 to 2 sulfated hydroxyalkoxycarbonyl or N-(hydroxyalkyl) carbamoyl groups on its ring |
US4302390A (en) * | 1979-12-05 | 1981-11-24 | Eastman Kodak Company | Azo dyes with sulfate groups on the diazotized 2-amino thiazol and 5-amino isothiazol moiety and with aniline, tetrahydroquinoline and benzomorpholine couplers |
US4302387A (en) * | 1979-12-05 | 1981-11-24 | Eastman Kodak Company | Azo dyes from 1,3,4-thiadiazol-2-yl and 1,2,4-thiadiazol-5-yl moieties bearing sulfated hydroxyalkoxycarbonyl or N-(hydroxyalkyl)carbamoyl groups on their rings |
US4301071A (en) * | 1979-12-05 | 1981-11-17 | Eastman Kodak Company | Azo dyes from aniline having 1 or 2 sulfated hydroxyalkoxycarbonyl or N-(hydroxyalkyl)carbamoyl groups on its ring |
US4374769A (en) * | 1981-06-17 | 1983-02-22 | Eastman Kodak Company | Water-soluble tris phenyl bisazo dyes for polyamide fibers |
DE3372292D1 (en) * | 1982-12-20 | 1987-08-06 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
US5182275A (en) * | 1987-07-13 | 1993-01-26 | Hoechst-Roussel Pharmaceuticals Incorporated | Dihydro-4(hydroxyalkyeneamino)quinolines |
Family Cites Families (12)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2670265A (en) * | 1954-02-23 | Process | ||
US2211339A (en) * | 1939-04-15 | 1940-08-13 | Eastman Kodak Co | Azo compounds and material colored therewith |
US2556743A (en) * | 1948-07-16 | 1951-06-12 | American Cyanamid Co | Metallized azo dyes |
US2863860A (en) * | 1955-06-29 | 1958-12-09 | Ici Ltd | New monoazo compounds |
US2969351A (en) * | 1957-03-11 | 1961-01-24 | Durand & Huguenin Ag | New metalliferous ortho:ortho'-dihydroxy-monoazo-dyestuffs |
DE1262475B (de) * | 1962-02-08 | 1968-03-07 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
DE1280448B (de) * | 1962-10-03 | 1968-10-17 | Hoechst Ag | Verfahren zur Herstellung von Azofarbstoffen |
DE1291036B (de) * | 1964-02-28 | 1969-03-20 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
FR1470022A (fr) * | 1966-02-24 | 1967-02-17 | Nouveaux colorants azoïques, leur production et applications | |
DE1644157C3 (de) * | 1966-05-03 | 1975-04-24 | Farbwerke Hoechst Ag Vormals Meister Lucius & Bruening, 6000 Frankfurt | Wasserlösliche Monoazoreaktivfarbstoffe und Verfahren zur Herstellung dieser Farbstoffe |
US3655642A (en) * | 1968-08-24 | 1972-04-11 | Hoechst Ag | Water-soluble monoazo dyestuffs containing a naphthalene diazo component |
CS153538B2 (en:Method) * | 1969-03-10 | 1974-02-25 |
-
1972
- 1972-01-12 DE DE19722201280 patent/DE2201280A1/de active Pending
-
1973
- 1973-01-09 IN IN65/CAL/73A patent/IN139721B/en unknown
- 1973-01-10 CH CH28873A patent/CH582738A5/xx not_active IP Right Cessation
- 1973-01-10 IT IT19136/73A patent/IT978096B/it active
- 1973-01-10 US US05/322,374 patent/US3957751A/en not_active Expired - Lifetime
- 1973-01-10 JP JP48005364A patent/JPS6011065B2/ja not_active Expired
- 1973-01-10 AR AR246055A patent/AR193312A1/es active
- 1973-01-11 BR BR73222A patent/BR7300222D0/pt unknown
- 1973-01-11 GB GB155973A patent/GB1406913A/en not_active Expired
- 1973-01-12 FR FR7301056A patent/FR2168022B1/fr not_active Expired
Also Published As
Publication number | Publication date |
---|---|
IN139721B (en:Method) | 1976-07-24 |
FR2168022A1 (en:Method) | 1973-08-24 |
FR2168022B1 (en:Method) | 1976-11-05 |
IT978096B (it) | 1974-09-20 |
GB1406913A (en) | 1975-09-17 |
AR193312A1 (es) | 1973-04-11 |
CH582738A5 (en:Method) | 1976-12-15 |
BR7300222D0 (pt) | 1973-09-20 |
JPS4880877A (en:Method) | 1973-10-29 |
US3957751A (en) | 1976-05-18 |
JPS6011065B2 (ja) | 1985-03-22 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0511523B1 (de) | Azofarbstoffe mit mehreren reaktiven Ankergruppen | |
DE1644203C3 (en:Method) | ||
DE2201280A1 (de) | Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellung | |
DE2951541A1 (de) | Verbindungen mit reaktiven resten | |
DE1644184C3 (de) | Reaktivfarbstoffe, Verfahren zu deren Herstellung und Verwendung zum Färben und Bedrucken cellulosehaltiger Materialien | |
DE2114158A1 (de) | Reaktivfarbstoffe | |
EP0071168B1 (de) | Wasserlösliche Disazoverbindungen und neue Bis-(aminophenoxy)-äthan-Verbindungen mit faserreaktiven Gruppen als Tetrazokomponenten, Verfahren zur Herstellung dieser Verbindungen und Verwendung der Disazoverbindungen als Farbstoffe | |
DE2318412C2 (de) | Azo-Reaktivfarbstoffe | |
DE2132963B2 (de) | Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre Verwendung | |
CH624426A5 (en) | Process for preparing reactive azo dyes | |
DE2050901B2 (de) | Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder Zellulose | |
DE2315638A1 (de) | Metallfreie monoazo-reaktivfarbstoffe | |
EP0641841B1 (de) | Azo-Reaktivfarbstoffe | |
DE1924570B2 (de) | Wasserloesliche azofarbstoffe, verfahren zu deren herstellung und ihre verwendung zum faerben und bedrucken | |
DE4418992A1 (de) | Neue Reaktivfarbstoffe, deren Herstellung und Verwendung | |
DE3039137A1 (de) | Reaktivfarbstoffe und verfahren zu ihrer herstellung sowie ihre verwendung zum faerben von cellulosetextilmaterialien | |
DE3135432A1 (de) | Wasserloesliche disazoverbindungen und wasserloesliche azokomponenten als deren vorprodukte sowie die herstellung und verwendung dieser verbindungen | |
EP0125650B1 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Substraten | |
EP0043411B1 (de) | Dis-Azoreaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von stickstoff- und/oder hydroxylgruppenhaltigen Materialien | |
DE2054198A1 (de) | Neue wasserlösliche faserreaktive Azofarbstoffe und Verfahren zu ihrer Herstellung | |
CH450594A (de) | Verfahren zur Herstellung von neuen Metallkomplexen von Bis- und Polyazoverbindungen | |
EP0050266B1 (de) | Disazoreaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und/oder Bedrucken hydroxyl- und/oder stickstoffhaltiger Materialien | |
EP0162386B1 (de) | Azoreaktivfarbstoffe | |
WO1991009913A1 (de) | Azoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
DE1813438C3 (de) | Reaktivmonoazofarbstoffe und deren Verwendung |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OD | Request for examination | ||
OHN | Withdrawal |