DE2065509C3 - - Google Patents
Info
- Publication number
- DE2065509C3 DE2065509C3 DE19702065509 DE2065509A DE2065509C3 DE 2065509 C3 DE2065509 C3 DE 2065509C3 DE 19702065509 DE19702065509 DE 19702065509 DE 2065509 A DE2065509 A DE 2065509A DE 2065509 C3 DE2065509 C3 DE 2065509C3
- Authority
- DE
- Germany
- Prior art keywords
- piston
- pump
- housing
- liquid
- line
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007788 liquid Substances 0.000 claims description 65
- 238000004458 analytical method Methods 0.000 claims description 21
- 239000003153 chemical reaction reagent Substances 0.000 claims description 9
- 239000002699 waste material Substances 0.000 claims description 8
- 238000002347 injection Methods 0.000 claims description 3
- 239000007924 injection Substances 0.000 claims description 3
- 238000006073 displacement reaction Methods 0.000 claims description 2
- 239000000523 sample Substances 0.000 description 16
- 238000003756 stirring Methods 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- -1 polytetrafluoroethylene Polymers 0.000 description 5
- 239000004366 Glucose oxidase Substances 0.000 description 4
- 229940116332 glucose oxidase Drugs 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 3
- 239000004810 polytetrafluoroethylene Substances 0.000 description 3
- 108010015776 Glucose oxidase Proteins 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000000994 depressogenic effect Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 235000019420 glucose oxidase Nutrition 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 1
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 238000003760 magnetic stirring Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002493 poly(chlorotrifluoroethylene) Polymers 0.000 description 1
- 239000005023 polychlorotrifluoroethylene (PCTFE) polymer Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702065509 DE2065509B2 (de) | 1969-04-15 | 1970-04-15 | Fluessigkeitsanalysegeraet |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81632969A | 1969-04-15 | 1969-04-15 | |
| DE19702065509 DE2065509B2 (de) | 1969-04-15 | 1970-04-15 | Fluessigkeitsanalysegeraet |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2065509A1 DE2065509A1 (de) | 1974-03-14 |
| DE2065509B2 DE2065509B2 (de) | 1976-07-15 |
| DE2065509C3 true DE2065509C3 (https=) | 1977-03-24 |
Family
ID=25760286
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702065509 Granted DE2065509B2 (de) | 1969-04-15 | 1970-04-15 | Fluessigkeitsanalysegeraet |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE2065509B2 (https=) |
-
1970
- 1970-04-15 DE DE19702065509 patent/DE2065509B2/de active Granted
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69608705T2 (de) | Automatisches pipettieren von kleinen volumen | |
| DE68915865T2 (de) | Mehrartige Verdrängerpumpe für verschiedene Flüssigkeiten. | |
| DE1498960C3 (https=) | ||
| DE2011239C3 (de) | Vorrichtung zum Übertragen von Flüssigkeit in Aufnahmebehälter | |
| DE2640491A1 (de) | Automatischer pipettierapparat | |
| DE2342063B2 (de) | Mit der hand zu haltende pipette | |
| DE2018068C3 (https=) | ||
| DE2525340A1 (de) | Stechheber-anordnung fuer ein geraet zum verduennen von fluessigkeitsproben | |
| EP2633914B2 (de) | Pipettiervorrichtung und Verfahren zu ihrer Herstellung | |
| DE2603616A1 (de) | Pipettenanordnung fuer einzelanalysen | |
| DE69617786T2 (de) | Pipette mit mehreren Funktionsphasen | |
| DE2233913C3 (de) | Dosiervorrichtung | |
| DE2817709A1 (de) | Regulierbare pipette zum abgeben fluessiger proben | |
| DE68905698T2 (de) | Fliessinjektionsanalyse. | |
| DE2537606C3 (de) | Anordnung zum automatischen Transportieren und Injizieren einer Flüssigkeitsprobe | |
| DE3786519T2 (de) | Probeentnahmevorrichtung mit Mehrkanalpipette. | |
| DE2249173A1 (de) | Autoanalytische arbeitsvorrichtung | |
| DE69111394T2 (de) | Einwegvorrichtung zur Prüfung einer Flüssigkeit. | |
| DE2531825C3 (de) | Vorrichtung zum Konstanthalten des Durchflusses einer Flüssigkeit | |
| EP0331912A2 (de) | Befüllbares Probenaufnahmegefäss zur Handhabung einer flüssigen Probe | |
| DE3115568A1 (de) | Verfahren und vorrichtung zum mischen von fluessigkeiten unter verwendung einer automatisierten pipette | |
| DE2735947C2 (de) | Vorrichtung zum Vermischen einer flüssigen Probe mit einer Verdünnungsflüssigkeit | |
| DE2912617C2 (de) | Fraktionieraggregat | |
| DE2065509C3 (https=) | ||
| DE69400052T2 (de) | Mikrodosierverfahren für Flüssigkeiten zur Erzielung nanovolumetrischer Lösungen |