DE2132997C3 - - Google Patents
Info
- Publication number
- DE2132997C3 DE2132997C3 DE19712132997 DE2132997A DE2132997C3 DE 2132997 C3 DE2132997 C3 DE 2132997C3 DE 19712132997 DE19712132997 DE 19712132997 DE 2132997 A DE2132997 A DE 2132997A DE 2132997 C3 DE2132997 C3 DE 2132997C3
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- alkali metal
- mixture
- percent
- aluminum oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 description 91
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 54
- 229910052783 alkali metal Inorganic materials 0.000 description 53
- 150000001340 alkali metals Chemical class 0.000 description 51
- 238000006243 chemical reaction Methods 0.000 description 50
- 239000000203 mixture Substances 0.000 description 50
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- 229910001868 water Inorganic materials 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 229910052757 nitrogen Inorganic materials 0.000 description 27
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 23
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 21
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 21
- 239000011734 sodium Substances 0.000 description 20
- 238000006317 isomerization reaction Methods 0.000 description 19
- 239000006185 dispersion Substances 0.000 description 18
- 229910052708 sodium Inorganic materials 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- 230000000694 effects Effects 0.000 description 12
- 239000007789 gas Substances 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 10
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 8
- 125000002619 bicyclic group Chemical class 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 8
- IIPYXGDZVMZOAP-UHFFFAOYSA-N lithium nitrate Chemical compound [Li+].[O-][N+]([O-])=O IIPYXGDZVMZOAP-UHFFFAOYSA-N 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 7
- -1 alkyl radical Chemical class 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 5
- 238000002441 X-ray diffraction Methods 0.000 description 5
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 5
- 238000004817 gas chromatography Methods 0.000 description 5
- UGJBFMMPNVKBPX-UHFFFAOYSA-N 5-propan-2-ylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C(C)C)CC1C=C2 UGJBFMMPNVKBPX-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001260 acyclic compounds Chemical class 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- OJOWICOBYCXEKR-UHFFFAOYSA-N 5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=CC)CC1C=C2 OJOWICOBYCXEKR-UHFFFAOYSA-N 0.000 description 3
- ONHIKQFUPWWRAB-UHFFFAOYSA-N 5-ethylidenebicyclo[2.2.2]oct-2-ene Chemical compound C1CC2C(=CC)CC1C=C2 ONHIKQFUPWWRAB-UHFFFAOYSA-N 0.000 description 3
- 150000001339 alkali metal compounds Chemical class 0.000 description 3
- 229910045601 alloy Inorganic materials 0.000 description 3
- 239000000956 alloy Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000011973 solid acid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- OVAIKAHGQOHGBD-UHFFFAOYSA-N 5-ethenylbicyclo[2.2.2]oct-2-ene Chemical compound C1CC2C(C=C)CC1C=C2 OVAIKAHGQOHGBD-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical compound CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LLVWLCAZSOLOTF-UHFFFAOYSA-N 1-methyl-4-[1,4,4-tris(4-methylphenyl)buta-1,3-dienyl]benzene Chemical compound C1=CC(C)=CC=C1C(C=1C=CC(C)=CC=1)=CC=C(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 LLVWLCAZSOLOTF-UHFFFAOYSA-N 0.000 description 1
- JYNJSHGSQNGSNF-UHFFFAOYSA-N 2-methyl-3-propan-2-ylidenebicyclo[2.2.1]hept-5-ene Chemical compound C1C2C=CC1C(C)C2=C(C)C JYNJSHGSQNGSNF-UHFFFAOYSA-N 0.000 description 1
- ILPBINAXDRFYPL-UHFFFAOYSA-N 2-octene Chemical compound CCCCCC=CC ILPBINAXDRFYPL-UHFFFAOYSA-N 0.000 description 1
- APANDOFKSVUKOJ-UHFFFAOYSA-N 3-ethenyl-2-methylbicyclo[2.2.2]oct-5-ene Chemical compound C1CC2C=CC1C(C)C2C=C APANDOFKSVUKOJ-UHFFFAOYSA-N 0.000 description 1
- NIDDGDUXNZBZJZ-UHFFFAOYSA-N 3-prop-1-en-2-ylbicyclo[2.2.1]heptane Chemical compound C1CC2C(C(=C)C)CC1C2 NIDDGDUXNZBZJZ-UHFFFAOYSA-N 0.000 description 1
- QHJFJYRDVNTTOT-UHFFFAOYSA-N 3-propan-2-ylidenebicyclo[2.2.1]heptane Chemical compound C1CC2C(=C(C)C)CC1C2 QHJFJYRDVNTTOT-UHFFFAOYSA-N 0.000 description 1
- INYHZQLKOKTDAI-UHFFFAOYSA-N 5-ethenylbicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(C=C)CC1C=C2 INYHZQLKOKTDAI-UHFFFAOYSA-N 0.000 description 1
- OMTCNAOVFIMOJE-UHFFFAOYSA-N 5-propan-2-ylidenebicyclo[2.2.2]oct-2-ene Chemical compound C1CC2C(=C(C)C)CC1C=C2 OMTCNAOVFIMOJE-UHFFFAOYSA-N 0.000 description 1
- FHSVSHAJUKCZHU-UHFFFAOYSA-N 5-propylidenebicyclo[2.2.2]oct-2-ene Chemical compound C(CC)=C1C2C=CC(C1)CC2 FHSVSHAJUKCZHU-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910000799 K alloy Inorganic materials 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 241000124033 Salix Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- HHUIAYDQMNHELC-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O HHUIAYDQMNHELC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000002015 acyclic group Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910001593 boehmite Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- AZRCNKIZGKJWOA-UHFFFAOYSA-N dioxosilane oxygen(2-) zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4].O=[Si]=O AZRCNKIZGKJWOA-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- OTTZHAVKAVGASB-UHFFFAOYSA-N hept-2-ene Chemical compound CCCCC=CC OTTZHAVKAVGASB-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- FAHBNUUHRFUEAI-UHFFFAOYSA-M hydroxidooxidoaluminium Chemical compound O[Al]=O FAHBNUUHRFUEAI-UHFFFAOYSA-M 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910001947 lithium oxide Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- BITYAPCSNKJESK-UHFFFAOYSA-N potassiosodium Chemical compound [Na].[K] BITYAPCSNKJESK-UHFFFAOYSA-N 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 229910001952 rubidium oxide Inorganic materials 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5852270 | 1970-07-02 | ||
| JP45058522A JPS4935264B1 (cg-RX-API-DMAC7.html) | 1970-07-02 | 1970-07-02 | |
| JP7264370A JPS503274B1 (cg-RX-API-DMAC7.html) | 1970-08-18 | 1970-08-18 | |
| JP7264370 | 1970-08-18 | ||
| JP3970171 | 1971-06-05 | ||
| JP3970171A JPS5721378B1 (cg-RX-API-DMAC7.html) | 1971-06-05 | 1971-06-05 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2132997A1 DE2132997A1 (de) | 1972-01-20 |
| DE2132997B2 DE2132997B2 (de) | 1976-12-23 |
| DE2132997C3 true DE2132997C3 (cg-RX-API-DMAC7.html) | 1977-08-11 |
Family
ID=27290237
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712132997 Granted DE2132997B2 (de) | 1970-07-02 | 1971-07-02 | Mit einem alkalimetallhydroxid und einem alkalimetall behandelter aluminiumoxid-katalysator und seine verwendung zur herstellung alkylidensubstituierter bicyclischer verbundungen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3808152A (cg-RX-API-DMAC7.html) |
| BE (1) | BE769443A (cg-RX-API-DMAC7.html) |
| CA (1) | CA984817A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2132997B2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK149621C (cg-RX-API-DMAC7.html) |
| FR (1) | FR2098137A5 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1340897A (cg-RX-API-DMAC7.html) |
| IL (1) | IL37199A (cg-RX-API-DMAC7.html) |
| IT (1) | IT939726B (cg-RX-API-DMAC7.html) |
| NL (1) | NL169830C (cg-RX-API-DMAC7.html) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2103221A5 (cg-RX-API-DMAC7.html) * | 1970-07-23 | 1972-04-07 | Sumitomo Chemical Co | |
| US4394302A (en) * | 1981-10-26 | 1983-07-19 | Union Oil Company Of California | Hydrodesulfurization catalyst on lithium-containing support and method for its preparation |
| US4772750A (en) * | 1985-06-14 | 1988-09-20 | The Dow Chemical Company | Method of producing amines |
| DE3675601D1 (de) * | 1985-08-16 | 1990-12-20 | Sumitomo Chemical Co | Verfahren zur vorbereitung einer festen base. |
| MX169136B (es) * | 1985-12-20 | 1993-06-23 | Sumitomo Chemical Co | Procedimiento para preparar 5-etiliden-2-norborneno de alta calidad |
| MX171769B (es) * | 1987-02-16 | 1993-11-15 | Sumitomo Chemical Co | Base catalitica solida y procedimiento para obtenerla |
| US5347062A (en) * | 1988-02-03 | 1994-09-13 | Sumitomo Chemical Co., Ltd. | Process for preparing alkyl-substituted aromatic hydrocarbons |
| US5227559A (en) * | 1988-02-03 | 1993-07-13 | Sumitomo Chemical Company, Ltd. | Process for preparing alkyl-subtituted aromatic hydrocarbons |
| US4992612A (en) * | 1988-08-12 | 1991-02-12 | Sumitomo Chemical Company, Limited | Solid base, process for producing the same and process of preparing internal olefins |
| NL8802179A (nl) * | 1988-09-02 | 1990-04-02 | B & D Ingenieursburo | Inrichting voor het behandelen van vloeistof voor het verhinderen en/of verwijderen van ketelsteenafzettingen. |
| US5849966A (en) * | 1991-05-14 | 1998-12-15 | Exxon Chemical Patents Inc. | Catalyst and process for the isomerization of olefins in the presence of reactive impurities |
| US5292985A (en) * | 1991-05-14 | 1994-03-08 | Exxon Chemical Patents, Inc. | Multi-stage olefin isomerization |
| ES2128696T3 (es) * | 1993-11-12 | 1999-05-16 | Exxon Chemical Patents Inc | Metodo para preparar un catalizador de isomerizacion. |
| CA2459546A1 (en) * | 2001-09-20 | 2003-03-27 | Biocon Limited | Modified alumina catalyst |
| WO2005051839A2 (en) * | 2003-11-24 | 2005-06-09 | Michael Lefenfeld | Silica gel compositions containing alkali metals and alkali metal alloys |
| JP5048503B2 (ja) * | 2004-09-22 | 2012-10-17 | シグナ・ケミストリー・リミテッド・ライアビリティ・カンパニー | 酸化チタンおよびアルミナアルカリ金属組成物 |
-
1971
- 1971-06-30 FR FR7123991A patent/FR2098137A5/fr not_active Expired
- 1971-06-30 CA CA117,105A patent/CA984817A/en not_active Expired
- 1971-07-01 GB GB3091371A patent/GB1340897A/en not_active Expired
- 1971-07-01 IL IL37199A patent/IL37199A/xx unknown
- 1971-07-01 IT IT69243/71A patent/IT939726B/it active
- 1971-07-02 US US00159308A patent/US3808152A/en not_active Expired - Lifetime
- 1971-07-02 DE DE19712132997 patent/DE2132997B2/de active Granted
- 1971-07-02 BE BE769443A patent/BE769443A/xx unknown
- 1971-07-02 DK DK327071A patent/DK149621C/da not_active IP Right Cessation
- 1971-07-02 NL NLAANVRAGE7109156,A patent/NL169830C/xx not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2132997C3 (cg-RX-API-DMAC7.html) | ||
| DE68905553T2 (de) | Feste base, verfahren fuer ihre herstellung und ihre verwendung fuer die bereitung von olefinen. | |
| DE2132997B2 (de) | Mit einem alkalimetallhydroxid und einem alkalimetall behandelter aluminiumoxid-katalysator und seine verwendung zur herstellung alkylidensubstituierter bicyclischer verbundungen | |
| EP0262389A1 (de) | Verfahren zur Herstellung von medizinischen Weissölen und medizinischen Paraffinen | |
| DE2137024C3 (de) | Verfahren zur Doppelbindungs-Isomerisierung von Olefinen | |
| DE2050908C2 (de) | Verfahren zur Herstellung von Weißöl | |
| DE2547100A1 (de) | Entschwefelungskatalysatoren und ihre verwendung bei der entschwefelung von kohlenwasserstoffverbindungen | |
| DE814293C (de) | Verfahren zur Ausfuehrung katalytischer Reaktionen | |
| DE2364688A1 (de) | Verfahren zur herstellung von dimethylnaphthalinen | |
| DE2314813C3 (de) | Kontinuierliches Verfahren zur Herstellung von dJ-Menthol | |
| DE1118973B (de) | Verfahren zur Herstellung eines Polymerisationskatalysators fuer die Herstellung von im wesentlichen linearem trans-1, 4-Polyisopren | |
| EP0066212B1 (de) | Verfahren zur katalytischen Hydrierung von Di-(4-aminophenyl)methan | |
| DE2626676A1 (de) | Verfahren zur herstellung von 2-pyrrolidon | |
| DE2040675A1 (de) | Verfahren zum Umwandeln von Olefinen mit 4 bis 12 Kohlenstoffatomen in ein Gemisch,das Olefine mit hoeherer und niedrigerer Kohlenstoffzahl als das Ausgangsgut enthaelt,durch doppelte Umsetzung | |
| DE19506096A1 (de) | Verfahren zur Herstellung von Bernsteinsäure-dialkylestern | |
| DE2407096A1 (de) | Hydrierungsverfahren mit metallhydroxydkatalysatoren der gruppe viii, die keine traeger enthalten | |
| DE626787C (de) | Verfahren zur Herstellung von Oxydationsprodukten aus hoehermolekularen Paraffinkohlenwasserstoffen | |
| DE2157534A1 (cg-RX-API-DMAC7.html) | ||
| DE3872679T2 (de) | Verfahren zur herstellung von inneren olefinen. | |
| DE2455319A1 (de) | Verfahren zur herstellung einer anorganischen verbindung mit der chemischen zusammensetzung eines zeolithen | |
| DE2157539C3 (de) | Verfahren zur Herstellung von 1,3-Cyclooctadien durch Isomerisierung von 1,5-Cycloodtadien über aus Aluminiumoxid und Alkalimetallen hergestellten Katalysatoren | |
| DE2360379C2 (de) | Zweistufiges Verfahren zur Herstellung medizinischer Öle mittels katalytisch hydrierender Behandlung | |
| DE3120087A1 (de) | "nickelcluster-katalysator auf einem metallmodifizierten traeger aus hochschmelzenden metalloxid/siliciumdioxid" | |
| DE4103431C2 (de) | Lanthan, Scandium oder Yttrium oder ein Alkali- oder Erdalkalimetall sowie gegebenenfalls Zinn enthaltender Katalysator sowie Verwendung desselben zur Umwandlung von Methan in höhere Kohlenwasserstoffe | |
| DE2430238B2 (de) | Verfahren zur Herstellung von Cyclopolyenen |