DE2117573C3 - Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als Arzneimittel - Google Patents
Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als ArzneimittelInfo
- Publication number
- DE2117573C3 DE2117573C3 DE19712117573 DE2117573A DE2117573C3 DE 2117573 C3 DE2117573 C3 DE 2117573C3 DE 19712117573 DE19712117573 DE 19712117573 DE 2117573 A DE2117573 A DE 2117573A DE 2117573 C3 DE2117573 C3 DE 2117573C3
- Authority
- DE
- Germany
- Prior art keywords
- ester
- acid
- dihydropyridine
- ethanol
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 11
- 230000008569 process Effects 0.000 title claims description 7
- 239000003814 drug Substances 0.000 title description 5
- COLPLFZHPXIFCQ-UHFFFAOYSA-N 1,4-dihydropyridine-3,5-dicarboxylic acid Chemical class OC(=O)C1=CNC=C(C(O)=O)C1 COLPLFZHPXIFCQ-UHFFFAOYSA-N 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 27
- 150000002148 esters Chemical class 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 114
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 238000009835 boiling Methods 0.000 description 16
- 238000010438 heat treatment Methods 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- -1 methyl mercapto Chemical class 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- 150000001299 aldehydes Chemical class 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 10
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 8
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- AXLMPTNTPOWPLT-UHFFFAOYSA-N prop-2-enyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC=C AXLMPTNTPOWPLT-UHFFFAOYSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 3
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- DHGFMVMDBNLMKT-UHFFFAOYSA-N propyl 3-oxobutanoate Chemical compound CCCOC(=O)CC(C)=O DHGFMVMDBNLMKT-UHFFFAOYSA-N 0.000 description 3
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 2
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 2
- OPHQOIGEOHXOGX-UHFFFAOYSA-N 3,4,5-trimethoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(OC)=C1OC OPHQOIGEOHXOGX-UHFFFAOYSA-N 0.000 description 2
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- QRVYABWJVXXOTN-UHFFFAOYSA-N 4-methylsulfanylbenzaldehyde Chemical compound CSC1=CC=C(C=O)C=C1 QRVYABWJVXXOTN-UHFFFAOYSA-N 0.000 description 2
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 2
- KAOHYMHKNXJUFY-HYXAFXHYSA-N ethyl (z)-2-aminobut-2-enoate Chemical compound CCOC(=O)C(\N)=C\C KAOHYMHKNXJUFY-HYXAFXHYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 125000005493 quinolyl group Chemical group 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- XJRIDJAGAYGJCK-UHFFFAOYSA-N (1-acetyl-5-bromoindol-3-yl) acetate Chemical compound C1=C(Br)C=C2C(OC(=O)C)=CN(C(C)=O)C2=C1 XJRIDJAGAYGJCK-UHFFFAOYSA-N 0.000 description 1
- XORZEQZOEIWCJH-SNAWJCMRSA-N (E)-2-amino-3-methylpent-2-enoic acid Chemical compound N\C(=C(/C)\CC)\C(=O)O XORZEQZOEIWCJH-SNAWJCMRSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- GISVICWQYMUPJF-UHFFFAOYSA-N 2,4-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(C)=C1 GISVICWQYMUPJF-UHFFFAOYSA-N 0.000 description 1
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 1
- RMZQSAMHIQBMLW-UHFFFAOYSA-N 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C)NC(C)=C(C(O)=O)C1C1=CC=CC=C1[N+]([O-])=O RMZQSAMHIQBMLW-UHFFFAOYSA-N 0.000 description 1
- TZDPJNSHSWMCPN-UHFFFAOYSA-N 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C)NC(C)=C(C(O)=O)C1C1=CC=CC([N+]([O-])=O)=C1 TZDPJNSHSWMCPN-UHFFFAOYSA-N 0.000 description 1
- WHFZQNNDIJKLIO-UHFFFAOYSA-N 2,6-dinitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1C=O WHFZQNNDIJKLIO-UHFFFAOYSA-N 0.000 description 1
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 1
- WRIAMYXQKSDDRP-UHFFFAOYSA-N 2-bromo-6-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(Br)=C1C=O WRIAMYXQKSDDRP-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- DYNFCHNNOHNJFG-UHFFFAOYSA-N 2-formylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=O DYNFCHNNOHNJFG-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- PLHCSZRZWOWUBW-UHFFFAOYSA-N 2-methoxyethyl 3-oxobutanoate Chemical compound COCCOC(=O)CC(C)=O PLHCSZRZWOWUBW-UHFFFAOYSA-N 0.000 description 1
- PJKVFARRVXDXAD-UHFFFAOYSA-N 2-naphthaldehyde Chemical compound C1=CC=CC2=CC(C=O)=CC=C21 PJKVFARRVXDXAD-UHFFFAOYSA-N 0.000 description 1
- ZZJVNPRHHLLANO-UHFFFAOYSA-N 2-propan-2-yloxybenzaldehyde Chemical compound CC(C)OC1=CC=CC=C1C=O ZZJVNPRHHLLANO-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 description 1
- BHRLPDORPMWEQO-UHFFFAOYSA-N 3-O-ethyl 5-O-propyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound C(CC)OC(=O)C=1C(C(=C(NC1C)C)C(=O)OCC)C1=CC(=CC=C1)[N+](=O)[O-] BHRLPDORPMWEQO-UHFFFAOYSA-N 0.000 description 1
- PRRBQHNMYJRHFW-UHFFFAOYSA-M 3-oxoheptanoate Chemical compound CCCCC(=O)CC([O-])=O PRRBQHNMYJRHFW-UHFFFAOYSA-M 0.000 description 1
- WQGFZQFGVYDFOP-UHFFFAOYSA-N 4,6-dimethoxypyrimidine-5-carbaldehyde Chemical compound COC1=NC=NC(OC)=C1C=O WQGFZQFGVYDFOP-UHFFFAOYSA-N 0.000 description 1
- BEOBZEOPTQQELP-UHFFFAOYSA-N 4-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(C=O)C=C1 BEOBZEOPTQQELP-UHFFFAOYSA-N 0.000 description 1
- MZPNQUMLOFWSEK-UHFFFAOYSA-N 4-chloro-2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1C=O MZPNQUMLOFWSEK-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- KLTDQLIGNSBZPO-UHFFFAOYSA-N 4-methoxy-2-nitrobenzaldehyde Chemical compound COC1=CC=C(C=O)C([N+]([O-])=O)=C1 KLTDQLIGNSBZPO-UHFFFAOYSA-N 0.000 description 1
- JVVPPRRJHPQUHT-UHFFFAOYSA-N 6-chloro-3-methoxy-2-nitrobenzaldehyde Chemical compound COC1=CC=C(Cl)C(C=O)=C1[N+]([O-])=O JVVPPRRJHPQUHT-UHFFFAOYSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000003440 anti-fibrillation Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- GJOSRMAVDXJBCZ-UHFFFAOYSA-N cyclohexyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCCC1 GJOSRMAVDXJBCZ-UHFFFAOYSA-N 0.000 description 1
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 1
- MPFLRYZEEAQMLQ-UHFFFAOYSA-N dinicotinic acid Chemical compound OC(=O)C1=CN=CC(C(O)=O)=C1 MPFLRYZEEAQMLQ-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- SYFFHRPDTQNMQB-UHFFFAOYSA-N ethyl 3-oxopropanoate Chemical compound CCOC(=O)CC=O SYFFHRPDTQNMQB-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- RIZZXCJMFIGMON-UHFFFAOYSA-N prop-2-ynyl acetate Chemical compound CC(=O)OCC#C RIZZXCJMFIGMON-UHFFFAOYSA-N 0.000 description 1
- JEMFYCFWXQJCPM-XQRVVYSFSA-N propan-2-yl (z)-2-aminobut-2-enoate Chemical compound C\C=C(/N)C(=O)OC(C)C JEMFYCFWXQJCPM-XQRVVYSFSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- MGCGJBXTNWUHQE-UHFFFAOYSA-N quinoline-4-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CC=NC2=C1 MGCGJBXTNWUHQE-UHFFFAOYSA-N 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- IRFHMTUHTBSEBK-QGZVFWFLSA-N tert-butyl n-[(2s)-2-(2,5-difluorophenyl)-3-quinolin-3-ylpropyl]carbamate Chemical compound C1([C@H](CC=2C=C3C=CC=CC3=NC=2)CNC(=O)OC(C)(C)C)=CC(F)=CC=C1F IRFHMTUHTBSEBK-QGZVFWFLSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Priority Applications (21)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712117573 DE2117573C3 (de) | 1971-04-10 | 1971-04-10 | Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als Arzneimittel |
| CH346072A CH571492A5 (esLanguage) | 1971-04-10 | 1972-03-09 | |
| SU1768161A SU421193A3 (ru) | 1971-04-10 | 1972-04-05 | Способ получения несимметричных эфиров 1,4-дигидропиридиндикарбоновых кислот |
| BG020166A BG20105A3 (bg) | 1971-04-10 | 1972-04-06 | Метод за получаване на естери на несиметрични 1,4-дихидропиридин- дикарбонови киселини |
| FI94872A FI55188C (fi) | 1971-04-10 | 1972-04-06 | Foerfarande foer framstaellning av nya osymmetriska 1 4-dihydropyridindikarboxylsyraestrar |
| DD16215572A DD104520A5 (esLanguage) | 1971-04-10 | 1972-04-07 | |
| JP3450872A JPS5529990B1 (esLanguage) | 1971-04-10 | 1972-04-07 | |
| LU65130D LU65130A1 (esLanguage) | 1971-04-10 | 1972-04-07 | |
| NO119272A NO133712C (esLanguage) | 1971-04-10 | 1972-04-07 | |
| DK172472A DK134600C (da) | 1971-04-10 | 1972-04-07 | Fremgangsmade til fremstilling af usymmetriske 1,4-dihydropyridindicarboxylsyreestere |
| NL7204695A NL170535C (nl) | 1971-04-10 | 1972-04-07 | Werkwijze voor het bereiden van asymmetrische 1.4-dihydropyridine 3.5-dicarbonzuuresters, alsmede voor het bereiden van farmaceutische preparaten en de onder toepassing daarvan verkregen gevormde voortbrengselen. |
| AT301872A AT315178B (de) | 1971-04-10 | 1972-04-07 | Verfahren zur Herstellung von neuen unsymmetrischen 1,4-Dihydropyridindicarbonsäureestern |
| ES401616A ES401616A1 (es) | 1971-04-10 | 1972-04-08 | Procedimiento para la obtencion de 1,4-dihidropiridin - di-carboxilatos asimetricos. |
| PL15462572A PL83824B1 (esLanguage) | 1971-04-10 | 1972-04-08 | |
| SE460872A SE371441B (esLanguage) | 1971-04-10 | 1972-04-10 | |
| CA139293A CA934758A (en) | 1971-04-10 | 1972-04-10 | Process for the preparation of unsymmetrical 1,4-dihydropyridine 3,5-dicarboxylates |
| CS237972A CS178407B2 (esLanguage) | 1971-04-10 | 1972-04-10 | |
| RO7048872A RO61069A (esLanguage) | 1971-04-10 | 1972-04-10 | |
| YU95672A YU34992B (en) | 1971-04-10 | 1972-04-10 | Process for preparing non-symmetric 1,4-dihydrpyridines |
| HUBA002727 HU163996B (esLanguage) | 1971-04-10 | 1972-04-10 | |
| YU96072A YU34993B (en) | 1971-04-10 | 1972-04-10 | Process for preparing novel non-symmetric 1,4-dihydropyridines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712117573 DE2117573C3 (de) | 1971-04-10 | 1971-04-10 | Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als Arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2117573A1 DE2117573A1 (de) | 1972-10-19 |
| DE2117573B2 DE2117573B2 (de) | 1977-12-01 |
| DE2117573C3 true DE2117573C3 (de) | 1978-07-27 |
Family
ID=5804435
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712117573 Expired DE2117573C3 (de) | 1971-04-10 | 1971-04-10 | Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als Arzneimittel |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS5529990B1 (esLanguage) |
| AT (1) | AT315178B (esLanguage) |
| BG (1) | BG20105A3 (esLanguage) |
| CA (1) | CA934758A (esLanguage) |
| CH (1) | CH571492A5 (esLanguage) |
| CS (1) | CS178407B2 (esLanguage) |
| DD (1) | DD104520A5 (esLanguage) |
| DE (1) | DE2117573C3 (esLanguage) |
| DK (1) | DK134600C (esLanguage) |
| ES (1) | ES401616A1 (esLanguage) |
| FI (1) | FI55188C (esLanguage) |
| HU (1) | HU163996B (esLanguage) |
| LU (1) | LU65130A1 (esLanguage) |
| NL (1) | NL170535C (esLanguage) |
| NO (1) | NO133712C (esLanguage) |
| PL (1) | PL83824B1 (esLanguage) |
| RO (1) | RO61069A (esLanguage) |
| SE (1) | SE371441B (esLanguage) |
| SU (1) | SU421193A3 (esLanguage) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2320750A1 (fr) * | 1975-08-12 | 1977-03-11 | Hexachimie | Dihydro-1,4 pyridines et leur application therapeutique |
| DE2650013C3 (de) * | 1976-10-30 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | 1.4-Dihydro-2.6-dimethyl-4-(3-nitrophenyl)-3.5-pyridindicarbonsäureisopropyl-(2-propoxy-äthyl)-ester, Verfahren zu seiner Herstellung sowie ihn enthaltende Arzneimittel |
| DE2815578C2 (de) * | 1978-04-11 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Neue pharmazeutische Verwendung von Nimodipin |
| SE429652B (sv) * | 1978-06-30 | 1983-09-19 | Haessle Ab | 2.6-dimetyl-4-(2.3-diklorfenyl)-1.4-dihydropyridin-3.5-dikarboxylsyra-3-metylester-5-etylester |
| DE2841667A1 (de) * | 1978-09-25 | 1980-04-10 | Bayer Ag | Fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| JPS58159490A (ja) * | 1982-02-23 | 1983-09-21 | Nikken Kagaku Kk | 1,4−ジヒドロピリジン化合物 |
| DE3208628A1 (de) * | 1982-03-10 | 1983-09-22 | Bayer Ag, 5090 Leverkusen | Neue verbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| JPS58185562A (ja) * | 1982-04-22 | 1983-10-29 | Taisho Pharmaceut Co Ltd | 1,4−ジヒドロピリジン誘導体 |
| DE3222367A1 (de) * | 1982-06-15 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | Verwendung von 1,4-dihydropyridinen in antiarteriosklerotika und deren herstellung |
| US4656181A (en) * | 1982-11-24 | 1987-04-07 | Cermol S.A. | Esters of 1,4-dihydropyridines, processes for the preparation of the new esters, and medicaments containing the same |
| US4529733A (en) * | 1983-04-06 | 1985-07-16 | Merrell Dow Pharmaceuticals Inc. | Antihypertensive 3-furoyl-1,4-dihydropyridines |
| US4607041A (en) * | 1983-04-27 | 1986-08-19 | Fisons Plc | Antihypertensive 2-phenyl Hantzsch dihydropyridines |
| IE57810B1 (en) * | 1984-03-27 | 1993-04-21 | Delagrange Lab | 1,4-dihydropyridine derivatives,their preparation and their use |
| EP0311053A3 (en) * | 1987-10-06 | 1991-05-08 | Banyu Pharmaceutical Co., Ltd. | Ameliorant of cerebral circulation and optical isomer of nb-818, processes for its production and its use |
| DE3741540A1 (de) * | 1987-12-08 | 1989-06-22 | Bayer Ag | Verfahren zur herstellung von unsymmetrischen dihydropyridinen |
| DK0657432T3 (da) * | 1993-12-10 | 2003-07-07 | Bayer Ag | Phenylsubstituerede 1,4-dihydropyridiner med cerebral aktivitet |
| US5977369A (en) * | 1995-12-28 | 1999-11-02 | Napp Technologies, Inc. | Process to prepare dihydropyridine and derivatives thereof |
| IT1283793B1 (it) * | 1996-08-23 | 1998-04-30 | Lusochimica Spa | Processo per la preparazione di diidropiridine |
| AU8430098A (en) * | 1998-07-23 | 2000-02-14 | Ing-Jun Chen | Guaiacoxypropanolamines with alpha/beta-adrenergic blocking activity |
-
1971
- 1971-04-10 DE DE19712117573 patent/DE2117573C3/de not_active Expired
-
1972
- 1972-03-09 CH CH346072A patent/CH571492A5/xx not_active IP Right Cessation
- 1972-04-05 SU SU1768161A patent/SU421193A3/ru active
- 1972-04-06 FI FI94872A patent/FI55188C/fi active
- 1972-04-06 BG BG020166A patent/BG20105A3/xx unknown
- 1972-04-07 JP JP3450872A patent/JPS5529990B1/ja active Pending
- 1972-04-07 DD DD16215572A patent/DD104520A5/xx unknown
- 1972-04-07 LU LU65130D patent/LU65130A1/xx unknown
- 1972-04-07 DK DK172472A patent/DK134600C/da not_active IP Right Cessation
- 1972-04-07 AT AT301872A patent/AT315178B/de active
- 1972-04-07 NO NO119272A patent/NO133712C/no unknown
- 1972-04-07 NL NL7204695A patent/NL170535C/xx not_active IP Right Cessation
- 1972-04-08 PL PL15462572A patent/PL83824B1/pl unknown
- 1972-04-08 ES ES401616A patent/ES401616A1/es not_active Expired
- 1972-04-10 CS CS237972A patent/CS178407B2/cs unknown
- 1972-04-10 HU HUBA002727 patent/HU163996B/hu unknown
- 1972-04-10 RO RO7048872A patent/RO61069A/ro unknown
- 1972-04-10 CA CA139293A patent/CA934758A/en not_active Expired
- 1972-04-10 SE SE460872A patent/SE371441B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS178407B2 (esLanguage) | 1977-09-15 |
| ES401616A1 (es) | 1975-02-16 |
| SU421193A3 (ru) | 1974-03-25 |
| SE371441B (esLanguage) | 1974-11-18 |
| NL170535B (nl) | 1982-06-16 |
| BG20105A3 (bg) | 1975-10-30 |
| HU163996B (esLanguage) | 1973-12-28 |
| PL83824B1 (esLanguage) | 1976-02-28 |
| DE2117573A1 (de) | 1972-10-19 |
| JPS5529990B1 (esLanguage) | 1980-08-07 |
| AT315178B (de) | 1974-05-10 |
| FI55188C (fi) | 1979-06-11 |
| NO133712B (esLanguage) | 1976-03-08 |
| LU65130A1 (esLanguage) | 1972-07-12 |
| NL170535C (nl) | 1982-11-16 |
| DK134600C (da) | 1977-05-16 |
| NL7204695A (esLanguage) | 1972-10-12 |
| RO61069A (esLanguage) | 1976-11-15 |
| DK134600B (da) | 1976-12-06 |
| NO133712C (esLanguage) | 1976-06-16 |
| CA934758A (en) | 1973-10-02 |
| CH571492A5 (esLanguage) | 1976-01-15 |
| DD104520A5 (esLanguage) | 1974-03-12 |
| DE2117573B2 (de) | 1977-12-01 |
| FI55188B (fi) | 1979-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2117573C3 (de) | Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als Arzneimittel | |
| DE2117571C3 (de) | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2218644C3 (de) | Basische Ester von 1,4-Dihydropyridinen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| EP0088276B1 (de) | Neue Verbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2005116C3 (de) | Symmetrische 1,4-Dihydropyridin-3,5-dicarbonsäureester | |
| EP0002208A1 (de) | Nitrosubstituierte 1,4-Dihydropyridine, diese enthaltende Arzneimittel sowie deren Herstellung | |
| DE2658183A1 (de) | In 2-position substituierte 1,4- dihydropyridin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2013431C3 (de) | 4-Azidophenyl-l,4-dihydropyridin-3,5-dicarbonsäureester | |
| EP0071819A1 (de) | Dihydropyridine mit positiv inotroper Wirkung, neue Verbindungen, ihre Verwendung in Arzneimitteln und Verfahren zu ihrer Herstellung | |
| DE2117572A1 (de) | Unsymmetrische 1,4-Dihydropyridine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel II | |
| DE2210672A1 (de) | Unsymmetrische n-substituierte dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2248150A1 (de) | Dihydropyridinpolyester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210633A1 (de) | Neue brueckenkopfheterocyclen, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2335466A1 (de) | Alkoxyalkyl-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2228377A1 (de) | Dihydropyridin-carbonsaeureamide, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210667A1 (de) | Kondensiert aromatisch substituierte 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210674A1 (de) | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen sowie ihre verwendung als coronarmittel | |
| DE1963186B2 (de) | Schwefelhaltige 1,4-Dihydropyridin-3,5-dicarbonsäureester | |
| DE1963188A1 (de) | Neue Cyanphenyl-1,4-dihydropyridinderivate | |
| DE2658804A1 (de) | Kreislaufbeeinflussende mittel | |
| DE3018259A1 (de) | 1,4-dihydropyridine mit unterschiedlichen substituenten in 2- und 6-position, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln | |
| DE3130041A1 (de) | Dihydropyridine mit positiv inotroper wirkung, neue verbindungen, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung | |
| DE2406198C2 (de) | Verfahren zur Herstellung von neuen 2-Amino-6-dialkylamino-dihydropyridinen | |
| DE2239815A1 (de) | Verfahren zur herstellung von neuen 2-alkylamino-dihydropyridinen sowie ihre verwendung als arzneimittel | |
| DE2210687A1 (de) | Verfahren zur herstellung von neuen 2,6-diamino-dihydropyridinen sowie ihre verwendung als arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |