DE1965321A1 - Cyclische Ketalderivate,ihre Verwendung und Verfahren zur Herstellung derselben - Google Patents
Cyclische Ketalderivate,ihre Verwendung und Verfahren zur Herstellung derselbenInfo
- Publication number
- DE1965321A1 DE1965321A1 DE19691965321 DE1965321A DE1965321A1 DE 1965321 A1 DE1965321 A1 DE 1965321A1 DE 19691965321 DE19691965321 DE 19691965321 DE 1965321 A DE1965321 A DE 1965321A DE 1965321 A1 DE1965321 A1 DE 1965321A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- derivatives
- ketal
- cyclic ketal
- addition salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000004122 cyclic group Chemical group 0.000 title claims description 18
- 238000000034 method Methods 0.000 title claims description 7
- QQXLDOJGLXJCSE-KNVOCYPGSA-N Tropinone Natural products C1C(=O)C[C@H]2CC[C@@H]1N2C QQXLDOJGLXJCSE-KNVOCYPGSA-N 0.000 claims description 37
- -1 alkylene radical Chemical class 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 23
- QQXLDOJGLXJCSE-UHFFFAOYSA-N N-methylnortropinone Natural products C1C(=O)CC2CCC1N2C QQXLDOJGLXJCSE-UHFFFAOYSA-N 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 20
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims description 5
- 239000004480 active ingredient Substances 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- RSJKGSCJYJTIGS-UHFFFAOYSA-N N-undecane Natural products CCCCCCCCCCC RSJKGSCJYJTIGS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004970 halomethyl group Chemical group 0.000 claims description 3
- 150000003813 tropane derivatives Chemical class 0.000 claims description 3
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- 239000011968 lewis acid catalyst Substances 0.000 claims description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N n-butylhexane Natural products CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 150000003053 piperidines Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 8
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 2
- QYPMYEBDZRSXPG-UHFFFAOYSA-N 1-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)piperidine Chemical compound C1CCCCN1CC(O1)COC21CCCCC2 QYPMYEBDZRSXPG-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 238000004806 packaging method and process Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 54
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- 239000000243 solution Substances 0.000 description 28
- 238000009835 boiling Methods 0.000 description 20
- 239000000203 mixture Substances 0.000 description 18
- 229910052757 nitrogen Inorganic materials 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 239000002904 solvent Substances 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 11
- 238000007912 intraperitoneal administration Methods 0.000 description 8
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- RGCVKNLCSQQDEP-UHFFFAOYSA-N Perphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 RGCVKNLCSQQDEP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229960002715 nicotine Drugs 0.000 description 2
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 2
- 229960000762 perphenazine Drugs 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- QDWJJTJNXAKQKD-UHFFFAOYSA-N trihexyphenidyl hydrochloride Chemical compound Cl.C1CCCCC1C(C=1C=CC=CC=1)(O)CCN1CCCCC1 QDWJJTJNXAKQKD-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical class C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- APZHURRBFHKXKX-UHFFFAOYSA-N 3-(chloromethyl)-1,4-dioxaspiro[4.6]undecane Chemical compound O1C(CCl)COC11CCCCCC1 APZHURRBFHKXKX-UHFFFAOYSA-N 0.000 description 1
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 1
- JYRSCMLJPXJTLI-UHFFFAOYSA-N 9h-xanthene-9-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)C3=CC=CC=C3OC2=C1 JYRSCMLJPXJTLI-UHFFFAOYSA-N 0.000 description 1
- 208000009132 Catalepsy Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 206010043376 Tetanus Diseases 0.000 description 1
- 206010047853 Waxy flexibility Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 229960001076 chlorpromazine Drugs 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- ANEJUHJDPGTVIO-UHFFFAOYSA-N ethyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate Chemical compound C1C(=O)CC2CCC1N2C(=O)OCC ANEJUHJDPGTVIO-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 229960004479 trihexyphenidyl hydrochloride Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
- C07D451/06—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/72—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 spiro-condensed with carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE001613 | 1968-12-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1965321A1 true DE1965321A1 (de) | 1970-09-03 |
Family
ID=10995285
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691965321 Pending DE1965321A1 (de) | 1968-12-29 | 1969-12-29 | Cyclische Ketalderivate,ihre Verwendung und Verfahren zur Herstellung derselben |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3641039A (enExample) |
| AT (1) | AT296299B (enExample) |
| BE (1) | BE743771A (enExample) |
| CA (1) | CA967160A (enExample) |
| DE (1) | DE1965321A1 (enExample) |
| DK (1) | DK122014B (enExample) |
| FR (1) | FR2070066B1 (enExample) |
| GB (1) | GB1294678A (enExample) |
| NL (1) | NL6919505A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0281842A1 (de) * | 1987-03-07 | 1988-09-14 | Bayer Ag | Aminomethylheterocyclen |
| DE3719326A1 (de) * | 1987-06-10 | 1989-01-05 | Bayer Ag | Fungizide wirkstoffkombination |
| WO1990000169A1 (en) * | 1988-07-01 | 1990-01-11 | Cheminova Agro A/S | Amino ketals, their preparation, and their use as fungicides |
| EP0355597A1 (de) * | 1988-08-23 | 1990-02-28 | Bayer Ag | Substituierte Dioxolanylethylamine, Verfahren zu ihrer Herstellung, ihre Verwendung in Schädlingsbekämpfungsmittteln und neue Zwischenprodukte |
| EP0359979A1 (de) * | 1988-08-23 | 1990-03-28 | Bayer Ag | Aminomethylheterocyclen, Verfahren zu ihrer Herstellung, ihre Verwendung in Schädlingsbekämpfungsmitteln und neue Zwischenprodukte |
| US5177103A (en) * | 1988-08-23 | 1993-01-05 | Bayer Aktiengesellschaft | Pesticidal aminomethylheterocyclic compounds |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2116796C3 (de) * | 1970-04-16 | 1974-01-17 | Egyt Gyogyszervegyeszeti Gyar, Budapest | Nortropinon-Derivate und diese enthaltende pharmazeutische Präparate |
| FR2129873B1 (enExample) * | 1971-03-18 | 1974-09-06 | Delalande Sa | |
| DE2945049A1 (de) * | 1979-11-08 | 1981-05-21 | Henkel KGaA, 4000 Düsseldorf | 2-alkyl-1,4-dioxaspiro(4,n)alkane, deren herstellung und verwendung als riechstoffe, sowie diese enthaltende riechstoffkompositionen |
| EP0031966B1 (en) * | 1979-12-29 | 1984-05-23 | Nippon Petrochemicals Company Limited | Substituted norbornanone acetals, process for preparing the same, and perfume compositions containing the same |
| US9562032B2 (en) * | 2014-01-24 | 2017-02-07 | Sumitomo Chemical Company, Limited | Salt and photoresist composition comprising the same |
-
1969
- 1969-12-19 AT AT1182669A patent/AT296299B/de not_active IP Right Cessation
- 1969-12-22 US US887318A patent/US3641039A/en not_active Expired - Lifetime
- 1969-12-23 GB GB62712/69A patent/GB1294678A/en not_active Expired
- 1969-12-24 FR FR6944814A patent/FR2070066B1/fr not_active Expired
- 1969-12-29 NL NL6919505A patent/NL6919505A/xx unknown
- 1969-12-29 DK DK686969AA patent/DK122014B/da unknown
- 1969-12-29 DE DE19691965321 patent/DE1965321A1/de active Pending
- 1969-12-29 BE BE743771D patent/BE743771A/xx unknown
- 1969-12-29 CA CA070,985A patent/CA967160A/en not_active Expired
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0281842A1 (de) * | 1987-03-07 | 1988-09-14 | Bayer Ag | Aminomethylheterocyclen |
| US4851405A (en) * | 1987-03-07 | 1989-07-25 | Bayer Aktiengesellschaft | Aminomethyl heterocyclic compounds |
| DE3719326A1 (de) * | 1987-06-10 | 1989-01-05 | Bayer Ag | Fungizide wirkstoffkombination |
| WO1990000169A1 (en) * | 1988-07-01 | 1990-01-11 | Cheminova Agro A/S | Amino ketals, their preparation, and their use as fungicides |
| EP0349247A3 (en) * | 1988-07-01 | 1990-11-07 | A/S Cheminova | Amino ketals, their preparation, and their use as fungicides |
| EP0355597A1 (de) * | 1988-08-23 | 1990-02-28 | Bayer Ag | Substituierte Dioxolanylethylamine, Verfahren zu ihrer Herstellung, ihre Verwendung in Schädlingsbekämpfungsmittteln und neue Zwischenprodukte |
| EP0359979A1 (de) * | 1988-08-23 | 1990-03-28 | Bayer Ag | Aminomethylheterocyclen, Verfahren zu ihrer Herstellung, ihre Verwendung in Schädlingsbekämpfungsmitteln und neue Zwischenprodukte |
| US4985421A (en) * | 1988-08-23 | 1991-01-15 | Bayer Aktiengesellschaft | Fungicidal substituted dioxolanylethylamine |
| US5010101A (en) * | 1988-08-23 | 1991-04-23 | Bayer Aktiengesellschaft | Pesticidal aminomethylheterocyclic compounds |
| US5177103A (en) * | 1988-08-23 | 1993-01-05 | Bayer Aktiengesellschaft | Pesticidal aminomethylheterocyclic compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2070066B1 (enExample) | 1974-08-09 |
| GB1294678A (en) | 1972-11-01 |
| FR2070066A1 (enExample) | 1971-09-10 |
| DK122014B (da) | 1972-01-03 |
| US3641039A (en) | 1972-02-08 |
| BE743771A (enExample) | 1970-05-28 |
| CA967160A (en) | 1975-05-06 |
| AT296299B (de) | 1972-02-10 |
| NL6919505A (enExample) | 1970-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2365896C3 (de) | Derivate des 4-{4-DiphenyImethylenpiperidino)-butan-1-ons und diese enthaltende Arzneimittel | |
| DE2503002A1 (de) | Substituierte piperidinderivate, ein verfahren zu ihrer herstellung sowie arzneimittel | |
| DE2062001C2 (de) | 1,2,3,4-Tetrahydro-4-phenylisochinolin-Derivate, deren Säureadditionssalze, Verfahren zu deren Herstellung und pharmazeutisches Präparat | |
| DE1965321A1 (de) | Cyclische Ketalderivate,ihre Verwendung und Verfahren zur Herstellung derselben | |
| DE2303306C3 (de) | Piperidinobutanol-Derivate, Verfahren zu deren Herstellung sowie diese enthaltende pharmazeutische Präparate | |
| EP0217372A2 (de) | Neue polyoxygenierte Labdan-Derivate, Verfahren zu ihrer Herstellung und ihre Anwendung als Medikamente | |
| DE2811031C2 (de) | Piperazino-3-indole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2947624A1 (de) | Beta, gamma -dihydropolyprenylalkohol und diesen enthaltendes blutdrucksenkendes arzneimittel | |
| EP0883610B1 (de) | Verfahren zur herstellung von 1,4,7,10-tetraazacyclododecan und dessen derivaten | |
| DE2719246C2 (de) | Dimaleat von 1[2(4-Methoxybenzhydryloxyäthyl)]-4-[3(4-fluorbenzoyl)-propyl]-piperazin, Verfahren zu dessen Herstellung und diese Verbindung enthaltendes Arzneimittel | |
| DE2416491C3 (de) | 13.02.74 V.SLVAmerika 442033 Dibenzopyranverbindungen und diese enthaltende Arzneimittel Abbott Laboratories, North Chicago, 111. (V.StA.) | |
| DE2502504C3 (de) | Phenothiazinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| AT266832B (de) | Verfahren zur Herstellung von neuen Oxazolidinderivaten und ihren Salzen | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| DE1909406B2 (enExample) | ||
| DE2636866A1 (de) | Neue phenothiazinderivate und deren herstellung | |
| DE2653477A1 (de) | Spiro eckige klammer auf cyclopropan- 1,2'-indolin eckige klammer zu -3'-one | |
| DE2528194C2 (de) | Benzhydryloxyäthylamin-Derivate, deren Salze, Verfahren zur Herstellung derselben und solche enthaltende Arzneimittel | |
| DE2520131A1 (de) | Stickstoffhaltige polycyclische verbindungen und verfahren zu deren herstellung | |
| DE3434593C2 (enExample) | ||
| DE1922280B2 (de) | l-Methyl-5-(3'-dimethylaminopropyliden)-5Hdibenzo [a,d] -cyclohepten-N-oxid und dessen Säureadditionssalze, sowie Verfahren zu deren Herstellung und diese Verbindungen enthaltende Präparate | |
| DE2453142A1 (de) | Sym.-triazine, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| DE3008852A1 (de) | Benzodiazepinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE1670334C3 (de) | 5-Methyl-11 -(N-methyl-4-piperidylen)-5,6-dihydromorphanthridin und dessen pharmazeutisch geeignete Salze | |
| CH677669A5 (enExample) |