DE2111864A1 - Verfahren zur Herstellung von 4-substituierten N,N-Dihalogenalkyl-2,6-dinitroanilinen - Google Patents
Verfahren zur Herstellung von 4-substituierten N,N-Dihalogenalkyl-2,6-dinitroanilinenInfo
- Publication number
- DE2111864A1 DE2111864A1 DE19712111864 DE2111864A DE2111864A1 DE 2111864 A1 DE2111864 A1 DE 2111864A1 DE 19712111864 DE19712111864 DE 19712111864 DE 2111864 A DE2111864 A DE 2111864A DE 2111864 A1 DE2111864 A1 DE 2111864A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- carbon atoms
- reaction
- aromatic amine
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 64
- 230000008569 process Effects 0.000 title claims description 30
- 229910052757 nitrogen Inorganic materials 0.000 title claims description 28
- 238000002360 preparation method Methods 0.000 title claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 93
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 67
- 229910017604 nitric acid Inorganic materials 0.000 claims description 67
- 238000006396 nitration reaction Methods 0.000 claims description 51
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 43
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 claims description 43
- 125000004432 carbon atom Chemical group C* 0.000 claims description 43
- 150000003513 tertiary aromatic amines Chemical class 0.000 claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 26
- -1 nitrite ions Chemical class 0.000 claims description 23
- 230000015572 biosynthetic process Effects 0.000 claims description 22
- 239000011260 aqueous acid Substances 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 18
- 229960000583 acetic acid Drugs 0.000 claims description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 230000002209 hydrophobic effect Effects 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 125000001188 haloalkyl group Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 238000005192 partition Methods 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- 230000000802 nitrating effect Effects 0.000 claims description 5
- 239000012429 reaction media Substances 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 150000004982 aromatic amines Chemical class 0.000 claims description 4
- 230000002140 halogenating effect Effects 0.000 claims description 4
- 150000002500 ions Chemical class 0.000 claims description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 235000019260 propionic acid Nutrition 0.000 claims description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000004927 clay Substances 0.000 claims description 2
- 238000010790 dilution Methods 0.000 claims description 2
- 239000012895 dilution Substances 0.000 claims description 2
- 239000012362 glacial acetic acid Substances 0.000 claims description 2
- 150000004992 toluidines Chemical class 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 5
- 239000004305 biphenyl Substances 0.000 claims 5
- 235000010290 biphenyl Nutrition 0.000 claims 5
- 125000006267 biphenyl group Chemical group 0.000 claims 5
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 150000003142 primary aromatic amines Chemical class 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 44
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 27
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 239000008346 aqueous phase Substances 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 14
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- 239000012074 organic phase Substances 0.000 description 12
- 230000026030 halogenation Effects 0.000 description 11
- 238000005658 halogenation reaction Methods 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000009826 distribution Methods 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 230000007246 mechanism Effects 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000003849 aromatic solvent Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- XKUWFOYPQIVFMM-UHFFFAOYSA-N n,n-bis(2-chloroethyl)-4-methyl-2,6-dinitroaniline Chemical compound CC1=CC([N+]([O-])=O)=C(N(CCCl)CCCl)C([N+]([O-])=O)=C1 XKUWFOYPQIVFMM-UHFFFAOYSA-N 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- SIEAXQLZOYXGMS-UHFFFAOYSA-N n-(2-chloroethyl)-4-methylaniline Chemical compound CC1=CC=C(NCCCl)C=C1 SIEAXQLZOYXGMS-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- WFPZPJSADLPSON-UHFFFAOYSA-N dinitrogen tetraoxide Chemical compound [O-][N+](=O)[N+]([O-])=O WFPZPJSADLPSON-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 description 2
- GDPRJMAJFSDBKX-UHFFFAOYSA-N n,n-bis(2-chloroethyl)-4-methylaniline Chemical compound CC1=CC=C(N(CCCl)CCCl)C=C1 GDPRJMAJFSDBKX-UHFFFAOYSA-N 0.000 description 2
- 238000005121 nitriding Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000004995 p-toluidines Chemical class 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VUMCUSHVMYIRMB-UHFFFAOYSA-N 1,3,5-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1 VUMCUSHVMYIRMB-UHFFFAOYSA-N 0.000 description 1
- FMFKNGWZEQOWNK-UHFFFAOYSA-N 1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate Chemical compound CCCCOCC(C)OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl FMFKNGWZEQOWNK-UHFFFAOYSA-N 0.000 description 1
- YVJVQYNIANZFFM-UHFFFAOYSA-N 2-(4-methylanilino)ethanol Chemical compound CC1=CC=C(NCCO)C=C1 YVJVQYNIANZFFM-UHFFFAOYSA-N 0.000 description 1
- FGBSHFPGPYKJJD-UHFFFAOYSA-N 2-nitro-1,3,5-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=C([N+]([O-])=O)C(C(C)C)=C1 FGBSHFPGPYKJJD-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- GDIIPKWHAQGCJF-UHFFFAOYSA-N 4-Amino-2-nitrotoluene Chemical compound CC1=CC=C(N)C=C1[N+]([O-])=O GDIIPKWHAQGCJF-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000009118 appropriate response Effects 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 238000006172 aromatic nitration reaction Methods 0.000 description 1
- WOIVNLSVAKYSKX-UHFFFAOYSA-N benzyl nitrate Chemical compound [O-][N+](=O)OCC1=CC=CC=C1 WOIVNLSVAKYSKX-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004982 dihaloalkyl group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OMBRFUXPXNIUCZ-UHFFFAOYSA-N dioxidonitrogen(1+) Chemical compound O=[N+]=O OMBRFUXPXNIUCZ-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000002650 habitual effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229910001960 metal nitrate Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MCJOQKDJGJVDFY-UHFFFAOYSA-N n,n,4-trimethyl-2-nitroaniline Chemical compound CN(C)C1=CC=C(C)C=C1[N+]([O-])=O MCJOQKDJGJVDFY-UHFFFAOYSA-N 0.000 description 1
- MJVUDZGNBKFOBF-UHFFFAOYSA-N n-nitronitramide Chemical compound [O-][N+](=O)N[N+]([O-])=O MJVUDZGNBKFOBF-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- IQZPDFORWZTSKT-UHFFFAOYSA-N nitrosulphonic acid Chemical compound OS(=O)(=O)[N+]([O-])=O IQZPDFORWZTSKT-UHFFFAOYSA-N 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 229940082615 organic nitrates used in cardiac disease Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Inorganic materials [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000004148 unit process Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B43/00—Formation or introduction of functional groups containing nitrogen
- C07B43/02—Formation or introduction of functional groups containing nitrogen of nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2012470A | 1970-03-16 | 1970-03-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2111864A1 true DE2111864A1 (de) | 1971-10-07 |
Family
ID=21796898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712111864 Pending DE2111864A1 (de) | 1970-03-16 | 1971-03-12 | Verfahren zur Herstellung von 4-substituierten N,N-Dihalogenalkyl-2,6-dinitroanilinen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3726923A (enExample) |
| BE (1) | BE762232A (enExample) |
| CA (1) | CA1000300A (enExample) |
| DE (1) | DE2111864A1 (enExample) |
| FR (1) | FR2083917A5 (enExample) |
| GB (1) | GB1317499A (enExample) |
| LU (1) | LU62586A1 (enExample) |
| NL (1) | NL7102774A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4165231A (en) * | 1971-08-25 | 1979-08-21 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4251264A (en) * | 1971-08-25 | 1981-02-17 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4124639A (en) * | 1975-12-22 | 1978-11-07 | America Cyanamid Company | N-alkoxyalkyl-2,6-dinitroaniline herbicides |
| US4101582A (en) * | 1975-12-22 | 1978-07-18 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| GB1598765A (en) * | 1977-06-27 | 1981-09-23 | Lilly Co Eli | N-alkoxydinitro anilines and their herbicidal compositions |
| US4087460A (en) * | 1977-06-27 | 1978-05-02 | Eli Lilly And Company | Substituted N-alkoxy-N-substituted-2,6-dinitroanilines and intermediates for the preparation thereof |
| USRE33168E (en) * | 1984-05-07 | 1990-02-20 | Jerome A. Gross | Nitration processes |
| US4621157A (en) * | 1984-05-07 | 1986-11-04 | Jerome A. Gross | Nitration processes |
| IT1289740B1 (it) * | 1996-12-12 | 1998-10-16 | Finchimica Srl | Procedimento continuo per la dinitrazione di substrati aromatici |
| US5922913A (en) * | 1998-11-06 | 1999-07-13 | Srm Chemical, Ltd., Co. | Process for nitrating aromatic amines |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2435314A (en) * | 1940-12-05 | 1948-02-03 | Autoxygen Inc | Method of nitrating organic compounds |
| US2739174A (en) * | 1951-09-08 | 1956-03-20 | Eastman Kodak Co | Nitrating aromatic hydrocarbons with only nitric acid |
| US3062887A (en) * | 1956-07-20 | 1962-11-06 | Hercules Powder Co Ltd | Preparation of nitrosamines |
| US3086062A (en) * | 1959-12-05 | 1963-04-16 | Bayer Ag | Process for the production of 2, 4-dinitro-1, 3, 5-triisopropylbenzene |
-
1970
- 1970-03-16 US US00020124A patent/US3726923A/en not_active Expired - Lifetime
-
1971
- 1971-01-26 CA CA103,670A patent/CA1000300A/en not_active Expired
- 1971-01-29 BE BE762232A patent/BE762232A/xx unknown
- 1971-02-11 FR FR7104618A patent/FR2083917A5/fr not_active Expired
- 1971-02-12 LU LU62586D patent/LU62586A1/xx unknown
- 1971-03-02 NL NL7102774A patent/NL7102774A/xx unknown
- 1971-03-12 DE DE19712111864 patent/DE2111864A1/de active Pending
- 1971-04-19 GB GB2209271A patent/GB1317499A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3726923A (en) | 1973-04-10 |
| FR2083917A5 (enExample) | 1971-12-17 |
| CA1000300A (en) | 1976-11-23 |
| GB1317499A (en) | 1973-05-16 |
| NL7102774A (enExample) | 1971-09-20 |
| BE762232A (fr) | 1971-07-01 |
| LU62586A1 (enExample) | 1971-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH626043A5 (enExample) | ||
| WO1999006339A1 (de) | Verfahren zur herstellung von substituierten benzylbromiden | |
| DE2400887A1 (de) | Verfahren zur herstellung von nitroderivaten aromatischer verbindungen | |
| EP2473477A1 (de) | Verfahren zur herstellung von mononitrotoluol | |
| EP0597361B1 (de) | Verfahren zur Herstellung von Dinitrotoluol | |
| DE2111864A1 (de) | Verfahren zur Herstellung von 4-substituierten N,N-Dihalogenalkyl-2,6-dinitroanilinen | |
| DE2604277C2 (de) | Verfahren zur Herstellung von 2,5- Dichlor-p-xylol | |
| EP1713756A1 (de) | Verfahren zur herstellung von dinitrotoluol | |
| EP0019281B1 (de) | Verfahren zur Entfernung von Nitrosierungsmittel(n) aus nitrierten aromatischen Verbindungen | |
| EP0502253A1 (de) | Verfahren zur Herstellung von 9,9-Bis-(4-hydroxyphenyl-)fluoren | |
| EP0004623B1 (de) | Verfahren zur Herstellung von aromatischen Aminen | |
| DE69607633T2 (de) | Verfahren zur nitrierung von diphenyl ether verbindungen | |
| DE1518225A1 (de) | Nitrierverfahren | |
| CH641450A5 (de) | Verfahren zur herstellung von benzofurazan-1-oxiden. | |
| DE2609461C2 (de) | α-4-(Trifluormethylphenoxy)-phenoxy-propionsäuren und ihre Derivate, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel | |
| DE102007010161A1 (de) | Verfahren zur Nitrierung substituierter Benzole in Gegenwart von Propionsäure | |
| DE10117207C1 (de) | Kontinuierliches isothermes Verfahren zur Herstellung von Mononitrotoluolen in Gegenwart von Phosphorsäure | |
| CH630050A5 (de) | Verfahren zur herstellung substituierter benzal- und benzylbromide. | |
| DE3504073C2 (enExample) | ||
| DE69929453T2 (de) | Zur sulfonierung von perhalogenierten sulfanilid verwendbare verfahren und reagenz zur sulfonierung | |
| DE1643600C3 (de) | Verfahren zur Nitrierung von alkylsubstituierten aromatischen Verbindungen | |
| DE19918291C1 (de) | Verfahren zur Herstellung von 1-substituierten 2,4-Dinitrobenzolen | |
| DE2527575C3 (de) | Verfahren zur Herstellung von 5-Methyl-2-nitrophenol | |
| DE2717708C2 (de) | Verfahren zur Herstellung von Estern aromatischer Sulfonsäuren mit aromatischen Aminohydroxyverbindungen | |
| DE899799C (de) | Verfahren zur Herstellung von substituierten Carbonsaeuren |