DE2125229C3 - Verfahren zur Herstellung von Chinazolinen - Google Patents
Verfahren zur Herstellung von ChinazolinenInfo
- Publication number
- DE2125229C3 DE2125229C3 DE2125229A DE2125229A DE2125229C3 DE 2125229 C3 DE2125229 C3 DE 2125229C3 DE 2125229 A DE2125229 A DE 2125229A DE 2125229 A DE2125229 A DE 2125229A DE 2125229 C3 DE2125229 C3 DE 2125229C3
- Authority
- DE
- Germany
- Prior art keywords
- formula
- trichloromethyl
- quinazolines
- halogen
- radicals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000003246 quinazolines Chemical class 0.000 title claims description 4
- 239000000460 chlorine Substances 0.000 claims description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- 150000004982 aromatic amines Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- -1 2,4-disubstituted Quinazolines Chemical class 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002723 alicyclic group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000002366 halogen compounds Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 12
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- SXLDBFDRSPKHLY-UHFFFAOYSA-N trichloro(isocyano)methane Chemical compound ClC(Cl)(Cl)[N+]#[C-] SXLDBFDRSPKHLY-UHFFFAOYSA-N 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 230000008030 elimination Effects 0.000 description 4
- 238000003379 elimination reaction Methods 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RLAROPIDCNCRNR-UHFFFAOYSA-N Cl.Cl.[C-]#N Chemical compound Cl.Cl.[C-]#N RLAROPIDCNCRNR-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000008241 heterogeneous mixture Substances 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- 235000021190 leftovers Nutrition 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- RLZAZSOIKZFKAV-UHFFFAOYSA-N 1,2-dichlorobenzene;hydrochloride Chemical compound Cl.ClC1=CC=CC=C1Cl RLZAZSOIKZFKAV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IROYFTFHERLMRO-UHFFFAOYSA-N 2,4,5,6,7,8-hexachloroquinazoline Chemical compound ClC=1C(=C(C(=C2C(=NC(=NC=12)Cl)Cl)Cl)Cl)Cl IROYFTFHERLMRO-UHFFFAOYSA-N 0.000 description 1
- VZDVVLXYAOVNRW-UHFFFAOYSA-N 2,4-dichloro-6-methylquinazoline Chemical compound N1=C(Cl)N=C(Cl)C2=CC(C)=CC=C21 VZDVVLXYAOVNRW-UHFFFAOYSA-N 0.000 description 1
- XCIWNFKPROTKHB-UHFFFAOYSA-N 2,4-dichloro-8-methylquinazoline Chemical compound N1=C(Cl)N=C2C(C)=CC=CC2=C1Cl XCIWNFKPROTKHB-UHFFFAOYSA-N 0.000 description 1
- TUQSVSYUEBNNKQ-UHFFFAOYSA-N 2,4-dichloroquinazoline Chemical compound C1=CC=CC2=NC(Cl)=NC(Cl)=C21 TUQSVSYUEBNNKQ-UHFFFAOYSA-N 0.000 description 1
- SPJXGIDHWJCRSL-UHFFFAOYSA-N 2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound CSCCC(C(O)=O)NC(=O)C(CC(C)C)NC(=O)OC(C)(C)C SPJXGIDHWJCRSL-UHFFFAOYSA-N 0.000 description 1
- SFKMVPQJJGJCMI-UHFFFAOYSA-N 2-chloro-4-phenylquinazoline Chemical compound C=12C=CC=CC2=NC(Cl)=NC=1C1=CC=CC=C1 SFKMVPQJJGJCMI-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- MFSIEROJJKUHBQ-UHFFFAOYSA-N O.[Cl] Chemical compound O.[Cl] MFSIEROJJKUHBQ-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- JQKBUTDZZRGQDR-UHFFFAOYSA-N hydron;4-methylaniline;chloride Chemical compound Cl.CC1=CC=C(N)C=C1 JQKBUTDZZRGQDR-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2125229A DE2125229C3 (de) | 1971-05-21 | 1971-05-21 | Verfahren zur Herstellung von Chinazolinen |
| US00249831A US3843652A (en) | 1971-05-21 | 1972-05-03 | Process for preparing quinazolines |
| GB2343372A GB1386326A (en) | 1971-05-21 | 1972-05-18 | Process for the production of quinazolines |
| IL7239473A IL39473A (en) | 1971-05-21 | 1972-05-18 | Process for the production of quinazolines |
| NL7206753A NL7206753A (enExample) | 1971-05-21 | 1972-05-18 | |
| IT24616/72A IT961184B (it) | 1971-05-21 | 1972-05-19 | Procedimento per la preparazione di chinazoline |
| BE783764A BE783764A (enExample) | 1971-05-21 | 1972-05-19 | |
| CA142,544A CA966130A (en) | 1971-05-21 | 1972-05-19 | Process for preparing quinazolines |
| FR727218149A FR2138837B1 (enExample) | 1971-05-21 | 1972-05-19 | |
| CH349372A CH583204A5 (enExample) | 1971-05-21 | 1972-05-19 | |
| ES403011A ES403011A1 (es) | 1971-05-21 | 1972-05-20 | Procedimiento para la obtencion de quinazolinas. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2125229A DE2125229C3 (de) | 1971-05-21 | 1971-05-21 | Verfahren zur Herstellung von Chinazolinen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2125229A1 DE2125229A1 (de) | 1972-11-30 |
| DE2125229B2 DE2125229B2 (de) | 1978-10-19 |
| DE2125229C3 true DE2125229C3 (de) | 1979-06-13 |
Family
ID=5808528
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2125229A Expired DE2125229C3 (de) | 1971-05-21 | 1971-05-21 | Verfahren zur Herstellung von Chinazolinen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3843652A (enExample) |
| BE (1) | BE783764A (enExample) |
| CA (1) | CA966130A (enExample) |
| CH (1) | CH583204A5 (enExample) |
| DE (1) | DE2125229C3 (enExample) |
| ES (1) | ES403011A1 (enExample) |
| FR (1) | FR2138837B1 (enExample) |
| GB (1) | GB1386326A (enExample) |
| IL (1) | IL39473A (enExample) |
| IT (1) | IT961184B (enExample) |
| NL (1) | NL7206753A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4102885A (en) * | 1977-06-20 | 1978-07-25 | Bristol-Myers Company | Process for preparing 2,4-dihaloquinazolines |
| US4639454A (en) * | 1985-01-17 | 1987-01-27 | E. I. Du Pont De Nemours And Company | Phenylquinazolinecarboxylic acids and derivatives as cancer chemotherapeutic agents |
| US20050288340A1 (en) * | 2004-06-29 | 2005-12-29 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
-
1971
- 1971-05-21 DE DE2125229A patent/DE2125229C3/de not_active Expired
-
1972
- 1972-05-03 US US00249831A patent/US3843652A/en not_active Expired - Lifetime
- 1972-05-18 GB GB2343372A patent/GB1386326A/en not_active Expired
- 1972-05-18 NL NL7206753A patent/NL7206753A/xx unknown
- 1972-05-18 IL IL7239473A patent/IL39473A/xx unknown
- 1972-05-19 IT IT24616/72A patent/IT961184B/it active
- 1972-05-19 BE BE783764A patent/BE783764A/xx unknown
- 1972-05-19 CH CH349372A patent/CH583204A5/xx not_active IP Right Cessation
- 1972-05-19 FR FR727218149A patent/FR2138837B1/fr not_active Expired
- 1972-05-19 CA CA142,544A patent/CA966130A/en not_active Expired
- 1972-05-20 ES ES403011A patent/ES403011A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL39473A (en) | 1975-07-28 |
| BE783764A (enExample) | 1972-11-20 |
| DE2125229A1 (de) | 1972-11-30 |
| DE2125229B2 (de) | 1978-10-19 |
| FR2138837A1 (enExample) | 1973-01-05 |
| CA966130A (en) | 1975-04-15 |
| US3843652A (en) | 1974-10-22 |
| IL39473A0 (en) | 1972-07-26 |
| GB1386326A (en) | 1975-03-05 |
| ES403011A1 (es) | 1975-04-16 |
| IT961184B (it) | 1973-12-10 |
| CH583204A5 (enExample) | 1976-12-31 |
| NL7206753A (enExample) | 1972-11-23 |
| FR2138837B1 (enExample) | 1973-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2614240C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE3200069A1 (de) | Verfahren zur herstellung von 2,4,6-trichloranilin | |
| DE2125229C3 (de) | Verfahren zur Herstellung von Chinazolinen | |
| DE1593865B2 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemi sehen | |
| EP0368008A1 (de) | Fluor enthaltende Phenole | |
| DE3104310A1 (de) | Verfahren zur herstellung von 5-chlor-2-nitroanilin | |
| EP0008097B1 (de) | Verfahren zur Herstellung von Indoleninen | |
| EP0206147A2 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodibenzylen | |
| DE2614241A1 (de) | Verfahren zur herstellung von acylcyaniden | |
| DE3605197A1 (de) | Verfahren zur herstellung von 4-nitrodiphenylaminen | |
| DE2054342A1 (de) | Neue 1,2,4-Oxdiazole | |
| EP0137175B1 (de) | Verfahren zur Herstellung von benzokondensierten, tetrachlorierten, heterocyclischen Verbindungen | |
| EP0478994B1 (de) | Verfahren zur Herstellung von 5-Hydroxy-3,4,5,6-tetrahydro-pyrimidin-Derivaten | |
| DE2221771C3 (de) | Verfahren zur Herstellung von α-Iminonitrilen | |
| EP0046859B1 (de) | Verfahren zur Herstellung von 1-Brom-3,5-dichlorbenzol | |
| DE19705466A1 (de) | Verfahren zur Herstellung von N-Alkylcarbazolen | |
| DE2711943C3 (de) | Verfahren zur Herstellung von 2-Hydroxycarbazolen | |
| DE1163803B (de) | Verfahren zur Herstellung von 3-Aryl-1,1,3,3-tetrachlor-2-aza-propenen | |
| DE1902419A1 (de) | 2-Amino-delta?-pyrroline und Verfahren zu ihrer Herstellung | |
| DE3904591A1 (de) | Verfahren zur herstellung von (beta)-chloraethylsulfonyl-arylisocyanaten | |
| EP0039905A1 (de) | Verfahren zur Herstellung von 2-Chlorbenzothiazol | |
| DE1224305B (de) | Verfahren zur Herstellung neuartiger Arylimin-Derivate | |
| CH498094A (de) | Verfahren zur Herstellung von 2,2,2-Trichloräthyliden-anilinen | |
| EP0311033A2 (de) | 3-Phthalimidothiophene bzw. deren Additionsprodukte mit Morpholin, Verfahren zu deren Herstellung, deren Verwendung zur Herstellung von 3-Aminothiophenen und das 3-Amino-5-chlorthiophen | |
| DE1568611A1 (de) | Verfahren zur Herstellung von Phenyltrichloracetimidchloriden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EHV | Ceased/renunciation |