DE2163458A1 - Harnstoffderivate - Google Patents
HarnstoffderivateInfo
- Publication number
- DE2163458A1 DE2163458A1 DE2163458A DE2163458A DE2163458A1 DE 2163458 A1 DE2163458 A1 DE 2163458A1 DE 2163458 A DE2163458 A DE 2163458A DE 2163458 A DE2163458 A DE 2163458A DE 2163458 A1 DE2163458 A1 DE 2163458A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- halogen
- lower alkyl
- methyl
- urea derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical class NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title 1
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 230000002363 herbicidal effect Effects 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000003672 ureas Chemical class 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 239000004009 herbicide Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- -1 phenoxyphenyl Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004001 thioalkyl group Chemical group 0.000 claims description 2
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 244000024671 Brassica kaber Species 0.000 description 6
- 244000061456 Solanum tuberosum Species 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- 235000011837 pasties Nutrition 0.000 description 6
- 235000002595 Solanum tuberosum Nutrition 0.000 description 5
- 235000008427 Brassica arvensis Nutrition 0.000 description 4
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 4
- 244000058871 Echinochloa crus-galli Species 0.000 description 4
- 235000011999 Panicum crusgalli Nutrition 0.000 description 4
- 244000062793 Sorghum vulgare Species 0.000 description 4
- 235000007244 Zea mays Nutrition 0.000 description 4
- 235000019713 millet Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 235000005637 Brassica campestris Nutrition 0.000 description 2
- 235000014750 Brassica kaber Nutrition 0.000 description 2
- 235000010149 Brassica rapa subsp chinensis Nutrition 0.000 description 2
- 235000010570 Brassica rapa var. rapa Nutrition 0.000 description 2
- 241001148727 Bromus tectorum Species 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 2
- 241001520808 Panicum virgatum Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 239000009032 Gur Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methyl urea Chemical compound CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE793090D BE793090A (fr) | 1971-12-21 | Derives de l'uree a activite herbicide | |
| DE2163458A DE2163458A1 (de) | 1971-12-21 | 1971-12-21 | Harnstoffderivate |
| IL40957A IL40957A0 (en) | 1971-12-21 | 1972-11-28 | Novel urea derivatives and their use as herbicides |
| JP47124024A JPS4867430A (enExample) | 1971-12-21 | 1972-12-12 | |
| AR245703A AR193450A1 (es) | 1971-12-21 | 1972-12-18 | Derivados de urea |
| IT54833/72A IT974157B (it) | 1971-12-21 | 1972-12-19 | Derivati ureici |
| NL7217301A NL7217301A (enExample) | 1971-12-21 | 1972-12-19 | |
| DD167691A DD104016A5 (enExample) | 1971-12-21 | 1972-12-19 | |
| BR8993/72A BR7208993D0 (pt) | 1971-12-21 | 1972-12-20 | Processo para produzir novos derivados de ureia substituidos, e, composicoes herbicidas, neles baseados |
| ZA728985A ZA728985B (en) | 1971-12-21 | 1972-12-20 | Urea derivatives |
| FR7245599A FR2167546A5 (en) | 1971-12-21 | 1972-12-21 | Substd n-acetyl ureas - selective herbicides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2163458A DE2163458A1 (de) | 1971-12-21 | 1971-12-21 | Harnstoffderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2163458A1 true DE2163458A1 (de) | 1973-07-05 |
Family
ID=5828674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2163458A Pending DE2163458A1 (de) | 1971-12-21 | 1971-12-21 | Harnstoffderivate |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS4867430A (enExample) |
| AR (1) | AR193450A1 (enExample) |
| BE (1) | BE793090A (enExample) |
| BR (1) | BR7208993D0 (enExample) |
| DD (1) | DD104016A5 (enExample) |
| DE (1) | DE2163458A1 (enExample) |
| FR (1) | FR2167546A5 (enExample) |
| IL (1) | IL40957A0 (enExample) |
| IT (1) | IT974157B (enExample) |
| NL (1) | NL7217301A (enExample) |
| ZA (1) | ZA728985B (enExample) |
-
0
- BE BE793090D patent/BE793090A/xx unknown
-
1971
- 1971-12-21 DE DE2163458A patent/DE2163458A1/de active Pending
-
1972
- 1972-11-28 IL IL40957A patent/IL40957A0/xx unknown
- 1972-12-12 JP JP47124024A patent/JPS4867430A/ja active Pending
- 1972-12-18 AR AR245703A patent/AR193450A1/es active
- 1972-12-19 DD DD167691A patent/DD104016A5/xx unknown
- 1972-12-19 IT IT54833/72A patent/IT974157B/it active
- 1972-12-19 NL NL7217301A patent/NL7217301A/xx unknown
- 1972-12-20 BR BR8993/72A patent/BR7208993D0/pt unknown
- 1972-12-20 ZA ZA728985A patent/ZA728985B/xx unknown
- 1972-12-21 FR FR7245599A patent/FR2167546A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4867430A (enExample) | 1973-09-14 |
| NL7217301A (enExample) | 1973-06-25 |
| FR2167546A5 (en) | 1973-08-24 |
| AR193450A1 (es) | 1973-04-23 |
| ZA728985B (en) | 1973-09-26 |
| IL40957A0 (en) | 1973-01-30 |
| BR7208993D0 (pt) | 1974-01-03 |
| IT974157B (it) | 1974-06-20 |
| BE793090A (fr) | 1973-06-20 |
| DD104016A5 (enExample) | 1974-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0314615B1 (de) | Schädlingsbekämpfungsmittel | |
| DE1953149A1 (de) | Mikrobizide Mittel | |
| DE2037265A1 (de) | Herbizid | |
| DE1770269A1 (de) | Neue Imidazol-Derivate und sie enthaltende herbizide Mittel | |
| CH380734A (de) | Verfahren zur Herstellung von neuen s-Triazinderivaten | |
| DE1908097A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1803728A1 (de) | Schaedlingsbekaempfungsmittel | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2709886A1 (de) | 2-iminothiazolinverbindungen und ihre 4,5-dihydroderivate, verfahren zur herstellung und verwendung in schaedlingsbekaempfungsmitteln | |
| DE2824126C2 (de) | Tetrahydro-1,3,5-thiadiazin-4-on-Verbindungen | |
| EP0183993A2 (de) | 2H-Imidazo[1',2':1,2]pyrrolo[3,4-b]pyridine und deren Verwendung als Unkrautbekämpfungsmittel | |
| DE1542715A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE2163458A1 (de) | Harnstoffderivate | |
| DE2537379A1 (de) | Substituierte 2-phenylimino-1,3- dithiolane, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitizide mittel | |
| DE2101698A1 (de) | Substituierte m-Trifluormethylphenylharnstoffderivate | |
| DE1518692A1 (de) | N-(2-Metyl-4-bromphenyl)-N',N'-dimethylformamidin und solches enthaltende Schaedlingsbekaempfungsmittel | |
| EP0135105A1 (de) | Mittel zur Bekämpfung von Insekten und Vertretern der Ordnung Akarina, welche als aktive Komponente 2-(1-Indolinyl-methyl)-imidazoline oder deren Salzen enthalten | |
| DE1204878B (de) | Akarizide Mittel | |
| DE2140842A1 (de) | 2-chloraethanphosphonsaeurederivate | |
| DE1643719A1 (de) | Substitutierte Dinitroaniline und diese enthaltende Herbizide | |
| DE2703266A1 (de) | Substituierte n-phenylmaleinimide, ihre herstellung und verwendung als fungizide | |
| DE2041996A1 (de) | Substituierte Uracile | |
| DE1670239A1 (de) | Substituierte Bernstensaeureimide | |
| DE2349970A1 (de) | N-benzoyl-n-(3-chlor-4-fluorphenyl)-2amino-propionsaeureester und deren verwendung als herbizide | |
| DE2852924A1 (de) | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |