DE2101970C3 - - Google Patents
Info
- Publication number
- DE2101970C3 DE2101970C3 DE19712101970 DE2101970A DE2101970C3 DE 2101970 C3 DE2101970 C3 DE 2101970C3 DE 19712101970 DE19712101970 DE 19712101970 DE 2101970 A DE2101970 A DE 2101970A DE 2101970 C3 DE2101970 C3 DE 2101970C3
- Authority
- DE
- Germany
- Prior art keywords
- plane
- grooves
- spherical
- center
- ball
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000009471 action Effects 0.000 description 7
- 230000005540 biological transmission Effects 0.000 description 7
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 230000033001 locomotion Effects 0.000 description 4
- 230000003187 abdominal effect Effects 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT6716070 | 1970-01-21 | ||
| IT6716070 | 1970-01-21 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2101970A1 DE2101970A1 (de) | 1971-08-05 |
| DE2101970B2 DE2101970B2 (de) | 1976-04-29 |
| DE2101970C3 true DE2101970C3 (cg-RX-API-DMAC7.html) | 1976-12-09 |
Family
ID=11300086
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712101970 Granted DE2101970B2 (de) | 1970-01-21 | 1971-01-16 | Homokinetisches wellengelenk |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3919861A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS4841172B1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2101970B2 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2090481A5 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1330330A (cg-RX-API-DMAC7.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5941050B2 (ja) * | 1975-04-29 | 1984-10-04 | ユニ − カルダン アクチエンゲゼルシヤフト | 同期回転継手 |
| DE2902062C2 (de) * | 1978-04-28 | 1983-12-08 | Gaston 6230 Villefranche-sur-Mer Devos | Homokinetische Gelenkkupplung |
| NL7902092A (nl) * | 1979-03-16 | 1980-09-18 | Skf Ind Trading & Dev | Homokinetische koppeling. |
| NL8801394A (nl) * | 1988-05-31 | 1989-12-18 | Skf Ind Trading & Dev | Homokinetische koppeling. |
| NL9000576A (nl) * | 1990-03-13 | 1991-10-01 | Skf Ind Trading & Dev | Homokinetische koppeling. |
| US5201107A (en) * | 1990-08-29 | 1993-04-13 | Pmx Inc. | Method of assembling a constant velocity universal joint |
| US6186899B1 (en) | 1998-11-25 | 2001-02-13 | Delphi Technologies, Inc. | Constant velocity joint |
| FR2792045B1 (fr) * | 1999-04-06 | 2001-06-29 | Gkn Glaenzer Spicer | Joint homocinetique a billes |
| DE10060120B4 (de) * | 2000-12-04 | 2005-12-22 | Gkn Driveline International Gmbh | Kugelgleichlaufgelenk als Gegenbahngelenk |
| US7008326B2 (en) * | 2003-06-09 | 2006-03-07 | Delphi Technologies, Inc. | Constant velocity universal joint |
| WO2017020061A1 (en) * | 2015-08-05 | 2017-02-09 | Edward Wechner | Large articulation constant velocity joint |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1444895A (fr) * | 1965-05-26 | 1966-07-08 | Glaenzer Spicer Sa | Joint universel homocinétique pour transmission |
| US3475924A (en) * | 1968-08-01 | 1969-11-04 | Loehr & Bromkamp Gmbh | Universal joint |
-
1970
- 1970-12-30 JP JP45125056A patent/JPS4841172B1/ja active Pending
- 1970-12-31 GB GB6208670A patent/GB1330330A/en not_active Expired
-
1971
- 1971-01-04 US US103490A patent/US3919861A/en not_active Expired - Lifetime
- 1971-01-15 FR FR7101291A patent/FR2090481A5/fr not_active Expired
- 1971-01-16 DE DE19712101970 patent/DE2101970B2/de active Granted
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2101970C3 (cg-RX-API-DMAC7.html) | ||
| DE2831044A1 (de) | Gleichlaufdrehgelenk | |
| DE1817284A1 (de) | Universalgelenk | |
| DE102004006225B4 (de) | Gleichlaufgelenk mit geringer Radialbewegung der Kugeln | |
| DE69703632T2 (de) | Homokinetisches Kugelgelenk | |
| DE2101970B2 (de) | Homokinetisches wellengelenk | |
| DE102004018777A1 (de) | Gegenbahngelenk für grosse Beugewinkel | |
| DE10220711A1 (de) | Gegenbahngelenk mit gleicher Orientierung von gegenüberliegenden Bahnpaaren | |
| DE2809243A1 (de) | Homokinetisches dreizapfengelenk | |
| EP0007607A1 (de) | Klemme zur Verbindung von Seilen | |
| DE1960247A1 (de) | Homokinetisches Wellengelenk | |
| DE3000119A1 (de) | Gleichlauf-universalgelenk | |
| DE3814605A1 (de) | Widerlagervorrichtung fuer ein inneres teil in einem gleit-universalgelenk | |
| DE3640633A1 (de) | Kaefig fuer kugellager | |
| DE69215859T2 (de) | Dreibein-doppelgelenk mit rollen mit mehreren komponenten | |
| DE102010013006A1 (de) | Gleichlaufgelenk | |
| DE885033C (de) | Bewegungsuebertragende Vorrichtung | |
| DE2429834A1 (de) | Wellengelenk | |
| DE1931446A1 (de) | Homokinetisches Universalgelenk | |
| DE102004052471A1 (de) | Einrichtungskupplung | |
| DE102013104065B4 (de) | Kugelgleichlaufgelenk in Form eines käfiglosen Verschiebegelenks | |
| DE3139335C2 (cg-RX-API-DMAC7.html) | ||
| DE602004007584T2 (de) | Gleichlaufgelenk | |
| DE19757392A1 (de) | Gleichlaufgelenk des Kreuznuttyps | |
| DE102019130791B4 (de) | Homokinetisches Universalgelenk |