DE2110059C3 - Bindemittel auf Basis von Alkalisilikaten - Google Patents
Bindemittel auf Basis von AlkalisilikatenInfo
- Publication number
- DE2110059C3 DE2110059C3 DE2110059A DE2110059A DE2110059C3 DE 2110059 C3 DE2110059 C3 DE 2110059C3 DE 2110059 A DE2110059 A DE 2110059A DE 2110059 A DE2110059 A DE 2110059A DE 2110059 C3 DE2110059 C3 DE 2110059C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- water
- binder
- content
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011230 binding agent Substances 0.000 title claims description 37
- 229910052910 alkali metal silicate Inorganic materials 0.000 title claims description 16
- 150000001412 amines Chemical class 0.000 claims description 16
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 12
- 150000002830 nitrogen compounds Chemical group 0.000 claims description 12
- OUPZKGBUJRBPGC-UHFFFAOYSA-N 1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound O=C1N(CC2OC2)C(=O)N(CC2OC2)C(=O)N1CC1CO1 OUPZKGBUJRBPGC-UHFFFAOYSA-N 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 9
- -1 phosphates Metals Chemical group 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 235000021317 phosphate Nutrition 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002924 oxiranes Chemical class 0.000 claims description 2
- 150000004760 silicates Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 21
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 16
- 229910004298 SiO 2 Inorganic materials 0.000 description 14
- 239000000203 mixture Substances 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 10
- 235000019353 potassium silicate Nutrition 0.000 description 10
- 239000011734 sodium Substances 0.000 description 9
- 229910052911 sodium silicate Inorganic materials 0.000 description 9
- 239000004115 Sodium Silicate Substances 0.000 description 8
- 239000003973 paint Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 235000019700 dicalcium phosphate Nutrition 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000011707 mineral Substances 0.000 description 5
- 235000010755 mineral Nutrition 0.000 description 5
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- XAAHAAMILDNBPS-UHFFFAOYSA-L calcium hydrogenphosphate dihydrate Chemical compound O.O.[Ca+2].OP([O-])([O-])=O XAAHAAMILDNBPS-UHFFFAOYSA-L 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 239000004848 polyfunctional curative Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 235000012241 calcium silicate Nutrition 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000004568 cement Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000005470 impregnation Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002823 nitrates Chemical class 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KYHNQSHAFPEHOG-UHFFFAOYSA-M 4-dodecyl-4-methylmorpholin-4-ium hydroxide Chemical compound [OH-].C(CCCCCCCCCCC)[N+]1(CCOCC1)C KYHNQSHAFPEHOG-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- JHLNERQLKQQLRZ-UHFFFAOYSA-N calcium silicate Chemical compound [Ca+2].[Ca+2].[O-][Si]([O-])([O-])[O-] JHLNERQLKQQLRZ-UHFFFAOYSA-N 0.000 description 2
- 229910052918 calcium silicate Inorganic materials 0.000 description 2
- NWXHSRDXUJENGJ-UHFFFAOYSA-N calcium;magnesium;dioxido(oxo)silane Chemical compound [Mg+2].[Ca+2].[O-][Si]([O-])=O.[O-][Si]([O-])=O NWXHSRDXUJENGJ-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 description 2
- 229910052637 diopside Inorganic materials 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000002557 mineral fiber Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical group 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229910052913 potassium silicate Inorganic materials 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- ASICDAYLHKWINM-UHFFFAOYSA-M tetraethoxyazanium;hydroxide Chemical compound [OH-].CCO[N+](OCC)(OCC)OCC ASICDAYLHKWINM-UHFFFAOYSA-M 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- XALTWITXELVMHP-UHFFFAOYSA-N 2-(2-aminopropylamino)ethanol Chemical compound CC(N)CNCCO XALTWITXELVMHP-UHFFFAOYSA-N 0.000 description 1
- IRQMMPJCYXMJHX-UHFFFAOYSA-N 2-[(2-aminoethylamino)methyl]propanedinitrile Chemical compound NCCNCC(C#N)C#N IRQMMPJCYXMJHX-UHFFFAOYSA-N 0.000 description 1
- CGSYHUHHSJWEKH-UHFFFAOYSA-N 3-(3-aminoanilino)propan-1-ol Chemical compound NC1=CC=CC(NCCCO)=C1 CGSYHUHHSJWEKH-UHFFFAOYSA-N 0.000 description 1
- ZARLIMSWJMJVQN-UHFFFAOYSA-N 4-[(2-aminoethylamino)methyl]phenol Chemical compound NCCNCC1=CC=C(O)C=C1 ZARLIMSWJMJVQN-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- RKXKSTQSIBDNIP-UHFFFAOYSA-N 4-[2-[2-aminoethyl(4-hydroxybutyl)amino]ethylamino]butan-1-ol Chemical compound OCCCCNCCN(CCN)CCCCO RKXKSTQSIBDNIP-UHFFFAOYSA-N 0.000 description 1
- GSUKYOGDUHZWIU-UHFFFAOYSA-N 4-[[2-(2-aminoethylamino)ethylamino]methyl]phenol Chemical compound NCCNCCNCC1=CC=C(O)C=C1 GSUKYOGDUHZWIU-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 229910000519 Ferrosilicon Inorganic materials 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000004111 Potassium silicate Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- FZVXUPLDQNBUQZ-UHFFFAOYSA-N [Ca+2].[Ca+2].[Ca+2].[O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-] Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-] FZVXUPLDQNBUQZ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000003868 ammonium compounds Chemical group 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical class N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical class [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000019827 calcium polyphosphate Nutrition 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- FGZBFIYFJUAETR-UHFFFAOYSA-N calcium;magnesium;silicate Chemical compound [Mg+2].[Ca+2].[O-][Si]([O-])([O-])[O-] FGZBFIYFJUAETR-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical class [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000009970 fire resistant effect Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000001034 iron oxide pigment Substances 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- PAZHGORSDKKUPI-UHFFFAOYSA-N lithium metasilicate Chemical compound [Li+].[Li+].[O-][Si]([O-])=O PAZHGORSDKKUPI-UHFFFAOYSA-N 0.000 description 1
- 229910052912 lithium silicate Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000011490 mineral wool Substances 0.000 description 1
- 239000003110 molding sand Substances 0.000 description 1
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- NNHHDJVEYQHLHG-UHFFFAOYSA-N potassium silicate Chemical compound [K+].[K+].[O-][Si]([O-])=O NNHHDJVEYQHLHG-UHFFFAOYSA-N 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000011863 silicon-based powder Substances 0.000 description 1
- 125000005625 siliconate group Chemical group 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- RLQWHDODQVOVKU-UHFFFAOYSA-N tetrapotassium;silicate Chemical compound [K+].[K+].[K+].[K+].[O-][Si]([O-])([O-])[O-] RLQWHDODQVOVKU-UHFFFAOYSA-N 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000010456 wollastonite Substances 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B28/00—Compositions of mortars, concrete or artificial stone, containing inorganic binders or the reaction product of an inorganic and an organic binder, e.g. polycarboxylate cements
- C04B28/24—Compositions of mortars, concrete or artificial stone, containing inorganic binders or the reaction product of an inorganic and an organic binder, e.g. polycarboxylate cements containing alkyl, ammonium or metal silicates; containing silica sols
- C04B28/26—Silicates of the alkali metals
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B24/00—Use of organic materials as active ingredients for mortars, concrete or artificial stone, e.g. plasticisers
- C04B24/12—Nitrogen containing compounds organic derivatives of hydrazine
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
- Paints Or Removers (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Sealing Material Composition (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2110059A DE2110059C3 (de) | 1971-03-03 | 1971-03-03 | Bindemittel auf Basis von Alkalisilikaten |
| YU1960/71A YU34385B (en) | 1971-03-03 | 1971-07-27 | Process for obtaining binders on the base of alkali silicates |
| US00230084A US3778283A (en) | 1971-03-03 | 1972-02-28 | Binders based on alkali metal silicates |
| NL7202717A NL7202717A (enExample) | 1971-03-03 | 1972-03-01 | |
| SE7202623A SE391945B (sv) | 1971-03-03 | 1972-03-01 | Bindemedel pa basis av alkalisilikatlosning |
| CH308772A CH576513A5 (enExample) | 1971-03-03 | 1972-03-02 | |
| JP2188972A JPS5531108B1 (enExample) | 1971-03-03 | 1972-03-02 | |
| IT21298/72A IT949795B (it) | 1971-03-03 | 1972-03-02 | Legante a base di silicati alcalini |
| BE780128A BE780128A (fr) | 1971-03-03 | 1972-03-02 | Liants a base de silicates alcalins |
| CA136,069A CA967307A (en) | 1971-03-03 | 1972-03-02 | Binders based on alkali metal silicates |
| FR7207184A FR2128512B1 (enExample) | 1971-03-03 | 1972-03-02 | |
| AT173272A AT316397B (de) | 1971-03-03 | 1972-03-02 | Bindemittel auf Basis von Alkalisilikaten |
| GB968072A GB1359907A (en) | 1971-03-03 | 1972-03-02 | Binding agents |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2110059A DE2110059C3 (de) | 1971-03-03 | 1971-03-03 | Bindemittel auf Basis von Alkalisilikaten |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2110059A1 DE2110059A1 (de) | 1972-11-09 |
| DE2110059B2 DE2110059B2 (de) | 1979-04-12 |
| DE2110059C3 true DE2110059C3 (de) | 1979-11-29 |
Family
ID=5800376
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2110059A Expired DE2110059C3 (de) | 1971-03-03 | 1971-03-03 | Bindemittel auf Basis von Alkalisilikaten |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3778283A (enExample) |
| JP (1) | JPS5531108B1 (enExample) |
| AT (1) | AT316397B (enExample) |
| BE (1) | BE780128A (enExample) |
| CA (1) | CA967307A (enExample) |
| CH (1) | CH576513A5 (enExample) |
| DE (1) | DE2110059C3 (enExample) |
| FR (1) | FR2128512B1 (enExample) |
| GB (1) | GB1359907A (enExample) |
| IT (1) | IT949795B (enExample) |
| NL (1) | NL7202717A (enExample) |
| SE (1) | SE391945B (enExample) |
| YU (1) | YU34385B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3929990A (en) * | 1973-12-18 | 1975-12-30 | Millmaster Onyx Corp | Microbiocidal polymeric quaternary ammonium compounds |
| US3923973A (en) * | 1973-12-18 | 1975-12-02 | Millmaster Onyx Corp | Fungicidal polymeric quaternary ammonium compounds |
| US3874870A (en) * | 1973-12-18 | 1975-04-01 | Mill Master Onyx Corp | Microbiocidal polymeric quarternary ammonium compounds |
| US4035480A (en) * | 1974-07-10 | 1977-07-12 | Millmaster Onyx Corporation | Microbiocidal mixtures of polymeric quaternary ammonium compounds |
| US4005193A (en) * | 1974-08-07 | 1977-01-25 | Millmaster Onyx Corporation | Microbiocidal polymeric quaternary ammonium compounds |
| DE2728074A1 (de) * | 1977-06-22 | 1979-01-11 | Bayer Ag | Verfahren zur herstellung von mineralfasermatten |
| DE3122244A1 (de) * | 1981-06-04 | 1982-12-23 | Henkel KGaA, 4000 Düsseldorf | Bindemittel auf basis von alkalimetallsilikatloesungen und deren verwendung |
| DE3918694C1 (enExample) | 1989-05-10 | 1990-10-25 | Bayer Ag, 5090 Leverkusen, De | |
| US5122551A (en) * | 1990-05-14 | 1992-06-16 | General Electric Company | Glass filled copolyether-polyester compositions |
| US5298064A (en) * | 1990-12-06 | 1994-03-29 | Hoechst Aktiengesellschaft | Water-containing organophilic phylloisilicates |
| US6383421B1 (en) | 1998-08-20 | 2002-05-07 | L. Myles Phipps | Method of manufacturing a gas burning artificial log from sol-gel compositions |
| DE19925412A1 (de) * | 1999-06-02 | 2000-12-07 | Murjahn Amphibolin Werke | Silikatgebundene Materialien wie Beschichtungs-, Form-, Klebe- und Spachtelmaterial, Bindemittel und Verfahren zu deren Herstellung |
| DE10001831A1 (de) * | 2000-01-18 | 2001-08-16 | Keimfarben Gmbh & Co Kg | Silikatische Beschichtungsmasse mit verbesserter Stabilität |
| JP2003535807A (ja) * | 2000-06-20 | 2003-12-02 | ショット、グラス、テクノロジーズ、インコーポレイテッド | ガラスセラミック複合材 |
| US9314941B2 (en) | 2007-07-13 | 2016-04-19 | Advanced Ceramics Manufacturing, Llc | Aggregate-based mandrels for composite part production and composite part production methods |
| WO2009012102A1 (en) * | 2007-07-13 | 2009-01-22 | Advanced Ceramics Manufacturing, Llc | Aggregate-based mandrels for composite part production and composite part production methods |
| FR3030550B1 (fr) * | 2014-12-22 | 2018-08-17 | Saint-Gobain Adfors | Composition aqueuse de liant pour fibres et produits fibreux obtenus. |
-
1971
- 1971-03-03 DE DE2110059A patent/DE2110059C3/de not_active Expired
- 1971-07-27 YU YU1960/71A patent/YU34385B/xx unknown
-
1972
- 1972-02-28 US US00230084A patent/US3778283A/en not_active Expired - Lifetime
- 1972-03-01 SE SE7202623A patent/SE391945B/xx unknown
- 1972-03-01 NL NL7202717A patent/NL7202717A/xx not_active Application Discontinuation
- 1972-03-02 IT IT21298/72A patent/IT949795B/it active
- 1972-03-02 FR FR7207184A patent/FR2128512B1/fr not_active Expired
- 1972-03-02 GB GB968072A patent/GB1359907A/en not_active Expired
- 1972-03-02 JP JP2188972A patent/JPS5531108B1/ja active Pending
- 1972-03-02 BE BE780128A patent/BE780128A/xx not_active IP Right Cessation
- 1972-03-02 CA CA136,069A patent/CA967307A/en not_active Expired
- 1972-03-02 AT AT173272A patent/AT316397B/de not_active IP Right Cessation
- 1972-03-02 CH CH308772A patent/CH576513A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5531108B1 (enExample) | 1980-08-15 |
| BE780128A (fr) | 1972-09-04 |
| CH576513A5 (enExample) | 1976-06-15 |
| CA967307A (en) | 1975-05-13 |
| NL7202717A (enExample) | 1972-09-05 |
| FR2128512B1 (enExample) | 1977-04-01 |
| DE2110059B2 (de) | 1979-04-12 |
| IT949795B (it) | 1973-06-11 |
| DE2110059A1 (de) | 1972-11-09 |
| YU34385B (en) | 1979-07-10 |
| FR2128512A1 (enExample) | 1972-10-20 |
| GB1359907A (en) | 1974-07-17 |
| AT316397B (de) | 1974-07-10 |
| YU196071A (en) | 1978-12-31 |
| SE391945B (sv) | 1977-03-07 |
| US3778283A (en) | 1973-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2110059C3 (de) | Bindemittel auf Basis von Alkalisilikaten | |
| DE2540756C2 (de) | Verwendung einer anorganischen Phosphatverbindung zur Härtung eines in Wasser löslichen oder in Wasser dispergierbaren Silikatbinders | |
| DE2751660C2 (enExample) | ||
| DE2558972A1 (de) | Verfahren zur herstellung eines gehaerteten zementprodukts | |
| DE3149991A1 (de) | Waessrige haertbare zusammensetzung und verfahren zu ihrer herstellung | |
| DE19628553C1 (de) | Schaumstoff für Brandschutz- und/oder Isolierzwecke | |
| EP0561978B1 (de) | Verfahren zur herstellung von feinporigem schaum aus im wesentlichen anorganischen bestandteilen | |
| WO2015124768A1 (de) | Massen oder formkörper aus anorganischen polymeren und deren herstellung | |
| DE102010003869A1 (de) | Alkyl- und Amino-funktionalisierte Siloxane mit Bis(alkoxysilyl)amin zur Massenhydrophobierung mineralischer Baustoffe | |
| DE102010003868A1 (de) | Zusammensetzung geeignet zur Massenmodifizierung von mineralischen Baustoffen | |
| DE2617685C3 (de) | Putzzusammensetzung für Baumaterial | |
| WO2011128129A1 (de) | Verwendung wässriger alkyl- und amino-funktionalisierter silizium enthaltender co-kondensate zur massenhydrophobierung mineralischer baustoffe | |
| DE2405437A1 (de) | Den wassergehalt vermindernde zusaetze fuer keramische massen | |
| EP0417583B1 (de) | Anorganische Formmasse | |
| DE3512516A1 (de) | Anorganische formmasse mit elektrofilterasche als steinbildende komponente | |
| EP0741677B1 (de) | Verfahren zur herstellung einer überwiegend anorganischen geschäumten masse, sowie ein(e) nach diesem verfahren herstellbare(r) masse oder formteil | |
| DE2627823A1 (de) | Verfahren zur herstellung von kalk-siliciumdioxid-isolierungen aus perlit | |
| DE3313386A1 (de) | Verfahren zur herstellung von nicht-brennbaren, thermisch isolierenden formkoerpern aus geblaehtem perlit | |
| CH503092A (de) | Bindemittel auf Basis von Alkalisilikaten | |
| DE2356524A1 (de) | Binde- und glasurmittel fuer koerniges gesteinsmaterial und dessen verwendung | |
| DE2539718C3 (de) | Verfahren zur Beschichtung von Bauteilen auf Basis anorganischer Bindemittel | |
| EP0433886A1 (de) | Verfahren zur Herstellung einer anorganischen Barium-haltigen Feststoffzusammensetzung | |
| SU626067A1 (ru) | Сырьева смесь дл изготовлени строительного материала | |
| DE1669178B2 (de) | Bindemittel auf basis von alkalisilikaten | |
| DE2310272A1 (de) | Dekoratives verkleidungsmaterial in plattenform und verfahren zu dessen herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |