DE2002629C3 - Verfahren zur Herstellung von asymmetrischen Alkanthiophosphonsäure-O.O- und Alkan-dithiophosphonsäure-O.S-diestern - Google Patents
Verfahren zur Herstellung von asymmetrischen Alkanthiophosphonsäure-O.O- und Alkan-dithiophosphonsäure-O.S-diesternInfo
- Publication number
- DE2002629C3 DE2002629C3 DE2002629A DE2002629A DE2002629C3 DE 2002629 C3 DE2002629 C3 DE 2002629C3 DE 2002629 A DE2002629 A DE 2002629A DE 2002629 A DE2002629 A DE 2002629A DE 2002629 C3 DE2002629 C3 DE 2002629C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- reaction
- ester
- alkanedithiophosphonic
- alkanethiophosphonic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 16
- 239000002253 acid Substances 0.000 title description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 description 34
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- -1 alkyl radicals Chemical class 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 239000011574 phosphorus Substances 0.000 description 5
- 229910052717 sulfur Chemical group 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 2
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 2
- 235000019838 diammonium phosphate Nutrition 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 238000001030 gas--liquid chromatography Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 238000006317 isomerization reaction Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 238000007280 thionation reaction Methods 0.000 description 2
- AATNZNJRDOVKDD-UHFFFAOYSA-N 1-[ethoxy(ethyl)phosphoryl]oxyethane Chemical compound CCOP(=O)(CC)OCC AATNZNJRDOVKDD-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- XOCUXOWLYLLJLV-UHFFFAOYSA-N [O].[S] Chemical compound [O].[S] XOCUXOWLYLLJLV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- XKCNGNVSRKVSDD-UHFFFAOYSA-N ethane;phosphoric acid Chemical compound CC.OP(O)(O)=O XKCNGNVSRKVSDD-UHFFFAOYSA-N 0.000 description 1
- GFTATZBXSYXGRK-UHFFFAOYSA-N ethyl-hydroxy-sulfanyl-sulfanylidene-$l^{5}-phosphane Chemical compound CCP(O)(S)=S GFTATZBXSYXGRK-UHFFFAOYSA-N 0.000 description 1
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical compound CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- FLQUDUCNBDGCRI-UHFFFAOYSA-N hydroxy-sulfanyl-sulfidophosphanium Chemical compound SP(S)=O FLQUDUCNBDGCRI-UHFFFAOYSA-N 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- RZWQDAUIUBVCDD-UHFFFAOYSA-M sodium;benzenethiolate Chemical compound [Na+].[S-]C1=CC=CC=C1 RZWQDAUIUBVCDD-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US79438769A | 1969-01-27 | 1969-01-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2002629A1 DE2002629A1 (de) | 1970-07-30 |
| DE2002629B2 DE2002629B2 (de) | 1980-05-08 |
| DE2002629C3 true DE2002629C3 (de) | 1981-01-22 |
Family
ID=25162503
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2002629A Expired DE2002629C3 (de) | 1969-01-27 | 1970-01-22 | Verfahren zur Herstellung von asymmetrischen Alkanthiophosphonsäure-O.O- und Alkan-dithiophosphonsäure-O.S-diestern |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3642960A (enExample) |
| JP (1) | JPS5220474B1 (enExample) |
| BE (1) | BE744917A (enExample) |
| BR (1) | BR7016285D0 (enExample) |
| CH (1) | CH531542A (enExample) |
| DE (1) | DE2002629C3 (enExample) |
| DK (1) | DK136265B (enExample) |
| FR (1) | FR2029472A1 (enExample) |
| GB (1) | GB1303841A (enExample) |
| IL (1) | IL33775A (enExample) |
| NL (1) | NL162392C (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3862276A (en) * | 1971-07-03 | 1975-01-21 | Bayer Ag | Preparation of 0-(2,2-dichlorovinyl)-thionophosphoric acid ester dichloride |
| US4268508A (en) * | 1979-12-28 | 1981-05-19 | Mobil Oil Corporation | 0-Alkyl-s-branched alkyl-alkylphosphonodithioate |
| US4284626A (en) * | 1979-12-31 | 1981-08-18 | Mobil Oil Corporation | O-aryl S-branched alkyl alkylphosphonodithioate insecticides and nematocides |
| US4948787A (en) * | 1989-01-04 | 1990-08-14 | Imperial Chemical Industries Plc | Inhibition of mercaptan odor in organothiophosphate biocides |
| US5295690A (en) * | 1992-07-30 | 1994-03-22 | John Johnson | Apparatus and method for improving a golf swing |
| US7300906B2 (en) * | 2005-04-07 | 2007-11-27 | Gowan Company, L.L.C. | Control of sulfhydryl compound odor in organothiophosphate formulations |
-
1969
- 1969-01-27 US US794387*A patent/US3642960A/en not_active Expired - Lifetime
-
1970
- 1970-01-15 GB GB202470A patent/GB1303841A/en not_active Expired
- 1970-01-22 DE DE2002629A patent/DE2002629C3/de not_active Expired
- 1970-01-24 JP JP45006041A patent/JPS5220474B1/ja active Pending
- 1970-01-26 BE BE744917D patent/BE744917A/xx not_active IP Right Cessation
- 1970-01-26 CH CH105970A patent/CH531542A/de not_active IP Right Cessation
- 1970-01-26 FR FR7002691A patent/FR2029472A1/fr not_active Withdrawn
- 1970-01-26 IL IL33775A patent/IL33775A/en unknown
- 1970-01-27 NL NL7001117.A patent/NL162392C/xx not_active IP Right Cessation
- 1970-01-27 DK DK36870AA patent/DK136265B/da not_active IP Right Cessation
- 1970-01-28 BR BR21628570A patent/BR7016285D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL162392B (nl) | 1979-12-17 |
| US3642960A (en) | 1972-02-15 |
| DK136265C (enExample) | 1978-02-20 |
| NL7001117A (enExample) | 1970-07-29 |
| GB1303841A (enExample) | 1973-01-24 |
| CH531542A (de) | 1972-12-15 |
| DK136265B (da) | 1977-09-19 |
| BE744917A (fr) | 1970-07-27 |
| NL162392C (nl) | 1980-05-16 |
| BR7016285D0 (pt) | 1973-01-25 |
| DE2002629A1 (de) | 1970-07-30 |
| IL33775A (en) | 1973-06-29 |
| JPS5220474B1 (enExample) | 1977-06-03 |
| IL33775A0 (en) | 1970-03-22 |
| FR2029472A1 (enExample) | 1970-10-23 |
| DE2002629B2 (de) | 1980-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0032202B1 (de) | Verfahren zur Herstellung neutraler Phosphorigsäurearylester | |
| DE2002629C3 (de) | Verfahren zur Herstellung von asymmetrischen Alkanthiophosphonsäure-O.O- und Alkan-dithiophosphonsäure-O.S-diestern | |
| EP0159294B1 (de) | Verfahren zur Herstellung cyclischer Phosphorigsäureester | |
| EP0452755B1 (de) | Kontinuierliches Verfahren zur Herstellung von 1-Halogen-1-oxophospholenen | |
| DE2526689C2 (de) | Verfahren zur Herstellung von 2,5-Dioxo-1,2-Oxa-phospholanen | |
| EP0080149A1 (de) | Verfahren zur Herstellung phosphoniger Säuren | |
| DE2643474C2 (de) | Verfahren zur Herstellung von Phosphitchloriden | |
| DE2643442C2 (de) | Verfahren zur Herstellung von Phosphitchloriden | |
| DE2538310C3 (de) | Verfahren zur Herstellung von O.O-Dialkylthionophosphorsäurechloriden | |
| DE2129583C3 (de) | Verfahren zur Herstellung von Phosphinsäureanhydriden | |
| EP0130439B1 (de) | Verfahren zur Herstellung von Derivaten der Vinylphosphon-, oder Vinylpyrophosphonsäure | |
| DE3139984A1 (de) | Verfahren zur herstellung von acylphosphinoxiden | |
| EP0122587B1 (de) | Verfahren zur Herstellung organischer Chlorphosphane | |
| CH631181A5 (de) | Verfahren zur herstellung von 2,6-dimethoxy-4-(quaternaeren-alkyl)phenyl-disubstituierten-phosphaten. | |
| EP0144743B1 (de) | Verfahren zur Herstellung organischer Chlorphosphane | |
| DE2238921C3 (de) | Verfahren zur Herstellung von 0,0-Dialkyl-0-(2,2-dichlorvinyl)-thionophosphorsäureestern | |
| DE2357677A1 (de) | Verfahren zur herstellung von alphachlor-acrylsaeurechlorid | |
| EP0007008A1 (de) | Verfahren zur Herstellung von Halogenbutenylacrylaten | |
| EP0003553B1 (de) | Verfahren zur Herstellung von O,S-Dialkylthiophosphorsäurechloriden | |
| EP0725071B1 (de) | Verfahren zur Herstellung von Alkalimetallsalzen von Phosphonsäuremonomethylestern | |
| DE907414C (de) | Verfahren zur Herstellung von 2-(2-Methyl-5-halogen-phenyl-1-mercapto)-benzoesaeuren | |
| DE1216278B (de) | Verfahren zur Herstellung von unsymmetrischen Phosphorigsaeure-O, O-diestern | |
| DE2800536A1 (de) | Verfahren zur herstellung von eckige klammer auf 1,1-dithienyl-(3)-1-hydroxypropyl-(3) eckige klammer zu - eckige klammer auf 1-phenyl-1-hydroxy-propyl- (2) eckige klammer zu -amin und eckige klammer auf 1,1-dithienyl-(3)-propen-(1)- yl-(3) eckige klammer zu - eckige klammer auf 1-phenyl-propyl-(2) eckige klammer zu -amin | |
| DE3826554A1 (de) | Verfahren zur herstellung von alkyldihalogenphosphinen | |
| CH629215A5 (de) | Verfahren zur herstellung von dithiophosphorsaeurediesterhalogeniden. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |