DE2161173C3 - Oxydelektrode für elektrische Hochleistungs-Gasentladungslampen - Google Patents
Oxydelektrode für elektrische Hochleistungs-GasentladungslampenInfo
- Publication number
- DE2161173C3 DE2161173C3 DE2161173A DE2161173A DE2161173C3 DE 2161173 C3 DE2161173 C3 DE 2161173C3 DE 2161173 A DE2161173 A DE 2161173A DE 2161173 A DE2161173 A DE 2161173A DE 2161173 C3 DE2161173 C3 DE 2161173C3
- Authority
- DE
- Germany
- Prior art keywords
- electron
- oxide electrode
- cawo
- emitting material
- bao
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 45
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- 239000006104 solid solution Substances 0.000 claims description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 4
- 239000000919 ceramic Substances 0.000 claims description 3
- 238000011049 filling Methods 0.000 claims description 3
- 239000003870 refractory metal Substances 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims 1
- 229910052753 mercury Inorganic materials 0.000 claims 1
- 229910052756 noble gas Inorganic materials 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 24
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 15
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 10
- 239000000292 calcium oxide Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 8
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 238000007789 sealing Methods 0.000 description 6
- 229910052788 barium Inorganic materials 0.000 description 5
- 238000010891 electric arc Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 5
- VXAUWWUXCIMFIM-UHFFFAOYSA-M aluminum;oxygen(2-);hydroxide Chemical compound [OH-].[O-2].[Al+3] VXAUWWUXCIMFIM-UHFFFAOYSA-M 0.000 description 4
- 238000010586 diagram Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- 239000010955 niobium Substances 0.000 description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 2
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 2
- 239000000565 sealant Substances 0.000 description 2
- IATRAKWUXMZMIY-UHFFFAOYSA-N strontium oxide Chemical compound [O-2].[Sr+2] IATRAKWUXMZMIY-UHFFFAOYSA-N 0.000 description 2
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 2
- 229910001930 tungsten oxide Inorganic materials 0.000 description 2
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- FQNGWRSKYZLJDK-UHFFFAOYSA-N [Ca].[Ba] Chemical compound [Ca].[Ba] FQNGWRSKYZLJDK-UHFFFAOYSA-N 0.000 description 1
- WOIHABYNKOEWFG-UHFFFAOYSA-N [Sr].[Ba] Chemical compound [Sr].[Ba] WOIHABYNKOEWFG-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910003439 heavy metal oxide Inorganic materials 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/06—Main electrodes
- H01J61/073—Main electrodes for high-pressure discharge lamps
- H01J61/0735—Main electrodes for high-pressure discharge lamps characterised by the material of the electrode
- H01J61/0737—Main electrodes for high-pressure discharge lamps characterised by the material of the electrode characterised by the electron emissive material
Landscapes
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9790770A | 1970-12-14 | 1970-12-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2161173A1 DE2161173A1 (de) | 1972-06-29 |
| DE2161173B2 DE2161173B2 (de) | 1974-11-21 |
| DE2161173C3 true DE2161173C3 (de) | 1975-07-03 |
Family
ID=22265716
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2161173A Expired DE2161173C3 (de) | 1970-12-14 | 1971-12-09 | Oxydelektrode für elektrische Hochleistungs-Gasentladungslampen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3708710A (https=) |
| JP (1) | JPS5528180B1 (https=) |
| BR (1) | BR7108240D0 (https=) |
| CA (1) | CA940999A (https=) |
| DE (1) | DE2161173C3 (https=) |
| GB (1) | GB1366525A (https=) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3832588A (en) * | 1972-09-25 | 1974-08-27 | Gen Electric | Ceramic discharge lamp having metal end cap |
| US3935495A (en) * | 1974-03-22 | 1976-01-27 | General Electric Company | Chemically polished polycrystalline alumina material |
| NL175771B (nl) * | 1975-06-20 | 1984-07-16 | Philips Nv | Hogedrukgasontladingslamp en een werkwijze voor de vervaardiging hiervan. |
| US4052636A (en) * | 1976-08-02 | 1977-10-04 | General Electric Company | High pressure sodium vapor lamp stabilized for pulse operation |
| JPS5367972A (en) * | 1976-11-30 | 1978-06-16 | Mitsubishi Electric Corp | Electrode for elctric discharge lamp |
| US4152619A (en) * | 1977-10-26 | 1979-05-01 | Westinghouse Electric Corp. | HID lamp electrode comprising barium (yttrium or rare earth metal) tungstate or molybdate |
| NL177455C (nl) * | 1977-12-02 | 1985-09-16 | Philips Nv | Hogedrukmetaaldampontladingslamp. |
| US4152620A (en) * | 1978-06-29 | 1979-05-01 | Westinghouse Electric Corp. | High intensity vapor discharge lamp with sintering aids for electrode emission materials |
| NL175770C (nl) * | 1978-10-06 | 1984-12-17 | Philips Nv | Hogedruknatriumdampontladingslamp. |
| US4321503A (en) * | 1978-11-06 | 1982-03-23 | Westinghouse Electric Corp. | HID Lamp electrode comprising barium-calcium niobate or tantalate |
| US4210840A (en) * | 1978-12-12 | 1980-07-01 | Westinghouse Electric Corp. | HID Lamp emission material |
| US4275330A (en) * | 1979-03-08 | 1981-06-23 | General Electric Company | Electric discharge lamp having a cathode with cesium metal oxide |
| JPS5676156A (en) * | 1979-11-24 | 1981-06-23 | Matsushita Electronics Corp | High-pressure sodium-vapor lamp |
| DE3125270A1 (de) * | 1981-06-24 | 1983-01-13 | Egyesült Izzólámpa és Villamossági Részvénytársaság, 1340 Budapest | Hochdruck-gasentladungslampe mit einer ein aktives material beinhaltenden gluehkatode |
| DE3378392D1 (en) * | 1982-06-11 | 1988-12-08 | Gen Electric | High pressure sodium vapor lamp |
| US4479074A (en) * | 1982-09-02 | 1984-10-23 | North American Philips Lighting Corp. | High intensity vapor discharge lamp with sintering aids for electrode emission materials |
| JPS60159287U (ja) * | 1984-04-02 | 1985-10-23 | 三恵技研工業株式会社 | フレキシブルチユ−ブ |
| US4617492A (en) * | 1985-02-04 | 1986-10-14 | General Electric Company | High pressure sodium lamp having improved pressure stability |
| US4620129A (en) * | 1985-04-29 | 1986-10-28 | General Electric Company | Gettered high pressure sodium lamp |
| US4620128A (en) * | 1985-04-29 | 1986-10-28 | General Electric Company | Tungsten laden emission mix of improved stability |
| US5111108A (en) * | 1990-12-14 | 1992-05-05 | Gte Products Corporation | Vapor discharge device with electron emissive material |
| US6157132A (en) * | 1998-08-19 | 2000-12-05 | General Electric Company | Discharge lamp emission material |
| US6700326B1 (en) * | 1999-06-14 | 2004-03-02 | Osram Sylvania Inc. | Edge sealing electrode for discharge lamp |
| US7633226B2 (en) * | 2005-11-30 | 2009-12-15 | General Electric Company | Electrode materials for electric lamps and methods of manufacture thereof |
| CN114644517A (zh) * | 2022-03-29 | 2022-06-21 | 南京三乐集团有限公司 | 太赫兹行波管用高性能铝酸盐源及其制备方法 |
| CN115527821A (zh) * | 2022-09-22 | 2022-12-27 | 中国星网网络应用有限公司 | 一种发射体、加热体的制备方法及空心阴极 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3434812A (en) * | 1964-04-16 | 1969-03-25 | Gen Electric | Thermionic cathode |
| US3294998A (en) * | 1964-09-29 | 1966-12-27 | Gen Electric | Arc tube mounting for high pressure metal vapor lamps |
-
1970
- 1970-12-14 US US00097907A patent/US3708710A/en not_active Expired - Lifetime
-
1971
- 1971-10-14 GB GB4792971A patent/GB1366525A/en not_active Expired
- 1971-10-29 JP JP8563071A patent/JPS5528180B1/ja active Pending
- 1971-11-30 CA CA128,900A patent/CA940999A/en not_active Expired
- 1971-12-09 DE DE2161173A patent/DE2161173C3/de not_active Expired
- 1971-12-13 BR BR8240/71A patent/BR7108240D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7108240D0 (pt) | 1973-07-03 |
| DE2161173B2 (de) | 1974-11-21 |
| CA940999A (en) | 1974-01-29 |
| GB1366525A (en) | 1974-09-11 |
| US3708710A (en) | 1973-01-02 |
| DE2161173A1 (de) | 1972-06-29 |
| JPS5528180B1 (https=) | 1980-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2161173C3 (de) | Oxydelektrode für elektrische Hochleistungs-Gasentladungslampen | |
| DE2626700C2 (de) | Hochdruckgasentladungslampe und Verfahren zu ihrer Herstellung | |
| DE1589171B1 (de) | Natriumdampflampe hoher intensitaet mit quecksilber | |
| DE1464181B2 (de) | Elektrische hochdruck dampfentladungslampe | |
| DE3042291C2 (de) | Hochdruck-Metallhalogenid-Entladungslampe | |
| EP0453893B1 (de) | Hochdruckentladungslampe | |
| DE1220039B (de) | Elektrische Metalldampflampe | |
| DE2746671A1 (de) | Elektrische hochdruckentladungslampe | |
| DE2647396A1 (de) | Gasentladungspaneel | |
| DE69731374T2 (de) | Niederdruckentladunglampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2951741A1 (de) | Elektrode fuer eine entladungslampe | |
| DE3050460C2 (de) | Elektrische Blitzlampe | |
| DE2645930A1 (de) | Alkalimetall-lampe mit einem rohr aus aluminiumoxidkeramik und einer metallgetter-struktur | |
| DE2530076C3 (de) | Elektrode für Hochdruck-Entladungslampen | |
| DE2550661C3 (de) | Quecksilberdampf - Hochdrucklampe | |
| DE69915966T2 (de) | Niederdruck-Quecksilberdampfentladungslampe | |
| DE3686193T2 (de) | Natriumhochdruckentladungslampe mit getter. | |
| DE69608261T2 (de) | Niederdruckentladungslampe | |
| EP0592915B1 (de) | Niederdruckentladungslampe und Herstellungsverfahren für eine Niederdruckentladungslampe | |
| DE3733217C2 (https=) | ||
| DE69911538T2 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE3123605A1 (de) | Metalldampf-hochdruckentladungslampe | |
| DE3119747A1 (de) | Emittierende masse und verfahren zu ihrer herstellung | |
| DE2120471A1 (de) | Eine ummantelte Alkalihalogeniddampflampe mit Getter |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |