DE2041868A1 - Verfahren zur Herstellung neuer heterocyclischer Verbindungen - Google Patents
Verfahren zur Herstellung neuer heterocyclischer VerbindungenInfo
- Publication number
- DE2041868A1 DE2041868A1 DE19702041868 DE2041868A DE2041868A1 DE 2041868 A1 DE2041868 A1 DE 2041868A1 DE 19702041868 DE19702041868 DE 19702041868 DE 2041868 A DE2041868 A DE 2041868A DE 2041868 A1 DE2041868 A1 DE 2041868A1
- Authority
- DE
- Germany
- Prior art keywords
- indole
- compounds
- formula
- hexahydrobenz
- acetyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 7
- 150000002391 heterocyclic compounds Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 27
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 claims description 15
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- QPWKTMKVYQJXJT-UHFFFAOYSA-N 2-(bromomethyl)-4,5-dihydro-1H-imidazole Chemical compound BrCC=1NCCN1 QPWKTMKVYQJXJT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- PBDVGQUFQGGXAN-UHFFFAOYSA-N 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2a,3,4,5-tetrahydro-2H-benzo[cd]indole Chemical compound N1C(=NCC1)CN1CC2C=3C(=CC=CC13)CCC2 PBDVGQUFQGGXAN-UHFFFAOYSA-N 0.000 claims 1
- DSLHPPFUHHXZPN-UHFFFAOYSA-N 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-6-methyl-2a,3,4,5-tetrahydro-2H-benzo[cd]indole Chemical compound CC1=C2C=3C(CN(C3C=C1)CC=1NCCN1)CCC2 DSLHPPFUHHXZPN-UHFFFAOYSA-N 0.000 claims 1
- RJKPQZGKDBFTKP-UHFFFAOYSA-N 6-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2a,3,4,5-tetrahydro-2H-benzo[cd]indole Chemical compound ClC1=C2C=3C(CN(C3C=C1)CC=1NCCN1)CCC2 RJKPQZGKDBFTKP-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 16
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- -1 chloroform Chemical class 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- MFVFAPQCEUCUSG-UHFFFAOYSA-N 1,2,2a,3,4,5-hexahydrobenzo[cd]indole Chemical compound C1CCC2CNC3=CC=CC1=C32 MFVFAPQCEUCUSG-UHFFFAOYSA-N 0.000 description 2
- KWSLGOVYXMQPPX-UHFFFAOYSA-N 5-[3-(trifluoromethyl)phenyl]-2h-tetrazole Chemical compound FC(F)(F)C1=CC=CC(C2=NNN=N2)=C1 KWSLGOVYXMQPPX-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- UTCMYCAFVUUNBK-UHFFFAOYSA-N benzo[cd]indole Chemical compound C1=CC(C=N2)=C3C2=CC=CC3=C1 UTCMYCAFVUUNBK-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910001379 sodium hypophosphite Inorganic materials 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RBPAHHIAMGEWQU-UHFFFAOYSA-N 2,2a,3,4-tetrahydro-1h-benzo[cd]indol-5-one Chemical compound C1NC2=CC=CC3=C2C1CCC3=O RBPAHHIAMGEWQU-UHFFFAOYSA-N 0.000 description 1
- WPCWSPFPBHJYAT-UHFFFAOYSA-N 2-(6-chloro-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-yl)acetonitrile Chemical compound ClC1=C2C=3C(CN(C3C=C1)CC#N)CCC2 WPCWSPFPBHJYAT-UHFFFAOYSA-N 0.000 description 1
- GHCCHMFFNHOXEU-UHFFFAOYSA-N 2-(chloromethyl)-4,5-dihydro-1H-imidazole hydrochloride Chemical compound Cl.ClCC1=NCCN1 GHCCHMFFNHOXEU-UHFFFAOYSA-N 0.000 description 1
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 1
- AOKMMIYCSDAOKR-UHFFFAOYSA-N C(C)(=O)N1CC2C=3C(=C(C=CC13)C=O)CCC2 Chemical compound C(C)(=O)N1CC2C=3C(=C(C=CC13)C=O)CCC2 AOKMMIYCSDAOKR-UHFFFAOYSA-N 0.000 description 1
- 206010048964 Carotid artery occlusion Diseases 0.000 description 1
- HKTCVXUJCKVGFE-UHFFFAOYSA-N N1C(=O)NC(=O)NC1=O.[Cu] Chemical compound N1C(=O)NC(=O)NC1=O.[Cu] HKTCVXUJCKVGFE-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- 238000006856 Wolf-Kishner-Huang Minlon reduction reaction Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000006196 deacetylation Effects 0.000 description 1
- 238000003381 deacetylation reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000009153 reflex inhibition Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 230000001975 sympathomimetic effect Effects 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/90—Benzo [c, d] indoles; Hydrogenated benzo [c, d] indoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1296769A CH512484A (de) | 1969-08-27 | 1969-08-27 | Verfahren zur Herstellung neuer Indolderivate |
| CH503970 | 1969-12-10 | ||
| CH470370 | 1970-03-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2041868A1 true DE2041868A1 (de) | 1971-03-04 |
Family
ID=27174955
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702041868 Pending DE2041868A1 (de) | 1969-08-27 | 1970-08-24 | Verfahren zur Herstellung neuer heterocyclischer Verbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3671541A (enExample) |
| AU (1) | AU1922070A (enExample) |
| BE (1) | BE755270A (enExample) |
| DE (1) | DE2041868A1 (enExample) |
| FR (1) | FR2068520B1 (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR910005851B1 (ko) * | 1983-12-12 | 1991-08-05 | 신 떼라보 | 피롤로[3,2,1-hi]인돌유도체 및 약학적으로 허용되는 그의 산부가염을 제조하는 방법 |
| FR2621486B1 (fr) * | 1987-10-07 | 1990-01-26 | Synthelabo | Utilisation de derives de pyrrolo(3,2,1-hi)indole pour obtenir un medicament destine au traitement du diabete |
| US5302612A (en) * | 1990-02-26 | 1994-04-12 | Eli Lilly And Company | 6-substituted-hexahydrobenz[cd]indoles |
| US5229409A (en) * | 1990-08-15 | 1993-07-20 | Eli Lilly And Company | 6-substituted-tetrahydrobenz[cd]indoles |
| US5229410A (en) * | 1990-08-15 | 1993-07-20 | Eli Lilly And Company | 6-substituted-hexahydrobenz[cd]indoles |
| US5633273A (en) * | 1991-03-28 | 1997-05-27 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,2,2a,3,4,5-hexahydrobenz[cd] indoles |
| US5244912A (en) * | 1991-03-28 | 1993-09-14 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,3,4,5-tetrahydrobenz(cd)indoles and pharmaceutical use thereof |
| US5244911A (en) * | 1991-03-28 | 1993-09-14 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,2,2a,3,4,5-hexahydrobenz(cd)indoles and pharmaceutical use thereof |
| US5347013A (en) * | 1991-03-28 | 1994-09-13 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,2,2a,3,4,5-hexahydrobenz[cd]indoles |
| US5364856A (en) * | 1991-03-28 | 1994-11-15 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,3,4,5-tetrahydrobenz[CD]indoles |
| KR0171994B1 (ko) * | 1995-07-13 | 1999-03-30 | 구광시 | 방향족 폴리아미드, 광학적 이방성 도우프와 성형물, 및 이들의 제조방법 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3288805A (en) * | 1966-11-29 | Amino-eviid azoline | ||
| CH235953A (de) * | 1938-05-11 | 1944-12-31 | Chem Ind Basel | Verfahren zur Darstellung eines neuen therapeutisch wirksamen Amidins. |
| CH234986A (de) * | 1938-05-11 | 1944-10-31 | Chem Ind Basel | Verfahren zur Darstellung eines neuen therapeutisch wirksamen Amidins. |
| CH265662A (de) * | 1946-03-13 | 1949-12-15 | Ciba Geigy | Verfahren zur Herstellung eines Imidazolins. |
| US2751393A (en) * | 1953-05-13 | 1956-06-19 | Imidazoline derivatives of aryl indoles | |
| US2778836A (en) * | 1954-04-02 | 1957-01-22 | Union Chimique Belge Sa | Substituted 2-methyl-delta2 imidazolines |
| US3202660A (en) * | 1961-10-09 | 1965-08-24 | Boehringer Sohn Ingelheim | Process for the preparation of 3-arylamino-1, 3-diazacycloalkenes |
| FR1506407A (fr) * | 1965-10-01 | 1967-12-22 | Boehringer Sohn Ingelheim | Procédé pour fabriquer des dérivés du 2-anilino-1, 3-diazacyclopentène-(2) |
| GB1174349A (en) * | 1966-08-25 | 1969-12-17 | Boehringer Sohn Ingelheim | Novel 2-Anilinomethylimidazoline Derivatives and process for the preparation thereof |
-
0
- BE BE755270D patent/BE755270A/xx unknown
-
1970
- 1970-08-19 US US65281A patent/US3671541A/en not_active Expired - Lifetime
- 1970-08-24 DE DE19702041868 patent/DE2041868A1/de active Pending
- 1970-08-25 FR FR7031013A patent/FR2068520B1/fr not_active Expired
- 1970-08-26 AU AU19220/70A patent/AU1922070A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU1922070A (en) | 1972-03-02 |
| BE755270A (fr) | 1971-02-25 |
| FR2068520A1 (enExample) | 1971-08-27 |
| FR2068520B1 (enExample) | 1974-03-22 |
| US3671541A (en) | 1972-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2925448A1 (de) | 3-aminopropoxyaryl-derivate, ihre herstellung und verwendung | |
| DE2041868A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| EP0386628B1 (de) | Verfahren zur Herstellung von Indolcarbonsäurederivaten | |
| DD255344A5 (de) | Heteroaryl-oxy-beta-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel | |
| EP0155903B1 (de) | Indolophenanthridine, ihre Herstellung und Verwendung | |
| DE1695961A1 (de) | Neue Azepin-indole und Verfahren zu deren Herstellung | |
| DE1909110A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| DE2257311A1 (de) | Benzimidazolyl-aminoimidazoline, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2051062A1 (de) | Verfahren zur Herstellung neuer hetero cyclischer Verbindungen | |
| CH511838A (de) | Verfahren zur Herstellung von neuen Indolderivaten | |
| DE1927429B2 (de) | 4,6-dihydro-pyrazolo eckige klammer auf 4,3-e eckige klammer zu eckige klammer auf 1,4 eckige klammer zu diazepin-5-on- verbindungen | |
| CH461489A (de) | Verfahren zur Herstellung von neuen Oxazolderivaten | |
| DE2649855C2 (de) | Substituierte 5-Acetyl-4-hydroxy-3-phenylamino-2H-pyran-2,6(3H)-dione, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1280878B (de) | 3-Aminoindazole | |
| CH512484A (de) | Verfahren zur Herstellung neuer Indolderivate | |
| CH526562A (de) | Verfahren zur Herstellung neuer 1, 2, 6, 7, 8, 8a-Hexahydrobenz(cd)-indole | |
| CH529702A (de) | Verfahren zur Herstellung neuer Benz(cd)indole | |
| DE2345651A1 (de) | Indolylalkylamine und verfahren zu ihrer herstellung | |
| DE1445123C (de) | 7 substituierte 10 (beta Amino athyl) 10,11 dihydrodibenzo eckige Klammer auf b,e eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu diazepinon (11) derivate | |
| CH526564A (de) | Verfahren zur Herstellung neuer 1, 2, 6, 7, 8, 8a-Hexahydrobenz(cd)indole | |
| CH547808A (de) | Verfahren zur herstellung neuer cycloalkan(c)pyridazine. | |
| CH625238A5 (en) | Process for the preparation of (2-imidazolin-2-ylamino)-2,1,3-benzoxadiazoles | |
| CH517733A (de) | Verfahren zur Herstellung neuer Guanidin- Verbindungen | |
| CH518935A (de) | Verfahren zur Herstellung neuer Guanidin-Derivate | |
| CH648309A5 (en) | Dibenzazepines, process for their preparation and medicaments containing them |