DE2035127A1 - - Google Patents
Info
- Publication number
- DE2035127A1 DE2035127A1 DE19702035127 DE2035127A DE2035127A1 DE 2035127 A1 DE2035127 A1 DE 2035127A1 DE 19702035127 DE19702035127 DE 19702035127 DE 2035127 A DE2035127 A DE 2035127A DE 2035127 A1 DE2035127 A1 DE 2035127A1
- Authority
- DE
- Germany
- Prior art keywords
- hydroperoxide
- tertiary
- tert
- dihydroperoxide
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 13
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical group CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 claims description 10
- WWUVJRULCWHUSA-UHFFFAOYSA-N 2-methyl-1-pentene Chemical compound CCCC(C)=C WWUVJRULCWHUSA-UHFFFAOYSA-N 0.000 claims description 8
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 8
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 8
- -1 hydrocarbon halide Chemical group 0.000 claims description 8
- MHAJPDPJQMAIIY-UHFFFAOYSA-M hydroperoxide group Chemical group [O-]O MHAJPDPJQMAIIY-UHFFFAOYSA-M 0.000 claims description 7
- 150000001451 organic peroxides Chemical class 0.000 claims description 7
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 6
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 6
- 150000003509 tertiary alcohols Chemical class 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 claims description 2
- SBUBPFHJZHQNNT-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene hydrogen peroxide Chemical compound OO.OO.CC(C)C1=CC=CC=C1C(C)C SBUBPFHJZHQNNT-UHFFFAOYSA-N 0.000 claims description 2
- MIRQGKQPLPBZQM-UHFFFAOYSA-N 2-hydroperoxy-2,4,4-trimethylpentane Chemical compound CC(C)(C)CC(C)(C)OO MIRQGKQPLPBZQM-UHFFFAOYSA-N 0.000 claims description 2
- XRXANEMIFVRKLN-UHFFFAOYSA-N 2-hydroperoxy-2-methylbutane Chemical compound CCC(C)(C)OO XRXANEMIFVRKLN-UHFFFAOYSA-N 0.000 claims description 2
- BZGMEGUFFDTCNP-UHFFFAOYSA-N 2-hydroperoxy-2-methylpentane Chemical compound CCCC(C)(C)OO BZGMEGUFFDTCNP-UHFFFAOYSA-N 0.000 claims description 2
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229930007927 cymene Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical group 0.000 claims description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 claims description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000203 mixture Substances 0.000 description 9
- 150000002978 peroxides Chemical group 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- KPJKMUJJFXZGAX-UHFFFAOYSA-N 2-chloropropan-2-ylbenzene Chemical compound CC(C)(Cl)C1=CC=CC=C1 KPJKMUJJFXZGAX-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000012433 hydrogen halide Substances 0.000 description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 description 4
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical group CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 description 3
- BIISIZOQPWZPPS-UHFFFAOYSA-N 2-tert-butylperoxypropan-2-ylbenzene Chemical compound CC(C)(C)OOC(C)(C)C1=CC=CC=C1 BIISIZOQPWZPPS-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003431 cross linking reagent Substances 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002432 hydroperoxides Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/16—Peroxy compounds the —O—O— group being bound between two carbon atoms not further substituted by oxygen atoms, i.e. peroxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP44056755A JPS5022026B1 (enExample) | 1969-07-19 | 1969-07-19 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2035127A1 true DE2035127A1 (enExample) | 1971-10-28 |
| DE2035127B2 DE2035127B2 (de) | 1973-12-06 |
| DE2035127C3 DE2035127C3 (de) | 1979-03-29 |
Family
ID=13036311
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2035127A Expired DE2035127C3 (de) | 1969-07-19 | 1970-07-15 | Verfahren zur Herstellung von organischen Peroxiden |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3829503A (enExample) |
| JP (1) | JPS5022026B1 (enExample) |
| DE (1) | DE2035127C3 (enExample) |
| NL (1) | NL152547B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4241222A (en) * | 1979-09-13 | 1980-12-23 | Pennwalt Corporation | Process for the preparation of cumyl peroxides |
| US4243821A (en) * | 1979-09-13 | 1981-01-06 | Pennwalt Corporation | Process for the preparation of symmetrical dicumyl peroxides |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4159389A (en) * | 1978-05-16 | 1979-06-26 | Reichhold Chemicals, Inc. | Process for the production of dicumyl peroxide |
| IT1134535B (it) * | 1980-12-02 | 1986-08-13 | Euteco Impianti Spa | Procedimento e perfezionamento per la preparazione di dicumilperossido |
| IT1134536B (it) * | 1980-12-02 | 1986-08-13 | Euteco Impianti Spa | Procedimento per la preparazione di dicumilperossido |
| US12222133B2 (en) | 2021-06-02 | 2025-02-11 | Xerox Corporation | Desiccant coated fan blade |
-
1969
- 1969-07-19 JP JP44056755A patent/JPS5022026B1/ja active Pending
-
1970
- 1970-07-15 DE DE2035127A patent/DE2035127C3/de not_active Expired
- 1970-07-17 NL NL707010660A patent/NL152547B/xx not_active IP Right Cessation
- 1970-07-20 US US00056711A patent/US3829503A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4241222A (en) * | 1979-09-13 | 1980-12-23 | Pennwalt Corporation | Process for the preparation of cumyl peroxides |
| US4243821A (en) * | 1979-09-13 | 1981-01-06 | Pennwalt Corporation | Process for the preparation of symmetrical dicumyl peroxides |
| DE3034235A1 (de) * | 1979-09-13 | 1981-04-02 | Pennwalt Corp., 19102 Philadelphia, Pa. | Verfahren zur herstellung von symmetrischen dicumylperoxiden |
Also Published As
| Publication number | Publication date |
|---|---|
| NL152547B (nl) | 1977-03-15 |
| US3829503A (en) | 1974-08-13 |
| DE2035127B2 (de) | 1973-12-06 |
| NL7010660A (enExample) | 1971-01-21 |
| DE2035127C3 (de) | 1979-03-29 |
| JPS5022026B1 (enExample) | 1975-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| DE69209445T2 (de) | Katalytische Herstellung von Aryl-Alkyl-Hydroperoxiden mit Mangan-Komplexen | |
| DE2035127A1 (enExample) | ||
| DE68904558T2 (de) | Verfahren zu herstellung von bidentatliganden. | |
| DE2616934C3 (de) | Verfahren zur Epoxidierung von Olefinen | |
| DE2446830C3 (de) | Verfahren zur Epoxydation von Olefinen | |
| DE2630633C2 (enExample) | ||
| DE2605041C3 (de) | Verfahren zur Epoxydation von Olefinen | |
| DE2324390A1 (de) | Verfahren zur herstellung von derivaten des cyclopropans | |
| DE2949847C2 (enExample) | ||
| DE3519552A1 (de) | Verfahren zur herstellung von 4,4'-dinitrostilben-2,2'-disulfonsaeuresalzen | |
| DE2603269C3 (de) | Verfahren zur Herstellung von Cyclohexanon und methylsubstituiertem oder unsubstituiertem Phenol | |
| EP0897910B1 (de) | Verfahren zur Herstellung von 2-Carboxyy-5-nitro-benzolsulfonsäure und deren Salzen durch Oxidation | |
| DE2521324A1 (de) | Verfahren zur herstellung eines hydroperoxids | |
| US2107789A (en) | Method of making chlorhydrin | |
| DE2211745C3 (de) | Verfahren zur selektiven Herstellung von 3-Phenyl-l-buten | |
| DE3220225A1 (de) | Verfahren zur herstellung von carbonsaeuren | |
| EP0266544B1 (de) | Verfahren zur Herstellung von Halogenalkoholen | |
| DE2201456C3 (de) | Verfahren zur Herstellung von Aldehyden und Diolen | |
| DE1289523B (de) | Verfahren zur Herstellung von ª†-Valero- oder ªŠ-Caprolacton | |
| DE2349314A1 (de) | Verfahren zur herstellung von dibenzothiazolyldisulfid | |
| EP0075201B1 (de) | Verfahren zur Herstellung von 1,1,1-Trichlormethylverbindungen | |
| DE2827323A1 (de) | Verfahren zur herstellung von halogenbutenylacrylaten | |
| DE2919234C2 (de) | Verfahren zur Herstellung von p-Bromanisol | |
| DE1643899C3 (de) | Verfahren zur Herstellung von Acetalen bzw. Ketalen a-chlorierter Aldehyde bzw. Ketone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |