DE2201272A1 - Hydroxyalkylaminoalkylamide und Verfahren zu ihrer Herstellung - Google Patents
Hydroxyalkylaminoalkylamide und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2201272A1 DE2201272A1 DE19722201272 DE2201272A DE2201272A1 DE 2201272 A1 DE2201272 A1 DE 2201272A1 DE 19722201272 DE19722201272 DE 19722201272 DE 2201272 A DE2201272 A DE 2201272A DE 2201272 A1 DE2201272 A1 DE 2201272A1
- Authority
- DE
- Germany
- Prior art keywords
- nitrile
- lower alkyl
- group
- nhch
- hydroxyalkylaminoalkylamides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title description 4
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims description 21
- 150000002825 nitriles Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 230000037213 diet Effects 0.000 claims 1
- 235000005911 diet Nutrition 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical compound N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 claims 1
- 229920006391 phthalonitrile polymer Polymers 0.000 claims 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 25
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 16
- 239000000047 product Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 229910021529 ammonia Inorganic materials 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- -1 aryl nitriles Chemical class 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- VCZNNAKNUVJVGX-UHFFFAOYSA-N 4-methylbenzonitrile Chemical compound CC1=CC=C(C#N)C=C1 VCZNNAKNUVJVGX-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- BHXFKXOIODIUJO-UHFFFAOYSA-N benzene-1,4-dicarbonitrile Chemical compound N#CC1=CC=C(C#N)C=C1 BHXFKXOIODIUJO-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- WNDSQRGJJHSKCQ-UHFFFAOYSA-N naphthalene-1,5-dicarbonitrile Chemical compound C1=CC=C2C(C#N)=CC=CC2=C1C#N WNDSQRGJJHSKCQ-UHFFFAOYSA-N 0.000 description 2
- YJMNOKOLADGBKA-UHFFFAOYSA-N naphthalene-1-carbonitrile Chemical compound C1=CC=C2C(C#N)=CC=CC2=C1 YJMNOKOLADGBKA-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IUXYVKZUDNLISR-UHFFFAOYSA-N 2-(tert-butylamino)ethanol Chemical compound CC(C)(C)NCCO IUXYVKZUDNLISR-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- STDUWVXNNZTCAM-UHFFFAOYSA-N 2-[2-(2-hydroxyethylamino)ethyl]benzamide Chemical compound NC(=O)C1=CC=CC=C1CCNCCO STDUWVXNNZTCAM-UHFFFAOYSA-N 0.000 description 1
- FGCAYDRDVMXQOH-UHFFFAOYSA-N 2-[3-(2-hydroxypropylamino)propyl]benzamide Chemical compound CC(O)CNCCCC1=CC=CC=C1C(N)=O FGCAYDRDVMXQOH-UHFFFAOYSA-N 0.000 description 1
- PAFKFMDVIXXXME-UHFFFAOYSA-N 2-ethyl-8-(2-hydroxyhexylamino)octanamide Chemical compound CCCCC(O)CNCCCCCCC(CC)C(N)=O PAFKFMDVIXXXME-UHFFFAOYSA-N 0.000 description 1
- JXPDNDHCMMOJPC-UHFFFAOYSA-N 2-hydroxybutanedinitrile Chemical compound N#CC(O)CC#N JXPDNDHCMMOJPC-UHFFFAOYSA-N 0.000 description 1
- BLFRQYKZFKYQLO-UHFFFAOYSA-N 4-aminobutan-1-ol Chemical compound NCCCCO BLFRQYKZFKYQLO-UHFFFAOYSA-N 0.000 description 1
- YHXHPICGMVECJA-UHFFFAOYSA-N 4-n,4-n-bis[2-(2-hydroxyethylamino)ethyl]benzene-1,4-dicarboxamide Chemical compound NC(=O)C1=CC=C(C(=O)N(CCNCCO)CCNCCO)C=C1 YHXHPICGMVECJA-UHFFFAOYSA-N 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZTOMUSMDRMJOTH-UHFFFAOYSA-N glutaronitrile Chemical compound N#CCCCC#N ZTOMUSMDRMJOTH-UHFFFAOYSA-N 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- LAQPNDIUHRHNCV-UHFFFAOYSA-N isophthalonitrile Chemical compound N#CC1=CC=CC(C#N)=C1 LAQPNDIUHRHNCV-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- ODHYIQOBTIWVRZ-UHFFFAOYSA-N n-propan-2-ylhydroxylamine Chemical compound CC(C)NO ODHYIQOBTIWVRZ-UHFFFAOYSA-N 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- IAHFWCOBPZCAEA-UHFFFAOYSA-N succinonitrile Chemical compound N#CCCC#N IAHFWCOBPZCAEA-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229940045860 white wax Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S516/00—Colloid systems and wetting agents; subcombinations thereof; processes of
- Y10S516/01—Wetting, emulsifying, dispersing, or stabilizing agents
- Y10S516/07—Organic amine, amide, or n-base containing
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10904571A | 1971-01-22 | 1971-01-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2201272A1 true DE2201272A1 (de) | 1972-08-03 |
Family
ID=22325514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722201272 Pending DE2201272A1 (de) | 1971-01-22 | 1972-01-12 | Hydroxyalkylaminoalkylamide und Verfahren zu ihrer Herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3714249A (enExample) |
| BE (1) | BE778484A (enExample) |
| DE (1) | DE2201272A1 (enExample) |
| FR (1) | FR2122948A5 (enExample) |
| GB (1) | GB1350732A (enExample) |
| IT (1) | IT946460B (enExample) |
| NL (1) | NL7117450A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2425448A1 (de) * | 1974-05-25 | 1975-12-04 | Bayer Ag | Verfahren zur herstellung von polyurethanschaumstoffen |
| US4039565A (en) * | 1975-06-26 | 1977-08-02 | Ashland Oil, Inc. | Quaternized amidoamines |
| DE2616724C3 (de) * | 1976-04-15 | 1979-10-04 | Boehringer Mannheim Gmbh, 6800 Mannheim | Hydroxylalkylamide von Hydroxyphenylalaninen, ein Verfahren zu ihrer Herstellung und deren Verwendung |
| US4060553A (en) * | 1976-05-10 | 1977-11-29 | Petrolite Corporation | Hydroxyalkylaminoalkylamides and preparation and uses thereof |
| US4270001A (en) * | 1976-05-10 | 1981-05-26 | Petrolite Corporation | Quaternaries of hydroxyalkylaminoalkylamides |
| US4299982A (en) * | 1977-07-11 | 1981-11-10 | Petrolite Corporation | Quaternaries of hydroxyalkylaminoalkylamides |
| US4168292A (en) * | 1977-10-26 | 1979-09-18 | Petrolite Corporation | Acylated hydroxyalkylaminoalkylamides and preparation thereof and uses thereof as corrosion inhibitors |
| US4316038A (en) * | 1979-08-02 | 1982-02-16 | American Cyanamid Company | 1-(2-Methoxyethyl)-2-methyl-4-phenyl-2-imidazoline |
| US4854045A (en) * | 1985-01-01 | 1989-08-08 | Wenger Sa | Modular pocketknife |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2233296A (en) * | 1938-04-28 | 1941-02-25 | Gen Aniline & Film Corp | Process of making mono acyl alkylene diamines |
| US2551647A (en) * | 1950-02-08 | 1951-05-08 | Hoffmann La Roche | 3-hydroxy-4-oxo-naphthylideneamino-benzamides and method for preparing same |
| US2648708A (en) * | 1951-05-01 | 1953-08-11 | Hoffmann La Roche | Benzamide derivatives |
| NL229538A (enExample) * | 1957-07-13 | |||
| US3192214A (en) * | 1962-10-12 | 1965-06-29 | Olin Mathieson | Basic anilide derivatives |
-
1971
- 1971-01-22 US US00109045A patent/US3714249A/en not_active Expired - Lifetime
- 1971-12-20 NL NL7117450A patent/NL7117450A/xx unknown
-
1972
- 1972-01-11 IT IT19232/72A patent/IT946460B/it active
- 1972-01-12 DE DE19722201272 patent/DE2201272A1/de active Pending
- 1972-01-19 FR FR7201666A patent/FR2122948A5/fr not_active Expired
- 1972-01-21 GB GB298672A patent/GB1350732A/en not_active Expired
- 1972-01-26 BE BE778484A patent/BE778484A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2122948A5 (enExample) | 1972-09-01 |
| BE778484A (fr) | 1972-07-26 |
| GB1350732A (en) | 1974-04-24 |
| US3714249A (en) | 1973-01-30 |
| IT946460B (it) | 1973-05-21 |
| NL7117450A (enExample) | 1972-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0106055B1 (de) | Verfahren zur Herstellung von Carbamaten | |
| DE2201272A1 (de) | Hydroxyalkylaminoalkylamide und Verfahren zu ihrer Herstellung | |
| DE2616750B2 (de) | Polyaminoäther und Verfahren zu deren Herstellung | |
| DE69501487T2 (de) | Herstellung von Thioamiden | |
| DE69204806T2 (de) | 1-Cyanomethyl-4-carboxymethyl-3-ketopiperazine, ihre Salze und Verfahren zu ihrer Herstellung. | |
| DE2856384C3 (de) | Quartäre Ammoniumgruppen enthaltende Acrylyl- bzw. Methacrylylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE2454950C2 (de) | Verfahren zur Herstellung von 2-Aminobutan-1-ol und von dessen Säureanlagerungssalzen | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| DE2453365A1 (de) | Verfahren zur herstellung von n-trimethylsilylacetamid | |
| DE858551C (de) | Verfahren zur Herstellung von Piperidinderivaten | |
| DE2221109C2 (de) | Verfahren zur Herstellung von a-Anilincarbonsäurenitrilen | |
| EP0224849B1 (de) | Verfahren zur Herstellung von 4-Mercaptobenzonitrilen und neue 4-Mercaptobenzonitrile | |
| DE69127238T2 (de) | Verfahren zur Herstellung von Pyrido[1,2-a]pyrimidinderivaten | |
| DD236520A5 (de) | Verfahren zur herstellung von chlor-o-nitroanilinen | |
| EP0152598A1 (de) | Cyanomethyl-(2-cyano-ethyl)-(3-hydroxy-propyl)-amin, seine Verwendung zur Herstellung von 1-(3-Hydroxy-propyl)-1,4-diazepan und 1,4 Bis-[3-(3,4,5-trimethoxy-benzoyloxy)-propyl]-diazepan | |
| DE2000509C3 (de) | Verfahren zur Herstellung von 1-(N-Cyanoäthylamino)-benzolen | |
| DE866647C (de) | Verfahren zur Herstellung von sekundaeren 1, 3-Alkendiaminen | |
| DE1518903C3 (de) | Verfahren zur Herstellung von ungesättigten Sulfonsäurebetainen | |
| CH618160A5 (en) | Process for the preparation of beta-sulfo-propionic acid compounds | |
| EP0031089B1 (de) | Verfahren zur Herstellung von N,N'-Diarylalkylendiaminen oder N,N',N"-Triaryldialkylen-triaminen | |
| AT374190B (de) | Verfahren zur herstellung von chinoxalin-3-methyl-2-(carboxamid)-n1n4-dioxide | |
| DE1518315A1 (de) | Verfahren zur Herstellung von Tris-(N-acetamido)aminen | |
| AT345777B (de) | Verfahren zur herstellung von neuen, zumindest eine aethergruppe enthaltenden polyaminen | |
| DE2119302A1 (de) | Fluorierte carboxylierte Ampholyte und Verfahren zu ihrer Herstellung | |
| DD244341A1 (de) | Verfahren zur herstellung neuer 1h-pyrid-2-one |