DE2154095C3 - Ammoniumpolyphosphat, Phosphoniumbromid-Kombinationen als Feuerhemmende Mittel für Propylenpolymere - Google Patents
Ammoniumpolyphosphat, Phosphoniumbromid-Kombinationen als Feuerhemmende Mittel für PropylenpolymereInfo
- Publication number
- DE2154095C3 DE2154095C3 DE2154095A DE2154095A DE2154095C3 DE 2154095 C3 DE2154095 C3 DE 2154095C3 DE 2154095 A DE2154095 A DE 2154095A DE 2154095 A DE2154095 A DE 2154095A DE 2154095 C3 DE2154095 C3 DE 2154095C3
- Authority
- DE
- Germany
- Prior art keywords
- dito
- phosphonium bromide
- cyanoethyl
- ammonium polyphosphate
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003063 flame retardant Substances 0.000 title claims description 21
- 229920001155 polypropylene Polymers 0.000 title claims description 16
- 229920001276 ammonium polyphosphate Polymers 0.000 title claims description 13
- 235000019826 ammonium polyphosphate Nutrition 0.000 title claims description 12
- 239000004114 Ammonium polyphosphate Substances 0.000 title claims description 11
- PMOIAJVKYNVHQE-UHFFFAOYSA-N phosphanium;bromide Chemical compound [PH4+].[Br-] PMOIAJVKYNVHQE-UHFFFAOYSA-N 0.000 title claims description 9
- 229920000642 polymer Polymers 0.000 claims description 13
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 6
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 5
- -1 bromobenzyl radical Chemical class 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 230000002195 synergetic effect Effects 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 238000005266 casting Methods 0.000 claims 2
- WEMXRTXQKRXSIO-UHFFFAOYSA-N propanenitrile Chemical group [CH2]CC#N WEMXRTXQKRXSIO-UHFFFAOYSA-N 0.000 claims 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims 1
- 238000005253 cladding Methods 0.000 claims 1
- 239000002131 composite material Substances 0.000 claims 1
- 230000006866 deterioration Effects 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 239000000835 fiber Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000010813 municipal solid waste Substances 0.000 claims 1
- 150000003018 phosphorus compounds Chemical class 0.000 claims 1
- 239000011342 resin composition Substances 0.000 claims 1
- 229920001169 thermoplastic Polymers 0.000 claims 1
- 239000004416 thermosoftening plastic Substances 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 239000000377 silicon dioxide Substances 0.000 description 8
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 6
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical compound [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 4
- 229910000410 antimony oxide Inorganic materials 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 3
- 239000001095 magnesium carbonate Substances 0.000 description 3
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 3
- 239000000395 magnesium oxide Substances 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 3
- 239000004408 titanium dioxide Substances 0.000 description 3
- 239000011787 zinc oxide Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- XKMRRTOUMJRJIA-UHFFFAOYSA-N ammonia nh3 Chemical compound N.N XKMRRTOUMJRJIA-UHFFFAOYSA-N 0.000 description 2
- HUCOKKBAZAFGJL-UHFFFAOYSA-N azanium phosphanium dibromide Chemical compound [NH4+].[Br-].[PH4+].[Br-] HUCOKKBAZAFGJL-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 125000006280 2-bromobenzyl group Chemical group [H]C1=C([H])C(Br)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 208000037062 Polyps Diseases 0.000 description 1
- 229910004856 P—O—P Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011885 synergistic combination Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/32—Phosphorus-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/50—Phosphorus bound to carbon only
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8530670A | 1970-10-29 | 1970-10-29 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2154095A1 DE2154095A1 (de) | 1972-05-04 |
| DE2154095B2 DE2154095B2 (de) | 1980-09-18 |
| DE2154095C3 true DE2154095C3 (de) | 1981-08-27 |
Family
ID=22190728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2154095A Expired DE2154095C3 (de) | 1970-10-29 | 1971-10-29 | Ammoniumpolyphosphat, Phosphoniumbromid-Kombinationen als Feuerhemmende Mittel für Propylenpolymere |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3649591A (enExample) |
| JP (1) | JPS527277B1 (enExample) |
| AU (1) | AU459684B2 (enExample) |
| BR (1) | BR7105930D0 (enExample) |
| CA (1) | CA957105A (enExample) |
| CH (1) | CH562314A5 (enExample) |
| DE (1) | DE2154095C3 (enExample) |
| FR (1) | FR2110105A5 (enExample) |
| GB (1) | GB1319027A (enExample) |
| NL (1) | NL7112306A (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3783146A (en) * | 1972-04-03 | 1974-01-01 | American Cyanamid Co | Ammonium polyphosphate-phosphonium bromide-alkoxyalkanolamine as flame-retardants for polyolefins |
| US4028336A (en) * | 1973-02-08 | 1977-06-07 | Velsicol Chemical Corporation | Plastic compositions |
| US4016137A (en) * | 1972-06-06 | 1977-04-05 | Michigan Chemical Corporation | Plastic compositions |
| US4035335A (en) * | 1973-02-08 | 1977-07-12 | Velsicol Chemical Corporation | Plastic compositions |
| US4032507A (en) * | 1973-02-08 | 1977-06-28 | Velsicol Chemical Corporation | Plastic compositions |
| US4016139A (en) * | 1973-02-08 | 1977-04-05 | Michigan Chemical Corporation | Plastic composition comprising acrylonitrile-butadiene-styrene polymer, a bis-phenoxy flame retardant and a flame retardant enhancing agent |
| US4045406A (en) * | 1973-02-08 | 1977-08-30 | Velsicol Chemical Corporation | Plastic compositions |
| US4033931A (en) * | 1973-02-08 | 1977-07-05 | Velsicol Chemical Corporation | Plastic compositions |
| US4038248A (en) * | 1973-02-08 | 1977-07-26 | Velsicol Chemical Corporation | Plastic compositions |
| US4082725A (en) * | 1973-02-08 | 1978-04-04 | Velsicol Chemical Corporation | Flame retardant plastic compositions |
| US4016138A (en) * | 1973-02-08 | 1977-04-05 | Michigan Chemical Corporation | Plastic compositions |
| US4041013A (en) * | 1973-02-08 | 1977-08-09 | Velsicol Chemical Corporation | Plastic compositions |
| US3936416A (en) * | 1973-07-24 | 1976-02-03 | Phillips Petroleum Company | Nonburning, nondripping, char-forming, polypropylene composition |
| US3936420A (en) * | 1973-07-24 | 1976-02-03 | Phillips Petroleum Company | Thermally stable, nonburning, nondripping, char forming polyolefin formulations |
| US4187214A (en) * | 1973-11-02 | 1980-02-05 | Phillips Petroleum Company | Fire retardant adhesive polyolefin compositions |
| US4096113A (en) * | 1974-07-15 | 1978-06-20 | Phillips Petroleum Company | Flame retardant polyolefins |
| US4043975A (en) * | 1976-11-12 | 1977-08-23 | Phillips Petroleum Company | Flame-resistant polyolefin compositions |
| US4174343A (en) * | 1978-05-05 | 1979-11-13 | American Cyanamid Company | Pentaerythrityl diphosphonate-ammonium polyphosphate combinations as flame retardants for olefin polymers |
| JP4304510B2 (ja) * | 2004-02-16 | 2009-07-29 | 信越化学工業株式会社 | 難燃性添加剤、並びにエマルション型コーティング剤及び難燃性組成物 |
| KR102186650B1 (ko) | 2018-03-30 | 2020-12-04 | 롯데첨단소재(주) | 열가소성 수지 조성물 및 이로부터 제조된 성형품 |
| KR102280351B1 (ko) * | 2018-12-21 | 2021-07-22 | 롯데첨단소재(주) | 열가소성 수지 조성물 및 이로부터 제조된 성형품 |
| EP4097171A1 (en) | 2020-01-27 | 2022-12-07 | Ricoh Company, Ltd. | Foamed sheet, manufacture, and method for producing foamed sheet |
| WO2021152387A1 (en) | 2020-01-27 | 2021-08-05 | Ricoh Company, Ltd. | Foamed sheet, manufacture, and method for producing foamed sheet |
| EP3872122A1 (en) | 2020-02-26 | 2021-09-01 | Ricoh Company, Ltd. | Foamed body, foamed sheet, manufacture, and method for producing foamed sheet |
| US12043717B2 (en) | 2020-11-24 | 2024-07-23 | Ricoh Company, Ltd. | Foam sheet, product, formed product, and method for producing foam sheet |
-
1970
- 1970-10-29 US US85306A patent/US3649591A/en not_active Expired - Lifetime
-
1971
- 1971-08-17 CA CA120,764A patent/CA957105A/en not_active Expired
- 1971-08-18 GB GB3884871A patent/GB1319027A/en not_active Expired
- 1971-08-18 AU AU32473/71A patent/AU459684B2/en not_active Expired
- 1971-09-07 NL NL7112306A patent/NL7112306A/xx unknown
- 1971-09-09 BR BR5930/71A patent/BR7105930D0/pt unknown
- 1971-10-20 JP JP46082547A patent/JPS527277B1/ja active Pending
- 1971-10-28 FR FR7138832A patent/FR2110105A5/fr not_active Expired
- 1971-10-29 DE DE2154095A patent/DE2154095C3/de not_active Expired
- 1971-10-29 CH CH1582071A patent/CH562314A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS527277B1 (enExample) | 1977-03-01 |
| NL7112306A (enExample) | 1972-05-03 |
| GB1319027A (en) | 1973-05-31 |
| CH562314A5 (enExample) | 1975-05-30 |
| BR7105930D0 (pt) | 1973-03-13 |
| DE2154095A1 (de) | 1972-05-04 |
| DE2154095B2 (de) | 1980-09-18 |
| AU459684B2 (en) | 1975-04-10 |
| US3649591A (en) | 1972-03-14 |
| AU3247371A (en) | 1973-02-22 |
| CA957105A (en) | 1974-11-05 |
| FR2110105A5 (enExample) | 1972-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2154095C3 (de) | Ammoniumpolyphosphat, Phosphoniumbromid-Kombinationen als Feuerhemmende Mittel für Propylenpolymere | |
| DE2546668A1 (de) | Selbstloeschende kunststoffmasse | |
| DE2460194A1 (de) | Verfahren zur unterdrueckung der rauchentwicklung brennender halogenhaltiger polymerisatmassen | |
| DE2331826A1 (de) | Thermoplastische massen | |
| DE2158432B2 (de) | Verstärkte Polyalkylenterephthalatmassen mit verringerter Brennbarkeit | |
| CH628664A5 (de) | Feuerhemmende polyamid-grundmischung und -masse. | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2456374B2 (de) | Flammenhemmende polymere Formmassen | |
| DE3687851T2 (de) | Polymerzusammensetzungen mit flammfestigkeitseigenschaften. | |
| DE19519820A1 (de) | Thermostabile, witterungsbeständige Polyamidformmassen | |
| DE1201053B (de) | Halogenierte Cyclohexane enthaltende Styrol-polymerisate | |
| DE3001901A1 (de) | Feuerhemmende harzmasse und ihre verwendung | |
| DE2928349B2 (de) | Flammschutzmittel für thermoplastische Kunststoffe | |
| DE2346177C3 (de) | Selbsterlöschende Formmasse | |
| DE2154096A1 (de) | Tert phosphinoxid Ammoniumpolyphos phat Kombinationen als feuerhemmende Zu satze für Propylenpolymere | |
| DE2443700C3 (de) | Homogene selbstverlöschende Formmasse aus Styrolpolymerisat | |
| DE3751579T2 (de) | Halogenfreie, feuerfeste kunstharzzusammensetzung. | |
| DE2225323C2 (de) | Flammwidrige Formmassen auf der Basis von Polyolefinen | |
| DE2548088C3 (de) | Selbstverlöschende Olefinpolymerisat- oder Styrolpolymerisatzusammensetzungen | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460324A1 (de) | Licht-stabilisierte polyphenylenaetherharz-zusammensetzung | |
| DE2013496A1 (de) | Feuerhemmende Additivsysteme | |
| DE1694494A1 (de) | Flammbestaendige Nylonzusammensetzungen | |
| DE1494926B2 (de) | Flammverzogerungsmittel fur thermo plastische Polymerisate | |
| DE2437525C2 (de) | Form- und Preßmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |