DE2135070C2 - Elektrolysiervorrichtung - Google Patents
ElektrolysiervorrichtungInfo
- Publication number
- DE2135070C2 DE2135070C2 DE2135070A DE2135070A DE2135070C2 DE 2135070 C2 DE2135070 C2 DE 2135070C2 DE 2135070 A DE2135070 A DE 2135070A DE 2135070 A DE2135070 A DE 2135070A DE 2135070 C2 DE2135070 C2 DE 2135070C2
- Authority
- DE
- Germany
- Prior art keywords
- rear wall
- bipolar
- hydrogen
- steel
- titanium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910000831 Steel Inorganic materials 0.000 claims description 74
- 239000010959 steel Substances 0.000 claims description 74
- 239000001257 hydrogen Substances 0.000 claims description 49
- 229910052739 hydrogen Inorganic materials 0.000 claims description 49
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 46
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 38
- 229910052751 metal Inorganic materials 0.000 claims description 29
- 239000002184 metal Substances 0.000 claims description 29
- 229910052742 iron Inorganic materials 0.000 claims description 19
- 238000000576 coating method Methods 0.000 claims description 18
- 230000015572 biosynthetic process Effects 0.000 claims description 17
- 239000011248 coating agent Substances 0.000 claims description 15
- 230000004888 barrier function Effects 0.000 claims description 12
- 150000004678 hydrides Chemical class 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 6
- 230000035699 permeability Effects 0.000 claims description 5
- 229910052719 titanium Inorganic materials 0.000 description 43
- 239000010936 titanium Substances 0.000 description 43
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 39
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 28
- 238000005868 electrolysis reaction Methods 0.000 description 24
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 18
- 229910052802 copper Inorganic materials 0.000 description 18
- 239000010949 copper Substances 0.000 description 18
- 230000001681 protective effect Effects 0.000 description 11
- 239000003792 electrolyte Substances 0.000 description 9
- 150000002739 metals Chemical class 0.000 description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 239000011133 lead Substances 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 229910052793 cadmium Inorganic materials 0.000 description 6
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 6
- 229910052725 zinc Inorganic materials 0.000 description 6
- 239000011701 zinc Substances 0.000 description 6
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 5
- 230000005012 migration Effects 0.000 description 5
- 238000013508 migration Methods 0.000 description 5
- 229910052750 molybdenum Inorganic materials 0.000 description 5
- 239000011733 molybdenum Substances 0.000 description 5
- -1 titanium hydride Chemical compound 0.000 description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 4
- 241000357293 Leptobrama muelleri Species 0.000 description 4
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 4
- 238000010073 coating (rubber) Methods 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229910052709 silver Inorganic materials 0.000 description 4
- 239000004332 silver Substances 0.000 description 4
- 238000009423 ventilation Methods 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 3
- 229910052737 gold Inorganic materials 0.000 description 3
- 239000010931 gold Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910000048 titanium hydride Inorganic materials 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- 229910000640 Fe alloy Inorganic materials 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 238000005215 recombination Methods 0.000 description 2
- 230000006798 recombination Effects 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910001200 Ferrotitanium Inorganic materials 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910000963 austenitic stainless steel Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- YOCUPQPZWBBYIX-UHFFFAOYSA-N copper nickel Chemical compound [Ni].[Cu] YOCUPQPZWBBYIX-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 239000012811 non-conductive material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 238000005482 strain hardening Methods 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 150000003608 titanium Chemical class 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/60—Constructional parts of cells
- C25B9/63—Holders for electrodes; Positioning of the electrodes
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/70—Assemblies comprising two or more cells
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5568070A | 1970-07-17 | 1970-07-17 | |
| US15869571A | 1971-07-01 | 1971-07-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2135070A1 DE2135070A1 (de) | 1972-01-27 |
| DE2135070C2 true DE2135070C2 (de) | 1982-06-03 |
Family
ID=26734521
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2135070A Expired DE2135070C2 (de) | 1970-07-17 | 1971-07-14 | Elektrolysiervorrichtung |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3759813A (enExample) |
| JP (1) | JPS578878B1 (enExample) |
| AU (1) | AU467993B2 (enExample) |
| BE (1) | BE770118A (enExample) |
| CA (1) | CA994711A (enExample) |
| DE (1) | DE2135070C2 (enExample) |
| FR (1) | FR2099429B1 (enExample) |
| GB (1) | GB1359210A (enExample) |
| IT (1) | IT939735B (enExample) |
| NL (1) | NL170969C (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3941675A (en) * | 1971-09-28 | 1976-03-02 | Friedrich Uhde Gmbh | Bipolar multiple electrolytic cell comprising a diaphragm and electrode for same |
| CA1094981A (en) * | 1972-09-15 | 1981-02-03 | Erco Industries Limited | Bipolar electrodes |
| JPS5647267B2 (enExample) * | 1973-03-13 | 1981-11-09 | ||
| US3920535A (en) * | 1973-05-25 | 1975-11-18 | Hooker Chemicals Plastics Corp | Bipolar electrode |
| US3899409A (en) * | 1973-05-25 | 1975-08-12 | Hooker Chemicals Plastics Corp | Bipolar electrode |
| US3878084A (en) * | 1973-05-25 | 1975-04-15 | Hooker Chemicals Plastics Corp | Bipolar electrode |
| SE377140B (enExample) * | 1973-08-20 | 1975-06-23 | Kema Nord Ab | |
| US3902985A (en) * | 1973-11-30 | 1975-09-02 | Ppg Industries Inc | Alakali metal chlorate cell having metal bipolar electrodes |
| US3884791A (en) * | 1973-11-30 | 1975-05-20 | Ppg Industries Inc | Electrolytic cell having metal electrodes |
| US3948750A (en) * | 1974-05-28 | 1976-04-06 | Hooker Chemical & Plastics Corporation | Hollow bipolar electrode |
| US3956097A (en) * | 1974-07-05 | 1976-05-11 | Electronor Corporation | Titanium blankets and anode constructions for diaphragm cells |
| JPS5232866B2 (enExample) * | 1974-10-09 | 1977-08-24 | ||
| US4085027A (en) * | 1975-01-29 | 1978-04-18 | Kerr-Mcgee Chemical Corporation | Hybrid bipolar electrode |
| US4069130A (en) * | 1975-01-29 | 1978-01-17 | Kerr-Mcgee Chemical Corporation | Bipolar electrode and method for constructing same |
| JPS526374A (en) * | 1975-07-07 | 1977-01-18 | Tokuyama Soda Co Ltd | Anode structure for electrolysis |
| US4059216A (en) * | 1975-12-15 | 1977-11-22 | Diamond Shamrock Corporation | Metal laminate strip construction of bipolar electrode backplates |
| US4118306A (en) * | 1976-02-02 | 1978-10-03 | Diamond Shamrock Technologies S. A. | Anode constructions for electrolysis cells |
| US4116807A (en) * | 1977-01-21 | 1978-09-26 | Diamond Shamrock Corporation | Explosion bonding of bipolar electrode backplates |
| US4088551A (en) * | 1977-02-15 | 1978-05-09 | Ppg Industries, Inc. | Electrolytic cell and method of electrolysis |
| US4316787A (en) * | 1979-08-06 | 1982-02-23 | Themy Constantinos D | High voltage electrolytic cell |
| US4339323A (en) * | 1980-09-18 | 1982-07-13 | Ppg Industries, Inc. | Bipolar electrolyzer element |
| US4402809A (en) * | 1981-09-03 | 1983-09-06 | Ppg Industries, Inc. | Bipolar electrolyzer |
| US4448663A (en) * | 1982-07-06 | 1984-05-15 | The Dow Chemical Company | Double L-shaped electrode for brine electrolysis cell |
| DE3926634A1 (de) * | 1988-08-11 | 1990-02-15 | Fraunhofer Ges Forschung | Vorrichtung zur gewinnung einer saeure aus ihrem salz |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3441495A (en) * | 1966-05-20 | 1969-04-29 | Electric Reduction Co | Bipolar electrolytic cell |
| US3451914A (en) * | 1966-08-31 | 1969-06-24 | Electric Reduction Co | Bipolar electrolytic cell |
| ES372809A1 (es) * | 1968-11-22 | 1971-11-01 | Solvay | Dispositivo de ensamblaje de electrodo bipolar para celda de electrolisis multiple. |
-
1971
- 1971-07-01 US US00158695A patent/US3759813A/en not_active Expired - Lifetime
- 1971-07-07 CA CA117,609A patent/CA994711A/en not_active Expired
- 1971-07-13 IT IT69365/71A patent/IT939735B/it active
- 1971-07-14 DE DE2135070A patent/DE2135070C2/de not_active Expired
- 1971-07-14 AU AU31201/71A patent/AU467993B2/en not_active Expired
- 1971-07-15 GB GB3316271A patent/GB1359210A/en not_active Expired
- 1971-07-16 FR FR7126097A patent/FR2099429B1/fr not_active Expired
- 1971-07-16 NL NLAANVRAGE7109887,A patent/NL170969C/xx not_active IP Right Cessation
- 1971-07-16 BE BE770118A patent/BE770118A/xx unknown
- 1971-07-17 JP JP5349371A patent/JPS578878B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3759813A (en) | 1973-09-18 |
| NL170969C (nl) | 1983-01-17 |
| IT939735B (it) | 1973-02-10 |
| GB1359210A (en) | 1974-07-10 |
| JPS578878B1 (enExample) | 1982-02-18 |
| NL170969B (nl) | 1982-08-16 |
| AU3120171A (en) | 1973-01-18 |
| BE770118A (enExample) | |
| NL7109887A (enExample) | 1972-01-19 |
| AU467993B2 (en) | 1975-12-18 |
| FR2099429A1 (enExample) | 1972-03-17 |
| DE2135070A1 (de) | 1972-01-27 |
| FR2099429B1 (enExample) | 1974-05-31 |
| CA994711A (en) | 1976-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2135070C2 (de) | Elektrolysiervorrichtung | |
| DE2809332C2 (de) | Monopolare Elektrolysezelle in Filterpressenbauweise | |
| EP0189535B1 (de) | Elektrolyseapparat | |
| DE60106419T2 (de) | Elektrolysezelle und elektrolyseverfahren | |
| DE2656650A1 (de) | Bipolare elektrode fuer eine elektrolysezelle | |
| DE2656110A1 (de) | Bipolare elektrode fuer filterpressen-elektrolysezellen und verfahren zu deren herstellung | |
| DE1421051B2 (de) | Mehrfachelektrolysezelle | |
| DE3108255C2 (de) | Baueinheit für Elektrolysezellen für die alkalische Wasserelektrolyse und Verfahren zur Herstellung derselben | |
| DE2809333C2 (de) | Monopolare Elektrolysezelle in Filterpressenbauweise | |
| EP0168600B1 (de) | Bipolarer Elektrolyseapparat mit Gasdiffusionskathode | |
| DE3542324C2 (de) | Elektrische Kurzschlußvorrichtung | |
| DE2262173B2 (de) | Auseinandernehmbare, bipolare Elektrode | |
| DE3324047A1 (de) | Umpolbare elektrodialyse-zelle und hierfuer geeignete elektroden | |
| DE2812055A1 (de) | Bipolare elektrode und verfahren zu ihrer herstellung | |
| EP0274138B1 (de) | Elektrodenanordnung für gasbildende Elektrolyseure mit vertikal angeordneten Plattenelektroden | |
| DE2125941C3 (de) | Bipolare Einheit und damit aufgebaute elektrolytische Zelle | |
| DE2357550B2 (de) | Bipolare Elektrolysiervorrichtung | |
| DE3239535C2 (de) | Verfahren zur Herstellung einer bipolaren Elektrode | |
| EP0333281A1 (de) | Membranelektrolysevorrichtung | |
| DE2650825A1 (de) | Bipolare elektrolysiereinrichtung | |
| DE2434353B2 (de) | Verfahren zur verminderung der titan- spaltkorrosion in einer bipolaren elektrolysiervorrichtung und vorrichtung dafuer | |
| DE3135320A1 (de) | Bipolare einheit fuer elektrolysezellen | |
| DE2148337A1 (de) | Bipolare mehrfach-elektrolysezelle mit diaphragma | |
| DE2550224A1 (de) | Anodenanordnung und bipolare elektrolysiervorrichtung mit einer derartigen anodenanordnung | |
| DE2538414C2 (de) | Elektrolyseapparat zur Herstellung von Chlor aus wässriger Alkalihalogenidlösung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |