DE1963439A1 - Verfahren zur Herstellung poroeser Kieselsaeure - Google Patents
Verfahren zur Herstellung poroeser KieselsaeureInfo
- Publication number
- DE1963439A1 DE1963439A1 DE19691963439 DE1963439A DE1963439A1 DE 1963439 A1 DE1963439 A1 DE 1963439A1 DE 19691963439 DE19691963439 DE 19691963439 DE 1963439 A DE1963439 A DE 1963439A DE 1963439 A1 DE1963439 A1 DE 1963439A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrolysis
- oxides
- silica
- silicic acid
- transition metals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 title claims description 111
- 238000000034 method Methods 0.000 title claims description 54
- 239000000377 silicon dioxide Substances 0.000 title claims description 54
- 230000008569 process Effects 0.000 title claims description 27
- 238000004519 manufacturing process Methods 0.000 title claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 50
- 230000007062 hydrolysis Effects 0.000 claims description 46
- 238000006460 hydrolysis reaction Methods 0.000 claims description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 41
- 239000000126 substance Substances 0.000 claims description 35
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 32
- 229910052723 transition metal Inorganic materials 0.000 claims description 30
- 150000003624 transition metals Chemical class 0.000 claims description 30
- -1 aliphatic alcohols Chemical class 0.000 claims description 27
- 229910021529 ammonia Inorganic materials 0.000 claims description 25
- 235000012239 silicon dioxide Nutrition 0.000 claims description 23
- LFQCEHFDDXELDD-UHFFFAOYSA-N tetramethyl orthosilicate Chemical compound CO[Si](OC)(OC)OC LFQCEHFDDXELDD-UHFFFAOYSA-N 0.000 claims description 20
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 19
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 18
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 16
- 238000010438 heat treatment Methods 0.000 claims description 14
- 230000015572 biosynthetic process Effects 0.000 claims description 13
- 238000009835 boiling Methods 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 12
- 238000003756 stirring Methods 0.000 claims description 11
- 238000004438 BET method Methods 0.000 claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 150000002739 metals Chemical class 0.000 claims description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 8
- 150000007513 acids Chemical class 0.000 claims description 8
- 229910052742 iron Inorganic materials 0.000 claims description 8
- 229910052719 titanium Inorganic materials 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 7
- 230000003213 activating effect Effects 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 235000019253 formic acid Nutrition 0.000 claims description 7
- 150000004760 silicates Chemical class 0.000 claims description 7
- 239000000725 suspension Substances 0.000 claims description 7
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- UOUJSJZBMCDAEU-UHFFFAOYSA-N chromium(3+);oxygen(2-) Chemical class [O-2].[O-2].[O-2].[Cr+3].[Cr+3] UOUJSJZBMCDAEU-UHFFFAOYSA-N 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 238000001914 filtration Methods 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 229910044991 metal oxide Inorganic materials 0.000 claims description 5
- 150000004706 metal oxides Chemical class 0.000 claims description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 238000001514 detection method Methods 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 4
- 229910052750 molybdenum Inorganic materials 0.000 claims description 4
- 239000011733 molybdenum Substances 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 229910052758 niobium Inorganic materials 0.000 claims description 4
- 239000010955 niobium Substances 0.000 claims description 4
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 4
- 229910052715 tantalum Inorganic materials 0.000 claims description 4
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- 239000010937 tungsten Substances 0.000 claims description 4
- 239000000470 constituent Substances 0.000 claims description 3
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical class [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 claims description 3
- 235000011054 acetic acid Nutrition 0.000 claims description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 150000007514 bases Chemical class 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 2
- 235000013980 iron oxide Nutrition 0.000 claims description 2
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 claims description 2
- 235000011007 phosphoric acid Nutrition 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims 2
- 150000001243 acetic acids Chemical class 0.000 claims 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 239000000499 gel Substances 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 239000000203 mixture Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 7
- 238000001556 precipitation Methods 0.000 description 6
- 238000004821 distillation Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000498 cooling water Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- SJECZPVISLOESU-UHFFFAOYSA-N 3-trimethoxysilylpropan-1-amine Chemical compound CO[Si](OC)(OC)CCCN SJECZPVISLOESU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical group 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000010981 drying operation Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229940103459 ferrogels Drugs 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- ITNVWQNWHXEMNS-UHFFFAOYSA-N methanolate;titanium(4+) Chemical compound [Ti+4].[O-]C.[O-]C.[O-]C.[O-]C ITNVWQNWHXEMNS-UHFFFAOYSA-N 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- OXYOBDANCFSCGB-UHFFFAOYSA-J silicon(4+) tetraformate Chemical compound [Si+4].[O-]C=O.[O-]C=O.[O-]C=O.[O-]C=O OXYOBDANCFSCGB-UHFFFAOYSA-J 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- APSPVJKFJYTCTN-UHFFFAOYSA-N tetramethylazanium;silicate Chemical compound C[N+](C)(C)C.C[N+](C)(C)C.C[N+](C)(C)C.C[N+](C)(C)C.[O-][Si]([O-])([O-])[O-] APSPVJKFJYTCTN-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000010023 transfer printing Methods 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- 229910000314 transition metal oxide Inorganic materials 0.000 description 1
- 239000011240 wet gel Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/113—Silicon oxides; Hydrates thereof
- C01B33/12—Silica; Hydrates thereof, e.g. lepidoic silicic acid
- C01B33/16—Preparation of silica xerogels
- C01B33/163—Preparation of silica xerogels by hydrolysis of organosilicon compounds, e.g. ethyl orthosilicate
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Silicon Compounds (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691963439 DE1963439A1 (de) | 1969-12-18 | 1969-12-18 | Verfahren zur Herstellung poroeser Kieselsaeure |
| NO4644/70A NO131980C (cg-RX-API-DMAC7.html) | 1969-12-18 | 1970-12-03 | |
| CH1841970A CH572446A5 (cg-RX-API-DMAC7.html) | 1969-12-18 | 1970-12-11 | |
| US00098244A US3850971A (en) | 1969-12-18 | 1970-12-15 | Porous silicic acid and its production |
| BE760413A BE760413A (fr) | 1969-12-18 | 1970-12-16 | Procede de preparation d'acide silicique poreaux |
| AT1131770A AT336542B (de) | 1969-12-18 | 1970-12-16 | Verfahren zur herstellung poroser, alkoxygruppen mit 1 oder 2 c-atomen enthaltender kieselsaure |
| FR7045673A FR2073963A5 (cg-RX-API-DMAC7.html) | 1969-12-18 | 1970-12-17 | |
| GB6008770A GB1331624A (en) | 1969-12-18 | 1970-12-17 | Silica gel |
| SE17148/70A SE365780B (cg-RX-API-DMAC7.html) | 1969-12-18 | 1970-12-17 | |
| NL7018504A NL7018504A (cg-RX-API-DMAC7.html) | 1969-12-18 | 1970-12-18 | |
| US05/491,420 US4006175A (en) | 1969-12-18 | 1974-07-24 | Porous silicic acid and its production |
| DK369075A DK369075A (cg-RX-API-DMAC7.html) | 1969-12-18 | 1975-08-14 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691963439 DE1963439A1 (de) | 1969-12-18 | 1969-12-18 | Verfahren zur Herstellung poroeser Kieselsaeure |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1963439A1 true DE1963439A1 (de) | 1971-06-24 |
Family
ID=5754238
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691963439 Pending DE1963439A1 (de) | 1969-12-18 | 1969-12-18 | Verfahren zur Herstellung poroeser Kieselsaeure |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3850971A (cg-RX-API-DMAC7.html) |
| AT (1) | AT336542B (cg-RX-API-DMAC7.html) |
| BE (1) | BE760413A (cg-RX-API-DMAC7.html) |
| CH (1) | CH572446A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE1963439A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2073963A5 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1331624A (cg-RX-API-DMAC7.html) |
| NL (1) | NL7018504A (cg-RX-API-DMAC7.html) |
| NO (1) | NO131980C (cg-RX-API-DMAC7.html) |
| SE (1) | SE365780B (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0040362A1 (en) * | 1980-05-21 | 1981-11-25 | Phillips Petroleum Company | A process for producing silica and use of same |
| WO1991007349A1 (en) * | 1989-11-22 | 1991-05-30 | Allied-Signal Inc. | Process for forming highly uniform silica spheres |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4030938A (en) * | 1976-02-03 | 1977-06-21 | Owens-Illinois, Inc. | Method for the manufacture of borosilicate glasses |
| DE2644193C2 (de) * | 1976-09-30 | 1987-03-12 | Bayer Ag, 5090 Leverkusen | Vernetzer und Härtungskatalysatoren enthaltende pastöse Massen als Komponente für bei Raumtemperatur vulkanisierbare Polysiloxanelastomere |
| US4206297A (en) * | 1977-04-25 | 1980-06-03 | Chemplex Company | Polymerization catalysts and methods |
| DK155176C (da) * | 1978-06-22 | 1989-07-17 | Snam Progetti | Fremgangsmaade til fremstilling af aluminiumoxidmodificeret siliciumdioxid |
| US4288460A (en) * | 1979-05-24 | 1981-09-08 | Balchem Corporation | Non-caking, water-soluble, granular coated food ingredient |
| US4344800A (en) * | 1980-06-03 | 1982-08-17 | Dow Corning Corporation | Method for producing hydrophobic reinforcing silica fillers and fillers obtained thereby |
| JPS6287409A (ja) * | 1985-09-09 | 1987-04-21 | Tama Kagaku Kogyo Kk | 合成シリカの製造方法 |
| US5807501A (en) * | 1997-02-20 | 1998-09-15 | Dow Corning Corporation | Neutral-aged hydrophobic organosilicate-modified silica gels |
| US5750610A (en) * | 1997-02-24 | 1998-05-12 | Dow Corning Corporation | Hydrophobic organosilicate-modified silica gels |
| AU6178498A (en) * | 1997-02-24 | 1998-09-09 | Dow Corning Corporation | Neutral-aged hydrophobic silica gels with reduced surface area |
| US5789495A (en) * | 1997-02-24 | 1998-08-04 | Dow Corning Corporation | Method for making hydrophobic organosilicate-modified silica gels under neutral conditions |
| US5708069A (en) * | 1997-02-24 | 1998-01-13 | Dow Corning Corporation | Method for making hydrophobic silica gels under neutral conditions |
| DE19816136A1 (de) * | 1998-04-09 | 1999-10-14 | Inst Neue Mat Gemein Gmbh | Nanostrukturierte Formkörper und Schichten und deren Herstellung über stabile wasserlösliche Vorstufen |
| US6620368B1 (en) | 2000-07-13 | 2003-09-16 | Simax Technologies, Inc. | Sol-gel process for production of oxide-based glass and ceramic articles |
| US7125912B2 (en) * | 2001-10-09 | 2006-10-24 | Simax Technologies, Inc. | Doped sol-gel materials and method of manufacture utilizing reduced mixing temperatures |
| US7026362B2 (en) | 2001-10-09 | 2006-04-11 | Simax Technologies, Inc. | Sol-gel process utilizing reduced mixing temperatures |
| US7001568B2 (en) * | 2002-02-01 | 2006-02-21 | Simax Technologies, Inc. | Method of removing liquid from pores of a sol-gel monolith |
| US20040194511A1 (en) * | 2002-02-01 | 2004-10-07 | Chih-Hsing Cheng | Sol-gel-derived halogen-doped glass |
| US20030147606A1 (en) * | 2002-02-01 | 2003-08-07 | Shiho Wang | Sol-gel-based optical preforms and methods of manufacture |
| US6928220B2 (en) * | 2002-02-01 | 2005-08-09 | Simax Technologies, Inc. | Sol-gel-derived optical fiber preform and method of manufacture |
| US7000885B2 (en) * | 2002-02-01 | 2006-02-21 | Simax Technologies, Inc. | Apparatus and method for forming a sol-gel monolith utilizing multiple casting |
| WO2006045012A2 (en) * | 2004-10-20 | 2006-04-27 | Cabot Corporation | Method of preparing hydrophobic silica directly from an aqueous colloidal silica dispersion |
| CN110335708B (zh) * | 2019-06-30 | 2021-10-19 | 金泰电缆有限公司 | 一种长效固型高强韧自增强海底电缆及其制造方法 |
| CN110322989B (zh) * | 2019-07-01 | 2021-10-22 | 金泰电缆有限公司 | 一种通信电力两用海底双三芯电缆及其制造方法 |
| EP3954743A1 (de) | 2020-08-12 | 2022-02-16 | Evonik Operations GmbH | Verwendung von siliziumdioxid zur verbesserung der leitfähigkeit von beschichtungen |
| CN116903281B (zh) * | 2023-07-20 | 2025-10-31 | 武汉大学 | 铁基地聚物前驱体、铁基地聚物凝胶材料及制备方法 |
-
1969
- 1969-12-18 DE DE19691963439 patent/DE1963439A1/de active Pending
-
1970
- 1970-12-03 NO NO4644/70A patent/NO131980C/no unknown
- 1970-12-11 CH CH1841970A patent/CH572446A5/xx not_active IP Right Cessation
- 1970-12-15 US US00098244A patent/US3850971A/en not_active Expired - Lifetime
- 1970-12-16 AT AT1131770A patent/AT336542B/de not_active IP Right Cessation
- 1970-12-16 BE BE760413A patent/BE760413A/xx unknown
- 1970-12-17 SE SE17148/70A patent/SE365780B/xx unknown
- 1970-12-17 GB GB6008770A patent/GB1331624A/en not_active Expired
- 1970-12-17 FR FR7045673A patent/FR2073963A5/fr not_active Expired
- 1970-12-18 NL NL7018504A patent/NL7018504A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0040362A1 (en) * | 1980-05-21 | 1981-11-25 | Phillips Petroleum Company | A process for producing silica and use of same |
| WO1991007349A1 (en) * | 1989-11-22 | 1991-05-30 | Allied-Signal Inc. | Process for forming highly uniform silica spheres |
Also Published As
| Publication number | Publication date |
|---|---|
| ATA1131770A (de) | 1976-09-15 |
| SE365780B (cg-RX-API-DMAC7.html) | 1974-04-01 |
| CH572446A5 (cg-RX-API-DMAC7.html) | 1976-02-13 |
| FR2073963A5 (cg-RX-API-DMAC7.html) | 1971-10-01 |
| GB1331624A (en) | 1973-09-26 |
| US3850971A (en) | 1974-11-26 |
| NO131980B (cg-RX-API-DMAC7.html) | 1975-05-26 |
| BE760413A (fr) | 1971-05-27 |
| NL7018504A (cg-RX-API-DMAC7.html) | 1971-06-22 |
| AT336542B (de) | 1977-05-10 |
| NO131980C (cg-RX-API-DMAC7.html) | 1975-09-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1963439A1 (de) | Verfahren zur Herstellung poroeser Kieselsaeure | |
| DE60221950T2 (de) | Kieselsäure sowie Verfahren zu ihrer Herstellung | |
| DE19781988B4 (de) | Verfahren zur Herstellung von Methacrylsäureestern oder Acrylsäureestern | |
| DE69015209T2 (de) | Verfahren zur herstellung hochgleichmässiger kieselsäurekugeln. | |
| DE3120195A1 (de) | Polymere ammoniumverbindungen mit kieselsaeureartigem grundgeruest, verfahren zu ihrer herstellung und verwendung | |
| DE2048861A1 (de) | Herstellungsverfahren von Benzvhden sorbit | |
| DE1467093A1 (de) | Schichtaehnliches,tonartiges Mineral | |
| DE3885151T2 (de) | Methode zur Herstellung von Methacrylatestern. | |
| EP0415202A2 (de) | Verfahren zur Herstellung niederer, mehrwertiger Alkohole | |
| EP2574609B1 (de) | Verfahren zur Herstellung von Furanverbindungen aus nachwachsenden Rohstoffen | |
| DE3613011A1 (de) | Verfahren zur herstellung von sinterbaren metalloxidkeramikpulvern | |
| DE886143C (de) | Verfahren zur Herstellung von Tonerde | |
| DE69127720T2 (de) | Methode zur Reinigung von organischen Lösungen, die Laktame enthalten | |
| DE820893C (de) | Verfahren zur Herstellung eines Katalysators bzw. eines Katalysatortraegers | |
| EP0812803B1 (de) | Verfahren zur Herstellung salzarmer Kieselsoldispersionen in niedrigsiedenden Alkoholen | |
| DE69902816T2 (de) | Synthese von heteropolysäuren | |
| DE3750986T2 (de) | Glykosidherstellung. | |
| DE2262196A1 (de) | Verfahren zur gewinnung von formaldehyd und phenol aus abwaessern | |
| DE2642458B2 (de) | Verfahren zur Gewinnung von kristallinem Acrylamid | |
| DE1618492B1 (de) | Fruktosegewinnung aus Zucker | |
| DE1160413B (de) | Verfahren zur Herstellung eines bestaendigen alkalischen Kieselsaeuresols | |
| DE1034611B (de) | Verfahren zum Reinigen von Pentraerythrit | |
| DE2131941A1 (de) | Hochreine Kieselerde kleiner Partikelgroesse | |
| DE69504281T2 (de) | Verfahren zur Herstellung von Hydroxyaldehyden | |
| DE2107970C3 (de) | Verfahren zur Herstellung sulfathaltiger, basischer Aluminiumchloride |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |